hw3_Lovepreet_Singh.html

Student HSE, 29.11.2017 20:00

       <!DOCTYPE html>
       <html>
       <head><meta charset="utf-8" />
       <title>hw3_Lovepreet_Singh</title><script src="https://cdnjs.cloudflare.com/ajax/libs/require.js/2.1.10/require.min.js"></script>
       <script src="https://cdnjs.cloudflare.com/ajax/libs/jquery/2.0.3/jquery.min.js"></script>
       <style type="text/css">
           /*!
+      *
       * Twitter Bootstrap
+      *
       */
       /*!
        * Bootstrap v3.3.7 (http://getbootstrap.com)
        * Copyright 2011-2016 Twitter, Inc.
        * Licensed under MIT (https://github.com/twbs/bootstrap/blob/master/LICENSE)
        */
       /*! normalize.css v3.0.3 | MIT License | github.com/necolas/normalize.css */
       html {
         font-family: sans-serif;
         -ms-text-size-adjust: 100%;
         -webkit-text-size-adjust: 100%;
+      }
       body {
         margin: 0;
+      }
       article,
       aside,
       details,
       figcaption,
       figure,
       footer,
       header,
       hgroup,
       main,
       menu,
       nav,
       section,
       summary {
         display: block;
+      }
       audio,
       canvas,
       progress,
       video {
         display: inline-block;
         vertical-align: baseline;
+      }
       audio:not([controls]) {
         display: none;
         height: 0;
+      }
       [hidden],
       template {
         display: none;
+      }
       a {
         background-color: transparent;
+      }
       a:active,
       a:hover {
         outline: 0;
+      }
       abbr[title] {
         border-bottom: 1px dotted;
+      }
       b,
       strong {
         font-weight: bold;
+      }
       dfn {
         font-style: italic;
+      }
       h1 {
         font-size: 2em;
         margin: 0.67em 0;
+      }
       mark {
         background: #ff0;
         color: #000;
+      }
       small {
         font-size: 80%;
+      }
       sub,
       sup {
         font-size: 75%;
         line-height: 0;
         position: relative;
         vertical-align: baseline;
+      }
       sup {
         top: -0.5em;
+      }
       sub {
         bottom: -0.25em;
+      }
       img {
         border: 0;
+      }
       svg:not(:root) {
         overflow: hidden;
+      }
       figure {
         margin: 1em 40px;
+      }
       hr {
         box-sizing: content-box;
         height: 0;
+      }
       pre {
         overflow: auto;
+      }
       code,
       kbd,
       pre,
       samp {
         font-family: monospace, monospace;
         font-size: 1em;
+      }
       button,
       input,
       optgroup,
       select,
       textarea {
         color: inherit;
         font: inherit;
         margin: 0;
+      }
       button {
         overflow: visible;
+      }
       button,
       select {
         text-transform: none;
+      }
       button,
       html input[type="button"],
       input[type="reset"],
       input[type="submit"] {
         -webkit-appearance: button;
         cursor: pointer;
+      }
       button[disabled],
       html input[disabled] {
         cursor: default;
+      }
       button::-moz-focus-inner,
       input::-moz-focus-inner {
         border: 0;
         padding: 0;
+      }
       input {
         line-height: normal;
+      }
       input[type="checkbox"],
       input[type="radio"] {
         box-sizing: border-box;
         padding: 0;
+      }
       input[type="number"]::-webkit-inner-spin-button,
       input[type="number"]::-webkit-outer-spin-button {
         height: auto;
+      }
       input[type="search"] {
         -webkit-appearance: textfield;
         box-sizing: content-box;
+      }
       input[type="search"]::-webkit-search-cancel-button,
       input[type="search"]::-webkit-search-decoration {
         -webkit-appearance: none;
+      }
       fieldset {
         border: 1px solid #c0c0c0;
         margin: 0 2px;
         padding: 0.35em 0.625em 0.75em;
+      }
       legend {
         border: 0;
         padding: 0;
+      }
       textarea {
         overflow: auto;
+      }
       optgroup {
         font-weight: bold;
+      }
       table {
         border-collapse: collapse;
         border-spacing: 0;
+      }
       td,
       th {
         padding: 0;
+      }
       /*! Source: https://github.com/h5bp/html5-boilerplate/blob/master/src/css/main.css */
       @media print {
         *,
         *:before,
         *:after {
           background: transparent !important;
           color: #000 !important;
           box-shadow: none !important;
           text-shadow: none !important;
+        }
         a,
         a:visited {
           text-decoration: underline;
+        }
         a[href]:after {
           content: " (" attr(href) ")";
+        }
         abbr[title]:after {
           content: " (" attr(title) ")";
+        }
         a[href^="#"]:after,
         a[href^="javascript:"]:after {
           content: "";
+        }
         pre,
         blockquote {
           border: 1px solid #999;
           page-break-inside: avoid;
+        }
         thead {
           display: table-header-group;
+        }
         tr,
         img {
           page-break-inside: avoid;
+        }
         img {
           max-width: 100% !important;
+        }
         p,
         h2,
         h3 {
           orphans: 3;
           widows: 3;
+        }
         h2,
         h3 {
           page-break-after: avoid;
+        }
         .navbar {
           display: none;
+        }
         .btn > .caret,
         .dropup > .btn > .caret {
           border-top-color: #000 !important;
+        }
         .label {
           border: 1px solid #000;
+        }
         .table {
           border-collapse: collapse !important;
+        }
         .table td,
         .table th {
           background-color: #fff !important;
+        }
         .table-bordered th,
         .table-bordered td {
           border: 1px solid #ddd !important;
+        }
+      }
       @font-face {
         font-family: 'Glyphicons Halflings';
         src: url('../components/bootstrap/fonts/glyphicons-halflings-regular.eot');
         src: url('../components/bootstrap/fonts/glyphicons-halflings-regular.eot?#iefix') format('embedded-opentype'), url('../components/bootstrap/fonts/glyphicons-halflings-regular.woff2') format('woff2'), url('../components/bootstrap/fonts/glyphicons-halflings-regular.woff') format('woff'), url('../components/bootstrap/fonts/glyphicons-halflings-regular.ttf') format('truetype'), url('../components/bootstrap/fonts/glyphicons-halflings-regular.svg#glyphicons_halflingsregular') format('svg');
+      }
       .glyphicon {
         position: relative;
         top: 1px;
         display: inline-block;
         font-family: 'Glyphicons Halflings';
         font-style: normal;
         font-weight: normal;
         line-height: 1;
         -webkit-font-smoothing: antialiased;
         -moz-osx-font-smoothing: grayscale;
+      }
       .glyphicon-asterisk:before {
         content: "\002a";
+      }
       .glyphicon-plus:before {
         content: "\002b";
+      }
       .glyphicon-euro:before,
       .glyphicon-eur:before {
         content: "\20ac";
+      }
       .glyphicon-minus:before {
         content: "\2212";
+      }
       .glyphicon-cloud:before {
         content: "\2601";
+      }
       .glyphicon-envelope:before {
         content: "\2709";
+      }
       .glyphicon-pencil:before {
         content: "\270f";
+      }
       .glyphicon-glass:before {
         content: "\e001";
+      }
       .glyphicon-music:before {
         content: "\e002";
+      }
       .glyphicon-search:before {
         content: "\e003";
+      }
       .glyphicon-heart:before {
         content: "\e005";
+      }
       .glyphicon-star:before {
         content: "\e006";
+      }
       .glyphicon-star-empty:before {
         content: "\e007";
+      }
       .glyphicon-user:before {
         content: "\e008";
+      }
       .glyphicon-film:before {
         content: "\e009";
+      }
       .glyphicon-th-large:before {
         content: "\e010";
+      }
       .glyphicon-th:before {
         content: "\e011";
+      }
       .glyphicon-th-list:before {
         content: "\e012";
+      }
       .glyphicon-ok:before {
         content: "\e013";
+      }
       .glyphicon-remove:before {
         content: "\e014";
+      }
       .glyphicon-zoom-in:before {
         content: "\e015";
+      }
       .glyphicon-zoom-out:before {
         content: "\e016";
+      }
       .glyphicon-off:before {
         content: "\e017";
+      }
       .glyphicon-signal:before {
         content: "\e018";
+      }
       .glyphicon-cog:before {
         content: "\e019";
+      }
       .glyphicon-trash:before {
         content: "\e020";
+      }
       .glyphicon-home:before {
         content: "\e021";
+      }
       .glyphicon-file:before {
         content: "\e022";
+      }
       .glyphicon-time:before {
         content: "\e023";
+      }
       .glyphicon-road:before {
         content: "\e024";
+      }
       .glyphicon-download-alt:before {
         content: "\e025";
+      }
       .glyphicon-download:before {
         content: "\e026";
+      }
       .glyphicon-upload:before {
         content: "\e027";
+      }
       .glyphicon-inbox:before {
         content: "\e028";
+      }
       .glyphicon-play-circle:before {
         content: "\e029";
+      }
       .glyphicon-repeat:before {
         content: "\e030";
+      }
       .glyphicon-refresh:before {
         content: "\e031";
+      }
       .glyphicon-list-alt:before {
         content: "\e032";
+      }
       .glyphicon-lock:before {
         content: "\e033";
+      }
       .glyphicon-flag:before {
         content: "\e034";
+      }
       .glyphicon-headphones:before {
         content: "\e035";
+      }
       .glyphicon-volume-off:before {
         content: "\e036";
+      }
       .glyphicon-volume-down:before {
         content: "\e037";
+      }
       .glyphicon-volume-up:before {
         content: "\e038";
+      }
       .glyphicon-qrcode:before {
         content: "\e039";
+      }
       .glyphicon-barcode:before {
         content: "\e040";
+      }
       .glyphicon-tag:before {
         content: "\e041";
+      }
       .glyphicon-tags:before {
         content: "\e042";
+      }
       .glyphicon-book:before {
         content: "\e043";
+      }
       .glyphicon-bookmark:before {
         content: "\e044";
+      }
       .glyphicon-print:before {
         content: "\e045";
+      }
       .glyphicon-camera:before {
         content: "\e046";
+      }
       .glyphicon-font:before {
         content: "\e047";
+      }
       .glyphicon-bold:before {
         content: "\e048";
+      }
       .glyphicon-italic:before {
         content: "\e049";
+      }
       .glyphicon-text-height:before {
         content: "\e050";
+      }
       .glyphicon-text-width:before {
         content: "\e051";
+      }
       .glyphicon-align-left:before {
         content: "\e052";
+      }
       .glyphicon-align-center:before {
         content: "\e053";
+      }
       .glyphicon-align-right:before {
         content: "\e054";
+      }
       .glyphicon-align-justify:before {
         content: "\e055";
+      }
       .glyphicon-list:before {
         content: "\e056";
+      }
       .glyphicon-indent-left:before {
         content: "\e057";
+      }
       .glyphicon-indent-right:before {
         content: "\e058";
+      }
       .glyphicon-facetime-video:before {
         content: "\e059";
+      }
       .glyphicon-picture:before {
         content: "\e060";
+      }
       .glyphicon-map-marker:before {
         content: "\e062";
+      }
       .glyphicon-adjust:before {
         content: "\e063";
+      }
       .glyphicon-tint:before {
         content: "\e064";
+      }
       .glyphicon-edit:before {
         content: "\e065";
+      }
       .glyphicon-share:before {
         content: "\e066";
+      }
       .glyphicon-check:before {
         content: "\e067";
+      }
       .glyphicon-move:before {
         content: "\e068";
+      }
       .glyphicon-step-backward:before {
         content: "\e069";
+      }
       .glyphicon-fast-backward:before {
         content: "\e070";
+      }
       .glyphicon-backward:before {
         content: "\e071";
+      }
       .glyphicon-play:before {
         content: "\e072";
+      }
       .glyphicon-pause:before {
         content: "\e073";
+      }
       .glyphicon-stop:before {
         content: "\e074";
+      }
       .glyphicon-forward:before {
         content: "\e075";
+      }
       .glyphicon-fast-forward:before {
         content: "\e076";
+      }
       .glyphicon-step-forward:before {
         content: "\e077";
+      }
       .glyphicon-eject:before {
         content: "\e078";
+      }
       .glyphicon-chevron-left:before {
         content: "\e079";
+      }
       .glyphicon-chevron-right:before {
         content: "\e080";
+      }
       .glyphicon-plus-sign:before {
         content: "\e081";
+      }
       .glyphicon-minus-sign:before {
         content: "\e082";
+      }
       .glyphicon-remove-sign:before {
         content: "\e083";
+      }
       .glyphicon-ok-sign:before {
         content: "\e084";
+      }
       .glyphicon-question-sign:before {
         content: "\e085";
+      }
       .glyphicon-info-sign:before {
         content: "\e086";
+      }
       .glyphicon-screenshot:before {
         content: "\e087";
+      }
       .glyphicon-remove-circle:before {
         content: "\e088";
+      }
       .glyphicon-ok-circle:before {
         content: "\e089";
+      }
       .glyphicon-ban-circle:before {
         content: "\e090";
+      }
       .glyphicon-arrow-left:before {
         content: "\e091";
+      }
       .glyphicon-arrow-right:before {
         content: "\e092";
+      }
       .glyphicon-arrow-up:before {
         content: "\e093";
+      }
       .glyphicon-arrow-down:before {
         content: "\e094";
+      }
       .glyphicon-share-alt:before {
         content: "\e095";
+      }
       .glyphicon-resize-full:before {
         content: "\e096";
+      }
       .glyphicon-resize-small:before {
         content: "\e097";
+      }
       .glyphicon-exclamation-sign:before {
         content: "\e101";
+      }
       .glyphicon-gift:before {
         content: "\e102";
+      }
       .glyphicon-leaf:before {
         content: "\e103";
+      }
       .glyphicon-fire:before {
         content: "\e104";
+      }
       .glyphicon-eye-open:before {
         content: "\e105";
+      }
       .glyphicon-eye-close:before {
         content: "\e106";
+      }
       .glyphicon-warning-sign:before {
         content: "\e107";
+      }
       .glyphicon-plane:before {
         content: "\e108";
+      }
       .glyphicon-calendar:before {
         content: "\e109";
+      }
       .glyphicon-random:before {
         content: "\e110";
+      }
       .glyphicon-comment:before {
         content: "\e111";
+      }
       .glyphicon-magnet:before {
         content: "\e112";
+      }
       .glyphicon-chevron-up:before {
         content: "\e113";
+      }
       .glyphicon-chevron-down:before {
         content: "\e114";
+      }
       .glyphicon-retweet:before {
         content: "\e115";
+      }
       .glyphicon-shopping-cart:before {
         content: "\e116";
+      }
       .glyphicon-folder-close:before {
         content: "\e117";
+      }
       .glyphicon-folder-open:before {
         content: "\e118";
+      }
       .glyphicon-resize-vertical:before {
         content: "\e119";
+      }
       .glyphicon-resize-horizontal:before {
         content: "\e120";
+      }
       .glyphicon-hdd:before {
         content: "\e121";
+      }
       .glyphicon-bullhorn:before {
         content: "\e122";
+      }
       .glyphicon-bell:before {
         content: "\e123";
+      }
       .glyphicon-certificate:before {
         content: "\e124";
+      }
       .glyphicon-thumbs-up:before {
         content: "\e125";
+      }
       .glyphicon-thumbs-down:before {
         content: "\e126";
+      }
       .glyphicon-hand-right:before {
         content: "\e127";
+      }
       .glyphicon-hand-left:before {
         content: "\e128";
+      }
       .glyphicon-hand-up:before {
         content: "\e129";
+      }
       .glyphicon-hand-down:before {
         content: "\e130";
+      }
       .glyphicon-circle-arrow-right:before {
         content: "\e131";
+      }
       .glyphicon-circle-arrow-left:before {
         content: "\e132";
+      }
       .glyphicon-circle-arrow-up:before {
         content: "\e133";
+      }
       .glyphicon-circle-arrow-down:before {
         content: "\e134";
+      }
       .glyphicon-globe:before {
         content: "\e135";
+      }
       .glyphicon-wrench:before {
         content: "\e136";
+      }
       .glyphicon-tasks:before {
         content: "\e137";
+      }
       .glyphicon-filter:before {
         content: "\e138";
+      }
       .glyphicon-briefcase:before {
         content: "\e139";
+      }
       .glyphicon-fullscreen:before {
         content: "\e140";
+      }
       .glyphicon-dashboard:before {
         content: "\e141";
+      }
       .glyphicon-paperclip:before {
         content: "\e142";
+      }
       .glyphicon-heart-empty:before {
         content: "\e143";
+      }
       .glyphicon-link:before {
         content: "\e144";
+      }
       .glyphicon-phone:before {
         content: "\e145";
+      }
       .glyphicon-pushpin:before {
         content: "\e146";
+      }
       .glyphicon-usd:before {
         content: "\e148";
+      }
       .glyphicon-gbp:before {
         content: "\e149";
+      }
       .glyphicon-sort:before {
         content: "\e150";
+      }
       .glyphicon-sort-by-alphabet:before {
         content: "\e151";
+      }
       .glyphicon-sort-by-alphabet-alt:before {
         content: "\e152";
+      }
       .glyphicon-sort-by-order:before {
         content: "\e153";
+      }
       .glyphicon-sort-by-order-alt:before {
         content: "\e154";
+      }
       .glyphicon-sort-by-attributes:before {
         content: "\e155";
+      }
       .glyphicon-sort-by-attributes-alt:before {
         content: "\e156";
+      }
       .glyphicon-unchecked:before {
         content: "\e157";
+      }
       .glyphicon-expand:before {
         content: "\e158";
+      }
       .glyphicon-collapse-down:before {
         content: "\e159";
+      }
       .glyphicon-collapse-up:before {
         content: "\e160";
+      }
       .glyphicon-log-in:before {
         content: "\e161";
+      }
       .glyphicon-flash:before {
         content: "\e162";
+      }
       .glyphicon-log-out:before {
         content: "\e163";
+      }
       .glyphicon-new-window:before {
         content: "\e164";
+      }
       .glyphicon-record:before {
         content: "\e165";
+      }
       .glyphicon-save:before {
         content: "\e166";
+      }
       .glyphicon-open:before {
         content: "\e167";
+      }
       .glyphicon-saved:before {
         content: "\e168";
+      }
       .glyphicon-import:before {
         content: "\e169";
+      }
       .glyphicon-export:before {
         content: "\e170";
+      }
       .glyphicon-send:before {
         content: "\e171";
+      }
       .glyphicon-floppy-disk:before {
         content: "\e172";
+      }
       .glyphicon-floppy-saved:before {
         content: "\e173";
+      }
       .glyphicon-floppy-remove:before {
         content: "\e174";
+      }
       .glyphicon-floppy-save:before {
         content: "\e175";
+      }
       .glyphicon-floppy-open:before {
         content: "\e176";
+      }
       .glyphicon-credit-card:before {
         content: "\e177";
+      }
       .glyphicon-transfer:before {
         content: "\e178";
+      }
       .glyphicon-cutlery:before {
         content: "\e179";
+      }
       .glyphicon-header:before {
         content: "\e180";
+      }
       .glyphicon-compressed:before {
         content: "\e181";
+      }
       .glyphicon-earphone:before {
         content: "\e182";
+      }
       .glyphicon-phone-alt:before {
         content: "\e183";
+      }
       .glyphicon-tower:before {
         content: "\e184";
+      }
       .glyphicon-stats:before {
         content: "\e185";
+      }
       .glyphicon-sd-video:before {
         content: "\e186";
+      }
       .glyphicon-hd-video:before {
         content: "\e187";
+      }
       .glyphicon-subtitles:before {
         content: "\e188";
+      }
       .glyphicon-sound-stereo:before {
         content: "\e189";
+      }
       .glyphicon-sound-dolby:before {
         content: "\e190";
+      }
       .glyphicon-sound-5-1:before {
         content: "\e191";
+      }
       .glyphicon-sound-6-1:before {
         content: "\e192";
+      }
       .glyphicon-sound-7-1:before {
         content: "\e193";
+      }
       .glyphicon-copyright-mark:before {
         content: "\e194";
+      }
       .glyphicon-registration-mark:before {
         content: "\e195";
+      }
       .glyphicon-cloud-download:before {
         content: "\e197";
+      }
       .glyphicon-cloud-upload:before {
         content: "\e198";
+      }
       .glyphicon-tree-conifer:before {
         content: "\e199";
+      }
       .glyphicon-tree-deciduous:before {
         content: "\e200";
+      }
       .glyphicon-cd:before {
         content: "\e201";
+      }
       .glyphicon-save-file:before {
         content: "\e202";
+      }
       .glyphicon-open-file:before {
         content: "\e203";
+      }
       .glyphicon-level-up:before {
         content: "\e204";
+      }
       .glyphicon-copy:before {
         content: "\e205";
+      }
       .glyphicon-paste:before {
         content: "\e206";
+      }
       .glyphicon-alert:before {
         content: "\e209";
+      }
       .glyphicon-equalizer:before {
         content: "\e210";
+      }
       .glyphicon-king:before {
         content: "\e211";
+      }
       .glyphicon-queen:before {
         content: "\e212";
+      }
       .glyphicon-pawn:before {
         content: "\e213";
+      }
       .glyphicon-bishop:before {
         content: "\e214";
+      }
       .glyphicon-knight:before {
         content: "\e215";
+      }
       .glyphicon-baby-formula:before {
         content: "\e216";
+      }
       .glyphicon-tent:before {
         content: "\26fa";
+      }
       .glyphicon-blackboard:before {
         content: "\e218";
+      }
       .glyphicon-bed:before {
         content: "\e219";
+      }
       .glyphicon-apple:before {
         content: "\f8ff";
+      }
       .glyphicon-erase:before {
         content: "\e221";
+      }
       .glyphicon-hourglass:before {
         content: "\231b";
+      }
       .glyphicon-lamp:before {
         content: "\e223";
+      }
       .glyphicon-duplicate:before {
         content: "\e224";
+      }
       .glyphicon-piggy-bank:before {
         content: "\e225";
+      }
       .glyphicon-scissors:before {
         content: "\e226";
+      }
       .glyphicon-bitcoin:before {
         content: "\e227";
+      }
       .glyphicon-btc:before {
         content: "\e227";
+      }
       .glyphicon-xbt:before {
         content: "\e227";
+      }
       .glyphicon-yen:before {
         content: "\00a5";
+      }
       .glyphicon-jpy:before {
         content: "\00a5";
+      }
       .glyphicon-ruble:before {
         content: "\20bd";
+      }
       .glyphicon-rub:before {
         content: "\20bd";
+      }
       .glyphicon-scale:before {
         content: "\e230";
+      }
       .glyphicon-ice-lolly:before {
         content: "\e231";
+      }
       .glyphicon-ice-lolly-tasted:before {
         content: "\e232";
+      }
       .glyphicon-education:before {
         content: "\e233";
+      }
       .glyphicon-option-horizontal:before {
         content: "\e234";
+      }
       .glyphicon-option-vertical:before {
         content: "\e235";
+      }
       .glyphicon-menu-hamburger:before {
         content: "\e236";
+      }
       .glyphicon-modal-window:before {
         content: "\e237";
+      }
       .glyphicon-oil:before {
         content: "\e238";
+      }
       .glyphicon-grain:before {
         content: "\e239";
+      }
       .glyphicon-sunglasses:before {
         content: "\e240";
+      }
       .glyphicon-text-size:before {
         content: "\e241";
+      }
       .glyphicon-text-color:before {
         content: "\e242";
+      }
       .glyphicon-text-background:before {
         content: "\e243";
+      }
       .glyphicon-object-align-top:before {
         content: "\e244";
+      }
       .glyphicon-object-align-bottom:before {
         content: "\e245";
+      }
       .glyphicon-object-align-horizontal:before {
         content: "\e246";
+      }
       .glyphicon-object-align-left:before {
         content: "\e247";
+      }
       .glyphicon-object-align-vertical:before {
         content: "\e248";
+      }
       .glyphicon-object-align-right:before {
         content: "\e249";
+      }
       .glyphicon-triangle-right:before {
         content: "\e250";
+      }
       .glyphicon-triangle-left:before {
         content: "\e251";
+      }
       .glyphicon-triangle-bottom:before {
         content: "\e252";
+      }
       .glyphicon-triangle-top:before {
         content: "\e253";
+      }
       .glyphicon-console:before {
         content: "\e254";
+      }
       .glyphicon-superscript:before {
         content: "\e255";
+      }
       .glyphicon-subscript:before {
         content: "\e256";
+      }
       .glyphicon-menu-left:before {
         content: "\e257";
+      }
       .glyphicon-menu-right:before {
         content: "\e258";
+      }
       .glyphicon-menu-down:before {
         content: "\e259";
+      }
       .glyphicon-menu-up:before {
         content: "\e260";
+      }
       * {
         -webkit-box-sizing: border-box;
         -moz-box-sizing: border-box;
         box-sizing: border-box;
+      }
       *:before,
       *:after {
         -webkit-box-sizing: border-box;
         -moz-box-sizing: border-box;
         box-sizing: border-box;
+      }
       html {
         font-size: 10px;
         -webkit-tap-highlight-color: rgba(0, 0, 0, 0);
+      }
       body {
         font-family: "Helvetica Neue", Helvetica, Arial, sans-serif;
         font-size: 13px;
         line-height: 1.42857143;
         color: #000;
         background-color: #fff;
+      }
       input,
       button,
       select,
       textarea {
         font-family: inherit;
         font-size: inherit;
         line-height: inherit;
+      }
       a {
         color: #337ab7;
         text-decoration: none;
+      }
       a:hover,
       a:focus {
         color: #23527c;
         text-decoration: underline;
+      }
       a:focus {
         outline: 5px auto -webkit-focus-ring-color;
         outline-offset: -2px;
+      }
       figure {
         margin: 0;
+      }
       img {
         vertical-align: middle;
+      }
       .img-responsive,
       .thumbnail > img,
       .thumbnail a > img,
       .carousel-inner > .item > img,
       .carousel-inner > .item > a > img {
         display: block;
         max-width: 100%;
         height: auto;
+      }
       .img-rounded {
         border-radius: 3px;
+      }
       .img-thumbnail {
         padding: 4px;
         line-height: 1.42857143;
         background-color: #fff;
         border: 1px solid #ddd;
         border-radius: 2px;
         -webkit-transition: all 0.2s ease-in-out;
         -o-transition: all 0.2s ease-in-out;
         transition: all 0.2s ease-in-out;
         display: inline-block;
         max-width: 100%;
         height: auto;
+      }
       .img-circle {
         border-radius: 50%;
+      }
       hr {
         margin-top: 18px;
         margin-bottom: 18px;
         border: 0;
         border-top: 1px solid #eeeeee;
+      }
       .sr-only {
         position: absolute;
         width: 1px;
         height: 1px;
         margin: -1px;
         padding: 0;
         overflow: hidden;
         clip: rect(0, 0, 0, 0);
         border: 0;
+      }
       .sr-only-focusable:active,
       .sr-only-focusable:focus {
         position: static;
         width: auto;
         height: auto;
         margin: 0;
         overflow: visible;
         clip: auto;
+      }
       [role="button"] {
         cursor: pointer;
+      }
       h1,
       h2,
       h3,
       h4,
       h5,
       h6,
       .h1,
       .h2,
       .h3,
       .h4,
       .h5,
       .h6 {
         font-family: inherit;
         font-weight: 500;
         line-height: 1.1;
         color: inherit;
+      }
       h1 small,
       h2 small,
       h3 small,
       h4 small,
       h5 small,
       h6 small,
       .h1 small,
       .h2 small,
       .h3 small,
       .h4 small,
       .h5 small,
       .h6 small,
       h1 .small,
       h2 .small,
       h3 .small,
       h4 .small,
       h5 .small,
       h6 .small,
       .h1 .small,
       .h2 .small,
       .h3 .small,
       .h4 .small,
       .h5 .small,
       .h6 .small {
         font-weight: normal;
         line-height: 1;
         color: #777777;
+      }
       h1,
       .h1,
       h2,
       .h2,
       h3,
       .h3 {
         margin-top: 18px;
         margin-bottom: 9px;
+      }
       h1 small,
       .h1 small,
       h2 small,
       .h2 small,
       h3 small,
       .h3 small,
       h1 .small,
       .h1 .small,
       h2 .small,
       .h2 .small,
       h3 .small,
       .h3 .small {
         font-size: 65%;
+      }
       h4,
       .h4,
       h5,
       .h5,
       h6,
       .h6 {
         margin-top: 9px;
         margin-bottom: 9px;
+      }
       h4 small,
       .h4 small,
       h5 small,
       .h5 small,
       h6 small,
       .h6 small,
       h4 .small,
       .h4 .small,
       h5 .small,
       .h5 .small,
       h6 .small,
       .h6 .small {
         font-size: 75%;
+      }
       h1,
       .h1 {
         font-size: 33px;
+      }
       h2,
       .h2 {
         font-size: 27px;
+      }
       h3,
       .h3 {
         font-size: 23px;
+      }
       h4,
       .h4 {
         font-size: 17px;
+      }
       h5,
       .h5 {
         font-size: 13px;
+      }
       h6,
       .h6 {
         font-size: 12px;
+      }
       p {
         margin: 0 0 9px;
+      }
       .lead {
         margin-bottom: 18px;
         font-size: 14px;
         font-weight: 300;
         line-height: 1.4;
+      }
       @media (min-width: 768px) {
         .lead {
           font-size: 19.5px;
+        }
+      }
       small,
       .small {
         font-size: 92%;
+      }
       mark,
       .mark {
         background-color: #fcf8e3;
         padding: .2em;
+      }
       .text-left {
         text-align: left;
+      }
       .text-right {
         text-align: right;
+      }
       .text-center {
         text-align: center;
+      }
       .text-justify {
         text-align: justify;
+      }
       .text-nowrap {
         white-space: nowrap;
+      }
       .text-lowercase {
         text-transform: lowercase;
+      }
       .text-uppercase {
         text-transform: uppercase;
+      }
       .text-capitalize {
         text-transform: capitalize;
+      }
       .text-muted {
         color: #777777;
+      }
       .text-primary {
         color: #337ab7;
+      }
       a.text-primary:hover,
       a.text-primary:focus {
         color: #286090;
+      }
       .text-success {
         color: #3c763d;
+      }
       a.text-success:hover,
       a.text-success:focus {
         color: #2b542c;
+      }
       .text-info {
         color: #31708f;
+      }
       a.text-info:hover,
       a.text-info:focus {
         color: #245269;
+      }
       .text-warning {
         color: #8a6d3b;
+      }
       a.text-warning:hover,
       a.text-warning:focus {
         color: #66512c;
+      }
       .text-danger {
         color: #a94442;
+      }
       a.text-danger:hover,
       a.text-danger:focus {
         color: #843534;
+      }
       .bg-primary {
         color: #fff;
         background-color: #337ab7;
+      }
       a.bg-primary:hover,
       a.bg-primary:focus {
         background-color: #286090;
+      }
       .bg-success {
         background-color: #dff0d8;
+      }
       a.bg-success:hover,
       a.bg-success:focus {
         background-color: #c1e2b3;
+      }
       .bg-info {
         background-color: #d9edf7;
+      }
       a.bg-info:hover,
       a.bg-info:focus {
         background-color: #afd9ee;
+      }
       .bg-warning {
         background-color: #fcf8e3;
+      }
       a.bg-warning:hover,
       a.bg-warning:focus {
         background-color: #f7ecb5;
+      }
       .bg-danger {
         background-color: #f2dede;
+      }
       a.bg-danger:hover,
       a.bg-danger:focus {
         background-color: #e4b9b9;
+      }
       .page-header {
         padding-bottom: 8px;
         margin: 36px 0 18px;
         border-bottom: 1px solid #eeeeee;
+      }
       ul,
       ol {
         margin-top: 0;
         margin-bottom: 9px;
+      }
       ul ul,
       ol ul,
       ul ol,
       ol ol {
         margin-bottom: 0;
+      }
       .list-unstyled {
         padding-left: 0;
         list-style: none;
+      }
       .list-inline {
         padding-left: 0;
         list-style: none;
         margin-left: -5px;
+      }
       .list-inline > li {
         display: inline-block;
         padding-left: 5px;
         padding-right: 5px;
+      }
       dl {
         margin-top: 0;
         margin-bottom: 18px;
+      }
       dt,
       dd {
         line-height: 1.42857143;
+      }
       dt {
         font-weight: bold;
+      }
       dd {
         margin-left: 0;
+      }
       @media (min-width: 541px) {
         .dl-horizontal dt {
           float: left;
           width: 160px;
           clear: left;
           text-align: right;
           overflow: hidden;
           text-overflow: ellipsis;
           white-space: nowrap;
+        }
         .dl-horizontal dd {
           margin-left: 180px;
+        }
+      }
       abbr[title],
       abbr[data-original-title] {
         cursor: help;
         border-bottom: 1px dotted #777777;
+      }
       .initialism {
         font-size: 90%;
         text-transform: uppercase;
+      }
       blockquote {
         padding: 9px 18px;
         margin: 0 0 18px;
         font-size: inherit;
         border-left: 5px solid #eeeeee;
+      }
       blockquote p:last-child,
       blockquote ul:last-child,
       blockquote ol:last-child {
         margin-bottom: 0;
+      }
       blockquote footer,
       blockquote small,
       blockquote .small {
         display: block;
         font-size: 80%;
         line-height: 1.42857143;
         color: #777777;
+      }
       blockquote footer:before,
       blockquote small:before,
       blockquote .small:before {
         content: '\2014 \00A0';
+      }
       .blockquote-reverse,
       blockquote.pull-right {
         padding-right: 15px;
         padding-left: 0;
         border-right: 5px solid #eeeeee;
         border-left: 0;
         text-align: right;
+      }
       .blockquote-reverse footer:before,
       blockquote.pull-right footer:before,
       .blockquote-reverse small:before,
       blockquote.pull-right small:before,
       .blockquote-reverse .small:before,
       blockquote.pull-right .small:before {
         content: '';
+      }
       .blockquote-reverse footer:after,
       blockquote.pull-right footer:after,
       .blockquote-reverse small:after,
       blockquote.pull-right small:after,
       .blockquote-reverse .small:after,
       blockquote.pull-right .small:after {
         content: '\00A0 \2014';
+      }
       address {
         margin-bottom: 18px;
         font-style: normal;
         line-height: 1.42857143;
+      }
       code,
       kbd,
       pre,
       samp {
         font-family: monospace;
+      }
       code {
         padding: 2px 4px;
         font-size: 90%;
         color: #c7254e;
         background-color: #f9f2f4;
         border-radius: 2px;
+      }
       kbd {
         padding: 2px 4px;
         font-size: 90%;
         color: #888;
         background-color: transparent;
         border-radius: 1px;
         box-shadow: inset 0 -1px 0 rgba(0, 0, 0, 0.25);
+      }
       kbd kbd {
         padding: 0;
         font-size: 100%;
         font-weight: bold;
         box-shadow: none;
+      }
       pre {
         display: block;
         padding: 8.5px;
         margin: 0 0 9px;
         font-size: 12px;
         line-height: 1.42857143;
         word-break: break-all;
         word-wrap: break-word;
         color: #333333;
         background-color: #f5f5f5;
         border: 1px solid #ccc;
         border-radius: 2px;
+      }
       pre code {
         padding: 0;
         font-size: inherit;
         color: inherit;
         white-space: pre-wrap;
         background-color: transparent;
         border-radius: 0;
+      }
       .pre-scrollable {
         max-height: 340px;
         overflow-y: scroll;
+      }
       .container {
         margin-right: auto;
         margin-left: auto;
         padding-left: 0px;
         padding-right: 0px;
+      }
       @media (min-width: 768px) {
         .container {
           width: 768px;
+        }
+      }
       @media (min-width: 992px) {
         .container {
           width: 940px;
+        }
+      }
       @media (min-width: 1200px) {
         .container {
           width: 1140px;
+        }
+      }
       .container-fluid {
         margin-right: auto;
         margin-left: auto;
         padding-left: 0px;
         padding-right: 0px;
+      }
       .row {
         margin-left: 0px;
         margin-right: 0px;
+      }
       .col-xs-1, .col-sm-1, .col-md-1, .col-lg-1, .col-xs-2, .col-sm-2, .col-md-2, .col-lg-2, .col-xs-3, .col-sm-3, .col-md-3, .col-lg-3, .col-xs-4, .col-sm-4, .col-md-4, .col-lg-4, .col-xs-5, .col-sm-5, .col-md-5, .col-lg-5, .col-xs-6, .col-sm-6, .col-md-6, .col-lg-6, .col-xs-7, .col-sm-7, .col-md-7, .col-lg-7, .col-xs-8, .col-sm-8, .col-md-8, .col-lg-8, .col-xs-9, .col-sm-9, .col-md-9, .col-lg-9, .col-xs-10, .col-sm-10, .col-md-10, .col-lg-10, .col-xs-11, .col-sm-11, .col-md-11, .col-lg-11, .col-xs-12, .col-sm-12, .col-md-12, .col-lg-12 {
         position: relative;
         min-height: 1px;
         padding-left: 0px;
         padding-right: 0px;
+      }
       .col-xs-1, .col-xs-2, .col-xs-3, .col-xs-4, .col-xs-5, .col-xs-6, .col-xs-7, .col-xs-8, .col-xs-9, .col-xs-10, .col-xs-11, .col-xs-12 {
         float: left;
+      }
       .col-xs-12 {
         width: 100%;
+      }
       .col-xs-11 {
         width: 91.66666667%;
+      }
       .col-xs-10 {
         width: 83.33333333%;
+      }
       .col-xs-9 {
         width: 75%;
+      }
       .col-xs-8 {
         width: 66.66666667%;
+      }
       .col-xs-7 {
         width: 58.33333333%;
+      }
       .col-xs-6 {
         width: 50%;
+      }
       .col-xs-5 {
         width: 41.66666667%;
+      }
       .col-xs-4 {
         width: 33.33333333%;
+      }
       .col-xs-3 {
         width: 25%;
+      }
       .col-xs-2 {
         width: 16.66666667%;
+      }
       .col-xs-1 {
         width: 8.33333333%;
+      }
       .col-xs-pull-12 {
         right: 100%;
+      }
       .col-xs-pull-11 {
         right: 91.66666667%;
+      }
       .col-xs-pull-10 {
         right: 83.33333333%;
+      }
       .col-xs-pull-9 {
         right: 75%;
+      }
       .col-xs-pull-8 {
         right: 66.66666667%;
+      }
       .col-xs-pull-7 {
         right: 58.33333333%;
+      }
       .col-xs-pull-6 {
         right: 50%;
+      }
       .col-xs-pull-5 {
         right: 41.66666667%;
+      }
       .col-xs-pull-4 {
         right: 33.33333333%;
+      }
       .col-xs-pull-3 {
         right: 25%;
+      }
       .col-xs-pull-2 {
         right: 16.66666667%;
+      }
       .col-xs-pull-1 {
         right: 8.33333333%;
+      }
       .col-xs-pull-0 {
         right: auto;
+      }
       .col-xs-push-12 {
         left: 100%;
+      }
       .col-xs-push-11 {
         left: 91.66666667%;
+      }
       .col-xs-push-10 {
         left: 83.33333333%;
+      }
       .col-xs-push-9 {
         left: 75%;
+      }
       .col-xs-push-8 {
         left: 66.66666667%;
+      }
       .col-xs-push-7 {
         left: 58.33333333%;
+      }
       .col-xs-push-6 {
         left: 50%;
+      }
       .col-xs-push-5 {
         left: 41.66666667%;
+      }
       .col-xs-push-4 {
         left: 33.33333333%;
+      }
       .col-xs-push-3 {
         left: 25%;
+      }
       .col-xs-push-2 {
         left: 16.66666667%;
+      }
       .col-xs-push-1 {
         left: 8.33333333%;
+      }
       .col-xs-push-0 {
         left: auto;
+      }
       .col-xs-offset-12 {
         margin-left: 100%;
+      }
       .col-xs-offset-11 {
         margin-left: 91.66666667%;
+      }
       .col-xs-offset-10 {
         margin-left: 83.33333333%;
+      }
       .col-xs-offset-9 {
         margin-left: 75%;
+      }
       .col-xs-offset-8 {
         margin-left: 66.66666667%;
+      }
       .col-xs-offset-7 {
         margin-left: 58.33333333%;
+      }
       .col-xs-offset-6 {
         margin-left: 50%;
+      }
       .col-xs-offset-5 {
         margin-left: 41.66666667%;
+      }
       .col-xs-offset-4 {
         margin-left: 33.33333333%;
+      }
       .col-xs-offset-3 {
         margin-left: 25%;
+      }
       .col-xs-offset-2 {
         margin-left: 16.66666667%;
+      }
       .col-xs-offset-1 {
         margin-left: 8.33333333%;
+      }
       .col-xs-offset-0 {
         margin-left: 0%;
+      }
       @media (min-width: 768px) {
         .col-sm-1, .col-sm-2, .col-sm-3, .col-sm-4, .col-sm-5, .col-sm-6, .col-sm-7, .col-sm-8, .col-sm-9, .col-sm-10, .col-sm-11, .col-sm-12 {
           float: left;
+        }
         .col-sm-12 {
           width: 100%;
+        }
         .col-sm-11 {
           width: 91.66666667%;
+        }
         .col-sm-10 {
           width: 83.33333333%;
+        }
         .col-sm-9 {
           width: 75%;
+        }
         .col-sm-8 {
           width: 66.66666667%;
+        }
         .col-sm-7 {
           width: 58.33333333%;
+        }
         .col-sm-6 {
           width: 50%;
+        }
         .col-sm-5 {
           width: 41.66666667%;
+        }
         .col-sm-4 {
           width: 33.33333333%;
+        }
         .col-sm-3 {
           width: 25%;
+        }
         .col-sm-2 {
           width: 16.66666667%;
+        }
         .col-sm-1 {
           width: 8.33333333%;
+        }
         .col-sm-pull-12 {
           right: 100%;
+        }
         .col-sm-pull-11 {
           right: 91.66666667%;
+        }
         .col-sm-pull-10 {
           right: 83.33333333%;
+        }
         .col-sm-pull-9 {
           right: 75%;
+        }
         .col-sm-pull-8 {
           right: 66.66666667%;
+        }
         .col-sm-pull-7 {
           right: 58.33333333%;
+        }
         .col-sm-pull-6 {
           right: 50%;
+        }
         .col-sm-pull-5 {
           right: 41.66666667%;
+        }
         .col-sm-pull-4 {
           right: 33.33333333%;
+        }
         .col-sm-pull-3 {
           right: 25%;
+        }
         .col-sm-pull-2 {
           right: 16.66666667%;
+        }
         .col-sm-pull-1 {
           right: 8.33333333%;
+        }
         .col-sm-pull-0 {
           right: auto;
+        }
         .col-sm-push-12 {
           left: 100%;
+        }
         .col-sm-push-11 {
           left: 91.66666667%;
+        }
         .col-sm-push-10 {
           left: 83.33333333%;
+        }
         .col-sm-push-9 {
           left: 75%;
+        }
         .col-sm-push-8 {
           left: 66.66666667%;
+        }
         .col-sm-push-7 {
           left: 58.33333333%;
+        }
         .col-sm-push-6 {
           left: 50%;
+        }
         .col-sm-push-5 {
           left: 41.66666667%;
+        }
         .col-sm-push-4 {
           left: 33.33333333%;
+        }
         .col-sm-push-3 {
           left: 25%;
+        }
         .col-sm-push-2 {
           left: 16.66666667%;
+        }
         .col-sm-push-1 {
           left: 8.33333333%;
+        }
         .col-sm-push-0 {
           left: auto;
+        }
         .col-sm-offset-12 {
           margin-left: 100%;
+        }
         .col-sm-offset-11 {
           margin-left: 91.66666667%;
+        }
         .col-sm-offset-10 {
           margin-left: 83.33333333%;
+        }
         .col-sm-offset-9 {
           margin-left: 75%;
+        }
         .col-sm-offset-8 {
           margin-left: 66.66666667%;
+        }
         .col-sm-offset-7 {
           margin-left: 58.33333333%;
+        }
         .col-sm-offset-6 {
           margin-left: 50%;
+        }
         .col-sm-offset-5 {
           margin-left: 41.66666667%;
+        }
         .col-sm-offset-4 {
           margin-left: 33.33333333%;
+        }
         .col-sm-offset-3 {
           margin-left: 25%;
+        }
         .col-sm-offset-2 {
           margin-left: 16.66666667%;
+        }
         .col-sm-offset-1 {
           margin-left: 8.33333333%;
+        }
         .col-sm-offset-0 {
           margin-left: 0%;
+        }
+      }
       @media (min-width: 992px) {
         .col-md-1, .col-md-2, .col-md-3, .col-md-4, .col-md-5, .col-md-6, .col-md-7, .col-md-8, .col-md-9, .col-md-10, .col-md-11, .col-md-12 {
           float: left;
+        }
         .col-md-12 {
           width: 100%;
+        }
         .col-md-11 {
           width: 91.66666667%;
+        }
         .col-md-10 {
           width: 83.33333333%;
+        }
         .col-md-9 {
           width: 75%;
+        }
         .col-md-8 {
           width: 66.66666667%;
+        }
         .col-md-7 {
           width: 58.33333333%;
+        }
         .col-md-6 {
           width: 50%;
+        }
         .col-md-5 {
           width: 41.66666667%;
+        }
         .col-md-4 {
           width: 33.33333333%;
+        }
         .col-md-3 {
           width: 25%;
+        }
         .col-md-2 {
           width: 16.66666667%;
+        }
         .col-md-1 {
           width: 8.33333333%;
+        }
         .col-md-pull-12 {
           right: 100%;
+        }
         .col-md-pull-11 {
           right: 91.66666667%;
+        }
         .col-md-pull-10 {
           right: 83.33333333%;
+        }
         .col-md-pull-9 {
           right: 75%;
+        }
         .col-md-pull-8 {
           right: 66.66666667%;
+        }
         .col-md-pull-7 {
           right: 58.33333333%;
+        }
         .col-md-pull-6 {
           right: 50%;
+        }
         .col-md-pull-5 {
           right: 41.66666667%;
+        }
         .col-md-pull-4 {
           right: 33.33333333%;
+        }
         .col-md-pull-3 {
           right: 25%;
+        }
         .col-md-pull-2 {
           right: 16.66666667%;
+        }
         .col-md-pull-1 {
           right: 8.33333333%;
+        }
         .col-md-pull-0 {
           right: auto;
+        }
         .col-md-push-12 {
           left: 100%;
+        }
         .col-md-push-11 {
           left: 91.66666667%;
+        }
         .col-md-push-10 {
           left: 83.33333333%;
+        }
         .col-md-push-9 {
           left: 75%;
+        }
         .col-md-push-8 {
           left: 66.66666667%;
+        }
         .col-md-push-7 {
           left: 58.33333333%;
+        }
         .col-md-push-6 {
           left: 50%;
+        }
         .col-md-push-5 {
           left: 41.66666667%;
+        }
         .col-md-push-4 {
           left: 33.33333333%;
+        }
         .col-md-push-3 {
           left: 25%;
+        }
         .col-md-push-2 {
           left: 16.66666667%;
+        }
         .col-md-push-1 {
           left: 8.33333333%;
+        }
         .col-md-push-0 {
           left: auto;
+        }
         .col-md-offset-12 {
           margin-left: 100%;
+        }
         .col-md-offset-11 {
           margin-left: 91.66666667%;
+        }
         .col-md-offset-10 {
           margin-left: 83.33333333%;
+        }
         .col-md-offset-9 {
           margin-left: 75%;
+        }
         .col-md-offset-8 {
           margin-left: 66.66666667%;
+        }
         .col-md-offset-7 {
           margin-left: 58.33333333%;
+        }
         .col-md-offset-6 {
           margin-left: 50%;
+        }
         .col-md-offset-5 {
           margin-left: 41.66666667%;
+        }
         .col-md-offset-4 {
           margin-left: 33.33333333%;
+        }
         .col-md-offset-3 {
           margin-left: 25%;
+        }
         .col-md-offset-2 {
           margin-left: 16.66666667%;
+        }
         .col-md-offset-1 {
           margin-left: 8.33333333%;
+        }
         .col-md-offset-0 {
           margin-left: 0%;
+        }
+      }
       @media (min-width: 1200px) {
         .col-lg-1, .col-lg-2, .col-lg-3, .col-lg-4, .col-lg-5, .col-lg-6, .col-lg-7, .col-lg-8, .col-lg-9, .col-lg-10, .col-lg-11, .col-lg-12 {
           float: left;
+        }
         .col-lg-12 {
           width: 100%;
+        }
         .col-lg-11 {
           width: 91.66666667%;
+        }
         .col-lg-10 {
           width: 83.33333333%;
+        }
         .col-lg-9 {
           width: 75%;
+        }
         .col-lg-8 {
           width: 66.66666667%;
+        }
         .col-lg-7 {
           width: 58.33333333%;
+        }
         .col-lg-6 {
           width: 50%;
+        }
         .col-lg-5 {
           width: 41.66666667%;
+        }
         .col-lg-4 {
           width: 33.33333333%;
+        }
         .col-lg-3 {
           width: 25%;
+        }
         .col-lg-2 {
           width: 16.66666667%;
+        }
         .col-lg-1 {
           width: 8.33333333%;
+        }
         .col-lg-pull-12 {
           right: 100%;
+        }
         .col-lg-pull-11 {
           right: 91.66666667%;
+        }
         .col-lg-pull-10 {
           right: 83.33333333%;
+        }
         .col-lg-pull-9 {
           right: 75%;
+        }
         .col-lg-pull-8 {
           right: 66.66666667%;
+        }
         .col-lg-pull-7 {
           right: 58.33333333%;
+        }
         .col-lg-pull-6 {
           right: 50%;
+        }
         .col-lg-pull-5 {
           right: 41.66666667%;
+        }
         .col-lg-pull-4 {
           right: 33.33333333%;
+        }
         .col-lg-pull-3 {
           right: 25%;
+        }
         .col-lg-pull-2 {
           right: 16.66666667%;
+        }
         .col-lg-pull-1 {
           right: 8.33333333%;
+        }
         .col-lg-pull-0 {
           right: auto;
+        }
         .col-lg-push-12 {
           left: 100%;
+        }
         .col-lg-push-11 {
           left: 91.66666667%;
+        }
         .col-lg-push-10 {
           left: 83.33333333%;
+        }
         .col-lg-push-9 {
           left: 75%;
+        }
         .col-lg-push-8 {
           left: 66.66666667%;
+        }
         .col-lg-push-7 {
           left: 58.33333333%;
+        }
         .col-lg-push-6 {
           left: 50%;
+        }
         .col-lg-push-5 {
           left: 41.66666667%;
+        }
         .col-lg-push-4 {
           left: 33.33333333%;
+        }
         .col-lg-push-3 {
           left: 25%;
+        }
         .col-lg-push-2 {
           left: 16.66666667%;
+        }
         .col-lg-push-1 {
           left: 8.33333333%;
+        }
         .col-lg-push-0 {
           left: auto;
+        }
         .col-lg-offset-12 {
           margin-left: 100%;
+        }
         .col-lg-offset-11 {
           margin-left: 91.66666667%;
+        }
         .col-lg-offset-10 {
           margin-left: 83.33333333%;
+        }
         .col-lg-offset-9 {
           margin-left: 75%;
+        }
         .col-lg-offset-8 {
           margin-left: 66.66666667%;
+        }
         .col-lg-offset-7 {
           margin-left: 58.33333333%;
+        }
         .col-lg-offset-6 {
           margin-left: 50%;
+        }
         .col-lg-offset-5 {
           margin-left: 41.66666667%;
+        }
         .col-lg-offset-4 {
           margin-left: 33.33333333%;
+        }
         .col-lg-offset-3 {
           margin-left: 25%;
+        }
         .col-lg-offset-2 {
           margin-left: 16.66666667%;
+        }
         .col-lg-offset-1 {
           margin-left: 8.33333333%;
+        }
         .col-lg-offset-0 {
           margin-left: 0%;
+        }
+      }
       table {
         background-color: transparent;
+      }
       caption {
         padding-top: 8px;
         padding-bottom: 8px;
         color: #777777;
         text-align: left;
+      }
       th {
         text-align: left;
+      }
       .table {
         width: 100%;
         max-width: 100%;
         margin-bottom: 18px;
+      }
       .table > thead > tr > th,
       .table > tbody > tr > th,
       .table > tfoot > tr > th,
       .table > thead > tr > td,
       .table > tbody > tr > td,
       .table > tfoot > tr > td {
         padding: 8px;
         line-height: 1.42857143;
         vertical-align: top;
         border-top: 1px solid #ddd;
+      }
       .table > thead > tr > th {
         vertical-align: bottom;
         border-bottom: 2px solid #ddd;
+      }
       .table > caption + thead > tr:first-child > th,
       .table > colgroup + thead > tr:first-child > th,
       .table > thead:first-child > tr:first-child > th,
       .table > caption + thead > tr:first-child > td,
       .table > colgroup + thead > tr:first-child > td,
       .table > thead:first-child > tr:first-child > td {
         border-top: 0;
+      }
       .table > tbody + tbody {
         border-top: 2px solid #ddd;
+      }
       .table .table {
         background-color: #fff;
+      }
       .table-condensed > thead > tr > th,
       .table-condensed > tbody > tr > th,
       .table-condensed > tfoot > tr > th,
       .table-condensed > thead > tr > td,
       .table-condensed > tbody > tr > td,
       .table-condensed > tfoot > tr > td {
         padding: 5px;
+      }
       .table-bordered {
         border: 1px solid #ddd;
+      }
       .table-bordered > thead > tr > th,
       .table-bordered > tbody > tr > th,
       .table-bordered > tfoot > tr > th,
       .table-bordered > thead > tr > td,
       .table-bordered > tbody > tr > td,
       .table-bordered > tfoot > tr > td {
         border: 1px solid #ddd;
+      }
       .table-bordered > thead > tr > th,
       .table-bordered > thead > tr > td {
         border-bottom-width: 2px;
+      }
       .table-striped > tbody > tr:nth-of-type(odd) {
         background-color: #f9f9f9;
+      }
       .table-hover > tbody > tr:hover {
         background-color: #f5f5f5;
+      }
       table col[class*="col-"] {
         position: static;
         float: none;
         display: table-column;
+      }
       table td[class*="col-"],
       table th[class*="col-"] {
         position: static;
         float: none;
         display: table-cell;
+      }
       .table > thead > tr > td.active,
       .table > tbody > tr > td.active,
       .table > tfoot > tr > td.active,
       .table > thead > tr > th.active,
       .table > tbody > tr > th.active,
       .table > tfoot > tr > th.active,
       .table > thead > tr.active > td,
       .table > tbody > tr.active > td,
       .table > tfoot > tr.active > td,
       .table > thead > tr.active > th,
       .table > tbody > tr.active > th,
       .table > tfoot > tr.active > th {
         background-color: #f5f5f5;
+      }
       .table-hover > tbody > tr > td.active:hover,
       .table-hover > tbody > tr > th.active:hover,
       .table-hover > tbody > tr.active:hover > td,
       .table-hover > tbody > tr:hover > .active,
       .table-hover > tbody > tr.active:hover > th {
         background-color: #e8e8e8;
+      }
       .table > thead > tr > td.success,
       .table > tbody > tr > td.success,
       .table > tfoot > tr > td.success,
       .table > thead > tr > th.success,
       .table > tbody > tr > th.success,
       .table > tfoot > tr > th.success,
       .table > thead > tr.success > td,
       .table > tbody > tr.success > td,
       .table > tfoot > tr.success > td,
       .table > thead > tr.success > th,
       .table > tbody > tr.success > th,
       .table > tfoot > tr.success > th {
         background-color: #dff0d8;
+      }
       .table-hover > tbody > tr > td.success:hover,
       .table-hover > tbody > tr > th.success:hover,
       .table-hover > tbody > tr.success:hover > td,
       .table-hover > tbody > tr:hover > .success,
       .table-hover > tbody > tr.success:hover > th {
         background-color: #d0e9c6;
+      }
       .table > thead > tr > td.info,
       .table > tbody > tr > td.info,
       .table > tfoot > tr > td.info,
       .table > thead > tr > th.info,
       .table > tbody > tr > th.info,
       .table > tfoot > tr > th.info,
       .table > thead > tr.info > td,
       .table > tbody > tr.info > td,
       .table > tfoot > tr.info > td,
       .table > thead > tr.info > th,
       .table > tbody > tr.info > th,
       .table > tfoot > tr.info > th {
         background-color: #d9edf7;
+      }
       .table-hover > tbody > tr > td.info:hover,
       .table-hover > tbody > tr > th.info:hover,
       .table-hover > tbody > tr.info:hover > td,
       .table-hover > tbody > tr:hover > .info,
       .table-hover > tbody > tr.info:hover > th {
         background-color: #c4e3f3;
+      }
       .table > thead > tr > td.warning,
       .table > tbody > tr > td.warning,
       .table > tfoot > tr > td.warning,
       .table > thead > tr > th.warning,
       .table > tbody > tr > th.warning,
       .table > tfoot > tr > th.warning,
       .table > thead > tr.warning > td,
       .table > tbody > tr.warning > td,
       .table > tfoot > tr.warning > td,
       .table > thead > tr.warning > th,
       .table > tbody > tr.warning > th,
       .table > tfoot > tr.warning > th {
         background-color: #fcf8e3;
+      }
       .table-hover > tbody > tr > td.warning:hover,
       .table-hover > tbody > tr > th.warning:hover,
       .table-hover > tbody > tr.warning:hover > td,
       .table-hover > tbody > tr:hover > .warning,
       .table-hover > tbody > tr.warning:hover > th {
         background-color: #faf2cc;
+      }
       .table > thead > tr > td.danger,
       .table > tbody > tr > td.danger,
       .table > tfoot > tr > td.danger,
       .table > thead > tr > th.danger,
       .table > tbody > tr > th.danger,
       .table > tfoot > tr > th.danger,
       .table > thead > tr.danger > td,
       .table > tbody > tr.danger > td,
       .table > tfoot > tr.danger > td,
       .table > thead > tr.danger > th,
       .table > tbody > tr.danger > th,
       .table > tfoot > tr.danger > th {
         background-color: #f2dede;
+      }
       .table-hover > tbody > tr > td.danger:hover,
       .table-hover > tbody > tr > th.danger:hover,
       .table-hover > tbody > tr.danger:hover > td,
       .table-hover > tbody > tr:hover > .danger,
       .table-hover > tbody > tr.danger:hover > th {
         background-color: #ebcccc;
+      }
       .table-responsive {
         overflow-x: auto;
         min-height: 0.01%;
+      }
       @media screen and (max-width: 767px) {
         .table-responsive {
           width: 100%;
           margin-bottom: 13.5px;
           overflow-y: hidden;
           -ms-overflow-style: -ms-autohiding-scrollbar;
           border: 1px solid #ddd;
+        }
         .table-responsive > .table {
           margin-bottom: 0;
+        }
         .table-responsive > .table > thead > tr > th,
         .table-responsive > .table > tbody > tr > th,
         .table-responsive > .table > tfoot > tr > th,
         .table-responsive > .table > thead > tr > td,
         .table-responsive > .table > tbody > tr > td,
         .table-responsive > .table > tfoot > tr > td {
           white-space: nowrap;
+        }
         .table-responsive > .table-bordered {
           border: 0;
+        }
         .table-responsive > .table-bordered > thead > tr > th:first-child,
         .table-responsive > .table-bordered > tbody > tr > th:first-child,
         .table-responsive > .table-bordered > tfoot > tr > th:first-child,
         .table-responsive > .table-bordered > thead > tr > td:first-child,
         .table-responsive > .table-bordered > tbody > tr > td:first-child,
         .table-responsive > .table-bordered > tfoot > tr > td:first-child {
           border-left: 0;
+        }
         .table-responsive > .table-bordered > thead > tr > th:last-child,
         .table-responsive > .table-bordered > tbody > tr > th:last-child,
         .table-responsive > .table-bordered > tfoot > tr > th:last-child,
         .table-responsive > .table-bordered > thead > tr > td:last-child,
         .table-responsive > .table-bordered > tbody > tr > td:last-child,
         .table-responsive > .table-bordered > tfoot > tr > td:last-child {
           border-right: 0;
+        }
         .table-responsive > .table-bordered > tbody > tr:last-child > th,
         .table-responsive > .table-bordered > tfoot > tr:last-child > th,
         .table-responsive > .table-bordered > tbody > tr:last-child > td,
         .table-responsive > .table-bordered > tfoot > tr:last-child > td {
           border-bottom: 0;
+        }
+      }
       fieldset {
         padding: 0;
         margin: 0;
         border: 0;
         min-width: 0;
+      }
       legend {
         display: block;
         width: 100%;
         padding: 0;
         margin-bottom: 18px;
         font-size: 19.5px;
         line-height: inherit;
         color: #333333;
         border: 0;
         border-bottom: 1px solid #e5e5e5;
+      }
       label {
         display: inline-block;
         max-width: 100%;
         margin-bottom: 5px;
         font-weight: bold;
+      }
       input[type="search"] {
         -webkit-box-sizing: border-box;
         -moz-box-sizing: border-box;
         box-sizing: border-box;
+      }
       input[type="radio"],
       input[type="checkbox"] {
         margin: 4px 0 0;
         margin-top: 1px \9;
         line-height: normal;
+      }
       input[type="file"] {
         display: block;
+      }
       input[type="range"] {
         display: block;
         width: 100%;
+      }
       select[multiple],
       select[size] {
         height: auto;
+      }
       input[type="file"]:focus,
       input[type="radio"]:focus,
       input[type="checkbox"]:focus {
         outline: 5px auto -webkit-focus-ring-color;
         outline-offset: -2px;
+      }
       output {
         display: block;
         padding-top: 7px;
         font-size: 13px;
         line-height: 1.42857143;
         color: #555555;
+      }
       .form-control {
         display: block;
         width: 100%;
         height: 32px;
         padding: 6px 12px;
         font-size: 13px;
         line-height: 1.42857143;
         color: #555555;
         background-color: #fff;
         background-image: none;
         border: 1px solid #ccc;
         border-radius: 2px;
         -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
         box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
         -webkit-transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s;
         -o-transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s;
         transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s;
+      }
       .form-control:focus {
         border-color: #66afe9;
         outline: 0;
         -webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 8px rgba(102, 175, 233, 0.6);
         box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 8px rgba(102, 175, 233, 0.6);
+      }
       .form-control::-moz-placeholder {
         color: #999;
         opacity: 1;
+      }
       .form-control:-ms-input-placeholder {
         color: #999;
+      }
       .form-control::-webkit-input-placeholder {
         color: #999;
+      }
       .form-control::-ms-expand {
         border: 0;
         background-color: transparent;
+      }
       .form-control[disabled],
       .form-control[readonly],
       fieldset[disabled] .form-control {
         background-color: #eeeeee;
         opacity: 1;
+      }
       .form-control[disabled],
       fieldset[disabled] .form-control {
         cursor: not-allowed;
+      }
       textarea.form-control {
         height: auto;
+      }
       input[type="search"] {
         -webkit-appearance: none;
+      }
       @media screen and (-webkit-min-device-pixel-ratio: 0) {
         input[type="date"].form-control,
         input[type="time"].form-control,
         input[type="datetime-local"].form-control,
         input[type="month"].form-control {
           line-height: 32px;
+        }
         input[type="date"].input-sm,
         input[type="time"].input-sm,
         input[type="datetime-local"].input-sm,
         input[type="month"].input-sm,
         .input-group-sm input[type="date"],
         .input-group-sm input[type="time"],
         .input-group-sm input[type="datetime-local"],
         .input-group-sm input[type="month"] {
           line-height: 30px;
+        }
         input[type="date"].input-lg,
         input[type="time"].input-lg,
         input[type="datetime-local"].input-lg,
         input[type="month"].input-lg,
         .input-group-lg input[type="date"],
         .input-group-lg input[type="time"],
         .input-group-lg input[type="datetime-local"],
         .input-group-lg input[type="month"] {
           line-height: 45px;
+        }
+      }
       .form-group {
         margin-bottom: 15px;
+      }
       .radio,
       .checkbox {
         position: relative;
         display: block;
         margin-top: 10px;
         margin-bottom: 10px;
+      }
       .radio label,
       .checkbox label {
         min-height: 18px;
         padding-left: 20px;
         margin-bottom: 0;
         font-weight: normal;
         cursor: pointer;
+      }
       .radio input[type="radio"],
       .radio-inline input[type="radio"],
       .checkbox input[type="checkbox"],
       .checkbox-inline input[type="checkbox"] {
         position: absolute;
         margin-left: -20px;
         margin-top: 4px \9;
+      }
       .radio + .radio,
       .checkbox + .checkbox {
         margin-top: -5px;
+      }
       .radio-inline,
       .checkbox-inline {
         position: relative;
         display: inline-block;
         padding-left: 20px;
         margin-bottom: 0;
         vertical-align: middle;
         font-weight: normal;
         cursor: pointer;
+      }
       .radio-inline + .radio-inline,
       .checkbox-inline + .checkbox-inline {
         margin-top: 0;
         margin-left: 10px;
+      }
       input[type="radio"][disabled],
       input[type="checkbox"][disabled],
       input[type="radio"].disabled,
       input[type="checkbox"].disabled,
       fieldset[disabled] input[type="radio"],
       fieldset[disabled] input[type="checkbox"] {
         cursor: not-allowed;
+      }
       .radio-inline.disabled,
       .checkbox-inline.disabled,
       fieldset[disabled] .radio-inline,
       fieldset[disabled] .checkbox-inline {
         cursor: not-allowed;
+      }
       .radio.disabled label,
       .checkbox.disabled label,
       fieldset[disabled] .radio label,
       fieldset[disabled] .checkbox label {
         cursor: not-allowed;
+      }
       .form-control-static {
         padding-top: 7px;
         padding-bottom: 7px;
         margin-bottom: 0;
         min-height: 31px;
+      }
       .form-control-static.input-lg,
       .form-control-static.input-sm {
         padding-left: 0;
         padding-right: 0;
+      }
       .input-sm {
         height: 30px;
         padding: 5px 10px;
         font-size: 12px;
         line-height: 1.5;
         border-radius: 1px;
+      }
       select.input-sm {
         height: 30px;
         line-height: 30px;
+      }
       textarea.input-sm,
       select[multiple].input-sm {
         height: auto;
+      }
       .form-group-sm .form-control {
         height: 30px;
         padding: 5px 10px;
         font-size: 12px;
         line-height: 1.5;
         border-radius: 1px;
+      }
       .form-group-sm select.form-control {
         height: 30px;
         line-height: 30px;
+      }
       .form-group-sm textarea.form-control,
       .form-group-sm select[multiple].form-control {
         height: auto;
+      }
       .form-group-sm .form-control-static {
         height: 30px;
         min-height: 30px;
         padding: 6px 10px;
         font-size: 12px;
         line-height: 1.5;
+      }
       .input-lg {
         height: 45px;
         padding: 10px 16px;
         font-size: 17px;
         line-height: 1.3333333;
         border-radius: 3px;
+      }
       select.input-lg {
         height: 45px;
         line-height: 45px;
+      }
       textarea.input-lg,
       select[multiple].input-lg {
         height: auto;
+      }
       .form-group-lg .form-control {
         height: 45px;
         padding: 10px 16px;
         font-size: 17px;
         line-height: 1.3333333;
         border-radius: 3px;
+      }
       .form-group-lg select.form-control {
         height: 45px;
         line-height: 45px;
+      }
       .form-group-lg textarea.form-control,
       .form-group-lg select[multiple].form-control {
         height: auto;
+      }
       .form-group-lg .form-control-static {
         height: 45px;
         min-height: 35px;
         padding: 11px 16px;
         font-size: 17px;
         line-height: 1.3333333;
+      }
       .has-feedback {
         position: relative;
+      }
       .has-feedback .form-control {
         padding-right: 40px;
+      }
       .form-control-feedback {
         position: absolute;
         top: 0;
         right: 0;
         z-index: 2;
         display: block;
         width: 32px;
         height: 32px;
         line-height: 32px;
         text-align: center;
         pointer-events: none;
+      }
       .input-lg + .form-control-feedback,
       .input-group-lg + .form-control-feedback,
       .form-group-lg .form-control + .form-control-feedback {
         width: 45px;
         height: 45px;
         line-height: 45px;
+      }
       .input-sm + .form-control-feedback,
       .input-group-sm + .form-control-feedback,
       .form-group-sm .form-control + .form-control-feedback {
         width: 30px;
         height: 30px;
         line-height: 30px;
+      }
       .has-success .help-block,
       .has-success .control-label,
       .has-success .radio,
       .has-success .checkbox,
       .has-success .radio-inline,
       .has-success .checkbox-inline,
       .has-success.radio label,
       .has-success.checkbox label,
       .has-success.radio-inline label,
       .has-success.checkbox-inline label {
         color: #3c763d;
+      }
       .has-success .form-control {
         border-color: #3c763d;
         -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
         box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
+      }
       .has-success .form-control:focus {
         border-color: #2b542c;
         -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #67b168;
         box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #67b168;
+      }
       .has-success .input-group-addon {
         color: #3c763d;
         border-color: #3c763d;
         background-color: #dff0d8;
+      }
       .has-success .form-control-feedback {
         color: #3c763d;
+      }
       .has-warning .help-block,
       .has-warning .control-label,
       .has-warning .radio,
       .has-warning .checkbox,
       .has-warning .radio-inline,
       .has-warning .checkbox-inline,
       .has-warning.radio label,
       .has-warning.checkbox label,
       .has-warning.radio-inline label,
       .has-warning.checkbox-inline label {
         color: #8a6d3b;
+      }
       .has-warning .form-control {
         border-color: #8a6d3b;
         -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
         box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
+      }
       .has-warning .form-control:focus {
         border-color: #66512c;
         -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #c0a16b;
         box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #c0a16b;
+      }
       .has-warning .input-group-addon {
         color: #8a6d3b;
         border-color: #8a6d3b;
         background-color: #fcf8e3;
+      }
       .has-warning .form-control-feedback {
         color: #8a6d3b;
+      }
       .has-error .help-block,
       .has-error .control-label,
       .has-error .radio,
       .has-error .checkbox,
       .has-error .radio-inline,
       .has-error .checkbox-inline,
       .has-error.radio label,
       .has-error.checkbox label,
       .has-error.radio-inline label,
       .has-error.checkbox-inline label {
         color: #a94442;
+      }
       .has-error .form-control {
         border-color: #a94442;
         -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
         box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
+      }
       .has-error .form-control:focus {
         border-color: #843534;
         -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #ce8483;
         box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 6px #ce8483;
+      }
       .has-error .input-group-addon {
         color: #a94442;
         border-color: #a94442;
         background-color: #f2dede;
+      }
       .has-error .form-control-feedback {
         color: #a94442;
+      }
       .has-feedback label ~ .form-control-feedback {
         top: 23px;
+      }
       .has-feedback label.sr-only ~ .form-control-feedback {
         top: 0;
+      }
       .help-block {
         display: block;
         margin-top: 5px;
         margin-bottom: 10px;
         color: #404040;
+      }
       @media (min-width: 768px) {
         .form-inline .form-group {
           display: inline-block;
           margin-bottom: 0;
           vertical-align: middle;
+        }
         .form-inline .form-control {
           display: inline-block;
           width: auto;
           vertical-align: middle;
+        }
         .form-inline .form-control-static {
           display: inline-block;
+        }
         .form-inline .input-group {
           display: inline-table;
           vertical-align: middle;
+        }
         .form-inline .input-group .input-group-addon,
         .form-inline .input-group .input-group-btn,
         .form-inline .input-group .form-control {
           width: auto;
+        }
         .form-inline .input-group > .form-control {
           width: 100%;
+        }
         .form-inline .control-label {
           margin-bottom: 0;
           vertical-align: middle;
+        }
         .form-inline .radio,
         .form-inline .checkbox {
           display: inline-block;
           margin-top: 0;
           margin-bottom: 0;
           vertical-align: middle;
+        }
         .form-inline .radio label,
         .form-inline .checkbox label {
           padding-left: 0;
+        }
         .form-inline .radio input[type="radio"],
         .form-inline .checkbox input[type="checkbox"] {
           position: relative;
           margin-left: 0;
+        }
         .form-inline .has-feedback .form-control-feedback {
           top: 0;
+        }
+      }
       .form-horizontal .radio,
       .form-horizontal .checkbox,
       .form-horizontal .radio-inline,
       .form-horizontal .checkbox-inline {
         margin-top: 0;
         margin-bottom: 0;
         padding-top: 7px;
+      }
       .form-horizontal .radio,
       .form-horizontal .checkbox {
         min-height: 25px;
+      }
       .form-horizontal .form-group {
         margin-left: 0px;
         margin-right: 0px;
+      }
       @media (min-width: 768px) {
         .form-horizontal .control-label {
           text-align: right;
           margin-bottom: 0;
           padding-top: 7px;
+        }
+      }
       .form-horizontal .has-feedback .form-control-feedback {
         right: 0px;
+      }
       @media (min-width: 768px) {
         .form-horizontal .form-group-lg .control-label {
           padding-top: 11px;
           font-size: 17px;
+        }
+      }
       @media (min-width: 768px) {
         .form-horizontal .form-group-sm .control-label {
           padding-top: 6px;
           font-size: 12px;
+        }
+      }
       .btn {
         display: inline-block;
         margin-bottom: 0;
         font-weight: normal;
         text-align: center;
         vertical-align: middle;
         touch-action: manipulation;
         cursor: pointer;
         background-image: none;
         border: 1px solid transparent;
         white-space: nowrap;
         padding: 6px 12px;
         font-size: 13px;
         line-height: 1.42857143;
         border-radius: 2px;
         -webkit-user-select: none;
         -moz-user-select: none;
         -ms-user-select: none;
         user-select: none;
+      }
       .btn:focus,
       .btn:active:focus,
       .btn.active:focus,
       .btn.focus,
       .btn:active.focus,
       .btn.active.focus {
         outline: 5px auto -webkit-focus-ring-color;
         outline-offset: -2px;
+      }
       .btn:hover,
       .btn:focus,
       .btn.focus {
         color: #333;
         text-decoration: none;
+      }
       .btn:active,
       .btn.active {
         outline: 0;
         background-image: none;
         -webkit-box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
         box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
+      }
       .btn.disabled,
       .btn[disabled],
       fieldset[disabled] .btn {
         cursor: not-allowed;
         opacity: 0.65;
         filter: alpha(opacity=65);
         -webkit-box-shadow: none;
         box-shadow: none;
+      }
       a.btn.disabled,
       fieldset[disabled] a.btn {
         pointer-events: none;
+      }
       .btn-default {
         color: #333;
         background-color: #fff;
         border-color: #ccc;
+      }
       .btn-default:focus,
       .btn-default.focus {
         color: #333;
         background-color: #e6e6e6;
         border-color: #8c8c8c;
+      }
       .btn-default:hover {
         color: #333;
         background-color: #e6e6e6;
         border-color: #adadad;
+      }
       .btn-default:active,
       .btn-default.active,
       .open > .dropdown-toggle.btn-default {
         color: #333;
         background-color: #e6e6e6;
         border-color: #adadad;
+      }
       .btn-default:active:hover,
       .btn-default.active:hover,
       .open > .dropdown-toggle.btn-default:hover,
       .btn-default:active:focus,
       .btn-default.active:focus,
       .open > .dropdown-toggle.btn-default:focus,
       .btn-default:active.focus,
       .btn-default.active.focus,
       .open > .dropdown-toggle.btn-default.focus {
         color: #333;
         background-color: #d4d4d4;
         border-color: #8c8c8c;
+      }
       .btn-default:active,
       .btn-default.active,
       .open > .dropdown-toggle.btn-default {
         background-image: none;
+      }
       .btn-default.disabled:hover,
       .btn-default[disabled]:hover,
       fieldset[disabled] .btn-default:hover,
       .btn-default.disabled:focus,
       .btn-default[disabled]:focus,
       fieldset[disabled] .btn-default:focus,
       .btn-default.disabled.focus,
       .btn-default[disabled].focus,
       fieldset[disabled] .btn-default.focus {
         background-color: #fff;
         border-color: #ccc;
+      }
       .btn-default .badge {
         color: #fff;
         background-color: #333;
+      }
       .btn-primary {
         color: #fff;
         background-color: #337ab7;
         border-color: #2e6da4;
+      }
       .btn-primary:focus,
       .btn-primary.focus {
         color: #fff;
         background-color: #286090;
         border-color: #122b40;
+      }
       .btn-primary:hover {
         color: #fff;
         background-color: #286090;
         border-color: #204d74;
+      }
       .btn-primary:active,
       .btn-primary.active,
       .open > .dropdown-toggle.btn-primary {
         color: #fff;
         background-color: #286090;
         border-color: #204d74;
+      }
       .btn-primary:active:hover,
       .btn-primary.active:hover,
       .open > .dropdown-toggle.btn-primary:hover,
       .btn-primary:active:focus,
       .btn-primary.active:focus,
       .open > .dropdown-toggle.btn-primary:focus,
       .btn-primary:active.focus,
       .btn-primary.active.focus,
       .open > .dropdown-toggle.btn-primary.focus {
         color: #fff;
         background-color: #204d74;
         border-color: #122b40;
+      }
       .btn-primary:active,
       .btn-primary.active,
       .open > .dropdown-toggle.btn-primary {
         background-image: none;
+      }
       .btn-primary.disabled:hover,
       .btn-primary[disabled]:hover,
       fieldset[disabled] .btn-primary:hover,
       .btn-primary.disabled:focus,
       .btn-primary[disabled]:focus,
       fieldset[disabled] .btn-primary:focus,
       .btn-primary.disabled.focus,
       .btn-primary[disabled].focus,
       fieldset[disabled] .btn-primary.focus {
         background-color: #337ab7;
         border-color: #2e6da4;
+      }
       .btn-primary .badge {
         color: #337ab7;
         background-color: #fff;
+      }
       .btn-success {
         color: #fff;
         background-color: #5cb85c;
         border-color: #4cae4c;
+      }
       .btn-success:focus,
       .btn-success.focus {
         color: #fff;
         background-color: #449d44;
         border-color: #255625;
+      }
       .btn-success:hover {
         color: #fff;
         background-color: #449d44;
         border-color: #398439;
+      }
       .btn-success:active,
       .btn-success.active,
       .open > .dropdown-toggle.btn-success {
         color: #fff;
         background-color: #449d44;
         border-color: #398439;
+      }
       .btn-success:active:hover,
       .btn-success.active:hover,
       .open > .dropdown-toggle.btn-success:hover,
       .btn-success:active:focus,
       .btn-success.active:focus,
       .open > .dropdown-toggle.btn-success:focus,
       .btn-success:active.focus,
       .btn-success.active.focus,
       .open > .dropdown-toggle.btn-success.focus {
         color: #fff;
         background-color: #398439;
         border-color: #255625;
+      }
       .btn-success:active,
       .btn-success.active,
       .open > .dropdown-toggle.btn-success {
         background-image: none;
+      }
       .btn-success.disabled:hover,
       .btn-success[disabled]:hover,
       fieldset[disabled] .btn-success:hover,
       .btn-success.disabled:focus,
       .btn-success[disabled]:focus,
       fieldset[disabled] .btn-success:focus,
       .btn-success.disabled.focus,
       .btn-success[disabled].focus,
       fieldset[disabled] .btn-success.focus {
         background-color: #5cb85c;
         border-color: #4cae4c;
+      }
       .btn-success .badge {
         color: #5cb85c;
         background-color: #fff;
+      }
       .btn-info {
         color: #fff;
         background-color: #5bc0de;
         border-color: #46b8da;
+      }
       .btn-info:focus,
       .btn-info.focus {
         color: #fff;
         background-color: #31b0d5;
         border-color: #1b6d85;
+      }
       .btn-info:hover {
         color: #fff;
         background-color: #31b0d5;
         border-color: #269abc;
+      }
       .btn-info:active,
       .btn-info.active,
       .open > .dropdown-toggle.btn-info {
         color: #fff;
         background-color: #31b0d5;
         border-color: #269abc;
+      }
       .btn-info:active:hover,
       .btn-info.active:hover,
       .open > .dropdown-toggle.btn-info:hover,
       .btn-info:active:focus,
       .btn-info.active:focus,
       .open > .dropdown-toggle.btn-info:focus,
       .btn-info:active.focus,
       .btn-info.active.focus,
       .open > .dropdown-toggle.btn-info.focus {
         color: #fff;
         background-color: #269abc;
         border-color: #1b6d85;
+      }
       .btn-info:active,
       .btn-info.active,
       .open > .dropdown-toggle.btn-info {
         background-image: none;
+      }
       .btn-info.disabled:hover,
       .btn-info[disabled]:hover,
       fieldset[disabled] .btn-info:hover,
       .btn-info.disabled:focus,
       .btn-info[disabled]:focus,
       fieldset[disabled] .btn-info:focus,
       .btn-info.disabled.focus,
       .btn-info[disabled].focus,
       fieldset[disabled] .btn-info.focus {
         background-color: #5bc0de;
         border-color: #46b8da;
+      }
       .btn-info .badge {
         color: #5bc0de;
         background-color: #fff;
+      }
       .btn-warning {
         color: #fff;
         background-color: #f0ad4e;
         border-color: #eea236;
+      }
       .btn-warning:focus,
       .btn-warning.focus {
         color: #fff;
         background-color: #ec971f;
         border-color: #985f0d;
+      }
       .btn-warning:hover {
         color: #fff;
         background-color: #ec971f;
         border-color: #d58512;
+      }
       .btn-warning:active,
       .btn-warning.active,
       .open > .dropdown-toggle.btn-warning {
         color: #fff;
         background-color: #ec971f;
         border-color: #d58512;
+      }
       .btn-warning:active:hover,
       .btn-warning.active:hover,
       .open > .dropdown-toggle.btn-warning:hover,
       .btn-warning:active:focus,
       .btn-warning.active:focus,
       .open > .dropdown-toggle.btn-warning:focus,
       .btn-warning:active.focus,
       .btn-warning.active.focus,
       .open > .dropdown-toggle.btn-warning.focus {
         color: #fff;
         background-color: #d58512;
         border-color: #985f0d;
+      }
       .btn-warning:active,
       .btn-warning.active,
       .open > .dropdown-toggle.btn-warning {
         background-image: none;
+      }
       .btn-warning.disabled:hover,
       .btn-warning[disabled]:hover,
       fieldset[disabled] .btn-warning:hover,
       .btn-warning.disabled:focus,
       .btn-warning[disabled]:focus,
       fieldset[disabled] .btn-warning:focus,
       .btn-warning.disabled.focus,
       .btn-warning[disabled].focus,
       fieldset[disabled] .btn-warning.focus {
         background-color: #f0ad4e;
         border-color: #eea236;
+      }
       .btn-warning .badge {
         color: #f0ad4e;
         background-color: #fff;
+      }
       .btn-danger {
         color: #fff;
         background-color: #d9534f;
         border-color: #d43f3a;
+      }
       .btn-danger:focus,
       .btn-danger.focus {
         color: #fff;
         background-color: #c9302c;
         border-color: #761c19;
+      }
       .btn-danger:hover {
         color: #fff;
         background-color: #c9302c;
         border-color: #ac2925;
+      }
       .btn-danger:active,
       .btn-danger.active,
       .open > .dropdown-toggle.btn-danger {
         color: #fff;
         background-color: #c9302c;
         border-color: #ac2925;
+      }
       .btn-danger:active:hover,
       .btn-danger.active:hover,
       .open > .dropdown-toggle.btn-danger:hover,
       .btn-danger:active:focus,
       .btn-danger.active:focus,
       .open > .dropdown-toggle.btn-danger:focus,
       .btn-danger:active.focus,
       .btn-danger.active.focus,
       .open > .dropdown-toggle.btn-danger.focus {
         color: #fff;
         background-color: #ac2925;
         border-color: #761c19;
+      }
       .btn-danger:active,
       .btn-danger.active,
       .open > .dropdown-toggle.btn-danger {
         background-image: none;
+      }
       .btn-danger.disabled:hover,
       .btn-danger[disabled]:hover,
       fieldset[disabled] .btn-danger:hover,
       .btn-danger.disabled:focus,
       .btn-danger[disabled]:focus,
       fieldset[disabled] .btn-danger:focus,
       .btn-danger.disabled.focus,
       .btn-danger[disabled].focus,
       fieldset[disabled] .btn-danger.focus {
         background-color: #d9534f;
         border-color: #d43f3a;
+      }
       .btn-danger .badge {
         color: #d9534f;
         background-color: #fff;
+      }
       .btn-link {
         color: #337ab7;
         font-weight: normal;
         border-radius: 0;
+      }
       .btn-link,
       .btn-link:active,
       .btn-link.active,
       .btn-link[disabled],
       fieldset[disabled] .btn-link {
         background-color: transparent;
         -webkit-box-shadow: none;
         box-shadow: none;
+      }
       .btn-link,
       .btn-link:hover,
       .btn-link:focus,
       .btn-link:active {
         border-color: transparent;
+      }
       .btn-link:hover,
       .btn-link:focus {
         color: #23527c;
         text-decoration: underline;
         background-color: transparent;
+      }
       .btn-link[disabled]:hover,
       fieldset[disabled] .btn-link:hover,
       .btn-link[disabled]:focus,
       fieldset[disabled] .btn-link:focus {
         color: #777777;
         text-decoration: none;
+      }
       .btn-lg,
       .btn-group-lg > .btn {
         padding: 10px 16px;
         font-size: 17px;
         line-height: 1.3333333;
         border-radius: 3px;
+      }
       .btn-sm,
       .btn-group-sm > .btn {
         padding: 5px 10px;
         font-size: 12px;
         line-height: 1.5;
         border-radius: 1px;
+      }
       .btn-xs,
       .btn-group-xs > .btn {
         padding: 1px 5px;
         font-size: 12px;
         line-height: 1.5;
         border-radius: 1px;
+      }
       .btn-block {
         display: block;
         width: 100%;
+      }
       .btn-block + .btn-block {
         margin-top: 5px;
+      }
       input[type="submit"].btn-block,
       input[type="reset"].btn-block,
       input[type="button"].btn-block {
         width: 100%;
+      }
       .fade {
         opacity: 0;
         -webkit-transition: opacity 0.15s linear;
         -o-transition: opacity 0.15s linear;
         transition: opacity 0.15s linear;
+      }
       .fade.in {
         opacity: 1;
+      }
       .collapse {
         display: none;
+      }
       .collapse.in {
         display: block;
+      }
       tr.collapse.in {
         display: table-row;
+      }
       tbody.collapse.in {
         display: table-row-group;
+      }
       .collapsing {
         position: relative;
         height: 0;
         overflow: hidden;
         -webkit-transition-property: height, visibility;
         transition-property: height, visibility;
         -webkit-transition-duration: 0.35s;
         transition-duration: 0.35s;
         -webkit-transition-timing-function: ease;
         transition-timing-function: ease;
+      }
       .caret {
         display: inline-block;
         width: 0;
         height: 0;
         margin-left: 2px;
         vertical-align: middle;
         border-top: 4px dashed;
         border-top: 4px solid \9;
         border-right: 4px solid transparent;
         border-left: 4px solid transparent;
+      }
       .dropup,
       .dropdown {
         position: relative;
+      }
       .dropdown-toggle:focus {
         outline: 0;
+      }
       .dropdown-menu {
         position: absolute;
         top: 100%;
         left: 0;
         z-index: 1000;
         display: none;
         float: left;
         min-width: 160px;
         padding: 5px 0;
         margin: 2px 0 0;
         list-style: none;
         font-size: 13px;
         text-align: left;
         background-color: #fff;
         border: 1px solid #ccc;
         border: 1px solid rgba(0, 0, 0, 0.15);
         border-radius: 2px;
         -webkit-box-shadow: 0 6px 12px rgba(0, 0, 0, 0.175);
         box-shadow: 0 6px 12px rgba(0, 0, 0, 0.175);
         background-clip: padding-box;
+      }
       .dropdown-menu.pull-right {
         right: 0;
         left: auto;
+      }
       .dropdown-menu .divider {
         height: 1px;
         margin: 8px 0;
         overflow: hidden;
         background-color: #e5e5e5;
+      }
       .dropdown-menu > li > a {
         display: block;
         padding: 3px 20px;
         clear: both;
         font-weight: normal;
         line-height: 1.42857143;
         color: #333333;
         white-space: nowrap;
+      }
       .dropdown-menu > li > a:hover,
       .dropdown-menu > li > a:focus {
         text-decoration: none;
         color: #262626;
         background-color: #f5f5f5;
+      }
       .dropdown-menu > .active > a,
       .dropdown-menu > .active > a:hover,
       .dropdown-menu > .active > a:focus {
         color: #fff;
         text-decoration: none;
         outline: 0;
         background-color: #337ab7;
+      }
       .dropdown-menu > .disabled > a,
       .dropdown-menu > .disabled > a:hover,
       .dropdown-menu > .disabled > a:focus {
         color: #777777;
+      }
       .dropdown-menu > .disabled > a:hover,
       .dropdown-menu > .disabled > a:focus {
         text-decoration: none;
         background-color: transparent;
         background-image: none;
         filter: progid:DXImageTransform.Microsoft.gradient(enabled = false);
         cursor: not-allowed;
+      }
       .open > .dropdown-menu {
         display: block;
+      }
       .open > a {
         outline: 0;
+      }
       .dropdown-menu-right {
         left: auto;
         right: 0;
+      }
       .dropdown-menu-left {
         left: 0;
         right: auto;
+      }
       .dropdown-header {
         display: block;
         padding: 3px 20px;
         font-size: 12px;
         line-height: 1.42857143;
         color: #777777;
         white-space: nowrap;
+      }
       .dropdown-backdrop {
         position: fixed;
         left: 0;
         right: 0;
         bottom: 0;
         top: 0;
         z-index: 990;
+      }
       .pull-right > .dropdown-menu {
         right: 0;
         left: auto;
+      }
       .dropup .caret,
       .navbar-fixed-bottom .dropdown .caret {
         border-top: 0;
         border-bottom: 4px dashed;
         border-bottom: 4px solid \9;
         content: "";
+      }
       .dropup .dropdown-menu,
       .navbar-fixed-bottom .dropdown .dropdown-menu {
         top: auto;
         bottom: 100%;
         margin-bottom: 2px;
+      }
       @media (min-width: 541px) {
         .navbar-right .dropdown-menu {
           left: auto;
           right: 0;
+        }
         .navbar-right .dropdown-menu-left {
           left: 0;
           right: auto;
+        }
+      }
       .btn-group,
       .btn-group-vertical {
         position: relative;
         display: inline-block;
         vertical-align: middle;
+      }
       .btn-group > .btn,
       .btn-group-vertical > .btn {
         position: relative;
         float: left;
+      }
       .btn-group > .btn:hover,
       .btn-group-vertical > .btn:hover,
       .btn-group > .btn:focus,
       .btn-group-vertical > .btn:focus,
       .btn-group > .btn:active,
       .btn-group-vertical > .btn:active,
       .btn-group > .btn.active,
       .btn-group-vertical > .btn.active {
         z-index: 2;
+      }
       .btn-group .btn + .btn,
       .btn-group .btn + .btn-group,
       .btn-group .btn-group + .btn,
       .btn-group .btn-group + .btn-group {
         margin-left: -1px;
+      }
       .btn-toolbar {
         margin-left: -5px;
+      }
       .btn-toolbar .btn,
       .btn-toolbar .btn-group,
       .btn-toolbar .input-group {
         float: left;
+      }
       .btn-toolbar > .btn,
       .btn-toolbar > .btn-group,
       .btn-toolbar > .input-group {
         margin-left: 5px;
+      }
       .btn-group > .btn:not(:first-child):not(:last-child):not(.dropdown-toggle) {
         border-radius: 0;
+      }
       .btn-group > .btn:first-child {
         margin-left: 0;
+      }
       .btn-group > .btn:first-child:not(:last-child):not(.dropdown-toggle) {
         border-bottom-right-radius: 0;
         border-top-right-radius: 0;
+      }
       .btn-group > .btn:last-child:not(:first-child),
       .btn-group > .dropdown-toggle:not(:first-child) {
         border-bottom-left-radius: 0;
         border-top-left-radius: 0;
+      }
       .btn-group > .btn-group {
         float: left;
+      }
       .btn-group > .btn-group:not(:first-child):not(:last-child) > .btn {
         border-radius: 0;
+      }
       .btn-group > .btn-group:first-child:not(:last-child) > .btn:last-child,
       .btn-group > .btn-group:first-child:not(:last-child) > .dropdown-toggle {
         border-bottom-right-radius: 0;
         border-top-right-radius: 0;
+      }
       .btn-group > .btn-group:last-child:not(:first-child) > .btn:first-child {
         border-bottom-left-radius: 0;
         border-top-left-radius: 0;
+      }
       .btn-group .dropdown-toggle:active,
       .btn-group.open .dropdown-toggle {
         outline: 0;
+      }
       .btn-group > .btn + .dropdown-toggle {
         padding-left: 8px;
         padding-right: 8px;
+      }
       .btn-group > .btn-lg + .dropdown-toggle {
         padding-left: 12px;
         padding-right: 12px;
+      }
       .btn-group.open .dropdown-toggle {
         -webkit-box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
         box-shadow: inset 0 3px 5px rgba(0, 0, 0, 0.125);
+      }
       .btn-group.open .dropdown-toggle.btn-link {
         -webkit-box-shadow: none;
         box-shadow: none;
+      }
       .btn .caret {
         margin-left: 0;
+      }
       .btn-lg .caret {
         border-width: 5px 5px 0;
         border-bottom-width: 0;
+      }
       .dropup .btn-lg .caret {
         border-width: 0 5px 5px;
+      }
       .btn-group-vertical > .btn,
       .btn-group-vertical > .btn-group,
       .btn-group-vertical > .btn-group > .btn {
         display: block;
         float: none;
         width: 100%;
         max-width: 100%;
+      }
       .btn-group-vertical > .btn-group > .btn {
         float: none;
+      }
       .btn-group-vertical > .btn + .btn,
       .btn-group-vertical > .btn + .btn-group,
       .btn-group-vertical > .btn-group + .btn,
       .btn-group-vertical > .btn-group + .btn-group {
         margin-top: -1px;
         margin-left: 0;
+      }
       .btn-group-vertical > .btn:not(:first-child):not(:last-child) {
         border-radius: 0;
+      }
       .btn-group-vertical > .btn:first-child:not(:last-child) {
         border-top-right-radius: 2px;
         border-top-left-radius: 2px;
         border-bottom-right-radius: 0;
         border-bottom-left-radius: 0;
+      }
       .btn-group-vertical > .btn:last-child:not(:first-child) {
         border-top-right-radius: 0;
         border-top-left-radius: 0;
         border-bottom-right-radius: 2px;
         border-bottom-left-radius: 2px;
+      }
       .btn-group-vertical > .btn-group:not(:first-child):not(:last-child) > .btn {
         border-radius: 0;
+      }
       .btn-group-vertical > .btn-group:first-child:not(:last-child) > .btn:last-child,
       .btn-group-vertical > .btn-group:first-child:not(:last-child) > .dropdown-toggle {
         border-bottom-right-radius: 0;
         border-bottom-left-radius: 0;
+      }
       .btn-group-vertical > .btn-group:last-child:not(:first-child) > .btn:first-child {
         border-top-right-radius: 0;
         border-top-left-radius: 0;
+      }
       .btn-group-justified {
         display: table;
         width: 100%;
         table-layout: fixed;
         border-collapse: separate;
+      }
       .btn-group-justified > .btn,
       .btn-group-justified > .btn-group {
         float: none;
         display: table-cell;
         width: 1%;
+      }
       .btn-group-justified > .btn-group .btn {
         width: 100%;
+      }
       .btn-group-justified > .btn-group .dropdown-menu {
         left: auto;
+      }
       [data-toggle="buttons"] > .btn input[type="radio"],
       [data-toggle="buttons"] > .btn-group > .btn input[type="radio"],
       [data-toggle="buttons"] > .btn input[type="checkbox"],
       [data-toggle="buttons"] > .btn-group > .btn input[type="checkbox"] {
         position: absolute;
         clip: rect(0, 0, 0, 0);
         pointer-events: none;
+      }
       .input-group {
         position: relative;
         display: table;
         border-collapse: separate;
+      }
       .input-group[class*="col-"] {
         float: none;
         padding-left: 0;
         padding-right: 0;
+      }
       .input-group .form-control {
         position: relative;
         z-index: 2;
         float: left;
         width: 100%;
         margin-bottom: 0;
+      }
       .input-group .form-control:focus {
         z-index: 3;
+      }
       .input-group-lg > .form-control,
       .input-group-lg > .input-group-addon,
       .input-group-lg > .input-group-btn > .btn {
         height: 45px;
         padding: 10px 16px;
         font-size: 17px;
         line-height: 1.3333333;
         border-radius: 3px;
+      }
       select.input-group-lg > .form-control,
       select.input-group-lg > .input-group-addon,
       select.input-group-lg > .input-group-btn > .btn {
         height: 45px;
         line-height: 45px;
+      }
       textarea.input-group-lg > .form-control,
       textarea.input-group-lg > .input-group-addon,
       textarea.input-group-lg > .input-group-btn > .btn,
       select[multiple].input-group-lg > .form-control,
       select[multiple].input-group-lg > .input-group-addon,
       select[multiple].input-group-lg > .input-group-btn > .btn {
         height: auto;
+      }
       .input-group-sm > .form-control,
       .input-group-sm > .input-group-addon,
       .input-group-sm > .input-group-btn > .btn {
         height: 30px;
         padding: 5px 10px;
         font-size: 12px;
         line-height: 1.5;
         border-radius: 1px;
+      }
       select.input-group-sm > .form-control,
       select.input-group-sm > .input-group-addon,
       select.input-group-sm > .input-group-btn > .btn {
         height: 30px;
         line-height: 30px;
+      }
       textarea.input-group-sm > .form-control,
       textarea.input-group-sm > .input-group-addon,
       textarea.input-group-sm > .input-group-btn > .btn,
       select[multiple].input-group-sm > .form-control,
       select[multiple].input-group-sm > .input-group-addon,
       select[multiple].input-group-sm > .input-group-btn > .btn {
         height: auto;
+      }
       .input-group-addon,
       .input-group-btn,
       .input-group .form-control {
         display: table-cell;
+      }
       .input-group-addon:not(:first-child):not(:last-child),
       .input-group-btn:not(:first-child):not(:last-child),
       .input-group .form-control:not(:first-child):not(:last-child) {
         border-radius: 0;
+      }
       .input-group-addon,
       .input-group-btn {
         width: 1%;
         white-space: nowrap;
         vertical-align: middle;
+      }
       .input-group-addon {
         padding: 6px 12px;
         font-size: 13px;
         font-weight: normal;
         line-height: 1;
         color: #555555;
         text-align: center;
         background-color: #eeeeee;
         border: 1px solid #ccc;
         border-radius: 2px;
+      }
       .input-group-addon.input-sm {
         padding: 5px 10px;
         font-size: 12px;
         border-radius: 1px;
+      }
       .input-group-addon.input-lg {
         padding: 10px 16px;
         font-size: 17px;
         border-radius: 3px;
+      }
       .input-group-addon input[type="radio"],
       .input-group-addon input[type="checkbox"] {
         margin-top: 0;
+      }
       .input-group .form-control:first-child,
       .input-group-addon:first-child,
       .input-group-btn:first-child > .btn,
       .input-group-btn:first-child > .btn-group > .btn,
       .input-group-btn:first-child > .dropdown-toggle,
       .input-group-btn:last-child > .btn:not(:last-child):not(.dropdown-toggle),
       .input-group-btn:last-child > .btn-group:not(:last-child) > .btn {
         border-bottom-right-radius: 0;
         border-top-right-radius: 0;
+      }
       .input-group-addon:first-child {
         border-right: 0;
+      }
       .input-group .form-control:last-child,
       .input-group-addon:last-child,
       .input-group-btn:last-child > .btn,
       .input-group-btn:last-child > .btn-group > .btn,
       .input-group-btn:last-child > .dropdown-toggle,
       .input-group-btn:first-child > .btn:not(:first-child),
       .input-group-btn:first-child > .btn-group:not(:first-child) > .btn {
         border-bottom-left-radius: 0;
         border-top-left-radius: 0;
+      }
       .input-group-addon:last-child {
         border-left: 0;
+      }
       .input-group-btn {
         position: relative;
         font-size: 0;
         white-space: nowrap;
+      }
       .input-group-btn > .btn {
         position: relative;
+      }
       .input-group-btn > .btn + .btn {
         margin-left: -1px;
+      }
       .input-group-btn > .btn:hover,
       .input-group-btn > .btn:focus,
       .input-group-btn > .btn:active {
         z-index: 2;
+      }
       .input-group-btn:first-child > .btn,
       .input-group-btn:first-child > .btn-group {
         margin-right: -1px;
+      }
       .input-group-btn:last-child > .btn,
       .input-group-btn:last-child > .btn-group {
         z-index: 2;
         margin-left: -1px;
+      }
       .nav {
         margin-bottom: 0;
         padding-left: 0;
         list-style: none;
+      }
       .nav > li {
         position: relative;
         display: block;
+      }
       .nav > li > a {
         position: relative;
         display: block;
         padding: 10px 15px;
+      }
       .nav > li > a:hover,
       .nav > li > a:focus {
         text-decoration: none;
         background-color: #eeeeee;
+      }
       .nav > li.disabled > a {
         color: #777777;
+      }
       .nav > li.disabled > a:hover,
       .nav > li.disabled > a:focus {
         color: #777777;
         text-decoration: none;
         background-color: transparent;
         cursor: not-allowed;
+      }
       .nav .open > a,
       .nav .open > a:hover,
       .nav .open > a:focus {
         background-color: #eeeeee;
         border-color: #337ab7;
+      }
       .nav .nav-divider {
         height: 1px;
         margin: 8px 0;
         overflow: hidden;
         background-color: #e5e5e5;
+      }
       .nav > li > a > img {
         max-width: none;
+      }
       .nav-tabs {
         border-bottom: 1px solid #ddd;
+      }
       .nav-tabs > li {
         float: left;
         margin-bottom: -1px;
+      }
       .nav-tabs > li > a {
         margin-right: 2px;
         line-height: 1.42857143;
         border: 1px solid transparent;
         border-radius: 2px 2px 0 0;
+      }
       .nav-tabs > li > a:hover {
         border-color: #eeeeee #eeeeee #ddd;
+      }
       .nav-tabs > li.active > a,
       .nav-tabs > li.active > a:hover,
       .nav-tabs > li.active > a:focus {
         color: #555555;
         background-color: #fff;
         border: 1px solid #ddd;
         border-bottom-color: transparent;
         cursor: default;
+      }
       .nav-tabs.nav-justified {
         width: 100%;
         border-bottom: 0;
+      }
       .nav-tabs.nav-justified > li {
         float: none;
+      }
       .nav-tabs.nav-justified > li > a {
         text-align: center;
         margin-bottom: 5px;
+      }
       .nav-tabs.nav-justified > .dropdown .dropdown-menu {
         top: auto;
         left: auto;
+      }
       @media (min-width: 768px) {
         .nav-tabs.nav-justified > li {
           display: table-cell;
           width: 1%;
+        }
         .nav-tabs.nav-justified > li > a {
           margin-bottom: 0;
+        }
+      }
       .nav-tabs.nav-justified > li > a {
         margin-right: 0;
         border-radius: 2px;
+      }
       .nav-tabs.nav-justified > .active > a,
       .nav-tabs.nav-justified > .active > a:hover,
       .nav-tabs.nav-justified > .active > a:focus {
         border: 1px solid #ddd;
+      }
       @media (min-width: 768px) {
         .nav-tabs.nav-justified > li > a {
           border-bottom: 1px solid #ddd;
           border-radius: 2px 2px 0 0;
+        }
         .nav-tabs.nav-justified > .active > a,
         .nav-tabs.nav-justified > .active > a:hover,
         .nav-tabs.nav-justified > .active > a:focus {
           border-bottom-color: #fff;
+        }
+      }
       .nav-pills > li {
         float: left;
+      }
       .nav-pills > li > a {
         border-radius: 2px;
+      }
       .nav-pills > li + li {
         margin-left: 2px;
+      }
       .nav-pills > li.active > a,
       .nav-pills > li.active > a:hover,
       .nav-pills > li.active > a:focus {
         color: #fff;
         background-color: #337ab7;
+      }
       .nav-stacked > li {
         float: none;
+      }
       .nav-stacked > li + li {
         margin-top: 2px;
         margin-left: 0;
+      }
       .nav-justified {
         width: 100%;
+      }
       .nav-justified > li {
         float: none;
+      }
       .nav-justified > li > a {
         text-align: center;
         margin-bottom: 5px;
+      }
       .nav-justified > .dropdown .dropdown-menu {
         top: auto;
         left: auto;
+      }
       @media (min-width: 768px) {
         .nav-justified > li {
           display: table-cell;
           width: 1%;
+        }
         .nav-justified > li > a {
           margin-bottom: 0;
+        }
+      }
       .nav-tabs-justified {
         border-bottom: 0;
+      }
       .nav-tabs-justified > li > a {
         margin-right: 0;
         border-radius: 2px;
+      }
       .nav-tabs-justified > .active > a,
       .nav-tabs-justified > .active > a:hover,
       .nav-tabs-justified > .active > a:focus {
         border: 1px solid #ddd;
+      }
       @media (min-width: 768px) {
         .nav-tabs-justified > li > a {
           border-bottom: 1px solid #ddd;
           border-radius: 2px 2px 0 0;
+        }
         .nav-tabs-justified > .active > a,
         .nav-tabs-justified > .active > a:hover,
         .nav-tabs-justified > .active > a:focus {
           border-bottom-color: #fff;
+        }
+      }
       .tab-content > .tab-pane {
         display: none;
+      }
       .tab-content > .active {
         display: block;
+      }
       .nav-tabs .dropdown-menu {
         margin-top: -1px;
         border-top-right-radius: 0;
         border-top-left-radius: 0;
+      }
       .navbar {
         position: relative;
         min-height: 30px;
         margin-bottom: 18px;
         border: 1px solid transparent;
+      }
       @media (min-width: 541px) {
         .navbar {
           border-radius: 2px;
+        }
+      }
       @media (min-width: 541px) {
         .navbar-header {
           float: left;
+        }
+      }
       .navbar-collapse {
         overflow-x: visible;
         padding-right: 0px;
         padding-left: 0px;
         border-top: 1px solid transparent;
         box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.1);
         -webkit-overflow-scrolling: touch;
+      }
       .navbar-collapse.in {
         overflow-y: auto;
+      }
       @media (min-width: 541px) {
         .navbar-collapse {
           width: auto;
           border-top: 0;
           box-shadow: none;
+        }
         .navbar-collapse.collapse {
           display: block !important;
           height: auto !important;
           padding-bottom: 0;
           overflow: visible !important;
+        }
         .navbar-collapse.in {
           overflow-y: visible;
+        }
         .navbar-fixed-top .navbar-collapse,
         .navbar-static-top .navbar-collapse,
         .navbar-fixed-bottom .navbar-collapse {
           padding-left: 0;
           padding-right: 0;
+        }
+      }
       .navbar-fixed-top .navbar-collapse,
       .navbar-fixed-bottom .navbar-collapse {
         max-height: 340px;
+      }
       @media (max-device-width: 540px) and (orientation: landscape) {
         .navbar-fixed-top .navbar-collapse,
         .navbar-fixed-bottom .navbar-collapse {
           max-height: 200px;
+        }
+      }
       .container > .navbar-header,
       .container-fluid > .navbar-header,
       .container > .navbar-collapse,
       .container-fluid > .navbar-collapse {
         margin-right: 0px;
         margin-left: 0px;
+      }
       @media (min-width: 541px) {
         .container > .navbar-header,
         .container-fluid > .navbar-header,
         .container > .navbar-collapse,
         .container-fluid > .navbar-collapse {
           margin-right: 0;
           margin-left: 0;
+        }
+      }
       .navbar-static-top {
         z-index: 1000;
         border-width: 0 0 1px;
+      }
       @media (min-width: 541px) {
         .navbar-static-top {
           border-radius: 0;
+        }
+      }
       .navbar-fixed-top,
       .navbar-fixed-bottom {
         position: fixed;
         right: 0;
         left: 0;
         z-index: 1030;
+      }
       @media (min-width: 541px) {
         .navbar-fixed-top,
         .navbar-fixed-bottom {
           border-radius: 0;
+        }
+      }
       .navbar-fixed-top {
         top: 0;
         border-width: 0 0 1px;
+      }
       .navbar-fixed-bottom {
         bottom: 0;
         margin-bottom: 0;
         border-width: 1px 0 0;
+      }
       .navbar-brand {
         float: left;
         padding: 6px 0px;
         font-size: 17px;
         line-height: 18px;
         height: 30px;
+      }
       .navbar-brand:hover,
       .navbar-brand:focus {
         text-decoration: none;
+      }
       .navbar-brand > img {
         display: block;
+      }
       @media (min-width: 541px) {
         .navbar > .container .navbar-brand,
         .navbar > .container-fluid .navbar-brand {
           margin-left: 0px;
+        }
+      }
       .navbar-toggle {
         position: relative;
         float: right;
         margin-right: 0px;
         padding: 9px 10px;
         margin-top: -2px;
         margin-bottom: -2px;
         background-color: transparent;
         background-image: none;
         border: 1px solid transparent;
         border-radius: 2px;
+      }
       .navbar-toggle:focus {
         outline: 0;
+      }
       .navbar-toggle .icon-bar {
         display: block;
         width: 22px;
         height: 2px;
         border-radius: 1px;
+      }
       .navbar-toggle .icon-bar + .icon-bar {
         margin-top: 4px;
+      }
       @media (min-width: 541px) {
         .navbar-toggle {
           display: none;
+        }
+      }
       .navbar-nav {
         margin: 3px 0px;
+      }
       .navbar-nav > li > a {
         padding-top: 10px;
         padding-bottom: 10px;
         line-height: 18px;
+      }
       @media (max-width: 540px) {
         .navbar-nav .open .dropdown-menu {
           position: static;
           float: none;
           width: auto;
           margin-top: 0;
           background-color: transparent;
           border: 0;
           box-shadow: none;
+        }
         .navbar-nav .open .dropdown-menu > li > a,
         .navbar-nav .open .dropdown-menu .dropdown-header {
           padding: 5px 15px 5px 25px;
+        }
         .navbar-nav .open .dropdown-menu > li > a {
           line-height: 18px;
+        }
         .navbar-nav .open .dropdown-menu > li > a:hover,
         .navbar-nav .open .dropdown-menu > li > a:focus {
           background-image: none;
+        }
+      }
       @media (min-width: 541px) {
         .navbar-nav {
           float: left;
           margin: 0;
+        }
         .navbar-nav > li {
           float: left;
+        }
         .navbar-nav > li > a {
           padding-top: 6px;
           padding-bottom: 6px;
+        }
+      }
       .navbar-form {
         margin-left: 0px;
         margin-right: 0px;
         padding: 10px 0px;
         border-top: 1px solid transparent;
         border-bottom: 1px solid transparent;
         -webkit-box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.1), 0 1px 0 rgba(255, 255, 255, 0.1);
         box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.1), 0 1px 0 rgba(255, 255, 255, 0.1);
         margin-top: -1px;
         margin-bottom: -1px;
+      }
       @media (min-width: 768px) {
         .navbar-form .form-group {
           display: inline-block;
           margin-bottom: 0;
           vertical-align: middle;
+        }
         .navbar-form .form-control {
           display: inline-block;
           width: auto;
           vertical-align: middle;
+        }
         .navbar-form .form-control-static {
           display: inline-block;
+        }
         .navbar-form .input-group {
           display: inline-table;
           vertical-align: middle;
+        }
         .navbar-form .input-group .input-group-addon,
         .navbar-form .input-group .input-group-btn,
         .navbar-form .input-group .form-control {
           width: auto;
+        }
         .navbar-form .input-group > .form-control {
           width: 100%;
+        }
         .navbar-form .control-label {
           margin-bottom: 0;
           vertical-align: middle;
+        }
         .navbar-form .radio,
         .navbar-form .checkbox {
           display: inline-block;
           margin-top: 0;
           margin-bottom: 0;
           vertical-align: middle;
+        }
         .navbar-form .radio label,
         .navbar-form .checkbox label {
           padding-left: 0;
+        }
         .navbar-form .radio input[type="radio"],
         .navbar-form .checkbox input[type="checkbox"] {
           position: relative;
           margin-left: 0;
+        }
         .navbar-form .has-feedback .form-control-feedback {
           top: 0;
+        }
+      }
       @media (max-width: 540px) {
         .navbar-form .form-group {
           margin-bottom: 5px;
+        }
         .navbar-form .form-group:last-child {
           margin-bottom: 0;
+        }
+      }
       @media (min-width: 541px) {
         .navbar-form {
           width: auto;
           border: 0;
           margin-left: 0;
           margin-right: 0;
           padding-top: 0;
           padding-bottom: 0;
           -webkit-box-shadow: none;
           box-shadow: none;
+        }
+      }
       .navbar-nav > li > .dropdown-menu {
         margin-top: 0;
         border-top-right-radius: 0;
         border-top-left-radius: 0;
+      }
       .navbar-fixed-bottom .navbar-nav > li > .dropdown-menu {
         margin-bottom: 0;
         border-top-right-radius: 2px;
         border-top-left-radius: 2px;
         border-bottom-right-radius: 0;
         border-bottom-left-radius: 0;
+      }
       .navbar-btn {
         margin-top: -1px;
         margin-bottom: -1px;
+      }
       .navbar-btn.btn-sm {
         margin-top: 0px;
         margin-bottom: 0px;
+      }
       .navbar-btn.btn-xs {
         margin-top: 4px;
         margin-bottom: 4px;
+      }
       .navbar-text {
         margin-top: 6px;
         margin-bottom: 6px;
+      }
       @media (min-width: 541px) {
         .navbar-text {
           float: left;
           margin-left: 0px;
           margin-right: 0px;
+        }
+      }
       @media (min-width: 541px) {
         .navbar-left {
           float: left !important;
           float: left;
+        }
         .navbar-right {
           float: right !important;
           float: right;
           margin-right: 0px;
+        }
         .navbar-right ~ .navbar-right {
           margin-right: 0;
+        }
+      }
       .navbar-default {
         background-color: #f8f8f8;
         border-color: #e7e7e7;
+      }
       .navbar-default .navbar-brand {
         color: #777;
+      }
       .navbar-default .navbar-brand:hover,
       .navbar-default .navbar-brand:focus {
         color: #5e5e5e;
         background-color: transparent;
+      }
       .navbar-default .navbar-text {
         color: #777;
+      }
       .navbar-default .navbar-nav > li > a {
         color: #777;
+      }
       .navbar-default .navbar-nav > li > a:hover,
       .navbar-default .navbar-nav > li > a:focus {
         color: #333;
         background-color: transparent;
+      }
       .navbar-default .navbar-nav > .active > a,
       .navbar-default .navbar-nav > .active > a:hover,
       .navbar-default .navbar-nav > .active > a:focus {
         color: #555;
         background-color: #e7e7e7;
+      }
       .navbar-default .navbar-nav > .disabled > a,
       .navbar-default .navbar-nav > .disabled > a:hover,
       .navbar-default .navbar-nav > .disabled > a:focus {
         color: #ccc;
         background-color: transparent;
+      }
       .navbar-default .navbar-toggle {
         border-color: #ddd;
+      }
       .navbar-default .navbar-toggle:hover,
       .navbar-default .navbar-toggle:focus {
         background-color: #ddd;
+      }
       .navbar-default .navbar-toggle .icon-bar {
         background-color: #888;
+      }
       .navbar-default .navbar-collapse,
       .navbar-default .navbar-form {
         border-color: #e7e7e7;
+      }
       .navbar-default .navbar-nav > .open > a,
       .navbar-default .navbar-nav > .open > a:hover,
       .navbar-default .navbar-nav > .open > a:focus {
         background-color: #e7e7e7;
         color: #555;
+      }
       @media (max-width: 540px) {
         .navbar-default .navbar-nav .open .dropdown-menu > li > a {
           color: #777;
+        }
         .navbar-default .navbar-nav .open .dropdown-menu > li > a:hover,
         .navbar-default .navbar-nav .open .dropdown-menu > li > a:focus {
           color: #333;
           background-color: transparent;
+        }
         .navbar-default .navbar-nav .open .dropdown-menu > .active > a,
         .navbar-default .navbar-nav .open .dropdown-menu > .active > a:hover,
         .navbar-default .navbar-nav .open .dropdown-menu > .active > a:focus {
           color: #555;
           background-color: #e7e7e7;
+        }
         .navbar-default .navbar-nav .open .dropdown-menu > .disabled > a,
         .navbar-default .navbar-nav .open .dropdown-menu > .disabled > a:hover,
         .navbar-default .navbar-nav .open .dropdown-menu > .disabled > a:focus {
           color: #ccc;
           background-color: transparent;
+        }
+      }
       .navbar-default .navbar-link {
         color: #777;
+      }
       .navbar-default .navbar-link:hover {
         color: #333;
+      }
       .navbar-default .btn-link {
         color: #777;
+      }
       .navbar-default .btn-link:hover,
       .navbar-default .btn-link:focus {
         color: #333;
+      }
       .navbar-default .btn-link[disabled]:hover,
       fieldset[disabled] .navbar-default .btn-link:hover,
       .navbar-default .btn-link[disabled]:focus,
       fieldset[disabled] .navbar-default .btn-link:focus {
         color: #ccc;
+      }
       .navbar-inverse {
         background-color: #222;
         border-color: #080808;
+      }
       .navbar-inverse .navbar-brand {
         color: #9d9d9d;
+      }
       .navbar-inverse .navbar-brand:hover,
       .navbar-inverse .navbar-brand:focus {
         color: #fff;
         background-color: transparent;
+      }
       .navbar-inverse .navbar-text {
         color: #9d9d9d;
+      }
       .navbar-inverse .navbar-nav > li > a {
         color: #9d9d9d;
+      }
       .navbar-inverse .navbar-nav > li > a:hover,
       .navbar-inverse .navbar-nav > li > a:focus {
         color: #fff;
         background-color: transparent;
+      }
       .navbar-inverse .navbar-nav > .active > a,
       .navbar-inverse .navbar-nav > .active > a:hover,
       .navbar-inverse .navbar-nav > .active > a:focus {
         color: #fff;
         background-color: #080808;
+      }
       .navbar-inverse .navbar-nav > .disabled > a,
       .navbar-inverse .navbar-nav > .disabled > a:hover,
       .navbar-inverse .navbar-nav > .disabled > a:focus {
         color: #444;
         background-color: transparent;
+      }
       .navbar-inverse .navbar-toggle {
         border-color: #333;
+      }
       .navbar-inverse .navbar-toggle:hover,
       .navbar-inverse .navbar-toggle:focus {
         background-color: #333;
+      }
       .navbar-inverse .navbar-toggle .icon-bar {
         background-color: #fff;
+      }
       .navbar-inverse .navbar-collapse,
       .navbar-inverse .navbar-form {
         border-color: #101010;
+      }
       .navbar-inverse .navbar-nav > .open > a,
       .navbar-inverse .navbar-nav > .open > a:hover,
       .navbar-inverse .navbar-nav > .open > a:focus {
         background-color: #080808;
         color: #fff;
+      }
       @media (max-width: 540px) {
         .navbar-inverse .navbar-nav .open .dropdown-menu > .dropdown-header {
           border-color: #080808;
+        }
         .navbar-inverse .navbar-nav .open .dropdown-menu .divider {
           background-color: #080808;
+        }
         .navbar-inverse .navbar-nav .open .dropdown-menu > li > a {
           color: #9d9d9d;
+        }
         .navbar-inverse .navbar-nav .open .dropdown-menu > li > a:hover,
         .navbar-inverse .navbar-nav .open .dropdown-menu > li > a:focus {
           color: #fff;
           background-color: transparent;
+        }
         .navbar-inverse .navbar-nav .open .dropdown-menu > .active > a,
         .navbar-inverse .navbar-nav .open .dropdown-menu > .active > a:hover,
         .navbar-inverse .navbar-nav .open .dropdown-menu > .active > a:focus {
           color: #fff;
           background-color: #080808;
+        }
         .navbar-inverse .navbar-nav .open .dropdown-menu > .disabled > a,
         .navbar-inverse .navbar-nav .open .dropdown-menu > .disabled > a:hover,
         .navbar-inverse .navbar-nav .open .dropdown-menu > .disabled > a:focus {
           color: #444;
           background-color: transparent;
+        }
+      }
       .navbar-inverse .navbar-link {
         color: #9d9d9d;
+      }
       .navbar-inverse .navbar-link:hover {
         color: #fff;
+      }
       .navbar-inverse .btn-link {
         color: #9d9d9d;
+      }
       .navbar-inverse .btn-link:hover,
       .navbar-inverse .btn-link:focus {
         color: #fff;
+      }
       .navbar-inverse .btn-link[disabled]:hover,
       fieldset[disabled] .navbar-inverse .btn-link:hover,
       .navbar-inverse .btn-link[disabled]:focus,
       fieldset[disabled] .navbar-inverse .btn-link:focus {
         color: #444;
+      }
       .breadcrumb {
         padding: 8px 15px;
         margin-bottom: 18px;
         list-style: none;
         background-color: #f5f5f5;
         border-radius: 2px;
+      }
       .breadcrumb > li {
         display: inline-block;
+      }
       .breadcrumb > li + li:before {
         content: "/\00a0";
         padding: 0 5px;
         color: #5e5e5e;
+      }
       .breadcrumb > .active {
         color: #777777;
+      }
       .pagination {
         display: inline-block;
         padding-left: 0;
         margin: 18px 0;
         border-radius: 2px;
+      }
       .pagination > li {
         display: inline;
+      }
       .pagination > li > a,
       .pagination > li > span {
         position: relative;
         float: left;
         padding: 6px 12px;
         line-height: 1.42857143;
         text-decoration: none;
         color: #337ab7;
         background-color: #fff;
         border: 1px solid #ddd;
         margin-left: -1px;
+      }
       .pagination > li:first-child > a,
       .pagination > li:first-child > span {
         margin-left: 0;
         border-bottom-left-radius: 2px;
         border-top-left-radius: 2px;
+      }
       .pagination > li:last-child > a,
       .pagination > li:last-child > span {
         border-bottom-right-radius: 2px;
         border-top-right-radius: 2px;
+      }
       .pagination > li > a:hover,
       .pagination > li > span:hover,
       .pagination > li > a:focus,
       .pagination > li > span:focus {
         z-index: 2;
         color: #23527c;
         background-color: #eeeeee;
         border-color: #ddd;
+      }
       .pagination > .active > a,
       .pagination > .active > span,
       .pagination > .active > a:hover,
       .pagination > .active > span:hover,
       .pagination > .active > a:focus,
       .pagination > .active > span:focus {
         z-index: 3;
         color: #fff;
         background-color: #337ab7;
         border-color: #337ab7;
         cursor: default;
+      }
       .pagination > .disabled > span,
       .pagination > .disabled > span:hover,
       .pagination > .disabled > span:focus,
       .pagination > .disabled > a,
       .pagination > .disabled > a:hover,
       .pagination > .disabled > a:focus {
         color: #777777;
         background-color: #fff;
         border-color: #ddd;
         cursor: not-allowed;
+      }
       .pagination-lg > li > a,
       .pagination-lg > li > span {
         padding: 10px 16px;
         font-size: 17px;
         line-height: 1.3333333;
+      }
       .pagination-lg > li:first-child > a,
       .pagination-lg > li:first-child > span {
         border-bottom-left-radius: 3px;
         border-top-left-radius: 3px;
+      }
       .pagination-lg > li:last-child > a,
       .pagination-lg > li:last-child > span {
         border-bottom-right-radius: 3px;
         border-top-right-radius: 3px;
+      }
       .pagination-sm > li > a,
       .pagination-sm > li > span {
         padding: 5px 10px;
         font-size: 12px;
         line-height: 1.5;
+      }
       .pagination-sm > li:first-child > a,
       .pagination-sm > li:first-child > span {
         border-bottom-left-radius: 1px;
         border-top-left-radius: 1px;
+      }
       .pagination-sm > li:last-child > a,
       .pagination-sm > li:last-child > span {
         border-bottom-right-radius: 1px;
         border-top-right-radius: 1px;
+      }
       .pager {
         padding-left: 0;
         margin: 18px 0;
         list-style: none;
         text-align: center;
+      }
       .pager li {
         display: inline;
+      }
       .pager li > a,
       .pager li > span {
         display: inline-block;
         padding: 5px 14px;
         background-color: #fff;
         border: 1px solid #ddd;
         border-radius: 15px;
+      }
       .pager li > a:hover,
       .pager li > a:focus {
         text-decoration: none;
         background-color: #eeeeee;
+      }
       .pager .next > a,
       .pager .next > span {
         float: right;
+      }
       .pager .previous > a,
       .pager .previous > span {
         float: left;
+      }
       .pager .disabled > a,
       .pager .disabled > a:hover,
       .pager .disabled > a:focus,
       .pager .disabled > span {
         color: #777777;
         background-color: #fff;
         cursor: not-allowed;
+      }
       .label {
         display: inline;
         padding: .2em .6em .3em;
         font-size: 75%;
         font-weight: bold;
         line-height: 1;
         color: #fff;
         text-align: center;
         white-space: nowrap;
         vertical-align: baseline;
         border-radius: .25em;
+      }
       a.label:hover,
       a.label:focus {
         color: #fff;
         text-decoration: none;
         cursor: pointer;
+      }
       .label:empty {
         display: none;
+      }
       .btn .label {
         position: relative;
         top: -1px;
+      }
       .label-default {
         background-color: #777777;
+      }
       .label-default[href]:hover,
       .label-default[href]:focus {
         background-color: #5e5e5e;
+      }
       .label-primary {
         background-color: #337ab7;
+      }
       .label-primary[href]:hover,
       .label-primary[href]:focus {
         background-color: #286090;
+      }
       .label-success {
         background-color: #5cb85c;
+      }
       .label-success[href]:hover,
       .label-success[href]:focus {
         background-color: #449d44;
+      }
       .label-info {
         background-color: #5bc0de;
+      }
       .label-info[href]:hover,
       .label-info[href]:focus {
         background-color: #31b0d5;
+      }
       .label-warning {
         background-color: #f0ad4e;
+      }
       .label-warning[href]:hover,
       .label-warning[href]:focus {
         background-color: #ec971f;
+      }
       .label-danger {
         background-color: #d9534f;
+      }
       .label-danger[href]:hover,
       .label-danger[href]:focus {
         background-color: #c9302c;
+      }
       .badge {
         display: inline-block;
         min-width: 10px;
         padding: 3px 7px;
         font-size: 12px;
         font-weight: bold;
         color: #fff;
         line-height: 1;
         vertical-align: middle;
         white-space: nowrap;
         text-align: center;
         background-color: #777777;
         border-radius: 10px;
+      }
       .badge:empty {
         display: none;
+      }
       .btn .badge {
         position: relative;
         top: -1px;
+      }
       .btn-xs .badge,
       .btn-group-xs > .btn .badge {
         top: 0;
         padding: 1px 5px;
+      }
       a.badge:hover,
       a.badge:focus {
         color: #fff;
         text-decoration: none;
         cursor: pointer;
+      }
       .list-group-item.active > .badge,
       .nav-pills > .active > a > .badge {
         color: #337ab7;
         background-color: #fff;
+      }
       .list-group-item > .badge {
         float: right;
+      }
       .list-group-item > .badge + .badge {
         margin-right: 5px;
+      }
       .nav-pills > li > a > .badge {
         margin-left: 3px;
+      }
       .jumbotron {
         padding-top: 30px;
         padding-bottom: 30px;
         margin-bottom: 30px;
         color: inherit;
         background-color: #eeeeee;
+      }
       .jumbotron h1,
       .jumbotron .h1 {
         color: inherit;
+      }
       .jumbotron p {
         margin-bottom: 15px;
         font-size: 20px;
         font-weight: 200;
+      }
       .jumbotron > hr {
         border-top-color: #d5d5d5;
+      }
       .container .jumbotron,
       .container-fluid .jumbotron {
         border-radius: 3px;
         padding-left: 0px;
         padding-right: 0px;
+      }
       .jumbotron .container {
         max-width: 100%;
+      }
       @media screen and (min-width: 768px) {
         .jumbotron {
           padding-top: 48px;
           padding-bottom: 48px;
+        }
         .container .jumbotron,
         .container-fluid .jumbotron {
           padding-left: 60px;
           padding-right: 60px;
+        }
         .jumbotron h1,
         .jumbotron .h1 {
           font-size: 59px;
+        }
+      }
       .thumbnail {
         display: block;
         padding: 4px;
         margin-bottom: 18px;
         line-height: 1.42857143;
         background-color: #fff;
         border: 1px solid #ddd;
         border-radius: 2px;
         -webkit-transition: border 0.2s ease-in-out;
         -o-transition: border 0.2s ease-in-out;
         transition: border 0.2s ease-in-out;
+      }
       .thumbnail > img,
       .thumbnail a > img {
         margin-left: auto;
         margin-right: auto;
+      }
       a.thumbnail:hover,
       a.thumbnail:focus,
       a.thumbnail.active {
         border-color: #337ab7;
+      }
       .thumbnail .caption {
         padding: 9px;
         color: #000;
+      }
       .alert {
         padding: 15px;
         margin-bottom: 18px;
         border: 1px solid transparent;
         border-radius: 2px;
+      }
       .alert h4 {
         margin-top: 0;
         color: inherit;
+      }
       .alert .alert-link {
         font-weight: bold;
+      }
       .alert > p,
       .alert > ul {
         margin-bottom: 0;
+      }
       .alert > p + p {
         margin-top: 5px;
+      }
       .alert-dismissable,
       .alert-dismissible {
         padding-right: 35px;
+      }
       .alert-dismissable .close,
       .alert-dismissible .close {
         position: relative;
         top: -2px;
         right: -21px;
         color: inherit;
+      }
       .alert-success {
         background-color: #dff0d8;
         border-color: #d6e9c6;
         color: #3c763d;
+      }
       .alert-success hr {
         border-top-color: #c9e2b3;
+      }
       .alert-success .alert-link {
         color: #2b542c;
+      }
       .alert-info {
         background-color: #d9edf7;
         border-color: #bce8f1;
         color: #31708f;
+      }
       .alert-info hr {
         border-top-color: #a6e1ec;
+      }
       .alert-info .alert-link {
         color: #245269;
+      }
       .alert-warning {
         background-color: #fcf8e3;
         border-color: #faebcc;
         color: #8a6d3b;
+      }
       .alert-warning hr {
         border-top-color: #f7e1b5;
+      }
       .alert-warning .alert-link {
         color: #66512c;
+      }
       .alert-danger {
         background-color: #f2dede;
         border-color: #ebccd1;
         color: #a94442;
+      }
       .alert-danger hr {
         border-top-color: #e4b9c0;
+      }
       .alert-danger .alert-link {
         color: #843534;
+      }
       @-webkit-keyframes progress-bar-stripes {
         from {
           background-position: 40px 0;
+        }
         to {
           background-position: 0 0;
+        }
+      }
       @keyframes progress-bar-stripes {
         from {
           background-position: 40px 0;
+        }
         to {
           background-position: 0 0;
+        }
+      }
       .progress {
         overflow: hidden;
         height: 18px;
         margin-bottom: 18px;
         background-color: #f5f5f5;
         border-radius: 2px;
         -webkit-box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1);
         box-shadow: inset 0 1px 2px rgba(0, 0, 0, 0.1);
+      }
       .progress-bar {
         float: left;
         width: 0%;
         height: 100%;
         font-size: 12px;
         line-height: 18px;
         color: #fff;
         text-align: center;
         background-color: #337ab7;
         -webkit-box-shadow: inset 0 -1px 0 rgba(0, 0, 0, 0.15);
         box-shadow: inset 0 -1px 0 rgba(0, 0, 0, 0.15);
         -webkit-transition: width 0.6s ease;
         -o-transition: width 0.6s ease;
         transition: width 0.6s ease;
+      }
       .progress-striped .progress-bar,
       .progress-bar-striped {
         background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
         background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
         background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
         background-size: 40px 40px;
+      }
       .progress.active .progress-bar,
       .progress-bar.active {
         -webkit-animation: progress-bar-stripes 2s linear infinite;
         -o-animation: progress-bar-stripes 2s linear infinite;
         animation: progress-bar-stripes 2s linear infinite;
+      }
       .progress-bar-success {
         background-color: #5cb85c;
+      }
       .progress-striped .progress-bar-success {
         background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
         background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
         background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+      }
       .progress-bar-info {
         background-color: #5bc0de;
+      }
       .progress-striped .progress-bar-info {
         background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
         background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
         background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+      }
       .progress-bar-warning {
         background-color: #f0ad4e;
+      }
       .progress-striped .progress-bar-warning {
         background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
         background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
         background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+      }
       .progress-bar-danger {
         background-color: #d9534f;
+      }
       .progress-striped .progress-bar-danger {
         background-image: -webkit-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
         background-image: -o-linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
         background-image: linear-gradient(45deg, rgba(255, 255, 255, 0.15) 25%, transparent 25%, transparent 50%, rgba(255, 255, 255, 0.15) 50%, rgba(255, 255, 255, 0.15) 75%, transparent 75%, transparent);
+      }
       .media {
         margin-top: 15px;
+      }
       .media:first-child {
         margin-top: 0;
+      }
       .media,
       .media-body {
         zoom: 1;
         overflow: hidden;
+      }
       .media-body {
         width: 10000px;
+      }
       .media-object {
         display: block;
+      }
       .media-object.img-thumbnail {
         max-width: none;
+      }
       .media-right,
       .media > .pull-right {
         padding-left: 10px;
+      }
       .media-left,
       .media > .pull-left {
         padding-right: 10px;
+      }
       .media-left,
       .media-right,
       .media-body {
         display: table-cell;
         vertical-align: top;
+      }
       .media-middle {
         vertical-align: middle;
+      }
       .media-bottom {
         vertical-align: bottom;
+      }
       .media-heading {
         margin-top: 0;
         margin-bottom: 5px;
+      }
       .media-list {
         padding-left: 0;
         list-style: none;
+      }
       .list-group {
         margin-bottom: 20px;
         padding-left: 0;
+      }
       .list-group-item {
         position: relative;
         display: block;
         padding: 10px 15px;
         margin-bottom: -1px;
         background-color: #fff;
         border: 1px solid #ddd;
+      }
       .list-group-item:first-child {
         border-top-right-radius: 2px;
         border-top-left-radius: 2px;
+      }
       .list-group-item:last-child {
         margin-bottom: 0;
         border-bottom-right-radius: 2px;
         border-bottom-left-radius: 2px;
+      }
       a.list-group-item,
       button.list-group-item {
         color: #555;
+      }
       a.list-group-item .list-group-item-heading,
       button.list-group-item .list-group-item-heading {
         color: #333;
+      }
       a.list-group-item:hover,
       button.list-group-item:hover,
       a.list-group-item:focus,
       button.list-group-item:focus {
         text-decoration: none;
         color: #555;
         background-color: #f5f5f5;
+      }
       button.list-group-item {
         width: 100%;
         text-align: left;
+      }
       .list-group-item.disabled,
       .list-group-item.disabled:hover,
       .list-group-item.disabled:focus {
         background-color: #eeeeee;
         color: #777777;
         cursor: not-allowed;
+      }
       .list-group-item.disabled .list-group-item-heading,
       .list-group-item.disabled:hover .list-group-item-heading,
       .list-group-item.disabled:focus .list-group-item-heading {
         color: inherit;
+      }
       .list-group-item.disabled .list-group-item-text,
       .list-group-item.disabled:hover .list-group-item-text,
       .list-group-item.disabled:focus .list-group-item-text {
         color: #777777;
+      }
       .list-group-item.active,
       .list-group-item.active:hover,
       .list-group-item.active:focus {
         z-index: 2;
         color: #fff;
         background-color: #337ab7;
         border-color: #337ab7;
+      }
       .list-group-item.active .list-group-item-heading,
       .list-group-item.active:hover .list-group-item-heading,
       .list-group-item.active:focus .list-group-item-heading,
       .list-group-item.active .list-group-item-heading > small,
       .list-group-item.active:hover .list-group-item-heading > small,
       .list-group-item.active:focus .list-group-item-heading > small,
       .list-group-item.active .list-group-item-heading > .small,
       .list-group-item.active:hover .list-group-item-heading > .small,
       .list-group-item.active:focus .list-group-item-heading > .small {
         color: inherit;
+      }
       .list-group-item.active .list-group-item-text,
       .list-group-item.active:hover .list-group-item-text,
       .list-group-item.active:focus .list-group-item-text {
         color: #c7ddef;
+      }
       .list-group-item-success {
         color: #3c763d;
         background-color: #dff0d8;
+      }
       a.list-group-item-success,
       button.list-group-item-success {
         color: #3c763d;
+      }
       a.list-group-item-success .list-group-item-heading,
       button.list-group-item-success .list-group-item-heading {
         color: inherit;
+      }
       a.list-group-item-success:hover,
       button.list-group-item-success:hover,
       a.list-group-item-success:focus,
       button.list-group-item-success:focus {
         color: #3c763d;
         background-color: #d0e9c6;
+      }
       a.list-group-item-success.active,
       button.list-group-item-success.active,
       a.list-group-item-success.active:hover,
       button.list-group-item-success.active:hover,
       a.list-group-item-success.active:focus,
       button.list-group-item-success.active:focus {
         color: #fff;
         background-color: #3c763d;
         border-color: #3c763d;
+      }
       .list-group-item-info {
         color: #31708f;
         background-color: #d9edf7;
+      }
       a.list-group-item-info,
       button.list-group-item-info {
         color: #31708f;
+      }
       a.list-group-item-info .list-group-item-heading,
       button.list-group-item-info .list-group-item-heading {
         color: inherit;
+      }
       a.list-group-item-info:hover,
       button.list-group-item-info:hover,
       a.list-group-item-info:focus,
       button.list-group-item-info:focus {
         color: #31708f;
         background-color: #c4e3f3;
+      }
       a.list-group-item-info.active,
       button.list-group-item-info.active,
       a.list-group-item-info.active:hover,
       button.list-group-item-info.active:hover,
       a.list-group-item-info.active:focus,
       button.list-group-item-info.active:focus {
         color: #fff;
         background-color: #31708f;
         border-color: #31708f;
+      }
       .list-group-item-warning {
         color: #8a6d3b;
         background-color: #fcf8e3;
+      }
       a.list-group-item-warning,
       button.list-group-item-warning {
         color: #8a6d3b;
+      }
       a.list-group-item-warning .list-group-item-heading,
       button.list-group-item-warning .list-group-item-heading {
         color: inherit;
+      }
       a.list-group-item-warning:hover,
       button.list-group-item-warning:hover,
       a.list-group-item-warning:focus,
       button.list-group-item-warning:focus {
         color: #8a6d3b;
         background-color: #faf2cc;
+      }
       a.list-group-item-warning.active,
       button.list-group-item-warning.active,
       a.list-group-item-warning.active:hover,
       button.list-group-item-warning.active:hover,
       a.list-group-item-warning.active:focus,
       button.list-group-item-warning.active:focus {
         color: #fff;
         background-color: #8a6d3b;
         border-color: #8a6d3b;
+      }
       .list-group-item-danger {
         color: #a94442;
         background-color: #f2dede;
+      }
       a.list-group-item-danger,
       button.list-group-item-danger {
         color: #a94442;
+      }
       a.list-group-item-danger .list-group-item-heading,
       button.list-group-item-danger .list-group-item-heading {
         color: inherit;
+      }
       a.list-group-item-danger:hover,
       button.list-group-item-danger:hover,
       a.list-group-item-danger:focus,
       button.list-group-item-danger:focus {
         color: #a94442;
         background-color: #ebcccc;
+      }
       a.list-group-item-danger.active,
       button.list-group-item-danger.active,
       a.list-group-item-danger.active:hover,
       button.list-group-item-danger.active:hover,
       a.list-group-item-danger.active:focus,
       button.list-group-item-danger.active:focus {
         color: #fff;
         background-color: #a94442;
         border-color: #a94442;
+      }
       .list-group-item-heading {
         margin-top: 0;
         margin-bottom: 5px;
+      }
       .list-group-item-text {
         margin-bottom: 0;
         line-height: 1.3;
+      }
       .panel {
         margin-bottom: 18px;
         background-color: #fff;
         border: 1px solid transparent;
         border-radius: 2px;
         -webkit-box-shadow: 0 1px 1px rgba(0, 0, 0, 0.05);
         box-shadow: 0 1px 1px rgba(0, 0, 0, 0.05);
+      }
       .panel-body {
         padding: 15px;
+      }
       .panel-heading {
         padding: 10px 15px;
         border-bottom: 1px solid transparent;
         border-top-right-radius: 1px;
         border-top-left-radius: 1px;
+      }
       .panel-heading > .dropdown .dropdown-toggle {
         color: inherit;
+      }
       .panel-title {
         margin-top: 0;
         margin-bottom: 0;
         font-size: 15px;
         color: inherit;
+      }
       .panel-title > a,
       .panel-title > small,
       .panel-title > .small,
       .panel-title > small > a,
       .panel-title > .small > a {
         color: inherit;
+      }
       .panel-footer {
         padding: 10px 15px;
         background-color: #f5f5f5;
         border-top: 1px solid #ddd;
         border-bottom-right-radius: 1px;
         border-bottom-left-radius: 1px;
+      }
       .panel > .list-group,
       .panel > .panel-collapse > .list-group {
         margin-bottom: 0;
+      }
       .panel > .list-group .list-group-item,
       .panel > .panel-collapse > .list-group .list-group-item {
         border-width: 1px 0;
         border-radius: 0;
+      }
       .panel > .list-group:first-child .list-group-item:first-child,
       .panel > .panel-collapse > .list-group:first-child .list-group-item:first-child {
         border-top: 0;
         border-top-right-radius: 1px;
         border-top-left-radius: 1px;
+      }
       .panel > .list-group:last-child .list-group-item:last-child,
       .panel > .panel-collapse > .list-group:last-child .list-group-item:last-child {
         border-bottom: 0;
         border-bottom-right-radius: 1px;
         border-bottom-left-radius: 1px;
+      }
       .panel > .panel-heading + .panel-collapse > .list-group .list-group-item:first-child {
         border-top-right-radius: 0;
         border-top-left-radius: 0;
+      }
       .panel-heading + .list-group .list-group-item:first-child {
         border-top-width: 0;
+      }
       .list-group + .panel-footer {
         border-top-width: 0;
+      }
       .panel > .table,
       .panel > .table-responsive > .table,
       .panel > .panel-collapse > .table {
         margin-bottom: 0;
+      }
       .panel > .table caption,
       .panel > .table-responsive > .table caption,
       .panel > .panel-collapse > .table caption {
         padding-left: 15px;
         padding-right: 15px;
+      }
       .panel > .table:first-child,
       .panel > .table-responsive:first-child > .table:first-child {
         border-top-right-radius: 1px;
         border-top-left-radius: 1px;
+      }
       .panel > .table:first-child > thead:first-child > tr:first-child,
       .panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child,
       .panel > .table:first-child > tbody:first-child > tr:first-child,
       .panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child {
         border-top-left-radius: 1px;
         border-top-right-radius: 1px;
+      }
       .panel > .table:first-child > thead:first-child > tr:first-child td:first-child,
       .panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child td:first-child,
       .panel > .table:first-child > tbody:first-child > tr:first-child td:first-child,
       .panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child td:first-child,
       .panel > .table:first-child > thead:first-child > tr:first-child th:first-child,
       .panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child th:first-child,
       .panel > .table:first-child > tbody:first-child > tr:first-child th:first-child,
       .panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child th:first-child {
         border-top-left-radius: 1px;
+      }
       .panel > .table:first-child > thead:first-child > tr:first-child td:last-child,
       .panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child td:last-child,
       .panel > .table:first-child > tbody:first-child > tr:first-child td:last-child,
       .panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child td:last-child,
       .panel > .table:first-child > thead:first-child > tr:first-child th:last-child,
       .panel > .table-responsive:first-child > .table:first-child > thead:first-child > tr:first-child th:last-child,
       .panel > .table:first-child > tbody:first-child > tr:first-child th:last-child,
       .panel > .table-responsive:first-child > .table:first-child > tbody:first-child > tr:first-child th:last-child {
         border-top-right-radius: 1px;
+      }
       .panel > .table:last-child,
       .panel > .table-responsive:last-child > .table:last-child {
         border-bottom-right-radius: 1px;
         border-bottom-left-radius: 1px;
+      }
       .panel > .table:last-child > tbody:last-child > tr:last-child,
       .panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child,
       .panel > .table:last-child > tfoot:last-child > tr:last-child,
       .panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child {
         border-bottom-left-radius: 1px;
         border-bottom-right-radius: 1px;
+      }
       .panel > .table:last-child > tbody:last-child > tr:last-child td:first-child,
       .panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child td:first-child,
       .panel > .table:last-child > tfoot:last-child > tr:last-child td:first-child,
       .panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child td:first-child,
       .panel > .table:last-child > tbody:last-child > tr:last-child th:first-child,
       .panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child th:first-child,
       .panel > .table:last-child > tfoot:last-child > tr:last-child th:first-child,
       .panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child th:first-child {
         border-bottom-left-radius: 1px;
+      }
       .panel > .table:last-child > tbody:last-child > tr:last-child td:last-child,
       .panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child td:last-child,
       .panel > .table:last-child > tfoot:last-child > tr:last-child td:last-child,
       .panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child td:last-child,
       .panel > .table:last-child > tbody:last-child > tr:last-child th:last-child,
       .panel > .table-responsive:last-child > .table:last-child > tbody:last-child > tr:last-child th:last-child,
       .panel > .table:last-child > tfoot:last-child > tr:last-child th:last-child,
       .panel > .table-responsive:last-child > .table:last-child > tfoot:last-child > tr:last-child th:last-child {
         border-bottom-right-radius: 1px;
+      }
       .panel > .panel-body + .table,
       .panel > .panel-body + .table-responsive,
       .panel > .table + .panel-body,
       .panel > .table-responsive + .panel-body {
         border-top: 1px solid #ddd;
+      }
       .panel > .table > tbody:first-child > tr:first-child th,
       .panel > .table > tbody:first-child > tr:first-child td {
         border-top: 0;
+      }
       .panel > .table-bordered,
       .panel > .table-responsive > .table-bordered {
         border: 0;
+      }
       .panel > .table-bordered > thead > tr > th:first-child,
       .panel > .table-responsive > .table-bordered > thead > tr > th:first-child,
       .panel > .table-bordered > tbody > tr > th:first-child,
       .panel > .table-responsive > .table-bordered > tbody > tr > th:first-child,
       .panel > .table-bordered > tfoot > tr > th:first-child,
       .panel > .table-responsive > .table-bordered > tfoot > tr > th:first-child,
       .panel > .table-bordered > thead > tr > td:first-child,
       .panel > .table-responsive > .table-bordered > thead > tr > td:first-child,
       .panel > .table-bordered > tbody > tr > td:first-child,
       .panel > .table-responsive > .table-bordered > tbody > tr > td:first-child,
       .panel > .table-bordered > tfoot > tr > td:first-child,
       .panel > .table-responsive > .table-bordered > tfoot > tr > td:first-child {
         border-left: 0;
+      }
       .panel > .table-bordered > thead > tr > th:last-child,
       .panel > .table-responsive > .table-bordered > thead > tr > th:last-child,
       .panel > .table-bordered > tbody > tr > th:last-child,
       .panel > .table-responsive > .table-bordered > tbody > tr > th:last-child,
       .panel > .table-bordered > tfoot > tr > th:last-child,
       .panel > .table-responsive > .table-bordered > tfoot > tr > th:last-child,
       .panel > .table-bordered > thead > tr > td:last-child,
       .panel > .table-responsive > .table-bordered > thead > tr > td:last-child,
       .panel > .table-bordered > tbody > tr > td:last-child,
       .panel > .table-responsive > .table-bordered > tbody > tr > td:last-child,
       .panel > .table-bordered > tfoot > tr > td:last-child,
       .panel > .table-responsive > .table-bordered > tfoot > tr > td:last-child {
         border-right: 0;
+      }
       .panel > .table-bordered > thead > tr:first-child > td,
       .panel > .table-responsive > .table-bordered > thead > tr:first-child > td,
       .panel > .table-bordered > tbody > tr:first-child > td,
       .panel > .table-responsive > .table-bordered > tbody > tr:first-child > td,
       .panel > .table-bordered > thead > tr:first-child > th,
       .panel > .table-responsive > .table-bordered > thead > tr:first-child > th,
       .panel > .table-bordered > tbody > tr:first-child > th,
       .panel > .table-responsive > .table-bordered > tbody > tr:first-child > th {
         border-bottom: 0;
+      }
       .panel > .table-bordered > tbody > tr:last-child > td,
       .panel > .table-responsive > .table-bordered > tbody > tr:last-child > td,
       .panel > .table-bordered > tfoot > tr:last-child > td,
       .panel > .table-responsive > .table-bordered > tfoot > tr:last-child > td,
       .panel > .table-bordered > tbody > tr:last-child > th,
       .panel > .table-responsive > .table-bordered > tbody > tr:last-child > th,
       .panel > .table-bordered > tfoot > tr:last-child > th,
       .panel > .table-responsive > .table-bordered > tfoot > tr:last-child > th {
         border-bottom: 0;
+      }
       .panel > .table-responsive {
         border: 0;
         margin-bottom: 0;
+      }
       .panel-group {
         margin-bottom: 18px;
+      }
       .panel-group .panel {
         margin-bottom: 0;
         border-radius: 2px;
+      }
       .panel-group .panel + .panel {
         margin-top: 5px;
+      }
       .panel-group .panel-heading {
         border-bottom: 0;
+      }
       .panel-group .panel-heading + .panel-collapse > .panel-body,
       .panel-group .panel-heading + .panel-collapse > .list-group {
         border-top: 1px solid #ddd;
+      }
       .panel-group .panel-footer {
         border-top: 0;
+      }
       .panel-group .panel-footer + .panel-collapse .panel-body {
         border-bottom: 1px solid #ddd;
+      }
       .panel-default {
         border-color: #ddd;
+      }
       .panel-default > .panel-heading {
         color: #333333;
         background-color: #f5f5f5;
         border-color: #ddd;
+      }
       .panel-default > .panel-heading + .panel-collapse > .panel-body {
         border-top-color: #ddd;
+      }
       .panel-default > .panel-heading .badge {
         color: #f5f5f5;
         background-color: #333333;
+      }
       .panel-default > .panel-footer + .panel-collapse > .panel-body {
         border-bottom-color: #ddd;
+      }
       .panel-primary {
         border-color: #337ab7;
+      }
       .panel-primary > .panel-heading {
         color: #fff;
         background-color: #337ab7;
         border-color: #337ab7;
+      }
       .panel-primary > .panel-heading + .panel-collapse > .panel-body {
         border-top-color: #337ab7;
+      }
       .panel-primary > .panel-heading .badge {
         color: #337ab7;
         background-color: #fff;
+      }
       .panel-primary > .panel-footer + .panel-collapse > .panel-body {
         border-bottom-color: #337ab7;
+      }
       .panel-success {
         border-color: #d6e9c6;
+      }
       .panel-success > .panel-heading {
         color: #3c763d;
         background-color: #dff0d8;
         border-color: #d6e9c6;
+      }
       .panel-success > .panel-heading + .panel-collapse > .panel-body {
         border-top-color: #d6e9c6;
+      }
       .panel-success > .panel-heading .badge {
         color: #dff0d8;
         background-color: #3c763d;
+      }
       .panel-success > .panel-footer + .panel-collapse > .panel-body {
         border-bottom-color: #d6e9c6;
+      }
       .panel-info {
         border-color: #bce8f1;
+      }
       .panel-info > .panel-heading {
         color: #31708f;
         background-color: #d9edf7;
         border-color: #bce8f1;
+      }
       .panel-info > .panel-heading + .panel-collapse > .panel-body {
         border-top-color: #bce8f1;
+      }
       .panel-info > .panel-heading .badge {
         color: #d9edf7;
         background-color: #31708f;
+      }
       .panel-info > .panel-footer + .panel-collapse > .panel-body {
         border-bottom-color: #bce8f1;
+      }
       .panel-warning {
         border-color: #faebcc;
+      }
       .panel-warning > .panel-heading {
         color: #8a6d3b;
         background-color: #fcf8e3;
         border-color: #faebcc;
+      }
       .panel-warning > .panel-heading + .panel-collapse > .panel-body {
         border-top-color: #faebcc;
+      }
       .panel-warning > .panel-heading .badge {
         color: #fcf8e3;
         background-color: #8a6d3b;
+      }
       .panel-warning > .panel-footer + .panel-collapse > .panel-body {
         border-bottom-color: #faebcc;
+      }
       .panel-danger {
         border-color: #ebccd1;
+      }
       .panel-danger > .panel-heading {
         color: #a94442;
         background-color: #f2dede;
         border-color: #ebccd1;
+      }
       .panel-danger > .panel-heading + .panel-collapse > .panel-body {
         border-top-color: #ebccd1;
+      }
       .panel-danger > .panel-heading .badge {
         color: #f2dede;
         background-color: #a94442;
+      }
       .panel-danger > .panel-footer + .panel-collapse > .panel-body {
         border-bottom-color: #ebccd1;
+      }
       .embed-responsive {
         position: relative;
         display: block;
         height: 0;
         padding: 0;
         overflow: hidden;
+      }
       .embed-responsive .embed-responsive-item,
       .embed-responsive iframe,
       .embed-responsive embed,
       .embed-responsive object,
       .embed-responsive video {
         position: absolute;
         top: 0;
         left: 0;
         bottom: 0;
         height: 100%;
         width: 100%;
         border: 0;
+      }
       .embed-responsive-16by9 {
         padding-bottom: 56.25%;
+      }
       .embed-responsive-4by3 {
         padding-bottom: 75%;
+      }
       .well {
         min-height: 20px;
         padding: 19px;
         margin-bottom: 20px;
         background-color: #f5f5f5;
         border: 1px solid #e3e3e3;
         border-radius: 2px;
         -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.05);
         box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.05);
+      }
       .well blockquote {
         border-color: #ddd;
         border-color: rgba(0, 0, 0, 0.15);
+      }
       .well-lg {
         padding: 24px;
         border-radius: 3px;
+      }
       .well-sm {
         padding: 9px;
         border-radius: 1px;
+      }
       .close {
         float: right;
         font-size: 19.5px;
         font-weight: bold;
         line-height: 1;
         color: #000;
         text-shadow: 0 1px 0 #fff;
         opacity: 0.2;
         filter: alpha(opacity=20);
+      }
       .close:hover,
       .close:focus {
         color: #000;
         text-decoration: none;
         cursor: pointer;
         opacity: 0.5;
         filter: alpha(opacity=50);
+      }
       button.close {
         padding: 0;
         cursor: pointer;
         background: transparent;
         border: 0;
         -webkit-appearance: none;
+      }
       .modal-open {
         overflow: hidden;
+      }
       .modal {
         display: none;
         overflow: hidden;
         position: fixed;
         top: 0;
         right: 0;
         bottom: 0;
         left: 0;
         z-index: 1050;
         -webkit-overflow-scrolling: touch;
         outline: 0;
+      }
       .modal.fade .modal-dialog {
         -webkit-transform: translate(0, -25%);
         -ms-transform: translate(0, -25%);
         -o-transform: translate(0, -25%);
         transform: translate(0, -25%);
         -webkit-transition: -webkit-transform 0.3s ease-out;
         -moz-transition: -moz-transform 0.3s ease-out;
         -o-transition: -o-transform 0.3s ease-out;
         transition: transform 0.3s ease-out;
+      }
       .modal.in .modal-dialog {
         -webkit-transform: translate(0, 0);
         -ms-transform: translate(0, 0);
         -o-transform: translate(0, 0);
         transform: translate(0, 0);
+      }
       .modal-open .modal {
         overflow-x: hidden;
         overflow-y: auto;
+      }
       .modal-dialog {
         position: relative;
         width: auto;
         margin: 10px;
+      }
       .modal-content {
         position: relative;
         background-color: #fff;
         border: 1px solid #999;
         border: 1px solid rgba(0, 0, 0, 0.2);
         border-radius: 3px;
         -webkit-box-shadow: 0 3px 9px rgba(0, 0, 0, 0.5);
         box-shadow: 0 3px 9px rgba(0, 0, 0, 0.5);
         background-clip: padding-box;
         outline: 0;
+      }
       .modal-backdrop {
         position: fixed;
         top: 0;
         right: 0;
         bottom: 0;
         left: 0;
         z-index: 1040;
         background-color: #000;
+      }
       .modal-backdrop.fade {
         opacity: 0;
         filter: alpha(opacity=0);
+      }
       .modal-backdrop.in {
         opacity: 0.5;
         filter: alpha(opacity=50);
+      }
       .modal-header {
         padding: 15px;
         border-bottom: 1px solid #e5e5e5;
+      }
       .modal-header .close {
         margin-top: -2px;
+      }
       .modal-title {
         margin: 0;
         line-height: 1.42857143;
+      }
       .modal-body {
         position: relative;
         padding: 15px;
+      }
       .modal-footer {
         padding: 15px;
         text-align: right;
         border-top: 1px solid #e5e5e5;
+      }
       .modal-footer .btn + .btn {
         margin-left: 5px;
         margin-bottom: 0;
+      }
       .modal-footer .btn-group .btn + .btn {
         margin-left: -1px;
+      }
       .modal-footer .btn-block + .btn-block {
         margin-left: 0;
+      }
       .modal-scrollbar-measure {
         position: absolute;
         top: -9999px;
         width: 50px;
         height: 50px;
         overflow: scroll;
+      }
       @media (min-width: 768px) {
         .modal-dialog {
           width: 600px;
           margin: 30px auto;
+        }
         .modal-content {
           -webkit-box-shadow: 0 5px 15px rgba(0, 0, 0, 0.5);
           box-shadow: 0 5px 15px rgba(0, 0, 0, 0.5);
+        }
         .modal-sm {
           width: 300px;
+        }
+      }
       @media (min-width: 992px) {
         .modal-lg {
           width: 900px;
+        }
+      }
       .tooltip {
         position: absolute;
         z-index: 1070;
         display: block;
         font-family: "Helvetica Neue", Helvetica, Arial, sans-serif;
         font-style: normal;
         font-weight: normal;
         letter-spacing: normal;
         line-break: auto;
         line-height: 1.42857143;
         text-align: left;
         text-align: start;
         text-decoration: none;
         text-shadow: none;
         text-transform: none;
         white-space: normal;
         word-break: normal;
         word-spacing: normal;
         word-wrap: normal;
         font-size: 12px;
         opacity: 0;
         filter: alpha(opacity=0);
+      }
       .tooltip.in {
         opacity: 0.9;
         filter: alpha(opacity=90);
+      }
       .tooltip.top {
         margin-top: -3px;
         padding: 5px 0;
+      }
       .tooltip.right {
         margin-left: 3px;
         padding: 0 5px;
+      }
       .tooltip.bottom {
         margin-top: 3px;
         padding: 5px 0;
+      }
       .tooltip.left {
         margin-left: -3px;
         padding: 0 5px;
+      }
       .tooltip-inner {
         max-width: 200px;
         padding: 3px 8px;
         color: #fff;
         text-align: center;
         background-color: #000;
         border-radius: 2px;
+      }
       .tooltip-arrow {
         position: absolute;
         width: 0;
         height: 0;
         border-color: transparent;
         border-style: solid;
+      }
       .tooltip.top .tooltip-arrow {
         bottom: 0;
         left: 50%;
         margin-left: -5px;
         border-width: 5px 5px 0;
         border-top-color: #000;
+      }
       .tooltip.top-left .tooltip-arrow {
         bottom: 0;
         right: 5px;
         margin-bottom: -5px;
         border-width: 5px 5px 0;
         border-top-color: #000;
+      }
       .tooltip.top-right .tooltip-arrow {
         bottom: 0;
         left: 5px;
         margin-bottom: -5px;
         border-width: 5px 5px 0;
         border-top-color: #000;
+      }
       .tooltip.right .tooltip-arrow {
         top: 50%;
         left: 0;
         margin-top: -5px;
         border-width: 5px 5px 5px 0;
         border-right-color: #000;
+      }
       .tooltip.left .tooltip-arrow {
         top: 50%;
         right: 0;
         margin-top: -5px;
         border-width: 5px 0 5px 5px;
         border-left-color: #000;
+      }
       .tooltip.bottom .tooltip-arrow {
         top: 0;
         left: 50%;
         margin-left: -5px;
         border-width: 0 5px 5px;
         border-bottom-color: #000;
+      }
       .tooltip.bottom-left .tooltip-arrow {
         top: 0;
         right: 5px;
         margin-top: -5px;
         border-width: 0 5px 5px;
         border-bottom-color: #000;
+      }
       .tooltip.bottom-right .tooltip-arrow {
         top: 0;
         left: 5px;
         margin-top: -5px;
         border-width: 0 5px 5px;
         border-bottom-color: #000;
+      }
       .popover {
         position: absolute;
         top: 0;
         left: 0;
         z-index: 1060;
         display: none;
         max-width: 276px;
         padding: 1px;
         font-family: "Helvetica Neue", Helvetica, Arial, sans-serif;
         font-style: normal;
         font-weight: normal;
         letter-spacing: normal;
         line-break: auto;
         line-height: 1.42857143;
         text-align: left;
         text-align: start;
         text-decoration: none;
         text-shadow: none;
         text-transform: none;
         white-space: normal;
         word-break: normal;
         word-spacing: normal;
         word-wrap: normal;
         font-size: 13px;
         background-color: #fff;
         background-clip: padding-box;
         border: 1px solid #ccc;
         border: 1px solid rgba(0, 0, 0, 0.2);
         border-radius: 3px;
         -webkit-box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2);
         box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2);
+      }
       .popover.top {
         margin-top: -10px;
+      }
       .popover.right {
         margin-left: 10px;
+      }
       .popover.bottom {
         margin-top: 10px;
+      }
       .popover.left {
         margin-left: -10px;
+      }
       .popover-title {
         margin: 0;
         padding: 8px 14px;
         font-size: 13px;
         background-color: #f7f7f7;
         border-bottom: 1px solid #ebebeb;
         border-radius: 2px 2px 0 0;
+      }
       .popover-content {
         padding: 9px 14px;
+      }
       .popover > .arrow,
       .popover > .arrow:after {
         position: absolute;
         display: block;
         width: 0;
         height: 0;
         border-color: transparent;
         border-style: solid;
+      }
       .popover > .arrow {
         border-width: 11px;
+      }
       .popover > .arrow:after {
         border-width: 10px;
         content: "";
+      }
       .popover.top > .arrow {
         left: 50%;
         margin-left: -11px;
         border-bottom-width: 0;
         border-top-color: #999999;
         border-top-color: rgba(0, 0, 0, 0.25);
         bottom: -11px;
+      }
       .popover.top > .arrow:after {
         content: " ";
         bottom: 1px;
         margin-left: -10px;
         border-bottom-width: 0;
         border-top-color: #fff;
+      }
       .popover.right > .arrow {
         top: 50%;
         left: -11px;
         margin-top: -11px;
         border-left-width: 0;
         border-right-color: #999999;
         border-right-color: rgba(0, 0, 0, 0.25);
+      }
       .popover.right > .arrow:after {
         content: " ";
         left: 1px;
         bottom: -10px;
         border-left-width: 0;
         border-right-color: #fff;
+      }
       .popover.bottom > .arrow {
         left: 50%;
         margin-left: -11px;
         border-top-width: 0;
         border-bottom-color: #999999;
         border-bottom-color: rgba(0, 0, 0, 0.25);
         top: -11px;
+      }
       .popover.bottom > .arrow:after {
         content: " ";
         top: 1px;
         margin-left: -10px;
         border-top-width: 0;
         border-bottom-color: #fff;
+      }
       .popover.left > .arrow {
         top: 50%;
         right: -11px;
         margin-top: -11px;
         border-right-width: 0;
         border-left-color: #999999;
         border-left-color: rgba(0, 0, 0, 0.25);
+      }
       .popover.left > .arrow:after {
         content: " ";
         right: 1px;
         border-right-width: 0;
         border-left-color: #fff;
         bottom: -10px;
+      }
       .carousel {
         position: relative;
+      }
       .carousel-inner {
         position: relative;
         overflow: hidden;
         width: 100%;
+      }
       .carousel-inner > .item {
         display: none;
         position: relative;
         -webkit-transition: 0.6s ease-in-out left;
         -o-transition: 0.6s ease-in-out left;
         transition: 0.6s ease-in-out left;
+      }
       .carousel-inner > .item > img,
       .carousel-inner > .item > a > img {
         line-height: 1;
+      }
       @media all and (transform-3d), (-webkit-transform-3d) {
         .carousel-inner > .item {
           -webkit-transition: -webkit-transform 0.6s ease-in-out;
           -moz-transition: -moz-transform 0.6s ease-in-out;
           -o-transition: -o-transform 0.6s ease-in-out;
           transition: transform 0.6s ease-in-out;
           -webkit-backface-visibility: hidden;
           -moz-backface-visibility: hidden;
           backface-visibility: hidden;
           -webkit-perspective: 1000px;
           -moz-perspective: 1000px;
           perspective: 1000px;
+        }
         .carousel-inner > .item.next,
         .carousel-inner > .item.active.right {
           -webkit-transform: translate3d(100%, 0, 0);
           transform: translate3d(100%, 0, 0);
           left: 0;
+        }
         .carousel-inner > .item.prev,
         .carousel-inner > .item.active.left {
           -webkit-transform: translate3d(-100%, 0, 0);
           transform: translate3d(-100%, 0, 0);
           left: 0;
+        }
         .carousel-inner > .item.next.left,
         .carousel-inner > .item.prev.right,
         .carousel-inner > .item.active {
           -webkit-transform: translate3d(0, 0, 0);
           transform: translate3d(0, 0, 0);
           left: 0;
+        }
+      }
       .carousel-inner > .active,
       .carousel-inner > .next,
       .carousel-inner > .prev {
         display: block;
+      }
       .carousel-inner > .active {
         left: 0;
+      }
       .carousel-inner > .next,
       .carousel-inner > .prev {
         position: absolute;
         top: 0;
         width: 100%;
+      }
       .carousel-inner > .next {
         left: 100%;
+      }
       .carousel-inner > .prev {
         left: -100%;
+      }
       .carousel-inner > .next.left,
       .carousel-inner > .prev.right {
         left: 0;
+      }
       .carousel-inner > .active.left {
         left: -100%;
+      }
       .carousel-inner > .active.right {
         left: 100%;
+      }
       .carousel-control {
         position: absolute;
         top: 0;
         left: 0;
         bottom: 0;
         width: 15%;
         opacity: 0.5;
         filter: alpha(opacity=50);
         font-size: 20px;
         color: #fff;
         text-align: center;
         text-shadow: 0 1px 2px rgba(0, 0, 0, 0.6);
         background-color: rgba(0, 0, 0, 0);
+      }
       .carousel-control.left {
         background-image: -webkit-linear-gradient(left, rgba(0, 0, 0, 0.5) 0%, rgba(0, 0, 0, 0.0001) 100%);
         background-image: -o-linear-gradient(left, rgba(0, 0, 0, 0.5) 0%, rgba(0, 0, 0, 0.0001) 100%);
         background-image: linear-gradient(to right, rgba(0, 0, 0, 0.5) 0%, rgba(0, 0, 0, 0.0001) 100%);
         background-repeat: repeat-x;
         filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#80000000', endColorstr='#00000000', GradientType=1);
+      }
       .carousel-control.right {
         left: auto;
         right: 0;
         background-image: -webkit-linear-gradient(left, rgba(0, 0, 0, 0.0001) 0%, rgba(0, 0, 0, 0.5) 100%);
         background-image: -o-linear-gradient(left, rgba(0, 0, 0, 0.0001) 0%, rgba(0, 0, 0, 0.5) 100%);
         background-image: linear-gradient(to right, rgba(0, 0, 0, 0.0001) 0%, rgba(0, 0, 0, 0.5) 100%);
         background-repeat: repeat-x;
         filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#00000000', endColorstr='#80000000', GradientType=1);
+      }
       .carousel-control:hover,
       .carousel-control:focus {
         outline: 0;
         color: #fff;
         text-decoration: none;
         opacity: 0.9;
         filter: alpha(opacity=90);
+      }
       .carousel-control .icon-prev,
       .carousel-control .icon-next,
       .carousel-control .glyphicon-chevron-left,
       .carousel-control .glyphicon-chevron-right {
         position: absolute;
         top: 50%;
         margin-top: -10px;
         z-index: 5;
         display: inline-block;
+      }
       .carousel-control .icon-prev,
       .carousel-control .glyphicon-chevron-left {
         left: 50%;
         margin-left: -10px;
+      }
       .carousel-control .icon-next,
       .carousel-control .glyphicon-chevron-right {
         right: 50%;
         margin-right: -10px;
+      }
       .carousel-control .icon-prev,
       .carousel-control .icon-next {
         width: 20px;
         height: 20px;
         line-height: 1;
         font-family: serif;
+      }
       .carousel-control .icon-prev:before {
         content: '\2039';
+      }
       .carousel-control .icon-next:before {
         content: '\203a';
+      }
       .carousel-indicators {
         position: absolute;
         bottom: 10px;
         left: 50%;
         z-index: 15;
         width: 60%;
         margin-left: -30%;
         padding-left: 0;
         list-style: none;
         text-align: center;
+      }
       .carousel-indicators li {
         display: inline-block;
         width: 10px;
         height: 10px;
         margin: 1px;
         text-indent: -999px;
         border: 1px solid #fff;
         border-radius: 10px;
         cursor: pointer;
         background-color: #000 \9;
         background-color: rgba(0, 0, 0, 0);
+      }
       .carousel-indicators .active {
         margin: 0;
         width: 12px;
         height: 12px;
         background-color: #fff;
+      }
       .carousel-caption {
         position: absolute;
         left: 15%;
         right: 15%;
         bottom: 20px;
         z-index: 10;
         padding-top: 20px;
         padding-bottom: 20px;
         color: #fff;
         text-align: center;
         text-shadow: 0 1px 2px rgba(0, 0, 0, 0.6);
+      }
       .carousel-caption .btn {
         text-shadow: none;
+      }
       @media screen and (min-width: 768px) {
         .carousel-control .glyphicon-chevron-left,
         .carousel-control .glyphicon-chevron-right,
         .carousel-control .icon-prev,
         .carousel-control .icon-next {
           width: 30px;
           height: 30px;
           margin-top: -10px;
           font-size: 30px;
+        }
         .carousel-control .glyphicon-chevron-left,
         .carousel-control .icon-prev {
           margin-left: -10px;
+        }
         .carousel-control .glyphicon-chevron-right,
         .carousel-control .icon-next {
           margin-right: -10px;
+        }
         .carousel-caption {
           left: 20%;
           right: 20%;
           padding-bottom: 30px;
+        }
         .carousel-indicators {
           bottom: 20px;
+        }
+      }
       .clearfix:before,
       .clearfix:after,
       .dl-horizontal dd:before,
       .dl-horizontal dd:after,
       .container:before,
       .container:after,
       .container-fluid:before,
       .container-fluid:after,
       .row:before,
       .row:after,
       .form-horizontal .form-group:before,
       .form-horizontal .form-group:after,
       .btn-toolbar:before,
       .btn-toolbar:after,
       .btn-group-vertical > .btn-group:before,
       .btn-group-vertical > .btn-group:after,
       .nav:before,
       .nav:after,
       .navbar:before,
       .navbar:after,
       .navbar-header:before,
       .navbar-header:after,
       .navbar-collapse:before,
       .navbar-collapse:after,
       .pager:before,
       .pager:after,
       .panel-body:before,
       .panel-body:after,
       .modal-header:before,
       .modal-header:after,
       .modal-footer:before,
       .modal-footer:after,
       .item_buttons:before,
       .item_buttons:after {
         content: " ";
         display: table;
+      }
       .clearfix:after,
       .dl-horizontal dd:after,
       .container:after,
       .container-fluid:after,
       .row:after,
       .form-horizontal .form-group:after,
       .btn-toolbar:after,
       .btn-group-vertical > .btn-group:after,
       .nav:after,
       .navbar:after,
       .navbar-header:after,
       .navbar-collapse:after,
       .pager:after,
       .panel-body:after,
       .modal-header:after,
       .modal-footer:after,
       .item_buttons:after {
         clear: both;
+      }
       .center-block {
         display: block;
         margin-left: auto;
         margin-right: auto;
+      }
       .pull-right {
         float: right !important;
+      }
       .pull-left {
         float: left !important;
+      }
       .hide {
         display: none !important;
+      }
       .show {
         display: block !important;
+      }
       .invisible {
         visibility: hidden;
+      }
       .text-hide {
         font: 0/0 a;
         color: transparent;
         text-shadow: none;
         background-color: transparent;
         border: 0;
+      }
       .hidden {
         display: none !important;
+      }
       .affix {
         position: fixed;
+      }
       @-ms-viewport {
         width: device-width;
+      }
       .visible-xs,
       .visible-sm,
       .visible-md,
       .visible-lg {
         display: none !important;
+      }
       .visible-xs-block,
       .visible-xs-inline,
       .visible-xs-inline-block,
       .visible-sm-block,
       .visible-sm-inline,
       .visible-sm-inline-block,
       .visible-md-block,
       .visible-md-inline,
       .visible-md-inline-block,
       .visible-lg-block,
       .visible-lg-inline,
       .visible-lg-inline-block {
         display: none !important;
+      }
       @media (max-width: 767px) {
         .visible-xs {
           display: block !important;
+        }
         table.visible-xs {
           display: table !important;
+        }
         tr.visible-xs {
           display: table-row !important;
+        }
         th.visible-xs,
         td.visible-xs {
           display: table-cell !important;
+        }
+      }
       @media (max-width: 767px) {
         .visible-xs-block {
           display: block !important;
+        }
+      }
       @media (max-width: 767px) {
         .visible-xs-inline {
           display: inline !important;
+        }
+      }
       @media (max-width: 767px) {
         .visible-xs-inline-block {
           display: inline-block !important;
+        }
+      }
       @media (min-width: 768px) and (max-width: 991px) {
         .visible-sm {
           display: block !important;
+        }
         table.visible-sm {
           display: table !important;
+        }
         tr.visible-sm {
           display: table-row !important;
+        }
         th.visible-sm,
         td.visible-sm {
           display: table-cell !important;
+        }
+      }
       @media (min-width: 768px) and (max-width: 991px) {
         .visible-sm-block {
           display: block !important;
+        }
+      }
       @media (min-width: 768px) and (max-width: 991px) {
         .visible-sm-inline {
           display: inline !important;
+        }
+      }
       @media (min-width: 768px) and (max-width: 991px) {
         .visible-sm-inline-block {
           display: inline-block !important;
+        }
+      }
       @media (min-width: 992px) and (max-width: 1199px) {
         .visible-md {
           display: block !important;
+        }
         table.visible-md {
           display: table !important;
+        }
         tr.visible-md {
           display: table-row !important;
+        }
         th.visible-md,
         td.visible-md {
           display: table-cell !important;
+        }
+      }
       @media (min-width: 992px) and (max-width: 1199px) {
         .visible-md-block {
           display: block !important;
+        }
+      }
       @media (min-width: 992px) and (max-width: 1199px) {
         .visible-md-inline {
           display: inline !important;
+        }
+      }
       @media (min-width: 992px) and (max-width: 1199px) {
         .visible-md-inline-block {
           display: inline-block !important;
+        }
+      }
       @media (min-width: 1200px) {
         .visible-lg {
           display: block !important;
+        }
         table.visible-lg {
           display: table !important;
+        }
         tr.visible-lg {
           display: table-row !important;
+        }
         th.visible-lg,
         td.visible-lg {
           display: table-cell !important;
+        }
+      }
       @media (min-width: 1200px) {
         .visible-lg-block {
           display: block !important;
+        }
+      }
       @media (min-width: 1200px) {
         .visible-lg-inline {
           display: inline !important;
+        }
+      }
       @media (min-width: 1200px) {
         .visible-lg-inline-block {
           display: inline-block !important;
+        }
+      }
       @media (max-width: 767px) {
         .hidden-xs {
           display: none !important;
+        }
+      }
       @media (min-width: 768px) and (max-width: 991px) {
         .hidden-sm {
           display: none !important;
+        }
+      }
       @media (min-width: 992px) and (max-width: 1199px) {
         .hidden-md {
           display: none !important;
+        }
+      }
       @media (min-width: 1200px) {
         .hidden-lg {
           display: none !important;
+        }
+      }
       .visible-print {
         display: none !important;
+      }
       @media print {
         .visible-print {
           display: block !important;
+        }
         table.visible-print {
           display: table !important;
+        }
         tr.visible-print {
           display: table-row !important;
+        }
         th.visible-print,
         td.visible-print {
           display: table-cell !important;
+        }
+      }
       .visible-print-block {
         display: none !important;
+      }
       @media print {
         .visible-print-block {
           display: block !important;
+        }
+      }
       .visible-print-inline {
         display: none !important;
+      }
       @media print {
         .visible-print-inline {
           display: inline !important;
+        }
+      }
       .visible-print-inline-block {
         display: none !important;
+      }
       @media print {
         .visible-print-inline-block {
           display: inline-block !important;
+        }
+      }
       @media print {
         .hidden-print {
           display: none !important;
+        }
+      }
       /*!
+      *
       * Font Awesome
+      *
       */
       /*!
        *  Font Awesome 4.2.0 by @davegandy - http://fontawesome.io - @fontawesome
        *  License - http://fontawesome.io/license (Font: SIL OFL 1.1, CSS: MIT License)
        */
       /* FONT PATH
        * -------------------------- */
       @font-face {
         font-family: 'FontAwesome';
         src: url('../components/font-awesome/fonts/fontawesome-webfont.eot?v=4.2.0');
         src: url('../components/font-awesome/fonts/fontawesome-webfont.eot?#iefix&v=4.2.0') format('embedded-opentype'), url('../components/font-awesome/fonts/fontawesome-webfont.woff?v=4.2.0') format('woff'), url('../components/font-awesome/fonts/fontawesome-webfont.ttf?v=4.2.0') format('truetype'), url('../components/font-awesome/fonts/fontawesome-webfont.svg?v=4.2.0#fontawesomeregular') format('svg');
         font-weight: normal;
         font-style: normal;
+      }
       .fa {
         display: inline-block;
         font: normal normal normal 14px/1 FontAwesome;
         font-size: inherit;
         text-rendering: auto;
         -webkit-font-smoothing: antialiased;
         -moz-osx-font-smoothing: grayscale;
+      }
       /* makes the font 33% larger relative to the icon container */
       .fa-lg {
         font-size: 1.33333333em;
         line-height: 0.75em;
         vertical-align: -15%;
+      }
       .fa-2x {
         font-size: 2em;
+      }
       .fa-3x {
         font-size: 3em;
+      }
       .fa-4x {
         font-size: 4em;
+      }
       .fa-5x {
         font-size: 5em;
+      }
       .fa-fw {
         width: 1.28571429em;
         text-align: center;
+      }
       .fa-ul {
         padding-left: 0;
         margin-left: 2.14285714em;
         list-style-type: none;
+      }
       .fa-ul > li {
         position: relative;
+      }
       .fa-li {
         position: absolute;
         left: -2.14285714em;
         width: 2.14285714em;
         top: 0.14285714em;
         text-align: center;
+      }
       .fa-li.fa-lg {
         left: -1.85714286em;
+      }
       .fa-border {
         padding: .2em .25em .15em;
         border: solid 0.08em #eee;
         border-radius: .1em;
+      }
       .pull-right {
         float: right;
+      }
       .pull-left {
         float: left;
+      }
       .fa.pull-left {
         margin-right: .3em;
+      }
       .fa.pull-right {
         margin-left: .3em;
+      }
       .fa-spin {
         -webkit-animation: fa-spin 2s infinite linear;
         animation: fa-spin 2s infinite linear;
+      }
       @-webkit-keyframes fa-spin {
 % {
           -webkit-transform: rotate(0deg);
           transform: rotate(0deg);
+        }
 % {
           -webkit-transform: rotate(359deg);
           transform: rotate(359deg);
+        }
+      }
       @keyframes fa-spin {
 % {
           -webkit-transform: rotate(0deg);
           transform: rotate(0deg);
+        }
 % {
           -webkit-transform: rotate(359deg);
           transform: rotate(359deg);
+        }
+      }
       .fa-rotate-90 {
         filter: progid:DXImageTransform.Microsoft.BasicImage(rotation=1);
         -webkit-transform: rotate(90deg);
         -ms-transform: rotate(90deg);
         transform: rotate(90deg);
+      }
       .fa-rotate-180 {
         filter: progid:DXImageTransform.Microsoft.BasicImage(rotation=2);
         -webkit-transform: rotate(180deg);
         -ms-transform: rotate(180deg);
         transform: rotate(180deg);
+      }
       .fa-rotate-270 {
         filter: progid:DXImageTransform.Microsoft.BasicImage(rotation=3);
         -webkit-transform: rotate(270deg);
         -ms-transform: rotate(270deg);
         transform: rotate(270deg);
+      }
       .fa-flip-horizontal {
         filter: progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1);
         -webkit-transform: scale(-1, 1);
         -ms-transform: scale(-1, 1);
         transform: scale(-1, 1);
+      }
       .fa-flip-vertical {
         filter: progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1);
         -webkit-transform: scale(1, -1);
         -ms-transform: scale(1, -1);
         transform: scale(1, -1);
+      }
       :root .fa-rotate-90,
       :root .fa-rotate-180,
       :root .fa-rotate-270,
       :root .fa-flip-horizontal,
       :root .fa-flip-vertical {
         filter: none;
+      }
       .fa-stack {
         position: relative;
         display: inline-block;
         width: 2em;
         height: 2em;
         line-height: 2em;
         vertical-align: middle;
+      }
       .fa-stack-1x,
       .fa-stack-2x {
         position: absolute;
         left: 0;
         width: 100%;
         text-align: center;
+      }
       .fa-stack-1x {
         line-height: inherit;
+      }
       .fa-stack-2x {
         font-size: 2em;
+      }
       .fa-inverse {
         color: #fff;
+      }
       /* Font Awesome uses the Unicode Private Use Area (PUA) to ensure screen
          readers do not read off random characters that represent icons */
       .fa-glass:before {
         content: "\f000";
+      }
       .fa-music:before {
         content: "\f001";
+      }
       .fa-search:before {
         content: "\f002";
+      }
       .fa-envelope-o:before {
         content: "\f003";
+      }
       .fa-heart:before {
         content: "\f004";
+      }
       .fa-star:before {
         content: "\f005";
+      }
       .fa-star-o:before {
         content: "\f006";
+      }
       .fa-user:before {
         content: "\f007";
+      }
       .fa-film:before {
         content: "\f008";
+      }
       .fa-th-large:before {
         content: "\f009";
+      }
       .fa-th:before {
         content: "\f00a";
+      }
       .fa-th-list:before {
         content: "\f00b";
+      }
       .fa-check:before {
         content: "\f00c";
+      }
       .fa-remove:before,
       .fa-close:before,
       .fa-times:before {
         content: "\f00d";
+      }
       .fa-search-plus:before {
         content: "\f00e";
+      }
       .fa-search-minus:before {
         content: "\f010";
+      }
       .fa-power-off:before {
         content: "\f011";
+      }
       .fa-signal:before {
         content: "\f012";
+      }
       .fa-gear:before,
       .fa-cog:before {
         content: "\f013";
+      }
       .fa-trash-o:before {
         content: "\f014";
+      }
       .fa-home:before {
         content: "\f015";
+      }
       .fa-file-o:before {
         content: "\f016";
+      }
       .fa-clock-o:before {
         content: "\f017";
+      }
       .fa-road:before {
         content: "\f018";
+      }
       .fa-download:before {
         content: "\f019";
+      }
       .fa-arrow-circle-o-down:before {
         content: "\f01a";
+      }
       .fa-arrow-circle-o-up:before {
         content: "\f01b";
+      }
       .fa-inbox:before {
         content: "\f01c";
+      }
       .fa-play-circle-o:before {
         content: "\f01d";
+      }
       .fa-rotate-right:before,
       .fa-repeat:before {
         content: "\f01e";
+      }
       .fa-refresh:before {
         content: "\f021";
+      }
       .fa-list-alt:before {
         content: "\f022";
+      }
       .fa-lock:before {
         content: "\f023";
+      }
       .fa-flag:before {
         content: "\f024";
+      }
       .fa-headphones:before {
         content: "\f025";
+      }
       .fa-volume-off:before {
         content: "\f026";
+      }
       .fa-volume-down:before {
         content: "\f027";
+      }
       .fa-volume-up:before {
         content: "\f028";
+      }
       .fa-qrcode:before {
         content: "\f029";
+      }
       .fa-barcode:before {
         content: "\f02a";
+      }
       .fa-tag:before {
         content: "\f02b";
+      }
       .fa-tags:before {
         content: "\f02c";
+      }
       .fa-book:before {
         content: "\f02d";
+      }
       .fa-bookmark:before {
         content: "\f02e";
+      }
       .fa-print:before {
         content: "\f02f";
+      }
       .fa-camera:before {
         content: "\f030";
+      }
       .fa-font:before {
         content: "\f031";
+      }
       .fa-bold:before {
         content: "\f032";
+      }
       .fa-italic:before {
         content: "\f033";
+      }
       .fa-text-height:before {
         content: "\f034";
+      }
       .fa-text-width:before {
         content: "\f035";
+      }
       .fa-align-left:before {
         content: "\f036";
+      }
       .fa-align-center:before {
         content: "\f037";
+      }
       .fa-align-right:before {
         content: "\f038";
+      }
       .fa-align-justify:before {
         content: "\f039";
+      }
       .fa-list:before {
         content: "\f03a";
+      }
       .fa-dedent:before,
       .fa-outdent:before {
         content: "\f03b";
+      }
       .fa-indent:before {
         content: "\f03c";
+      }
       .fa-video-camera:before {
         content: "\f03d";
+      }
       .fa-photo:before,
       .fa-image:before,
       .fa-picture-o:before {
         content: "\f03e";
+      }
       .fa-pencil:before {
         content: "\f040";
+      }
       .fa-map-marker:before {
         content: "\f041";
+      }
       .fa-adjust:before {
         content: "\f042";
+      }
       .fa-tint:before {
         content: "\f043";
+      }
       .fa-edit:before,
       .fa-pencil-square-o:before {
         content: "\f044";
+      }
       .fa-share-square-o:before {
         content: "\f045";
+      }
       .fa-check-square-o:before {
         content: "\f046";
+      }
       .fa-arrows:before {
         content: "\f047";
+      }
       .fa-step-backward:before {
         content: "\f048";
+      }
       .fa-fast-backward:before {
         content: "\f049";
+      }
       .fa-backward:before {
         content: "\f04a";
+      }
       .fa-play:before {
         content: "\f04b";
+      }
       .fa-pause:before {
         content: "\f04c";
+      }
       .fa-stop:before {
         content: "\f04d";
+      }
       .fa-forward:before {
         content: "\f04e";
+      }
       .fa-fast-forward:before {
         content: "\f050";
+      }
       .fa-step-forward:before {
         content: "\f051";
+      }
       .fa-eject:before {
         content: "\f052";
+      }
       .fa-chevron-left:before {
         content: "\f053";
+      }
       .fa-chevron-right:before {
         content: "\f054";
+      }
       .fa-plus-circle:before {
         content: "\f055";
+      }
       .fa-minus-circle:before {
         content: "\f056";
+      }
       .fa-times-circle:before {
         content: "\f057";
+      }
       .fa-check-circle:before {
         content: "\f058";
+      }
       .fa-question-circle:before {
         content: "\f059";
+      }
       .fa-info-circle:before {
         content: "\f05a";
+      }
       .fa-crosshairs:before {
         content: "\f05b";
+      }
       .fa-times-circle-o:before {
         content: "\f05c";
+      }
       .fa-check-circle-o:before {
         content: "\f05d";
+      }
       .fa-ban:before {
         content: "\f05e";
+      }
       .fa-arrow-left:before {
         content: "\f060";
+      }
       .fa-arrow-right:before {
         content: "\f061";
+      }
       .fa-arrow-up:before {
         content: "\f062";
+      }
       .fa-arrow-down:before {
         content: "\f063";
+      }
       .fa-mail-forward:before,
       .fa-share:before {
         content: "\f064";
+      }
       .fa-expand:before {
         content: "\f065";
+      }
       .fa-compress:before {
         content: "\f066";
+      }
       .fa-plus:before {
         content: "\f067";
+      }
       .fa-minus:before {
         content: "\f068";
+      }
       .fa-asterisk:before {
         content: "\f069";
+      }
       .fa-exclamation-circle:before {
         content: "\f06a";
+      }
       .fa-gift:before {
         content: "\f06b";
+      }
       .fa-leaf:before {
         content: "\f06c";
+      }
       .fa-fire:before {
         content: "\f06d";
+      }
       .fa-eye:before {
         content: "\f06e";
+      }
       .fa-eye-slash:before {
         content: "\f070";
+      }
       .fa-warning:before,
       .fa-exclamation-triangle:before {
         content: "\f071";
+      }
       .fa-plane:before {
         content: "\f072";
+      }
       .fa-calendar:before {
         content: "\f073";
+      }
       .fa-random:before {
         content: "\f074";
+      }
       .fa-comment:before {
         content: "\f075";
+      }
       .fa-magnet:before {
         content: "\f076";
+      }
       .fa-chevron-up:before {
         content: "\f077";
+      }
       .fa-chevron-down:before {
         content: "\f078";
+      }
       .fa-retweet:before {
         content: "\f079";
+      }
       .fa-shopping-cart:before {
         content: "\f07a";
+      }
       .fa-folder:before {
         content: "\f07b";
+      }
       .fa-folder-open:before {
         content: "\f07c";
+      }
       .fa-arrows-v:before {
         content: "\f07d";
+      }
       .fa-arrows-h:before {
         content: "\f07e";
+      }
       .fa-bar-chart-o:before,
       .fa-bar-chart:before {
         content: "\f080";
+      }
       .fa-twitter-square:before {
         content: "\f081";
+      }
       .fa-facebook-square:before {
         content: "\f082";
+      }
       .fa-camera-retro:before {
         content: "\f083";
+      }
       .fa-key:before {
         content: "\f084";
+      }
       .fa-gears:before,
       .fa-cogs:before {
         content: "\f085";
+      }
       .fa-comments:before {
         content: "\f086";
+      }
       .fa-thumbs-o-up:before {
         content: "\f087";
+      }
       .fa-thumbs-o-down:before {
         content: "\f088";
+      }
       .fa-star-half:before {
         content: "\f089";
+      }
       .fa-heart-o:before {
         content: "\f08a";
+      }
       .fa-sign-out:before {
         content: "\f08b";
+      }
       .fa-linkedin-square:before {
         content: "\f08c";
+      }
       .fa-thumb-tack:before {
         content: "\f08d";
+      }
       .fa-external-link:before {
         content: "\f08e";
+      }
       .fa-sign-in:before {
         content: "\f090";
+      }
       .fa-trophy:before {
         content: "\f091";
+      }
       .fa-github-square:before {
         content: "\f092";
+      }
       .fa-upload:before {
         content: "\f093";
+      }
       .fa-lemon-o:before {
         content: "\f094";
+      }
       .fa-phone:before {
         content: "\f095";
+      }
       .fa-square-o:before {
         content: "\f096";
+      }
       .fa-bookmark-o:before {
         content: "\f097";
+      }
       .fa-phone-square:before {
         content: "\f098";
+      }
       .fa-twitter:before {
         content: "\f099";
+      }
       .fa-facebook:before {
         content: "\f09a";
+      }
       .fa-github:before {
         content: "\f09b";
+      }
       .fa-unlock:before {
         content: "\f09c";
+      }
       .fa-credit-card:before {
         content: "\f09d";
+      }
       .fa-rss:before {
         content: "\f09e";
+      }
       .fa-hdd-o:before {
         content: "\f0a0";
+      }
       .fa-bullhorn:before {
         content: "\f0a1";
+      }
       .fa-bell:before {
         content: "\f0f3";
+      }
       .fa-certificate:before {
         content: "\f0a3";
+      }
       .fa-hand-o-right:before {
         content: "\f0a4";
+      }
       .fa-hand-o-left:before {
         content: "\f0a5";
+      }
       .fa-hand-o-up:before {
         content: "\f0a6";
+      }
       .fa-hand-o-down:before {
         content: "\f0a7";
+      }
       .fa-arrow-circle-left:before {
         content: "\f0a8";
+      }
       .fa-arrow-circle-right:before {
         content: "\f0a9";
+      }
       .fa-arrow-circle-up:before {
         content: "\f0aa";
+      }
       .fa-arrow-circle-down:before {
         content: "\f0ab";
+      }
       .fa-globe:before {
         content: "\f0ac";
+      }
       .fa-wrench:before {
         content: "\f0ad";
+      }
       .fa-tasks:before {
         content: "\f0ae";
+      }
       .fa-filter:before {
         content: "\f0b0";
+      }
       .fa-briefcase:before {
         content: "\f0b1";
+      }
       .fa-arrows-alt:before {
         content: "\f0b2";
+      }
       .fa-group:before,
       .fa-users:before {
         content: "\f0c0";
+      }
       .fa-chain:before,
       .fa-link:before {
         content: "\f0c1";
+      }
       .fa-cloud:before {
         content: "\f0c2";
+      }
       .fa-flask:before {
         content: "\f0c3";
+      }
       .fa-cut:before,
       .fa-scissors:before {
         content: "\f0c4";
+      }
       .fa-copy:before,
       .fa-files-o:before {
         content: "\f0c5";
+      }
       .fa-paperclip:before {
         content: "\f0c6";
+      }
       .fa-save:before,
       .fa-floppy-o:before {
         content: "\f0c7";
+      }
       .fa-square:before {
         content: "\f0c8";
+      }
       .fa-navicon:before,
       .fa-reorder:before,
       .fa-bars:before {
         content: "\f0c9";
+      }
       .fa-list-ul:before {
         content: "\f0ca";
+      }
       .fa-list-ol:before {
         content: "\f0cb";
+      }
       .fa-strikethrough:before {
         content: "\f0cc";
+      }
       .fa-underline:before {
         content: "\f0cd";
+      }
       .fa-table:before {
         content: "\f0ce";
+      }
       .fa-magic:before {
         content: "\f0d0";
+      }
       .fa-truck:before {
         content: "\f0d1";
+      }
       .fa-pinterest:before {
         content: "\f0d2";
+      }
       .fa-pinterest-square:before {
         content: "\f0d3";
+      }
       .fa-google-plus-square:before {
         content: "\f0d4";
+      }
       .fa-google-plus:before {
         content: "\f0d5";
+      }
       .fa-money:before {
         content: "\f0d6";
+      }
       .fa-caret-down:before {
         content: "\f0d7";
+      }
       .fa-caret-up:before {
         content: "\f0d8";
+      }
       .fa-caret-left:before {
         content: "\f0d9";
+      }
       .fa-caret-right:before {
         content: "\f0da";
+      }
       .fa-columns:before {
         content: "\f0db";
+      }
       .fa-unsorted:before,
       .fa-sort:before {
         content: "\f0dc";
+      }
       .fa-sort-down:before,
       .fa-sort-desc:before {
         content: "\f0dd";
+      }
       .fa-sort-up:before,
       .fa-sort-asc:before {
         content: "\f0de";
+      }
       .fa-envelope:before {
         content: "\f0e0";
+      }
       .fa-linkedin:before {
         content: "\f0e1";
+      }
       .fa-rotate-left:before,
       .fa-undo:before {
         content: "\f0e2";
+      }
       .fa-legal:before,
       .fa-gavel:before {
         content: "\f0e3";
+      }
       .fa-dashboard:before,
       .fa-tachometer:before {
         content: "\f0e4";
+      }
       .fa-comment-o:before {
         content: "\f0e5";
+      }
       .fa-comments-o:before {
         content: "\f0e6";
+      }
       .fa-flash:before,
       .fa-bolt:before {
         content: "\f0e7";
+      }
       .fa-sitemap:before {
         content: "\f0e8";
+      }
       .fa-umbrella:before {
         content: "\f0e9";
+      }
       .fa-paste:before,
       .fa-clipboard:before {
         content: "\f0ea";
+      }
       .fa-lightbulb-o:before {
         content: "\f0eb";
+      }
       .fa-exchange:before {
         content: "\f0ec";
+      }
       .fa-cloud-download:before {
         content: "\f0ed";
+      }
       .fa-cloud-upload:before {
         content: "\f0ee";
+      }
       .fa-user-md:before {
         content: "\f0f0";
+      }
       .fa-stethoscope:before {
         content: "\f0f1";
+      }
       .fa-suitcase:before {
         content: "\f0f2";
+      }
       .fa-bell-o:before {
         content: "\f0a2";
+      }
       .fa-coffee:before {
         content: "\f0f4";
+      }
       .fa-cutlery:before {
         content: "\f0f5";
+      }
       .fa-file-text-o:before {
         content: "\f0f6";
+      }
       .fa-building-o:before {
         content: "\f0f7";
+      }
       .fa-hospital-o:before {
         content: "\f0f8";
+      }
       .fa-ambulance:before {
         content: "\f0f9";
+      }
       .fa-medkit:before {
         content: "\f0fa";
+      }
       .fa-fighter-jet:before {
         content: "\f0fb";
+      }
       .fa-beer:before {
         content: "\f0fc";
+      }
       .fa-h-square:before {
         content: "\f0fd";
+      }
       .fa-plus-square:before {
         content: "\f0fe";
+      }
       .fa-angle-double-left:before {
         content: "\f100";
+      }
       .fa-angle-double-right:before {
         content: "\f101";
+      }
       .fa-angle-double-up:before {
         content: "\f102";
+      }
       .fa-angle-double-down:before {
         content: "\f103";
+      }
       .fa-angle-left:before {
         content: "\f104";
+      }
       .fa-angle-right:before {
         content: "\f105";
+      }
       .fa-angle-up:before {
         content: "\f106";
+      }
       .fa-angle-down:before {
         content: "\f107";
+      }
       .fa-desktop:before {
         content: "\f108";
+      }
       .fa-laptop:before {
         content: "\f109";
+      }
       .fa-tablet:before {
         content: "\f10a";
+      }
       .fa-mobile-phone:before,
       .fa-mobile:before {
         content: "\f10b";
+      }
       .fa-circle-o:before {
         content: "\f10c";
+      }
       .fa-quote-left:before {
         content: "\f10d";
+      }
       .fa-quote-right:before {
         content: "\f10e";
+      }
       .fa-spinner:before {
         content: "\f110";
+      }
       .fa-circle:before {
         content: "\f111";
+      }
       .fa-mail-reply:before,
       .fa-reply:before {
         content: "\f112";
+      }
       .fa-github-alt:before {
         content: "\f113";
+      }
       .fa-folder-o:before {
         content: "\f114";
+      }
       .fa-folder-open-o:before {
         content: "\f115";
+      }
       .fa-smile-o:before {
         content: "\f118";
+      }
       .fa-frown-o:before {
         content: "\f119";
+      }
       .fa-meh-o:before {
         content: "\f11a";
+      }
       .fa-gamepad:before {
         content: "\f11b";
+      }
       .fa-keyboard-o:before {
         content: "\f11c";
+      }
       .fa-flag-o:before {
         content: "\f11d";
+      }
       .fa-flag-checkered:before {
         content: "\f11e";
+      }
       .fa-terminal:before {
         content: "\f120";
+      }
       .fa-code:before {
         content: "\f121";
+      }
       .fa-mail-reply-all:before,
       .fa-reply-all:before {
         content: "\f122";
+      }
       .fa-star-half-empty:before,
       .fa-star-half-full:before,
       .fa-star-half-o:before {
         content: "\f123";
+      }
       .fa-location-arrow:before {
         content: "\f124";
+      }
       .fa-crop:before {
         content: "\f125";
+      }
       .fa-code-fork:before {
         content: "\f126";
+      }
       .fa-unlink:before,
       .fa-chain-broken:before {
         content: "\f127";
+      }
       .fa-question:before {
         content: "\f128";
+      }
       .fa-info:before {
         content: "\f129";
+      }
       .fa-exclamation:before {
         content: "\f12a";
+      }
       .fa-superscript:before {
         content: "\f12b";
+      }
       .fa-subscript:before {
         content: "\f12c";
+      }
       .fa-eraser:before {
         content: "\f12d";
+      }
       .fa-puzzle-piece:before {
         content: "\f12e";
+      }
       .fa-microphone:before {
         content: "\f130";
+      }
       .fa-microphone-slash:before {
         content: "\f131";
+      }
       .fa-shield:before {
         content: "\f132";
+      }
       .fa-calendar-o:before {
         content: "\f133";
+      }
       .fa-fire-extinguisher:before {
         content: "\f134";
+      }
       .fa-rocket:before {
         content: "\f135";
+      }
       .fa-maxcdn:before {
         content: "\f136";
+      }
       .fa-chevron-circle-left:before {
         content: "\f137";
+      }
       .fa-chevron-circle-right:before {
         content: "\f138";
+      }
       .fa-chevron-circle-up:before {
         content: "\f139";
+      }
       .fa-chevron-circle-down:before {
         content: "\f13a";
+      }
       .fa-html5:before {
         content: "\f13b";
+      }
       .fa-css3:before {
         content: "\f13c";
+      }
       .fa-anchor:before {
         content: "\f13d";
+      }
       .fa-unlock-alt:before {
         content: "\f13e";
+      }
       .fa-bullseye:before {
         content: "\f140";
+      }
       .fa-ellipsis-h:before {
         content: "\f141";
+      }
       .fa-ellipsis-v:before {
         content: "\f142";
+      }
       .fa-rss-square:before {
         content: "\f143";
+      }
       .fa-play-circle:before {
         content: "\f144";
+      }
       .fa-ticket:before {
         content: "\f145";
+      }
       .fa-minus-square:before {
         content: "\f146";
+      }
       .fa-minus-square-o:before {
         content: "\f147";
+      }
       .fa-level-up:before {
         content: "\f148";
+      }
       .fa-level-down:before {
         content: "\f149";
+      }
       .fa-check-square:before {
         content: "\f14a";
+      }
       .fa-pencil-square:before {
         content: "\f14b";
+      }
       .fa-external-link-square:before {
         content: "\f14c";
+      }
       .fa-share-square:before {
         content: "\f14d";
+      }
       .fa-compass:before {
         content: "\f14e";
+      }
       .fa-toggle-down:before,
       .fa-caret-square-o-down:before {
         content: "\f150";
+      }
       .fa-toggle-up:before,
       .fa-caret-square-o-up:before {
         content: "\f151";
+      }
       .fa-toggle-right:before,
       .fa-caret-square-o-right:before {
         content: "\f152";
+      }
       .fa-euro:before,
       .fa-eur:before {
         content: "\f153";
+      }
       .fa-gbp:before {
         content: "\f154";
+      }
       .fa-dollar:before,
       .fa-usd:before {
         content: "\f155";
+      }
       .fa-rupee:before,
       .fa-inr:before {
         content: "\f156";
+      }
       .fa-cny:before,
       .fa-rmb:before,
       .fa-yen:before,
       .fa-jpy:before {
         content: "\f157";
+      }
       .fa-ruble:before,
       .fa-rouble:before,
       .fa-rub:before {
         content: "\f158";
+      }
       .fa-won:before,
       .fa-krw:before {
         content: "\f159";
+      }
       .fa-bitcoin:before,
       .fa-btc:before {
         content: "\f15a";
+      }
       .fa-file:before {
         content: "\f15b";
+      }
       .fa-file-text:before {
         content: "\f15c";
+      }
       .fa-sort-alpha-asc:before {
         content: "\f15d";
+      }
       .fa-sort-alpha-desc:before {
         content: "\f15e";
+      }
       .fa-sort-amount-asc:before {
         content: "\f160";
+      }
       .fa-sort-amount-desc:before {
         content: "\f161";
+      }
       .fa-sort-numeric-asc:before {
         content: "\f162";
+      }
       .fa-sort-numeric-desc:before {
         content: "\f163";
+      }
       .fa-thumbs-up:before {
         content: "\f164";
+      }
       .fa-thumbs-down:before {
         content: "\f165";
+      }
       .fa-youtube-square:before {
         content: "\f166";
+      }
       .fa-youtube:before {
         content: "\f167";
+      }
       .fa-xing:before {
         content: "\f168";
+      }
       .fa-xing-square:before {
         content: "\f169";
+      }
       .fa-youtube-play:before {
         content: "\f16a";
+      }
       .fa-dropbox:before {
         content: "\f16b";
+      }
       .fa-stack-overflow:before {
         content: "\f16c";
+      }
       .fa-instagram:before {
         content: "\f16d";
+      }
       .fa-flickr:before {
         content: "\f16e";
+      }
       .fa-adn:before {
         content: "\f170";
+      }
       .fa-bitbucket:before {
         content: "\f171";
+      }
       .fa-bitbucket-square:before {
         content: "\f172";
+      }
       .fa-tumblr:before {
         content: "\f173";
+      }
       .fa-tumblr-square:before {
         content: "\f174";
+      }
       .fa-long-arrow-down:before {
         content: "\f175";
+      }
       .fa-long-arrow-up:before {
         content: "\f176";
+      }
       .fa-long-arrow-left:before {
         content: "\f177";
+      }
       .fa-long-arrow-right:before {
         content: "\f178";
+      }
       .fa-apple:before {
         content: "\f179";
+      }
       .fa-windows:before {
         content: "\f17a";
+      }
       .fa-android:before {
         content: "\f17b";
+      }
       .fa-linux:before {
         content: "\f17c";
+      }
       .fa-dribbble:before {
         content: "\f17d";
+      }
       .fa-skype:before {
         content: "\f17e";
+      }
       .fa-foursquare:before {
         content: "\f180";
+      }
       .fa-trello:before {
         content: "\f181";
+      }
       .fa-female:before {
         content: "\f182";
+      }
       .fa-male:before {
         content: "\f183";
+      }
       .fa-gittip:before {
         content: "\f184";
+      }
       .fa-sun-o:before {
         content: "\f185";
+      }
       .fa-moon-o:before {
         content: "\f186";
+      }
       .fa-archive:before {
         content: "\f187";
+      }
       .fa-bug:before {
         content: "\f188";
+      }
       .fa-vk:before {
         content: "\f189";
+      }
       .fa-weibo:before {
         content: "\f18a";
+      }
       .fa-renren:before {
         content: "\f18b";
+      }
       .fa-pagelines:before {
         content: "\f18c";
+      }
       .fa-stack-exchange:before {
         content: "\f18d";
+      }
       .fa-arrow-circle-o-right:before {
         content: "\f18e";
+      }
       .fa-arrow-circle-o-left:before {
         content: "\f190";
+      }
       .fa-toggle-left:before,
       .fa-caret-square-o-left:before {
         content: "\f191";
+      }
       .fa-dot-circle-o:before {
         content: "\f192";
+      }
       .fa-wheelchair:before {
         content: "\f193";
+      }
       .fa-vimeo-square:before {
         content: "\f194";
+      }
       .fa-turkish-lira:before,
       .fa-try:before {
         content: "\f195";
+      }
       .fa-plus-square-o:before {
         content: "\f196";
+      }
       .fa-space-shuttle:before {
         content: "\f197";
+      }
       .fa-slack:before {
         content: "\f198";
+      }
       .fa-envelope-square:before {
         content: "\f199";
+      }
       .fa-wordpress:before {
         content: "\f19a";
+      }
       .fa-openid:before {
         content: "\f19b";
+      }
       .fa-institution:before,
       .fa-bank:before,
       .fa-university:before {
         content: "\f19c";
+      }
       .fa-mortar-board:before,
       .fa-graduation-cap:before {
         content: "\f19d";
+      }
       .fa-yahoo:before {
         content: "\f19e";
+      }
       .fa-google:before {
         content: "\f1a0";
+      }
       .fa-reddit:before {
         content: "\f1a1";
+      }
       .fa-reddit-square:before {
         content: "\f1a2";
+      }
       .fa-stumbleupon-circle:before {
         content: "\f1a3";
+      }
       .fa-stumbleupon:before {
         content: "\f1a4";
+      }
       .fa-delicious:before {
         content: "\f1a5";
+      }
       .fa-digg:before {
         content: "\f1a6";
+      }
       .fa-pied-piper:before {
         content: "\f1a7";
+      }
       .fa-pied-piper-alt:before {
         content: "\f1a8";
+      }
       .fa-drupal:before {
         content: "\f1a9";
+      }
       .fa-joomla:before {
         content: "\f1aa";
+      }
       .fa-language:before {
         content: "\f1ab";
+      }
       .fa-fax:before {
         content: "\f1ac";
+      }
       .fa-building:before {
         content: "\f1ad";
+      }
       .fa-child:before {
         content: "\f1ae";
+      }
       .fa-paw:before {
         content: "\f1b0";
+      }
       .fa-spoon:before {
         content: "\f1b1";
+      }
       .fa-cube:before {
         content: "\f1b2";
+      }
       .fa-cubes:before {
         content: "\f1b3";
+      }
       .fa-behance:before {
         content: "\f1b4";
+      }
       .fa-behance-square:before {
         content: "\f1b5";
+      }
       .fa-steam:before {
         content: "\f1b6";
+      }
       .fa-steam-square:before {
         content: "\f1b7";
+      }
       .fa-recycle:before {
         content: "\f1b8";
+      }
       .fa-automobile:before,
       .fa-car:before {
         content: "\f1b9";
+      }
       .fa-cab:before,
       .fa-taxi:before {
         content: "\f1ba";
+      }
       .fa-tree:before {
         content: "\f1bb";
+      }
       .fa-spotify:before {
         content: "\f1bc";
+      }
       .fa-deviantart:before {
         content: "\f1bd";
+      }
       .fa-soundcloud:before {
         content: "\f1be";
+      }
       .fa-database:before {
         content: "\f1c0";
+      }
       .fa-file-pdf-o:before {
         content: "\f1c1";
+      }
       .fa-file-word-o:before {
         content: "\f1c2";
+      }
       .fa-file-excel-o:before {
         content: "\f1c3";
+      }
       .fa-file-powerpoint-o:before {
         content: "\f1c4";
+      }
       .fa-file-photo-o:before,
       .fa-file-picture-o:before,
       .fa-file-image-o:before {
         content: "\f1c5";
+      }
       .fa-file-zip-o:before,
       .fa-file-archive-o:before {
         content: "\f1c6";
+      }
       .fa-file-sound-o:before,
       .fa-file-audio-o:before {
         content: "\f1c7";
+      }
       .fa-file-movie-o:before,
       .fa-file-video-o:before {
         content: "\f1c8";
+      }
       .fa-file-code-o:before {
         content: "\f1c9";
+      }
       .fa-vine:before {
         content: "\f1ca";
+      }
       .fa-codepen:before {
         content: "\f1cb";
+      }
       .fa-jsfiddle:before {
         content: "\f1cc";
+      }
       .fa-life-bouy:before,
       .fa-life-buoy:before,
       .fa-life-saver:before,
       .fa-support:before,
       .fa-life-ring:before {
         content: "\f1cd";
+      }
       .fa-circle-o-notch:before {
         content: "\f1ce";
+      }
       .fa-ra:before,
       .fa-rebel:before {
         content: "\f1d0";
+      }
       .fa-ge:before,
       .fa-empire:before {
         content: "\f1d1";
+      }
       .fa-git-square:before {
         content: "\f1d2";
+      }
       .fa-git:before {
         content: "\f1d3";
+      }
       .fa-hacker-news:before {
         content: "\f1d4";
+      }
       .fa-tencent-weibo:before {
         content: "\f1d5";
+      }
       .fa-qq:before {
         content: "\f1d6";
+      }
       .fa-wechat:before,
       .fa-weixin:before {
         content: "\f1d7";
+      }
       .fa-send:before,
       .fa-paper-plane:before {
         content: "\f1d8";
+      }
       .fa-send-o:before,
       .fa-paper-plane-o:before {
         content: "\f1d9";
+      }
       .fa-history:before {
         content: "\f1da";
+      }
       .fa-circle-thin:before {
         content: "\f1db";
+      }
       .fa-header:before {
         content: "\f1dc";
+      }
       .fa-paragraph:before {
         content: "\f1dd";
+      }
       .fa-sliders:before {
         content: "\f1de";
+      }
       .fa-share-alt:before {
         content: "\f1e0";
+      }
       .fa-share-alt-square:before {
         content: "\f1e1";
+      }
       .fa-bomb:before {
         content: "\f1e2";
+      }
       .fa-soccer-ball-o:before,
       .fa-futbol-o:before {
         content: "\f1e3";
+      }
       .fa-tty:before {
         content: "\f1e4";
+      }
       .fa-binoculars:before {
         content: "\f1e5";
+      }
       .fa-plug:before {
         content: "\f1e6";
+      }
       .fa-slideshare:before {
         content: "\f1e7";
+      }
       .fa-twitch:before {
         content: "\f1e8";
+      }
       .fa-yelp:before {
         content: "\f1e9";
+      }
       .fa-newspaper-o:before {
         content: "\f1ea";
+      }
       .fa-wifi:before {
         content: "\f1eb";
+      }
       .fa-calculator:before {
         content: "\f1ec";
+      }
       .fa-paypal:before {
         content: "\f1ed";
+      }
       .fa-google-wallet:before {
         content: "\f1ee";
+      }
       .fa-cc-visa:before {
         content: "\f1f0";
+      }
       .fa-cc-mastercard:before {
         content: "\f1f1";
+      }
       .fa-cc-discover:before {
         content: "\f1f2";
+      }
       .fa-cc-amex:before {
         content: "\f1f3";
+      }
       .fa-cc-paypal:before {
         content: "\f1f4";
+      }
       .fa-cc-stripe:before {
         content: "\f1f5";
+      }
       .fa-bell-slash:before {
         content: "\f1f6";
+      }
       .fa-bell-slash-o:before {
         content: "\f1f7";
+      }
       .fa-trash:before {
         content: "\f1f8";
+      }
       .fa-copyright:before {
         content: "\f1f9";
+      }
       .fa-at:before {
         content: "\f1fa";
+      }
       .fa-eyedropper:before {
         content: "\f1fb";
+      }
       .fa-paint-brush:before {
         content: "\f1fc";
+      }
       .fa-birthday-cake:before {
         content: "\f1fd";
+      }
       .fa-area-chart:before {
         content: "\f1fe";
+      }
       .fa-pie-chart:before {
         content: "\f200";
+      }
       .fa-line-chart:before {
         content: "\f201";
+      }
       .fa-lastfm:before {
         content: "\f202";
+      }
       .fa-lastfm-square:before {
         content: "\f203";
+      }
       .fa-toggle-off:before {
         content: "\f204";
+      }
       .fa-toggle-on:before {
         content: "\f205";
+      }
       .fa-bicycle:before {
         content: "\f206";
+      }
       .fa-bus:before {
         content: "\f207";
+      }
       .fa-ioxhost:before {
         content: "\f208";
+      }
       .fa-angellist:before {
         content: "\f209";
+      }
       .fa-cc:before {
         content: "\f20a";
+      }
       .fa-shekel:before,
       .fa-sheqel:before,
       .fa-ils:before {
         content: "\f20b";
+      }
       .fa-meanpath:before {
         content: "\f20c";
+      }
       /*!
+      *
       * IPython base
+      *
       */
       .modal.fade .modal-dialog {
         -webkit-transform: translate(0, 0);
         -ms-transform: translate(0, 0);
         -o-transform: translate(0, 0);
         transform: translate(0, 0);
+      }
       code {
         color: #000;
+      }
       pre {
         font-size: inherit;
         line-height: inherit;
+      }
       label {
         font-weight: normal;
+      }
       /* Make the page background atleast 100% the height of the view port */
       /* Make the page itself atleast 70% the height of the view port */
       .border-box-sizing {
         box-sizing: border-box;
         -moz-box-sizing: border-box;
         -webkit-box-sizing: border-box;
+      }
       .corner-all {
         border-radius: 2px;
+      }
       .no-padding {
         padding: 0px;
+      }
       /* Flexible box model classes */
       /* Taken from Alex Russell http://infrequently.org/2009/08/css-3-progress/ */
       /* This file is a compatability layer.  It allows the usage of flexible box
       model layouts accross multiple browsers, including older browsers.  The newest,
       universal implementation of the flexible box model is used when available (see
       `Modern browsers` comments below).  Browsers that are known to implement this
       new spec completely include:
           Firefox 28.0+
           Chrome 29.0+
           Internet Explorer 11+
           Opera 17.0+
       Browsers not listed, including Safari, are supported via the styling under the
       `Old browsers` comments below.
       */
       .hbox {
         /* Old browsers */
         display: -webkit-box;
         -webkit-box-orient: horizontal;
         -webkit-box-align: stretch;
         display: -moz-box;
         -moz-box-orient: horizontal;
         -moz-box-align: stretch;
         display: box;
         box-orient: horizontal;
         box-align: stretch;
         /* Modern browsers */
         display: flex;
         flex-direction: row;
         align-items: stretch;
+      }
       .hbox > * {
         /* Old browsers */
         -webkit-box-flex: 0;
         -moz-box-flex: 0;
         box-flex: 0;
         /* Modern browsers */
         flex: none;
+      }
       .vbox {
         /* Old browsers */
         display: -webkit-box;
         -webkit-box-orient: vertical;
         -webkit-box-align: stretch;
         display: -moz-box;
         -moz-box-orient: vertical;
         -moz-box-align: stretch;
         display: box;
         box-orient: vertical;
         box-align: stretch;
         /* Modern browsers */
         display: flex;
         flex-direction: column;
         align-items: stretch;
+      }
       .vbox > * {
         /* Old browsers */
         -webkit-box-flex: 0;
         -moz-box-flex: 0;
         box-flex: 0;
         /* Modern browsers */
         flex: none;
+      }
       .hbox.reverse,
       .vbox.reverse,
       .reverse {
         /* Old browsers */
         -webkit-box-direction: reverse;
         -moz-box-direction: reverse;
         box-direction: reverse;
         /* Modern browsers */
         flex-direction: row-reverse;
+      }
       .hbox.box-flex0,
       .vbox.box-flex0,
       .box-flex0 {
         /* Old browsers */
         -webkit-box-flex: 0;
         -moz-box-flex: 0;
         box-flex: 0;
         /* Modern browsers */
         flex: none;
         width: auto;
+      }
       .hbox.box-flex1,
       .vbox.box-flex1,
       .box-flex1 {
         /* Old browsers */
         -webkit-box-flex: 1;
         -moz-box-flex: 1;
         box-flex: 1;
         /* Modern browsers */
         flex: 1;
+      }
       .hbox.box-flex,
       .vbox.box-flex,
       .box-flex {
         /* Old browsers */
         /* Old browsers */
         -webkit-box-flex: 1;
         -moz-box-flex: 1;
         box-flex: 1;
         /* Modern browsers */
         flex: 1;
+      }
       .hbox.box-flex2,
       .vbox.box-flex2,
       .box-flex2 {
         /* Old browsers */
         -webkit-box-flex: 2;
         -moz-box-flex: 2;
         box-flex: 2;
         /* Modern browsers */
         flex: 2;
+      }
       .box-group1 {
         /*  Deprecated */
         -webkit-box-flex-group: 1;
         -moz-box-flex-group: 1;
         box-flex-group: 1;
+      }
       .box-group2 {
         /* Deprecated */
         -webkit-box-flex-group: 2;
         -moz-box-flex-group: 2;
         box-flex-group: 2;
+      }
       .hbox.start,
       .vbox.start,
       .start {
         /* Old browsers */
         -webkit-box-pack: start;
         -moz-box-pack: start;
         box-pack: start;
         /* Modern browsers */
         justify-content: flex-start;
+      }
       .hbox.end,
       .vbox.end,
       .end {
         /* Old browsers */
         -webkit-box-pack: end;
         -moz-box-pack: end;
         box-pack: end;
         /* Modern browsers */
         justify-content: flex-end;
+      }
       .hbox.center,
       .vbox.center,
       .center {
         /* Old browsers */
         -webkit-box-pack: center;
         -moz-box-pack: center;
         box-pack: center;
         /* Modern browsers */
         justify-content: center;
+      }
       .hbox.baseline,
       .vbox.baseline,
       .baseline {
         /* Old browsers */
         -webkit-box-pack: baseline;
         -moz-box-pack: baseline;
         box-pack: baseline;
         /* Modern browsers */
         justify-content: baseline;
+      }
       .hbox.stretch,
       .vbox.stretch,
       .stretch {
         /* Old browsers */
         -webkit-box-pack: stretch;
         -moz-box-pack: stretch;
         box-pack: stretch;
         /* Modern browsers */
         justify-content: stretch;
+      }
       .hbox.align-start,
       .vbox.align-start,
       .align-start {
         /* Old browsers */
         -webkit-box-align: start;
         -moz-box-align: start;
         box-align: start;
         /* Modern browsers */
         align-items: flex-start;
+      }
       .hbox.align-end,
       .vbox.align-end,
       .align-end {
         /* Old browsers */
         -webkit-box-align: end;
         -moz-box-align: end;
         box-align: end;
         /* Modern browsers */
         align-items: flex-end;
+      }
       .hbox.align-center,
       .vbox.align-center,
       .align-center {
         /* Old browsers */
         -webkit-box-align: center;
         -moz-box-align: center;
         box-align: center;
         /* Modern browsers */
         align-items: center;
+      }
       .hbox.align-baseline,
       .vbox.align-baseline,
       .align-baseline {
         /* Old browsers */
         -webkit-box-align: baseline;
         -moz-box-align: baseline;
         box-align: baseline;
         /* Modern browsers */
         align-items: baseline;
+      }
       .hbox.align-stretch,
       .vbox.align-stretch,
       .align-stretch {
         /* Old browsers */
         -webkit-box-align: stretch;
         -moz-box-align: stretch;
         box-align: stretch;
         /* Modern browsers */
         align-items: stretch;
+      }
       div.error {
         margin: 2em;
         text-align: center;
+      }
       div.error > h1 {
         font-size: 500%;
         line-height: normal;
+      }
       div.error > p {
         font-size: 200%;
         line-height: normal;
+      }
       div.traceback-wrapper {
         text-align: left;
         max-width: 800px;
         margin: auto;
+      }
       /**
        * Primary styles
+       *
        * Author: Jupyter Development Team
        */
       body {
         background-color: #fff;
         /* This makes sure that the body covers the entire window and needs to
              be in a different element than the display: box in wrapper below */
         position: absolute;
         left: 0px;
         right: 0px;
         top: 0px;
         bottom: 0px;
         overflow: visible;
+      }
       body > #header {
         /* Initially hidden to prevent FLOUC */
         display: none;
         background-color: #fff;
         /* Display over codemirror */
         position: relative;
         z-index: 100;
+      }
       body > #header #header-container {
         padding-bottom: 5px;
         padding-top: 5px;
         box-sizing: border-box;
         -moz-box-sizing: border-box;
         -webkit-box-sizing: border-box;
+      }
       body > #header .header-bar {
         width: 100%;
         height: 1px;
         background: #e7e7e7;
         margin-bottom: -1px;
+      }
       @media print {
         body > #header {
           display: none !important;
+        }
+      }
       #header-spacer {
         width: 100%;
         visibility: hidden;
+      }
       @media print {
         #header-spacer {
           display: none;
+        }
+      }
       #ipython_notebook {
         padding-left: 0px;
         padding-top: 1px;
         padding-bottom: 1px;
+      }
       @media (max-width: 991px) {
         #ipython_notebook {
           margin-left: 10px;
+        }
+      }
       [dir="rtl"] #ipython_notebook {
         float: right !important;
+      }
       #noscript {
         width: auto;
         padding-top: 16px;
         padding-bottom: 16px;
         text-align: center;
         font-size: 22px;
         color: red;
         font-weight: bold;
+      }
       #ipython_notebook img {
         height: 28px;
+      }
       #site {
         width: 100%;
         display: none;
         box-sizing: border-box;
         -moz-box-sizing: border-box;
         -webkit-box-sizing: border-box;
         overflow: auto;
+      }
       @media print {
         #site {
           height: auto !important;
+        }
+      }
       /* Smaller buttons */
       .ui-button .ui-button-text {
         padding: 0.2em 0.8em;
         font-size: 77%;
+      }
       input.ui-button {
         padding: 0.3em 0.9em;
+      }
       span#login_widget {
         float: right;
+      }
       span#login_widget > .button,
       #logout {
         color: #333;
         background-color: #fff;
         border-color: #ccc;
+      }
       span#login_widget > .button:focus,
       #logout:focus,
       span#login_widget > .button.focus,
       #logout.focus {
         color: #333;
         background-color: #e6e6e6;
         border-color: #8c8c8c;
+      }
       span#login_widget > .button:hover,
       #logout:hover {
         color: #333;
         background-color: #e6e6e6;
         border-color: #adadad;
+      }
       span#login_widget > .button:active,
       #logout:active,
       span#login_widget > .button.active,
       #logout.active,
       .open > .dropdown-togglespan#login_widget > .button,
       .open > .dropdown-toggle#logout {
         color: #333;
         background-color: #e6e6e6;
         border-color: #adadad;
+      }
       span#login_widget > .button:active:hover,
       #logout:active:hover,
       span#login_widget > .button.active:hover,
       #logout.active:hover,
       .open > .dropdown-togglespan#login_widget > .button:hover,
       .open > .dropdown-toggle#logout:hover,
       span#login_widget > .button:active:focus,
       #logout:active:focus,
       span#login_widget > .button.active:focus,
       #logout.active:focus,
       .open > .dropdown-togglespan#login_widget > .button:focus,
       .open > .dropdown-toggle#logout:focus,
       span#login_widget > .button:active.focus,
       #logout:active.focus,
       span#login_widget > .button.active.focus,
       #logout.active.focus,
       .open > .dropdown-togglespan#login_widget > .button.focus,
       .open > .dropdown-toggle#logout.focus {
         color: #333;
         background-color: #d4d4d4;
         border-color: #8c8c8c;
+      }
       span#login_widget > .button:active,
       #logout:active,
       span#login_widget > .button.active,
       #logout.active,
       .open > .dropdown-togglespan#login_widget > .button,
       .open > .dropdown-toggle#logout {
         background-image: none;
+      }
       span#login_widget > .button.disabled:hover,
       #logout.disabled:hover,
       span#login_widget > .button[disabled]:hover,
       #logout[disabled]:hover,
       fieldset[disabled] span#login_widget > .button:hover,
       fieldset[disabled] #logout:hover,
       span#login_widget > .button.disabled:focus,
       #logout.disabled:focus,
       span#login_widget > .button[disabled]:focus,
       #logout[disabled]:focus,
       fieldset[disabled] span#login_widget > .button:focus,
       fieldset[disabled] #logout:focus,
       span#login_widget > .button.disabled.focus,
       #logout.disabled.focus,
       span#login_widget > .button[disabled].focus,
       #logout[disabled].focus,
       fieldset[disabled] span#login_widget > .button.focus,
       fieldset[disabled] #logout.focus {
         background-color: #fff;
         border-color: #ccc;
+      }
       span#login_widget > .button .badge,
       #logout .badge {
         color: #fff;
         background-color: #333;
+      }
       .nav-header {
         text-transform: none;
+      }
       #header > span {
         margin-top: 10px;
+      }
       .modal_stretch .modal-dialog {
         /* Old browsers */
         display: -webkit-box;
         -webkit-box-orient: vertical;
         -webkit-box-align: stretch;
         display: -moz-box;
         -moz-box-orient: vertical;
         -moz-box-align: stretch;
         display: box;
         box-orient: vertical;
         box-align: stretch;
         /* Modern browsers */
         display: flex;
         flex-direction: column;
         align-items: stretch;
         min-height: 80vh;
+      }
       .modal_stretch .modal-dialog .modal-body {
         max-height: calc(100vh - 200px);
         overflow: auto;
         flex: 1;
+      }
       @media (min-width: 768px) {
         .modal .modal-dialog {
           width: 700px;
+        }
+      }
       @media (min-width: 768px) {
         select.form-control {
           margin-left: 12px;
           margin-right: 12px;
+        }
+      }
       /*!
+      *
       * IPython auth
+      *
       */
       .center-nav {
         display: inline-block;
         margin-bottom: -4px;
+      }
       /*!
+      *
       * IPython tree view
+      *
       */
       /* We need an invisible input field on top of the sentense*/
       /* "Drag file onto the list ..." */
       .alternate_upload {
         background-color: none;
         display: inline;
+      }
       .alternate_upload.form {
         padding: 0;
         margin: 0;
+      }
       .alternate_upload input.fileinput {
         text-align: center;
         vertical-align: middle;
         display: inline;
         opacity: 0;
         z-index: 2;
         width: 12ex;
         margin-right: -12ex;
+      }
       .alternate_upload .btn-upload {
         height: 22px;
+      }
       /**
        * Primary styles
+       *
        * Author: Jupyter Development Team
        */
       [dir="rtl"] #tabs li {
         float: right;
+      }
       ul#tabs {
         margin-bottom: 4px;
+      }
       [dir="rtl"] ul#tabs {
         margin-right: 0px;
+      }
       ul#tabs a {
         padding-top: 6px;
         padding-bottom: 4px;
+      }
       ul.breadcrumb a:focus,
       ul.breadcrumb a:hover {
         text-decoration: none;
+      }
       ul.breadcrumb i.icon-home {
         font-size: 16px;
         margin-right: 4px;
+      }
       ul.breadcrumb span {
         color: #5e5e5e;
+      }
       .list_toolbar {
         padding: 4px 0 4px 0;
         vertical-align: middle;
+      }
       .list_toolbar .tree-buttons {
         padding-top: 1px;
+      }
       [dir="rtl"] .list_toolbar .tree-buttons {
         float: left !important;
+      }
       [dir="rtl"] .list_toolbar .pull-right {
         padding-top: 1px;
         float: left !important;
+      }
       [dir="rtl"] .list_toolbar .pull-left {
         float: right !important;
+      }
       .dynamic-buttons {
         padding-top: 3px;
         display: inline-block;
+      }
       .list_toolbar [class*="span"] {
         min-height: 24px;
+      }
       .list_header {
         font-weight: bold;
         background-color: #EEE;
+      }
       .list_placeholder {
         font-weight: bold;
         padding-top: 4px;
         padding-bottom: 4px;
         padding-left: 7px;
         padding-right: 7px;
+      }
       .list_container {
         margin-top: 4px;
         margin-bottom: 20px;
         border: 1px solid #ddd;
         border-radius: 2px;
+      }
       .list_container > div {
         border-bottom: 1px solid #ddd;
+      }
       .list_container > div:hover .list-item {
         background-color: red;
+      }
       .list_container > div:last-child {
         border: none;
+      }
       .list_item:hover .list_item {
         background-color: #ddd;
+      }
       .list_item a {
         text-decoration: none;
+      }
       .list_item:hover {
         background-color: #fafafa;
+      }
       .list_header > div,
       .list_item > div {
         padding-top: 4px;
         padding-bottom: 4px;
         padding-left: 7px;
         padding-right: 7px;
         line-height: 22px;
+      }
       .list_header > div input,
       .list_item > div input {
         margin-right: 7px;
         margin-left: 14px;
         vertical-align: baseline;
         line-height: 22px;
         position: relative;
         top: -1px;
+      }
       .list_header > div .item_link,
       .list_item > div .item_link {
         margin-left: -1px;
         vertical-align: baseline;
         line-height: 22px;
+      }
       .new-file input[type=checkbox] {
         visibility: hidden;
+      }
       .item_name {
         line-height: 22px;
         height: 24px;
+      }
       .item_icon {
         font-size: 14px;
         color: #5e5e5e;
         margin-right: 7px;
         margin-left: 7px;
         line-height: 22px;
         vertical-align: baseline;
+      }
       .item_buttons {
         line-height: 1em;
         margin-left: -5px;
+      }
       .item_buttons .btn,
       .item_buttons .btn-group,
       .item_buttons .input-group {
         float: left;
+      }
       .item_buttons > .btn,
       .item_buttons > .btn-group,
       .item_buttons > .input-group {
         margin-left: 5px;
+      }
       .item_buttons .btn {
         min-width: 13ex;
+      }
       .item_buttons .running-indicator {
         padding-top: 4px;
         color: #5cb85c;
+      }
       .item_buttons .kernel-name {
         padding-top: 4px;
         color: #5bc0de;
         margin-right: 7px;
         float: left;
+      }
       .toolbar_info {
         height: 24px;
         line-height: 24px;
+      }
       .list_item input:not([type=checkbox]) {
         padding-top: 3px;
         padding-bottom: 3px;
         height: 22px;
         line-height: 14px;
         margin: 0px;
+      }
       .highlight_text {
         color: blue;
+      }
       #project_name {
         display: inline-block;
         padding-left: 7px;
         margin-left: -2px;
+      }
       #project_name > .breadcrumb {
         padding: 0px;
         margin-bottom: 0px;
         background-color: transparent;
         font-weight: bold;
+      }
       #tree-selector {
         padding-right: 0px;
+      }
       [dir="rtl"] #tree-selector a {
         float: right;
+      }
       #button-select-all {
         min-width: 50px;
+      }
       #select-all {
         margin-left: 7px;
         margin-right: 2px;
+      }
       .menu_icon {
         margin-right: 2px;
+      }
       .tab-content .row {
         margin-left: 0px;
         margin-right: 0px;
+      }
       .folder_icon:before {
         display: inline-block;
         font: normal normal normal 14px/1 FontAwesome;
         font-size: inherit;
         text-rendering: auto;
         -webkit-font-smoothing: antialiased;
         -moz-osx-font-smoothing: grayscale;
         content: "\f114";
+      }
       .folder_icon:before.pull-left {
         margin-right: .3em;
+      }
       .folder_icon:before.pull-right {
         margin-left: .3em;
+      }
       .notebook_icon:before {
         display: inline-block;
         font: normal normal normal 14px/1 FontAwesome;
         font-size: inherit;
         text-rendering: auto;
         -webkit-font-smoothing: antialiased;
         -moz-osx-font-smoothing: grayscale;
         content: "\f02d";
         position: relative;
         top: -1px;
+      }
       .notebook_icon:before.pull-left {
         margin-right: .3em;
+      }
       .notebook_icon:before.pull-right {
         margin-left: .3em;
+      }
       .running_notebook_icon:before {
         display: inline-block;
         font: normal normal normal 14px/1 FontAwesome;
         font-size: inherit;
         text-rendering: auto;
         -webkit-font-smoothing: antialiased;
         -moz-osx-font-smoothing: grayscale;
         content: "\f02d";
         position: relative;
         top: -1px;
         color: #5cb85c;
+      }
       .running_notebook_icon:before.pull-left {
         margin-right: .3em;
+      }
       .running_notebook_icon:before.pull-right {
         margin-left: .3em;
+      }
       .file_icon:before {
         display: inline-block;
         font: normal normal normal 14px/1 FontAwesome;
         font-size: inherit;
         text-rendering: auto;
         -webkit-font-smoothing: antialiased;
         -moz-osx-font-smoothing: grayscale;
         content: "\f016";
         position: relative;
         top: -2px;
+      }
       .file_icon:before.pull-left {
         margin-right: .3em;
+      }
       .file_icon:before.pull-right {
         margin-left: .3em;
+      }
       #notebook_toolbar .pull-right {
         padding-top: 0px;
         margin-right: -1px;
+      }
       ul#new-menu {
         left: auto;
         right: 0;
+      }
       [dir="rtl"] #new-menu {
         text-align: right;
+      }
       .kernel-menu-icon {
         padding-right: 12px;
         width: 24px;
         content: "\f096";
+      }
       .kernel-menu-icon:before {
         content: "\f096";
+      }
       .kernel-menu-icon-current:before {
         content: "\f00c";
+      }
       #tab_content {
         padding-top: 20px;
+      }
       #running .panel-group .panel {
         margin-top: 3px;
         margin-bottom: 1em;
+      }
       #running .panel-group .panel .panel-heading {
         background-color: #EEE;
         padding-top: 4px;
         padding-bottom: 4px;
         padding-left: 7px;
         padding-right: 7px;
         line-height: 22px;
+      }
       #running .panel-group .panel .panel-heading a:focus,
       #running .panel-group .panel .panel-heading a:hover {
         text-decoration: none;
+      }
       #running .panel-group .panel .panel-body {
         padding: 0px;
+      }
       #running .panel-group .panel .panel-body .list_container {
         margin-top: 0px;
         margin-bottom: 0px;
         border: 0px;
         border-radius: 0px;
+      }
       #running .panel-group .panel .panel-body .list_container .list_item {
         border-bottom: 1px solid #ddd;
+      }
       #running .panel-group .panel .panel-body .list_container .list_item:last-child {
         border-bottom: 0px;
+      }
       [dir="rtl"] #running .col-sm-8 {
         float: right !important;
+      }
       .delete-button {
         display: none;
+      }
       .duplicate-button {
         display: none;
+      }
       .rename-button {
         display: none;
+      }
       .shutdown-button {
         display: none;
+      }
       .dynamic-instructions {
         display: inline-block;
         padding-top: 4px;
+      }
       /*!
+      *
       * IPython text editor webapp
+      *
       */
       .selected-keymap i.fa {
         padding: 0px 5px;
+      }
       .selected-keymap i.fa:before {
         content: "\f00c";
+      }
       #mode-menu {
         overflow: auto;
         max-height: 20em;
+      }
       .edit_app #header {
         -webkit-box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2);
         box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2);
+      }
       .edit_app #menubar .navbar {
         /* Use a negative 1 bottom margin, so the border overlaps the border of the
           header */
         margin-bottom: -1px;
+      }
       .dirty-indicator {
         display: inline-block;
         font: normal normal normal 14px/1 FontAwesome;
         font-size: inherit;
         text-rendering: auto;
         -webkit-font-smoothing: antialiased;
         -moz-osx-font-smoothing: grayscale;
         width: 20px;
+      }
       .dirty-indicator.pull-left {
         margin-right: .3em;
+      }
       .dirty-indicator.pull-right {
         margin-left: .3em;
+      }
       .dirty-indicator-dirty {
         display: inline-block;
         font: normal normal normal 14px/1 FontAwesome;
         font-size: inherit;
         text-rendering: auto;
         -webkit-font-smoothing: antialiased;
         -moz-osx-font-smoothing: grayscale;
         width: 20px;
+      }
       .dirty-indicator-dirty.pull-left {
         margin-right: .3em;
+      }
       .dirty-indicator-dirty.pull-right {
         margin-left: .3em;
+      }
       .dirty-indicator-clean {
         display: inline-block;
         font: normal normal normal 14px/1 FontAwesome;
         font-size: inherit;
         text-rendering: auto;
         -webkit-font-smoothing: antialiased;
         -moz-osx-font-smoothing: grayscale;
         width: 20px;
+      }
       .dirty-indicator-clean.pull-left {
         margin-right: .3em;
+      }
       .dirty-indicator-clean.pull-right {
         margin-left: .3em;
+      }
       .dirty-indicator-clean:before {
         display: inline-block;
         font: normal normal normal 14px/1 FontAwesome;
         font-size: inherit;
         text-rendering: auto;
         -webkit-font-smoothing: antialiased;
         -moz-osx-font-smoothing: grayscale;
         content: "\f00c";
+      }
       .dirty-indicator-clean:before.pull-left {
         margin-right: .3em;
+      }
       .dirty-indicator-clean:before.pull-right {
         margin-left: .3em;
+      }
       #filename {
         font-size: 16pt;
         display: table;
         padding: 0px 5px;
+      }
       #current-mode {
         padding-left: 5px;
         padding-right: 5px;
+      }
       #texteditor-backdrop {
         padding-top: 20px;
         padding-bottom: 20px;
+      }
       @media not print {
         #texteditor-backdrop {
           background-color: #EEE;
+        }
+      }
       @media print {
         #texteditor-backdrop #texteditor-container .CodeMirror-gutter,
         #texteditor-backdrop #texteditor-container .CodeMirror-gutters {
           background-color: #fff;
+        }
+      }
       @media not print {
         #texteditor-backdrop #texteditor-container .CodeMirror-gutter,
         #texteditor-backdrop #texteditor-container .CodeMirror-gutters {
           background-color: #fff;
+        }
+      }
       @media not print {
         #texteditor-backdrop #texteditor-container {
           padding: 0px;
           background-color: #fff;
           -webkit-box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2);
           box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2);
+        }
+      }
       /*!
+      *
       * IPython notebook
+      *
       */
       /* CSS font colors for translated ANSI colors. */
       .ansibold {
         font-weight: bold;
+      }
       /* use dark versions for foreground, to improve visibility */
       .ansiblack {
         color: black;
+      }
       .ansired {
         color: darkred;
+      }
       .ansigreen {
         color: darkgreen;
+      }
       .ansiyellow {
         color: #c4a000;
+      }
       .ansiblue {
         color: darkblue;
+      }
       .ansipurple {
         color: darkviolet;
+      }
       .ansicyan {
         color: steelblue;
+      }
       .ansigray {
         color: gray;
+      }
       /* and light for background, for the same reason */
       .ansibgblack {
         background-color: black;
+      }
       .ansibgred {
         background-color: red;
+      }
       .ansibggreen {
         background-color: green;
+      }
       .ansibgyellow {
         background-color: yellow;
+      }
       .ansibgblue {
         background-color: blue;
+      }
       .ansibgpurple {
         background-color: magenta;
+      }
       .ansibgcyan {
         background-color: cyan;
+      }
       .ansibggray {
         background-color: gray;
+      }
       div.cell {
         /* Old browsers */
         display: -webkit-box;
         -webkit-box-orient: vertical;
         -webkit-box-align: stretch;
         display: -moz-box;
         -moz-box-orient: vertical;
         -moz-box-align: stretch;
         display: box;
         box-orient: vertical;
         box-align: stretch;
         /* Modern browsers */
         display: flex;
         flex-direction: column;
         align-items: stretch;
         border-radius: 2px;
         box-sizing: border-box;
         -moz-box-sizing: border-box;
         -webkit-box-sizing: border-box;
         border-width: 1px;
         border-style: solid;
         border-color: transparent;
         width: 100%;
         padding: 5px;
         /* This acts as a spacer between cells, that is outside the border */
         margin: 0px;
         outline: none;
         border-left-width: 1px;
         padding-left: 5px;
         background: linear-gradient(to right, transparent -40px, transparent 1px, transparent 1px, transparent 100%);
+      }
       div.cell.jupyter-soft-selected {
         border-left-color: #90CAF9;
         border-left-color: #E3F2FD;
         border-left-width: 1px;
         padding-left: 5px;
         border-right-color: #E3F2FD;
         border-right-width: 1px;
         background: #E3F2FD;
+      }
       @media print {
         div.cell.jupyter-soft-selected {
           border-color: transparent;
+        }
+      }
       div.cell.selected {
         border-color: #ababab;
         border-left-width: 0px;
         padding-left: 6px;
         background: linear-gradient(to right, #42A5F5 -40px, #42A5F5 5px, transparent 5px, transparent 100%);
+      }
       @media print {
         div.cell.selected {
           border-color: transparent;
+        }
+      }
       div.cell.selected.jupyter-soft-selected {
         border-left-width: 0;
         padding-left: 6px;
         background: linear-gradient(to right, #42A5F5 -40px, #42A5F5 7px, #E3F2FD 7px, #E3F2FD 100%);
+      }
       .edit_mode div.cell.selected {
         border-color: #66BB6A;
         border-left-width: 0px;
         padding-left: 6px;
         background: linear-gradient(to right, #66BB6A -40px, #66BB6A 5px, transparent 5px, transparent 100%);
+      }
       @media print {
         .edit_mode div.cell.selected {
           border-color: transparent;
+        }
+      }
       .prompt {
         /* This needs to be wide enough for 3 digit prompt numbers: In[100]: */
         min-width: 14ex;
         /* This padding is tuned to match the padding on the CodeMirror editor. */
         padding: 0.4em;
         margin: 0px;
         font-family: monospace;
         text-align: right;
         /* This has to match that of the the CodeMirror class line-height below */
         line-height: 1.21429em;
         /* Don't highlight prompt number selection */
         -webkit-touch-callout: none;
         -webkit-user-select: none;
         -khtml-user-select: none;
         -moz-user-select: none;
         -ms-user-select: none;
         user-select: none;
         /* Use default cursor */
         cursor: default;
+      }
       @media (max-width: 540px) {
         .prompt {
           text-align: left;
+        }
+      }
       div.inner_cell {
         min-width: 0;
         /* Old browsers */
         display: -webkit-box;
         -webkit-box-orient: vertical;
         -webkit-box-align: stretch;
         display: -moz-box;
         -moz-box-orient: vertical;
         -moz-box-align: stretch;
         display: box;
         box-orient: vertical;
         box-align: stretch;
         /* Modern browsers */
         display: flex;
         flex-direction: column;
         align-items: stretch;
         /* Old browsers */
         -webkit-box-flex: 1;
         -moz-box-flex: 1;
         box-flex: 1;
         /* Modern browsers */
         flex: 1;
+      }
       /* input_area and input_prompt must match in top border and margin for alignment */
       div.input_area {
         border: 1px solid #cfcfcf;
         border-radius: 2px;
         background: #f7f7f7;
         line-height: 1.21429em;
+      }
       /* This is needed so that empty prompt areas can collapse to zero height when there
          is no content in the output_subarea and the prompt. The main purpose of this is
          to make sure that empty JavaScript output_subareas have no height. */
       div.prompt:empty {
         padding-top: 0;
         padding-bottom: 0;
+      }
       div.unrecognized_cell {
         padding: 5px 5px 5px 0px;
         /* Old browsers */
         display: -webkit-box;
         -webkit-box-orient: horizontal;
         -webkit-box-align: stretch;
         display: -moz-box;
         -moz-box-orient: horizontal;
         -moz-box-align: stretch;
         display: box;
         box-orient: horizontal;
         box-align: stretch;
         /* Modern browsers */
         display: flex;
         flex-direction: row;
         align-items: stretch;
+      }
       div.unrecognized_cell .inner_cell {
         border-radius: 2px;
         padding: 5px;
         font-weight: bold;
         color: red;
         border: 1px solid #cfcfcf;
         background: #eaeaea;
+      }
       div.unrecognized_cell .inner_cell a {
         color: inherit;
         text-decoration: none;
+      }
       div.unrecognized_cell .inner_cell a:hover {
         color: inherit;
         text-decoration: none;
+      }
       @media (max-width: 540px) {
         div.unrecognized_cell > div.prompt {
           display: none;
+        }
+      }
       div.code_cell {
         /* avoid page breaking on code cells when printing */
+      }
       @media print {
         div.code_cell {
           page-break-inside: avoid;
+        }
+      }
       /* any special styling for code cells that are currently running goes here */
       div.input {
         page-break-inside: avoid;
         /* Old browsers */
         display: -webkit-box;
         -webkit-box-orient: horizontal;
         -webkit-box-align: stretch;
         display: -moz-box;
         -moz-box-orient: horizontal;
         -moz-box-align: stretch;
         display: box;
         box-orient: horizontal;
         box-align: stretch;
         /* Modern browsers */
         display: flex;
         flex-direction: row;
         align-items: stretch;
+      }
       @media (max-width: 540px) {
         div.input {
           /* Old browsers */
           display: -webkit-box;
           -webkit-box-orient: vertical;
           -webkit-box-align: stretch;
           display: -moz-box;
           -moz-box-orient: vertical;
           -moz-box-align: stretch;
           display: box;
           box-orient: vertical;
           box-align: stretch;
           /* Modern browsers */
           display: flex;
           flex-direction: column;
           align-items: stretch;
+        }
+      }
       /* input_area and input_prompt must match in top border and margin for alignment */
       div.input_prompt {
         color: #303F9F;
         border-top: 1px solid transparent;
+      }
       div.input_area > div.highlight {
         margin: 0.4em;
         border: none;
         padding: 0px;
         background-color: transparent;
+      }
       div.input_area > div.highlight > pre {
         margin: 0px;
         border: none;
         padding: 0px;
         background-color: transparent;
+      }
       /* The following gets added to the <head> if it is detected that the user has a
        * monospace font with inconsistent normal/bold/italic height.  See
        * notebookmain.js.  Such fonts will have keywords vertically offset with
        * respect to the rest of the text.  The user should select a better font.
        * See: https://github.com/ipython/ipython/issues/1503
+       *
        * .CodeMirror span {
        *      vertical-align: bottom;
        * }
        */
       .CodeMirror {
         line-height: 1.21429em;
         /* Changed from 1em to our global default */
         font-size: 14px;
         height: auto;
         /* Changed to auto to autogrow */
         background: none;
         /* Changed from white to allow our bg to show through */
+      }
       .CodeMirror-scroll {
         /*  The CodeMirror docs are a bit fuzzy on if overflow-y should be hidden or visible.*/
         /*  We have found that if it is visible, vertical scrollbars appear with font size changes.*/
         overflow-y: hidden;
         overflow-x: auto;
+      }
       .CodeMirror-lines {
         /* In CM2, this used to be 0.4em, but in CM3 it went to 4px. We need the em value because */
         /* we have set a different line-height and want this to scale with that. */
         padding: 0.4em;
+      }
       .CodeMirror-linenumber {
         padding: 0 8px 0 4px;
+      }
       .CodeMirror-gutters {
         border-bottom-left-radius: 2px;
         border-top-left-radius: 2px;
+      }
       .CodeMirror pre {
         /* In CM3 this went to 4px from 0 in CM2. We need the 0 value because of how we size */
         /* .CodeMirror-lines */
         padding: 0;
         border: 0;
         border-radius: 0;
+      }
       /*
       Original style from softwaremaniacs.org (c) Ivan Sagalaev <Maniac@SoftwareManiacs.Org>
       Adapted from GitHub theme
       */
       .highlight-base {
         color: #000;
+      }
       .highlight-variable {
         color: #000;
+      }
       .highlight-variable-2 {
         color: #1a1a1a;
+      }
       .highlight-variable-3 {
         color: #333333;
+      }
       .highlight-string {
         color: #BA2121;
+      }
       .highlight-comment {
         color: #408080;
         font-style: italic;
+      }
       .highlight-number {
         color: #080;
+      }
       .highlight-atom {
         color: #88F;
+      }
       .highlight-keyword {
         color: #008000;
         font-weight: bold;
+      }
       .highlight-builtin {
         color: #008000;
+      }
       .highlight-error {
         color: #f00;
+      }
       .highlight-operator {
         color: #AA22FF;
         font-weight: bold;
+      }
       .highlight-meta {
         color: #AA22FF;
+      }
       /* previously not defined, copying from default codemirror */
       .highlight-def {
         color: #00f;
+      }
       .highlight-string-2 {
         color: #f50;
+      }
       .highlight-qualifier {
         color: #555;
+      }
       .highlight-bracket {
         color: #997;
+      }
       .highlight-tag {
         color: #170;
+      }
       .highlight-attribute {
         color: #00c;
+      }
       .highlight-header {
         color: blue;
+      }
       .highlight-quote {
         color: #090;
+      }
       .highlight-link {
         color: #00c;
+      }
       /* apply the same style to codemirror */
       .cm-s-ipython span.cm-keyword {
         color: #008000;
         font-weight: bold;
+      }
       .cm-s-ipython span.cm-atom {
         color: #88F;
+      }
       .cm-s-ipython span.cm-number {
         color: #080;
+      }
       .cm-s-ipython span.cm-def {
         color: #00f;
+      }
       .cm-s-ipython span.cm-variable {
         color: #000;
+      }
       .cm-s-ipython span.cm-operator {
         color: #AA22FF;
         font-weight: bold;
+      }
       .cm-s-ipython span.cm-variable-2 {
         color: #1a1a1a;
+      }
       .cm-s-ipython span.cm-variable-3 {
         color: #333333;
+      }
       .cm-s-ipython span.cm-comment {
         color: #408080;
         font-style: italic;
+      }
       .cm-s-ipython span.cm-string {
         color: #BA2121;
+      }
       .cm-s-ipython span.cm-string-2 {
         color: #f50;
+      }
       .cm-s-ipython span.cm-meta {
         color: #AA22FF;
+      }
       .cm-s-ipython span.cm-qualifier {
         color: #555;
+      }
       .cm-s-ipython span.cm-builtin {
         color: #008000;
+      }
       .cm-s-ipython span.cm-bracket {
         color: #997;
+      }
       .cm-s-ipython span.cm-tag {
         color: #170;
+      }
       .cm-s-ipython span.cm-attribute {
         color: #00c;
+      }
       .cm-s-ipython span.cm-header {
         color: blue;
+      }
       .cm-s-ipython span.cm-quote {
         color: #090;
+      }
       .cm-s-ipython span.cm-link {
         color: #00c;
+      }
       .cm-s-ipython span.cm-error {
         color: #f00;
+      }
       .cm-s-ipython span.cm-tab {
         background: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAADAAAAAMCAYAAAAkuj5RAAAAAXNSR0IArs4c6QAAAGFJREFUSMft1LsRQFAQheHPowAKoACx3IgEKtaEHujDjORSgWTH/ZOdnZOcM/sgk/kFFWY0qV8foQwS4MKBCS3qR6ixBJvElOobYAtivseIE120FaowJPN75GMu8j/LfMwNjh4HUpwg4LUAAAAASUVORK5CYII=);
         background-position: right;
         background-repeat: no-repeat;
+      }
       div.output_wrapper {
         /* this position must be relative to enable descendents to be absolute within it */
         position: relative;
         /* Old browsers */
         display: -webkit-box;
         -webkit-box-orient: vertical;
         -webkit-box-align: stretch;
         display: -moz-box;
         -moz-box-orient: vertical;
         -moz-box-align: stretch;
         display: box;
         box-orient: vertical;
         box-align: stretch;
         /* Modern browsers */
         display: flex;
         flex-direction: column;
         align-items: stretch;
         z-index: 1;
+      }
       /* class for the output area when it should be height-limited */
       div.output_scroll {
         /* ideally, this would be max-height, but FF barfs all over that */
         height: 24em;
         /* FF needs this *and the wrapper* to specify full width, or it will shrinkwrap */
         width: 100%;
         overflow: auto;
         border-radius: 2px;
         -webkit-box-shadow: inset 0 2px 8px rgba(0, 0, 0, 0.8);
         box-shadow: inset 0 2px 8px rgba(0, 0, 0, 0.8);
         display: block;
+      }
       /* output div while it is collapsed */
       div.output_collapsed {
         margin: 0px;
         padding: 0px;
         /* Old browsers */
         display: -webkit-box;
         -webkit-box-orient: vertical;
         -webkit-box-align: stretch;
         display: -moz-box;
         -moz-box-orient: vertical;
         -moz-box-align: stretch;
         display: box;
         box-orient: vertical;
         box-align: stretch;
         /* Modern browsers */
         display: flex;
         flex-direction: column;
         align-items: stretch;
+      }
       div.out_prompt_overlay {
         height: 100%;
         padding: 0px 0.4em;
         position: absolute;
         border-radius: 2px;
+      }
       div.out_prompt_overlay:hover {
         /* use inner shadow to get border that is computed the same on WebKit/FF */
         -webkit-box-shadow: inset 0 0 1px #000;
         box-shadow: inset 0 0 1px #000;
         background: rgba(240, 240, 240, 0.5);
+      }
       div.output_prompt {
         color: #D84315;
+      }
       /* This class is the outer container of all output sections. */
       div.output_area {
         padding: 0px;
         page-break-inside: avoid;
         /* Old browsers */
         display: -webkit-box;
         -webkit-box-orient: horizontal;
         -webkit-box-align: stretch;
         display: -moz-box;
         -moz-box-orient: horizontal;
         -moz-box-align: stretch;
         display: box;
         box-orient: horizontal;
         box-align: stretch;
         /* Modern browsers */
         display: flex;
         flex-direction: row;
         align-items: stretch;
+      }
       div.output_area .MathJax_Display {
         text-align: left !important;
+      }
       div.output_area .rendered_html table {
         margin-left: 0;
         margin-right: 0;
+      }
       div.output_area .rendered_html img {
         margin-left: 0;
         margin-right: 0;
+      }
       div.output_area img,
       div.output_area svg {
         max-width: 100%;
         height: auto;
+      }
       div.output_area img.unconfined,
       div.output_area svg.unconfined {
         max-width: none;
+      }
       /* This is needed to protect the pre formating from global settings such
          as that of bootstrap */
       .output {
         /* Old browsers */
         display: -webkit-box;
         -webkit-box-orient: vertical;
         -webkit-box-align: stretch;
         display: -moz-box;
         -moz-box-orient: vertical;
         -moz-box-align: stretch;
         display: box;
         box-orient: vertical;
         box-align: stretch;
         /* Modern browsers */
         display: flex;
         flex-direction: column;
         align-items: stretch;
+      }
       @media (max-width: 540px) {
         div.output_area {
           /* Old browsers */
           display: -webkit-box;
           -webkit-box-orient: vertical;
           -webkit-box-align: stretch;
           display: -moz-box;
           -moz-box-orient: vertical;
           -moz-box-align: stretch;
           display: box;
           box-orient: vertical;
           box-align: stretch;
           /* Modern browsers */
           display: flex;
           flex-direction: column;
           align-items: stretch;
+        }
+      }
       div.output_area pre {
         margin: 0;
         padding: 0;
         border: 0;
         vertical-align: baseline;
         color: black;
         background-color: transparent;
         border-radius: 0;
+      }
       /* This class is for the output subarea inside the output_area and after
          the prompt div. */
       div.output_subarea {
         overflow-x: auto;
         padding: 0.4em;
         /* Old browsers */
         -webkit-box-flex: 1;
         -moz-box-flex: 1;
         box-flex: 1;
         /* Modern browsers */
         flex: 1;
         max-width: calc(100% - 14ex);
+      }
       div.output_scroll div.output_subarea {
         overflow-x: visible;
+      }
       /* The rest of the output_* classes are for special styling of the different
          output types */
       /* all text output has this class: */
       div.output_text {
         text-align: left;
         color: #000;
         /* This has to match that of the the CodeMirror class line-height below */
         line-height: 1.21429em;
+      }
       /* stdout/stderr are 'text' as well as 'stream', but execute_result/error are *not* streams */
       div.output_stderr {
         background: #fdd;
         /* very light red background for stderr */
+      }
       div.output_latex {
         text-align: left;
+      }
       /* Empty output_javascript divs should have no height */
       div.output_javascript:empty {
         padding: 0;
+      }
       .js-error {
         color: darkred;
+      }
       /* raw_input styles */
       div.raw_input_container {
         line-height: 1.21429em;
         padding-top: 5px;
+      }
       pre.raw_input_prompt {
         /* nothing needed here. */
+      }
       input.raw_input {
         font-family: monospace;
         font-size: inherit;
         color: inherit;
         width: auto;
         /* make sure input baseline aligns with prompt */
         vertical-align: baseline;
         /* padding + margin = 0.5em between prompt and cursor */
         padding: 0em 0.25em;
         margin: 0em 0.25em;
+      }
       input.raw_input:focus {
         box-shadow: none;
+      }
       p.p-space {
         margin-bottom: 10px;
+      }
       div.output_unrecognized {
         padding: 5px;
         font-weight: bold;
         color: red;
+      }
       div.output_unrecognized a {
         color: inherit;
         text-decoration: none;
+      }
       div.output_unrecognized a:hover {
         color: inherit;
         text-decoration: none;
+      }
       .rendered_html {
         color: #000;
         /* any extras will just be numbers: */
+      }
       .rendered_html em {
         font-style: italic;
+      }
       .rendered_html strong {
         font-weight: bold;
+      }
       .rendered_html u {
         text-decoration: underline;
+      }
       .rendered_html :link {
         text-decoration: underline;
+      }
       .rendered_html :visited {
         text-decoration: underline;
+      }
       .rendered_html h1 {
         font-size: 185.7%;
         margin: 1.08em 0 0 0;
         font-weight: bold;
         line-height: 1.0;
+      }
       .rendered_html h2 {
         font-size: 157.1%;
         margin: 1.27em 0 0 0;
         font-weight: bold;
         line-height: 1.0;
+      }
       .rendered_html h3 {
         font-size: 128.6%;
         margin: 1.55em 0 0 0;
         font-weight: bold;
         line-height: 1.0;
+      }
       .rendered_html h4 {
         font-size: 100%;
         margin: 2em 0 0 0;
         font-weight: bold;
         line-height: 1.0;
+      }
       .rendered_html h5 {
         font-size: 100%;
         margin: 2em 0 0 0;
         font-weight: bold;
         line-height: 1.0;
         font-style: italic;
+      }
       .rendered_html h6 {
         font-size: 100%;
         margin: 2em 0 0 0;
         font-weight: bold;
         line-height: 1.0;
         font-style: italic;
+      }
       .rendered_html h1:first-child {
         margin-top: 0.538em;
+      }
       .rendered_html h2:first-child {
         margin-top: 0.636em;
+      }
       .rendered_html h3:first-child {
         margin-top: 0.777em;
+      }
       .rendered_html h4:first-child {
         margin-top: 1em;
+      }
       .rendered_html h5:first-child {
         margin-top: 1em;
+      }
       .rendered_html h6:first-child {
         margin-top: 1em;
+      }
       .rendered_html ul {
         list-style: disc;
         margin: 0em 2em;
         padding-left: 0px;
+      }
       .rendered_html ul ul {
         list-style: square;
         margin: 0em 2em;
+      }
       .rendered_html ul ul ul {
         list-style: circle;
         margin: 0em 2em;
+      }
       .rendered_html ol {
         list-style: decimal;
         margin: 0em 2em;
         padding-left: 0px;
+      }
       .rendered_html ol ol {
         list-style: upper-alpha;
         margin: 0em 2em;
+      }
       .rendered_html ol ol ol {
         list-style: lower-alpha;
         margin: 0em 2em;
+      }
       .rendered_html ol ol ol ol {
         list-style: lower-roman;
         margin: 0em 2em;
+      }
       .rendered_html ol ol ol ol ol {
         list-style: decimal;
         margin: 0em 2em;
+      }
       .rendered_html * + ul {
         margin-top: 1em;
+      }
       .rendered_html * + ol {
         margin-top: 1em;
+      }
       .rendered_html hr {
         color: black;
         background-color: black;
+      }
       .rendered_html pre {
         margin: 1em 2em;
+      }
       .rendered_html pre,
       .rendered_html code {
         border: 0;
         background-color: #fff;
         color: #000;
         font-size: 100%;
         padding: 0px;
+      }
       .rendered_html blockquote {
         margin: 1em 2em;
+      }
       .rendered_html table {
         margin-left: auto;
         margin-right: auto;
         border: 1px solid black;
         border-collapse: collapse;
+      }
       .rendered_html tr,
       .rendered_html th,
       .rendered_html td {
         border: 1px solid black;
         border-collapse: collapse;
         margin: 1em 2em;
+      }
       .rendered_html td,
       .rendered_html th {
         text-align: left;
         vertical-align: middle;
         padding: 4px;
+      }
       .rendered_html th {
         font-weight: bold;
+      }
       .rendered_html * + table {
         margin-top: 1em;
+      }
       .rendered_html p {
         text-align: left;
+      }
       .rendered_html * + p {
         margin-top: 1em;
+      }
       .rendered_html img {
         display: block;
         margin-left: auto;
         margin-right: auto;
+      }
       .rendered_html * + img {
         margin-top: 1em;
+      }
       .rendered_html img,
       .rendered_html svg {
         max-width: 100%;
         height: auto;
+      }
       .rendered_html img.unconfined,
       .rendered_html svg.unconfined {
         max-width: none;
+      }
       div.text_cell {
         /* Old browsers */
         display: -webkit-box;
         -webkit-box-orient: horizontal;
         -webkit-box-align: stretch;
         display: -moz-box;
         -moz-box-orient: horizontal;
         -moz-box-align: stretch;
         display: box;
         box-orient: horizontal;
         box-align: stretch;
         /* Modern browsers */
         display: flex;
         flex-direction: row;
         align-items: stretch;
+      }
       @media (max-width: 540px) {
         div.text_cell > div.prompt {
           display: none;
+        }
+      }
       div.text_cell_render {
         /*font-family: "Helvetica Neue", Arial, Helvetica, Geneva, sans-serif;*/
         outline: none;
         resize: none;
         width: inherit;
         border-style: none;
         padding: 0.5em 0.5em 0.5em 0.4em;
         color: #000;
         box-sizing: border-box;
         -moz-box-sizing: border-box;
         -webkit-box-sizing: border-box;
+      }
       a.anchor-link:link {
         text-decoration: none;
         padding: 0px 20px;
         visibility: hidden;
+      }
       h1:hover .anchor-link,
       h2:hover .anchor-link,
       h3:hover .anchor-link,
       h4:hover .anchor-link,
       h5:hover .anchor-link,
       h6:hover .anchor-link {
         visibility: visible;
+      }
       .text_cell.rendered .input_area {
         display: none;
+      }
       .text_cell.rendered .rendered_html {
         overflow-x: auto;
         overflow-y: hidden;
+      }
       .text_cell.unrendered .text_cell_render {
         display: none;
+      }
       .cm-header-1,
       .cm-header-2,
       .cm-header-3,
       .cm-header-4,
       .cm-header-5,
       .cm-header-6 {
         font-weight: bold;
         font-family: "Helvetica Neue", Helvetica, Arial, sans-serif;
+      }
       .cm-header-1 {
         font-size: 185.7%;
+      }
       .cm-header-2 {
         font-size: 157.1%;
+      }
       .cm-header-3 {
         font-size: 128.6%;
+      }
       .cm-header-4 {
         font-size: 110%;
+      }
       .cm-header-5 {
         font-size: 100%;
         font-style: italic;
+      }
       .cm-header-6 {
         font-size: 100%;
         font-style: italic;
+      }
       /*!
+      *
       * IPython notebook webapp
+      *
       */
       @media (max-width: 767px) {
         .notebook_app {
           padding-left: 0px;
           padding-right: 0px;
+        }
+      }
       #ipython-main-app {
         box-sizing: border-box;
         -moz-box-sizing: border-box;
         -webkit-box-sizing: border-box;
         height: 100%;
+      }
       div#notebook_panel {
         margin: 0px;
         padding: 0px;
         box-sizing: border-box;
         -moz-box-sizing: border-box;
         -webkit-box-sizing: border-box;
         height: 100%;
+      }
       div#notebook {
         font-size: 14px;
         line-height: 20px;
         overflow-y: hidden;
         overflow-x: auto;
         width: 100%;
         /* This spaces the page away from the edge of the notebook area */
         padding-top: 20px;
         margin: 0px;
         outline: none;
         box-sizing: border-box;
         -moz-box-sizing: border-box;
         -webkit-box-sizing: border-box;
         min-height: 100%;
+      }
       @media not print {
         #notebook-container {
           padding: 15px;
           background-color: #fff;
           min-height: 0;
           -webkit-box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2);
           box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2);
+        }
+      }
       @media print {
         #notebook-container {
           width: 100%;
+        }
+      }
       div.ui-widget-content {
         border: 1px solid #ababab;
         outline: none;
+      }
       pre.dialog {
         background-color: #f7f7f7;
         border: 1px solid #ddd;
         border-radius: 2px;
         padding: 0.4em;
         padding-left: 2em;
+      }
       p.dialog {
         padding: 0.2em;
+      }
       /* Word-wrap output correctly.  This is the CSS3 spelling, though Firefox seems
          to not honor it correctly.  Webkit browsers (Chrome, rekonq, Safari) do.
        */
       pre,
       code,
       kbd,
       samp {
         white-space: pre-wrap;
+      }
       #fonttest {
         font-family: monospace;
+      }
       p {
         margin-bottom: 0;
+      }
       .end_space {
         min-height: 100px;
         transition: height .2s ease;
+      }
       .notebook_app > #header {
         -webkit-box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2);
         box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2);
+      }
       @media not print {
         .notebook_app {
           background-color: #EEE;
+        }
+      }
       kbd {
         border-style: solid;
         border-width: 1px;
         box-shadow: none;
         margin: 2px;
         padding-left: 2px;
         padding-right: 2px;
         padding-top: 1px;
         padding-bottom: 1px;
+      }
       /* CSS for the cell toolbar */
       .celltoolbar {
         border: thin solid #CFCFCF;
         border-bottom: none;
         background: #EEE;
         border-radius: 2px 2px 0px 0px;
         width: 100%;
         height: 29px;
         padding-right: 4px;
         /* Old browsers */
         display: -webkit-box;
         -webkit-box-orient: horizontal;
         -webkit-box-align: stretch;
         display: -moz-box;
         -moz-box-orient: horizontal;
         -moz-box-align: stretch;
         display: box;
         box-orient: horizontal;
         box-align: stretch;
         /* Modern browsers */
         display: flex;
         flex-direction: row;
         align-items: stretch;
         /* Old browsers */
         -webkit-box-pack: end;
         -moz-box-pack: end;
         box-pack: end;
         /* Modern browsers */
         justify-content: flex-end;
         display: -webkit-flex;
+      }
       @media print {
         .celltoolbar {
           display: none;
+        }
+      }
       .ctb_hideshow {
         display: none;
         vertical-align: bottom;
+      }
       /* ctb_show is added to the ctb_hideshow div to show the cell toolbar.
          Cell toolbars are only shown when the ctb_global_show class is also set.
       */
       .ctb_global_show .ctb_show.ctb_hideshow {
         display: block;
+      }
       .ctb_global_show .ctb_show + .input_area,
       .ctb_global_show .ctb_show + div.text_cell_input,
       .ctb_global_show .ctb_show ~ div.text_cell_render {
         border-top-right-radius: 0px;
         border-top-left-radius: 0px;
+      }
       .ctb_global_show .ctb_show ~ div.text_cell_render {
         border: 1px solid #cfcfcf;
+      }
       .celltoolbar {
         font-size: 87%;
         padding-top: 3px;
+      }
       .celltoolbar select {
         display: block;
         width: 100%;
         height: 32px;
         padding: 6px 12px;
         font-size: 13px;
         line-height: 1.42857143;
         color: #555555;
         background-color: #fff;
         background-image: none;
         border: 1px solid #ccc;
         border-radius: 2px;
         -webkit-box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
         box-shadow: inset 0 1px 1px rgba(0, 0, 0, 0.075);
         -webkit-transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s;
         -o-transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s;
         transition: border-color ease-in-out .15s, box-shadow ease-in-out .15s;
         height: 30px;
         padding: 5px 10px;
         font-size: 12px;
         line-height: 1.5;
         border-radius: 1px;
         width: inherit;
         font-size: inherit;
         height: 22px;
         padding: 0px;
         display: inline-block;
+      }
       .celltoolbar select:focus {
         border-color: #66afe9;
         outline: 0;
         -webkit-box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 8px rgba(102, 175, 233, 0.6);
         box-shadow: inset 0 1px 1px rgba(0,0,0,.075), 0 0 8px rgba(102, 175, 233, 0.6);
+      }
       .celltoolbar select::-moz-placeholder {
         color: #999;
         opacity: 1;
+      }
       .celltoolbar select:-ms-input-placeholder {
         color: #999;
+      }
       .celltoolbar select::-webkit-input-placeholder {
         color: #999;
+      }
       .celltoolbar select::-ms-expand {
         border: 0;
         background-color: transparent;
+      }
       .celltoolbar select[disabled],
       .celltoolbar select[readonly],
       fieldset[disabled] .celltoolbar select {
         background-color: #eeeeee;
         opacity: 1;
+      }
       .celltoolbar select[disabled],
       fieldset[disabled] .celltoolbar select {
         cursor: not-allowed;
+      }
       textarea.celltoolbar select {
         height: auto;
+      }
       select.celltoolbar select {
         height: 30px;
         line-height: 30px;
+      }
       textarea.celltoolbar select,
       select[multiple].celltoolbar select {
         height: auto;
+      }
       .celltoolbar label {
         margin-left: 5px;
         margin-right: 5px;
+      }
       .completions {
         position: absolute;
         z-index: 110;
         overflow: hidden;
         border: 1px solid #ababab;
         border-radius: 2px;
         -webkit-box-shadow: 0px 6px 10px -1px #adadad;
         box-shadow: 0px 6px 10px -1px #adadad;
         line-height: 1;
+      }
       .completions select {
         background: white;
         outline: none;
         border: none;
         padding: 0px;
         margin: 0px;
         overflow: auto;
         font-family: monospace;
         font-size: 110%;
         color: #000;
         width: auto;
+      }
       .completions select option.context {
         color: #286090;
+      }
       #kernel_logo_widget {
         float: right !important;
         float: right;
+      }
       #kernel_logo_widget .current_kernel_logo {
         display: none;
         margin-top: -1px;
         margin-bottom: -1px;
         width: 32px;
         height: 32px;
+      }
       #menubar {
         box-sizing: border-box;
         -moz-box-sizing: border-box;
         -webkit-box-sizing: border-box;
         margin-top: 1px;
+      }
       #menubar .navbar {
         border-top: 1px;
         border-radius: 0px 0px 2px 2px;
         margin-bottom: 0px;
+      }
       #menubar .navbar-toggle {
         float: left;
         padding-top: 7px;
         padding-bottom: 7px;
         border: none;
+      }
       #menubar .navbar-collapse {
         clear: left;
+      }
       .nav-wrapper {
         border-bottom: 1px solid #e7e7e7;
+      }
       i.menu-icon {
         padding-top: 4px;
+      }
       ul#help_menu li a {
         overflow: hidden;
         padding-right: 2.2em;
+      }
       ul#help_menu li a i {
         margin-right: -1.2em;
+      }
       .dropdown-submenu {
         position: relative;
+      }
       .dropdown-submenu > .dropdown-menu {
         top: 0;
         left: 100%;
         margin-top: -6px;
         margin-left: -1px;
+      }
       .dropdown-submenu:hover > .dropdown-menu {
         display: block;
+      }
       .dropdown-submenu > a:after {
         display: inline-block;
         font: normal normal normal 14px/1 FontAwesome;
         font-size: inherit;
         text-rendering: auto;
         -webkit-font-smoothing: antialiased;
         -moz-osx-font-smoothing: grayscale;
         display: block;
         content: "\f0da";
         float: right;
         color: #333333;
         margin-top: 2px;
         margin-right: -10px;
+      }
       .dropdown-submenu > a:after.pull-left {
         margin-right: .3em;
+      }
       .dropdown-submenu > a:after.pull-right {
         margin-left: .3em;
+      }
       .dropdown-submenu:hover > a:after {
         color: #262626;
+      }
       .dropdown-submenu.pull-left {
         float: none;
+      }
       .dropdown-submenu.pull-left > .dropdown-menu {
         left: -100%;
         margin-left: 10px;
+      }
       #notification_area {
         float: right !important;
         float: right;
         z-index: 10;
+      }
       .indicator_area {
         float: right !important;
         float: right;
         color: #777;
         margin-left: 5px;
         margin-right: 5px;
         width: 11px;
         z-index: 10;
         text-align: center;
         width: auto;
+      }
       #kernel_indicator {
         float: right !important;
         float: right;
         color: #777;
         margin-left: 5px;
         margin-right: 5px;
         width: 11px;
         z-index: 10;
         text-align: center;
         width: auto;
         border-left: 1px solid;
+      }
       #kernel_indicator .kernel_indicator_name {
         padding-left: 5px;
         padding-right: 5px;
+      }
       #modal_indicator {
         float: right !important;
         float: right;
         color: #777;
         margin-left: 5px;
         margin-right: 5px;
         width: 11px;
         z-index: 10;
         text-align: center;
         width: auto;
+      }
       #readonly-indicator {
         float: right !important;
         float: right;
         color: #777;
         margin-left: 5px;
         margin-right: 5px;
         width: 11px;
         z-index: 10;
         text-align: center;
         width: auto;
         margin-top: 2px;
         margin-bottom: 0px;
         margin-left: 0px;
         margin-right: 0px;
         display: none;
+      }
       .modal_indicator:before {
         width: 1.28571429em;
         text-align: center;
+      }
       .edit_mode .modal_indicator:before {
         display: inline-block;
         font: normal normal normal 14px/1 FontAwesome;
         font-size: inherit;
         text-rendering: auto;
         -webkit-font-smoothing: antialiased;
         -moz-osx-font-smoothing: grayscale;
         content: "\f040";
+      }
       .edit_mode .modal_indicator:before.pull-left {
         margin-right: .3em;
+      }
       .edit_mode .modal_indicator:before.pull-right {
         margin-left: .3em;
+      }
       .command_mode .modal_indicator:before {
         display: inline-block;
         font: normal normal normal 14px/1 FontAwesome;
         font-size: inherit;
         text-rendering: auto;
         -webkit-font-smoothing: antialiased;
         -moz-osx-font-smoothing: grayscale;
         content: ' ';
+      }
       .command_mode .modal_indicator:before.pull-left {
         margin-right: .3em;
+      }
       .command_mode .modal_indicator:before.pull-right {
         margin-left: .3em;
+      }
       .kernel_idle_icon:before {
         display: inline-block;
         font: normal normal normal 14px/1 FontAwesome;
         font-size: inherit;
         text-rendering: auto;
         -webkit-font-smoothing: antialiased;
         -moz-osx-font-smoothing: grayscale;
         content: "\f10c";
+      }
       .kernel_idle_icon:before.pull-left {
         margin-right: .3em;
+      }
       .kernel_idle_icon:before.pull-right {
         margin-left: .3em;
+      }
       .kernel_busy_icon:before {
         display: inline-block;
         font: normal normal normal 14px/1 FontAwesome;
         font-size: inherit;
         text-rendering: auto;
         -webkit-font-smoothing: antialiased;
         -moz-osx-font-smoothing: grayscale;
         content: "\f111";
+      }
       .kernel_busy_icon:before.pull-left {
         margin-right: .3em;
+      }
       .kernel_busy_icon:before.pull-right {
         margin-left: .3em;
+      }
       .kernel_dead_icon:before {
         display: inline-block;
         font: normal normal normal 14px/1 FontAwesome;
         font-size: inherit;
         text-rendering: auto;
         -webkit-font-smoothing: antialiased;
         -moz-osx-font-smoothing: grayscale;
         content: "\f1e2";
+      }
       .kernel_dead_icon:before.pull-left {
         margin-right: .3em;
+      }
       .kernel_dead_icon:before.pull-right {
         margin-left: .3em;
+      }
       .kernel_disconnected_icon:before {
         display: inline-block;
         font: normal normal normal 14px/1 FontAwesome;
         font-size: inherit;
         text-rendering: auto;
         -webkit-font-smoothing: antialiased;
         -moz-osx-font-smoothing: grayscale;
         content: "\f127";
+      }
       .kernel_disconnected_icon:before.pull-left {
         margin-right: .3em;
+      }
       .kernel_disconnected_icon:before.pull-right {
         margin-left: .3em;
+      }
       .notification_widget {
         color: #777;
         z-index: 10;
         background: rgba(240, 240, 240, 0.5);
         margin-right: 4px;
         color: #333;
         background-color: #fff;
         border-color: #ccc;
+      }
       .notification_widget:focus,
       .notification_widget.focus {
         color: #333;
         background-color: #e6e6e6;
         border-color: #8c8c8c;
+      }
       .notification_widget:hover {
         color: #333;
         background-color: #e6e6e6;
         border-color: #adadad;
+      }
       .notification_widget:active,
       .notification_widget.active,
       .open > .dropdown-toggle.notification_widget {
         color: #333;
         background-color: #e6e6e6;
         border-color: #adadad;
+      }
       .notification_widget:active:hover,
       .notification_widget.active:hover,
       .open > .dropdown-toggle.notification_widget:hover,
       .notification_widget:active:focus,
       .notification_widget.active:focus,
       .open > .dropdown-toggle.notification_widget:focus,
       .notification_widget:active.focus,
       .notification_widget.active.focus,
       .open > .dropdown-toggle.notification_widget.focus {
         color: #333;
         background-color: #d4d4d4;
         border-color: #8c8c8c;
+      }
       .notification_widget:active,
       .notification_widget.active,
       .open > .dropdown-toggle.notification_widget {
         background-image: none;
+      }
       .notification_widget.disabled:hover,
       .notification_widget[disabled]:hover,
       fieldset[disabled] .notification_widget:hover,
       .notification_widget.disabled:focus,
       .notification_widget[disabled]:focus,
       fieldset[disabled] .notification_widget:focus,
       .notification_widget.disabled.focus,
       .notification_widget[disabled].focus,
       fieldset[disabled] .notification_widget.focus {
         background-color: #fff;
         border-color: #ccc;
+      }
       .notification_widget .badge {
         color: #fff;
         background-color: #333;
+      }
       .notification_widget.warning {
         color: #fff;
         background-color: #f0ad4e;
         border-color: #eea236;
+      }
       .notification_widget.warning:focus,
       .notification_widget.warning.focus {
         color: #fff;
         background-color: #ec971f;
         border-color: #985f0d;
+      }
       .notification_widget.warning:hover {
         color: #fff;
         background-color: #ec971f;
         border-color: #d58512;
+      }
       .notification_widget.warning:active,
       .notification_widget.warning.active,
       .open > .dropdown-toggle.notification_widget.warning {
         color: #fff;
         background-color: #ec971f;
         border-color: #d58512;
+      }
       .notification_widget.warning:active:hover,
       .notification_widget.warning.active:hover,
       .open > .dropdown-toggle.notification_widget.warning:hover,
       .notification_widget.warning:active:focus,
       .notification_widget.warning.active:focus,
       .open > .dropdown-toggle.notification_widget.warning:focus,
       .notification_widget.warning:active.focus,
       .notification_widget.warning.active.focus,
       .open > .dropdown-toggle.notification_widget.warning.focus {
         color: #fff;
         background-color: #d58512;
         border-color: #985f0d;
+      }
       .notification_widget.warning:active,
       .notification_widget.warning.active,
       .open > .dropdown-toggle.notification_widget.warning {
         background-image: none;
+      }
       .notification_widget.warning.disabled:hover,
       .notification_widget.warning[disabled]:hover,
       fieldset[disabled] .notification_widget.warning:hover,
       .notification_widget.warning.disabled:focus,
       .notification_widget.warning[disabled]:focus,
       fieldset[disabled] .notification_widget.warning:focus,
       .notification_widget.warning.disabled.focus,
       .notification_widget.warning[disabled].focus,
       fieldset[disabled] .notification_widget.warning.focus {
         background-color: #f0ad4e;
         border-color: #eea236;
+      }
       .notification_widget.warning .badge {
         color: #f0ad4e;
         background-color: #fff;
+      }
       .notification_widget.success {
         color: #fff;
         background-color: #5cb85c;
         border-color: #4cae4c;
+      }
       .notification_widget.success:focus,
       .notification_widget.success.focus {
         color: #fff;
         background-color: #449d44;
         border-color: #255625;
+      }
       .notification_widget.success:hover {
         color: #fff;
         background-color: #449d44;
         border-color: #398439;
+      }
       .notification_widget.success:active,
       .notification_widget.success.active,
       .open > .dropdown-toggle.notification_widget.success {
         color: #fff;
         background-color: #449d44;
         border-color: #398439;
+      }
       .notification_widget.success:active:hover,
       .notification_widget.success.active:hover,
       .open > .dropdown-toggle.notification_widget.success:hover,
       .notification_widget.success:active:focus,
       .notification_widget.success.active:focus,
       .open > .dropdown-toggle.notification_widget.success:focus,
       .notification_widget.success:active.focus,
       .notification_widget.success.active.focus,
       .open > .dropdown-toggle.notification_widget.success.focus {
         color: #fff;
         background-color: #398439;
         border-color: #255625;
+      }
       .notification_widget.success:active,
       .notification_widget.success.active,
       .open > .dropdown-toggle.notification_widget.success {
         background-image: none;
+      }
       .notification_widget.success.disabled:hover,
       .notification_widget.success[disabled]:hover,
       fieldset[disabled] .notification_widget.success:hover,
       .notification_widget.success.disabled:focus,
       .notification_widget.success[disabled]:focus,
       fieldset[disabled] .notification_widget.success:focus,
       .notification_widget.success.disabled.focus,
       .notification_widget.success[disabled].focus,
       fieldset[disabled] .notification_widget.success.focus {
         background-color: #5cb85c;
         border-color: #4cae4c;
+      }
       .notification_widget.success .badge {
         color: #5cb85c;
         background-color: #fff;
+      }
       .notification_widget.info {
         color: #fff;
         background-color: #5bc0de;
         border-color: #46b8da;
+      }
       .notification_widget.info:focus,
       .notification_widget.info.focus {
         color: #fff;
         background-color: #31b0d5;
         border-color: #1b6d85;
+      }
       .notification_widget.info:hover {
         color: #fff;
         background-color: #31b0d5;
         border-color: #269abc;
+      }
       .notification_widget.info:active,
       .notification_widget.info.active,
       .open > .dropdown-toggle.notification_widget.info {
         color: #fff;
         background-color: #31b0d5;
         border-color: #269abc;
+      }
       .notification_widget.info:active:hover,
       .notification_widget.info.active:hover,
       .open > .dropdown-toggle.notification_widget.info:hover,
       .notification_widget.info:active:focus,
       .notification_widget.info.active:focus,
       .open > .dropdown-toggle.notification_widget.info:focus,
       .notification_widget.info:active.focus,
       .notification_widget.info.active.focus,
       .open > .dropdown-toggle.notification_widget.info.focus {
         color: #fff;
         background-color: #269abc;
         border-color: #1b6d85;
+      }
       .notification_widget.info:active,
       .notification_widget.info.active,
       .open > .dropdown-toggle.notification_widget.info {
         background-image: none;
+      }
       .notification_widget.info.disabled:hover,
       .notification_widget.info[disabled]:hover,
       fieldset[disabled] .notification_widget.info:hover,
       .notification_widget.info.disabled:focus,
       .notification_widget.info[disabled]:focus,
       fieldset[disabled] .notification_widget.info:focus,
       .notification_widget.info.disabled.focus,
       .notification_widget.info[disabled].focus,
       fieldset[disabled] .notification_widget.info.focus {
         background-color: #5bc0de;
         border-color: #46b8da;
+      }
       .notification_widget.info .badge {
         color: #5bc0de;
         background-color: #fff;
+      }
       .notification_widget.danger {
         color: #fff;
         background-color: #d9534f;
         border-color: #d43f3a;
+      }
       .notification_widget.danger:focus,
       .notification_widget.danger.focus {
         color: #fff;
         background-color: #c9302c;
         border-color: #761c19;
+      }
       .notification_widget.danger:hover {
         color: #fff;
         background-color: #c9302c;
         border-color: #ac2925;
+      }
       .notification_widget.danger:active,
       .notification_widget.danger.active,
       .open > .dropdown-toggle.notification_widget.danger {
         color: #fff;
         background-color: #c9302c;
         border-color: #ac2925;
+      }
       .notification_widget.danger:active:hover,
       .notification_widget.danger.active:hover,
       .open > .dropdown-toggle.notification_widget.danger:hover,
       .notification_widget.danger:active:focus,
       .notification_widget.danger.active:focus,
       .open > .dropdown-toggle.notification_widget.danger:focus,
       .notification_widget.danger:active.focus,
       .notification_widget.danger.active.focus,
       .open > .dropdown-toggle.notification_widget.danger.focus {
         color: #fff;
         background-color: #ac2925;
         border-color: #761c19;
+      }
       .notification_widget.danger:active,
       .notification_widget.danger.active,
       .open > .dropdown-toggle.notification_widget.danger {
         background-image: none;
+      }
       .notification_widget.danger.disabled:hover,
       .notification_widget.danger[disabled]:hover,
       fieldset[disabled] .notification_widget.danger:hover,
       .notification_widget.danger.disabled:focus,
       .notification_widget.danger[disabled]:focus,
       fieldset[disabled] .notification_widget.danger:focus,
       .notification_widget.danger.disabled.focus,
       .notification_widget.danger[disabled].focus,
       fieldset[disabled] .notification_widget.danger.focus {
         background-color: #d9534f;
         border-color: #d43f3a;
+      }
       .notification_widget.danger .badge {
         color: #d9534f;
         background-color: #fff;
+      }
       div#pager {
         background-color: #fff;
         font-size: 14px;
         line-height: 20px;
         overflow: hidden;
         display: none;
         position: fixed;
         bottom: 0px;
         width: 100%;
         max-height: 50%;
         padding-top: 8px;
         -webkit-box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2);
         box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2);
         /* Display over codemirror */
         z-index: 100;
         /* Hack which prevents jquery ui resizable from changing top. */
         top: auto !important;
+      }
       div#pager pre {
         line-height: 1.21429em;
         color: #000;
         background-color: #f7f7f7;
         padding: 0.4em;
+      }
       div#pager #pager-button-area {
         position: absolute;
         top: 8px;
         right: 20px;
+      }
       div#pager #pager-contents {
         position: relative;
         overflow: auto;
         width: 100%;
         height: 100%;
+      }
       div#pager #pager-contents #pager-container {
         position: relative;
         padding: 15px 0px;
         box-sizing: border-box;
         -moz-box-sizing: border-box;
         -webkit-box-sizing: border-box;
+      }
       div#pager .ui-resizable-handle {
         top: 0px;
         height: 8px;
         background: #f7f7f7;
         border-top: 1px solid #cfcfcf;
         border-bottom: 1px solid #cfcfcf;
         /* This injects handle bars (a short, wide = symbol) for
               the resize handle. */
+      }
       div#pager .ui-resizable-handle::after {
         content: '';
         top: 2px;
         left: 50%;
         height: 3px;
         width: 30px;
         margin-left: -15px;
         position: absolute;
         border-top: 1px solid #cfcfcf;
+      }
       .quickhelp {
         /* Old browsers */
         display: -webkit-box;
         -webkit-box-orient: horizontal;
         -webkit-box-align: stretch;
         display: -moz-box;
         -moz-box-orient: horizontal;
         -moz-box-align: stretch;
         display: box;
         box-orient: horizontal;
         box-align: stretch;
         /* Modern browsers */
         display: flex;
         flex-direction: row;
         align-items: stretch;
         line-height: 1.8em;
+      }
       .shortcut_key {
         display: inline-block;
         width: 21ex;
         text-align: right;
         font-family: monospace;
+      }
       .shortcut_descr {
         display: inline-block;
         /* Old browsers */
         -webkit-box-flex: 1;
         -moz-box-flex: 1;
         box-flex: 1;
         /* Modern browsers */
         flex: 1;
+      }
       span.save_widget {
         margin-top: 6px;
+      }
       span.save_widget span.filename {
         height: 1em;
         line-height: 1em;
         padding: 3px;
         margin-left: 16px;
         border: none;
         font-size: 146.5%;
         border-radius: 2px;
+      }
       span.save_widget span.filename:hover {
         background-color: #e6e6e6;
+      }
       span.checkpoint_status,
       span.autosave_status {
         font-size: small;
+      }
       @media (max-width: 767px) {
         span.save_widget {
           font-size: small;
+        }
         span.checkpoint_status,
         span.autosave_status {
           display: none;
+        }
+      }
       @media (min-width: 768px) and (max-width: 991px) {
         span.checkpoint_status {
           display: none;
+        }
         span.autosave_status {
           font-size: x-small;
+        }
+      }
       .toolbar {
         padding: 0px;
         margin-left: -5px;
         margin-top: 2px;
         margin-bottom: 5px;
         box-sizing: border-box;
         -moz-box-sizing: border-box;
         -webkit-box-sizing: border-box;
+      }
       .toolbar select,
       .toolbar label {
         width: auto;
         vertical-align: middle;
         margin-right: 2px;
         margin-bottom: 0px;
         display: inline;
         font-size: 92%;
         margin-left: 0.3em;
         margin-right: 0.3em;
         padding: 0px;
         padding-top: 3px;
+      }
       .toolbar .btn {
         padding: 2px 8px;
+      }
       .toolbar .btn-group {
         margin-top: 0px;
         margin-left: 5px;
+      }
       #maintoolbar {
         margin-bottom: -3px;
         margin-top: -8px;
         border: 0px;
         min-height: 27px;
         margin-left: 0px;
         padding-top: 11px;
         padding-bottom: 3px;
+      }
       #maintoolbar .navbar-text {
         float: none;
         vertical-align: middle;
         text-align: right;
         margin-left: 5px;
         margin-right: 0px;
         margin-top: 0px;
+      }
       .select-xs {
         height: 24px;
+      }
       .pulse,
       .dropdown-menu > li > a.pulse,
       li.pulse > a.dropdown-toggle,
       li.pulse.open > a.dropdown-toggle {
         background-color: #F37626;
         color: white;
+      }
       /**
        * Primary styles
+       *
        * Author: Jupyter Development Team
        */
       /** WARNING IF YOU ARE EDITTING THIS FILE, if this is a .css file, It has a lot
        * of chance of beeing generated from the ../less/[samename].less file, you can
        * try to get back the less file by reverting somme commit in history
        **/
       /*
        * We'll try to get something pretty, so we
        * have some strange css to have the scroll bar on
        * the left with fix button on the top right of the tooltip
        */
       @-moz-keyframes fadeOut {
         from {
           opacity: 1;
+        }
         to {
           opacity: 0;
+        }
+      }
       @-webkit-keyframes fadeOut {
         from {
           opacity: 1;
+        }
         to {
           opacity: 0;
+        }
+      }
       @-moz-keyframes fadeIn {
         from {
           opacity: 0;
+        }
         to {
           opacity: 1;
+        }
+      }
       @-webkit-keyframes fadeIn {
         from {
           opacity: 0;
+        }
         to {
           opacity: 1;
+        }
+      }
       /*properties of tooltip after "expand"*/
       .bigtooltip {
         overflow: auto;
         height: 200px;
         -webkit-transition-property: height;
         -webkit-transition-duration: 500ms;
         -moz-transition-property: height;
         -moz-transition-duration: 500ms;
         transition-property: height;
         transition-duration: 500ms;
+      }
       /*properties of tooltip before "expand"*/
       .smalltooltip {
         -webkit-transition-property: height;
         -webkit-transition-duration: 500ms;
         -moz-transition-property: height;
         -moz-transition-duration: 500ms;
         transition-property: height;
         transition-duration: 500ms;
         text-overflow: ellipsis;
         overflow: hidden;
         height: 80px;
+      }
       .tooltipbuttons {
         position: absolute;
         padding-right: 15px;
         top: 0px;
         right: 0px;
+      }
       .tooltiptext {
         /*avoid the button to overlap on some docstring*/
         padding-right: 30px;
+      }
       .ipython_tooltip {
         max-width: 700px;
         /*fade-in animation when inserted*/
         -webkit-animation: fadeOut 400ms;
         -moz-animation: fadeOut 400ms;
         animation: fadeOut 400ms;
         -webkit-animation: fadeIn 400ms;
         -moz-animation: fadeIn 400ms;
         animation: fadeIn 400ms;
         vertical-align: middle;
         background-color: #f7f7f7;
         overflow: visible;
         border: #ababab 1px solid;
         outline: none;
         padding: 3px;
         margin: 0px;
         padding-left: 7px;
         font-family: monospace;
         min-height: 50px;
         -moz-box-shadow: 0px 6px 10px -1px #adadad;
         -webkit-box-shadow: 0px 6px 10px -1px #adadad;
         box-shadow: 0px 6px 10px -1px #adadad;
         border-radius: 2px;
         position: absolute;
         z-index: 1000;
+      }
       .ipython_tooltip a {
         float: right;
+      }
       .ipython_tooltip .tooltiptext pre {
         border: 0;
         border-radius: 0;
         font-size: 100%;
         background-color: #f7f7f7;
+      }
       .pretooltiparrow {
         left: 0px;
         margin: 0px;
         top: -16px;
         width: 40px;
         height: 16px;
         overflow: hidden;
         position: absolute;
+      }
       .pretooltiparrow:before {
         background-color: #f7f7f7;
         border: 1px #ababab solid;
         z-index: 11;
         content: "";
         position: absolute;
         left: 15px;
         top: 10px;
         width: 25px;
         height: 25px;
         -webkit-transform: rotate(45deg);
         -moz-transform: rotate(45deg);
         -ms-transform: rotate(45deg);
         -o-transform: rotate(45deg);
+      }
       ul.typeahead-list i {
         margin-left: -10px;
         width: 18px;
+      }
       ul.typeahead-list {
         max-height: 80vh;
         overflow: auto;
+      }
       ul.typeahead-list > li > a {
         /** Firefox bug **/
         /* see https://github.com/jupyter/notebook/issues/559 */
         white-space: normal;
+      }
       .cmd-palette .modal-body {
         padding: 7px;
+      }
       .cmd-palette form {
         background: white;
+      }
       .cmd-palette input {
         outline: none;
+      }
       .no-shortcut {
         display: none;
+      }
       .command-shortcut:before {
         content: "(command)";
         padding-right: 3px;
         color: #777777;
+      }
       .edit-shortcut:before {
         content: "(edit)";
         padding-right: 3px;
         color: #777777;
+      }
       #find-and-replace #replace-preview .match,
       #find-and-replace #replace-preview .insert {
         background-color: #BBDEFB;
         border-color: #90CAF9;
         border-style: solid;
         border-width: 1px;
         border-radius: 0px;
+      }
       #find-and-replace #replace-preview .replace .match {
         background-color: #FFCDD2;
         border-color: #EF9A9A;
         border-radius: 0px;
+      }
       #find-and-replace #replace-preview .replace .insert {
         background-color: #C8E6C9;
         border-color: #A5D6A7;
         border-radius: 0px;
+      }
       #find-and-replace #replace-preview {
         max-height: 60vh;
         overflow: auto;
+      }
       #find-and-replace #replace-preview pre {
         padding: 5px 10px;
+      }
       .terminal-app {
         background: #EEE;
+      }
       .terminal-app #header {
         background: #fff;
         -webkit-box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2);
         box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.2);
+      }
       .terminal-app .terminal {
         width: 100%;
         float: left;
         font-family: monospace;
         color: white;
         background: black;
         padding: 0.4em;
         border-radius: 2px;
         -webkit-box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.4);
         box-shadow: 0px 0px 12px 1px rgba(87, 87, 87, 0.4);
+      }
       .terminal-app .terminal,
       .terminal-app .terminal dummy-screen {
         line-height: 1em;
         font-size: 14px;
+      }
       .terminal-app .terminal .xterm-rows {
         padding: 10px;
+      }
       .terminal-app .terminal-cursor {
         color: black;
         background: white;
+      }
       .terminal-app #terminado-container {
         margin-top: 20px;
+      }
       /*# sourceMappingURL=style.min.css.map */
           </style>
       <style type="text/css">
           .highlight .hll { background-color: #ffffcc }
       .highlight  { background: #f8f8f8; }
       .highlight .c { color: #408080; font-style: italic } /* Comment */
       .highlight .err { border: 1px solid #FF0000 } /* Error */
       .highlight .k { color: #008000; font-weight: bold } /* Keyword */
       .highlight .o { color: #666666 } /* Operator */
       .highlight .ch { color: #408080; font-style: italic } /* Comment.Hashbang */
       .highlight .cm { color: #408080; font-style: italic } /* Comment.Multiline */
       .highlight .cp { color: #BC7A00 } /* Comment.Preproc */
       .highlight .cpf { color: #408080; font-style: italic } /* Comment.PreprocFile */
       .highlight .c1 { color: #408080; font-style: italic } /* Comment.Single */
       .highlight .cs { color: #408080; font-style: italic } /* Comment.Special */
       .highlight .gd { color: #A00000 } /* Generic.Deleted */
       .highlight .ge { font-style: italic } /* Generic.Emph */
       .highlight .gr { color: #FF0000 } /* Generic.Error */
       .highlight .gh { color: #000080; font-weight: bold } /* Generic.Heading */
       .highlight .gi { color: #00A000 } /* Generic.Inserted */
       .highlight .go { color: #888888 } /* Generic.Output */
       .highlight .gp { color: #000080; font-weight: bold } /* Generic.Prompt */
       .highlight .gs { font-weight: bold } /* Generic.Strong */
       .highlight .gu { color: #800080; font-weight: bold } /* Generic.Subheading */
       .highlight .gt { color: #0044DD } /* Generic.Traceback */
       .highlight .kc { color: #008000; font-weight: bold } /* Keyword.Constant */
       .highlight .kd { color: #008000; font-weight: bold } /* Keyword.Declaration */
       .highlight .kn { color: #008000; font-weight: bold } /* Keyword.Namespace */
       .highlight .kp { color: #008000 } /* Keyword.Pseudo */
       .highlight .kr { color: #008000; font-weight: bold } /* Keyword.Reserved */
       .highlight .kt { color: #B00040 } /* Keyword.Type */
       .highlight .m { color: #666666 } /* Literal.Number */
       .highlight .s { color: #BA2121 } /* Literal.String */
       .highlight .na { color: #7D9029 } /* Name.Attribute */
       .highlight .nb { color: #008000 } /* Name.Builtin */
       .highlight .nc { color: #0000FF; font-weight: bold } /* Name.Class */
       .highlight .no { color: #880000 } /* Name.Constant */
       .highlight .nd { color: #AA22FF } /* Name.Decorator */
       .highlight .ni { color: #999999; font-weight: bold } /* Name.Entity */
       .highlight .ne { color: #D2413A; font-weight: bold } /* Name.Exception */
       .highlight .nf { color: #0000FF } /* Name.Function */
       .highlight .nl { color: #A0A000 } /* Name.Label */
       .highlight .nn { color: #0000FF; font-weight: bold } /* Name.Namespace */
       .highlight .nt { color: #008000; font-weight: bold } /* Name.Tag */
       .highlight .nv { color: #19177C } /* Name.Variable */
       .highlight .ow { color: #AA22FF; font-weight: bold } /* Operator.Word */
       .highlight .w { color: #bbbbbb } /* Text.Whitespace */
       .highlight .mb { color: #666666 } /* Literal.Number.Bin */
       .highlight .mf { color: #666666 } /* Literal.Number.Float */
       .highlight .mh { color: #666666 } /* Literal.Number.Hex */
       .highlight .mi { color: #666666 } /* Literal.Number.Integer */
       .highlight .mo { color: #666666 } /* Literal.Number.Oct */
       .highlight .sa { color: #BA2121 } /* Literal.String.Affix */
       .highlight .sb { color: #BA2121 } /* Literal.String.Backtick */
       .highlight .sc { color: #BA2121 } /* Literal.String.Char */
       .highlight .dl { color: #BA2121 } /* Literal.String.Delimiter */
       .highlight .sd { color: #BA2121; font-style: italic } /* Literal.String.Doc */
       .highlight .s2 { color: #BA2121 } /* Literal.String.Double */
       .highlight .se { color: #BB6622; font-weight: bold } /* Literal.String.Escape */
       .highlight .sh { color: #BA2121 } /* Literal.String.Heredoc */
       .highlight .si { color: #BB6688; font-weight: bold } /* Literal.String.Interpol */
       .highlight .sx { color: #008000 } /* Literal.String.Other */
       .highlight .sr { color: #BB6688 } /* Literal.String.Regex */
       .highlight .s1 { color: #BA2121 } /* Literal.String.Single */
       .highlight .ss { color: #19177C } /* Literal.String.Symbol */
       .highlight .bp { color: #008000 } /* Name.Builtin.Pseudo */
       .highlight .fm { color: #0000FF } /* Name.Function.Magic */
       .highlight .vc { color: #19177C } /* Name.Variable.Class */
       .highlight .vg { color: #19177C } /* Name.Variable.Global */
       .highlight .vi { color: #19177C } /* Name.Variable.Instance */
       .highlight .vm { color: #19177C } /* Name.Variable.Magic */
       .highlight .il { color: #666666 } /* Literal.Number.Integer.Long */
           </style>
       <style type="text/css">
       /* Temporary definitions which will become obsolete with Notebook release 5.0 */
       .ansi-black-fg { color: #3E424D; }
       .ansi-black-bg { background-color: #3E424D; }
       .ansi-black-intense-fg { color: #282C36; }
       .ansi-black-intense-bg { background-color: #282C36; }
       .ansi-red-fg { color: #E75C58; }
       .ansi-red-bg { background-color: #E75C58; }
       .ansi-red-intense-fg { color: #B22B31; }
       .ansi-red-intense-bg { background-color: #B22B31; }
       .ansi-green-fg { color: #00A250; }
       .ansi-green-bg { background-color: #00A250; }
       .ansi-green-intense-fg { color: #007427; }
       .ansi-green-intense-bg { background-color: #007427; }
       .ansi-yellow-fg { color: #DDB62B; }
       .ansi-yellow-bg { background-color: #DDB62B; }
       .ansi-yellow-intense-fg { color: #B27D12; }
       .ansi-yellow-intense-bg { background-color: #B27D12; }
       .ansi-blue-fg { color: #208FFB; }
       .ansi-blue-bg { background-color: #208FFB; }
       .ansi-blue-intense-fg { color: #0065CA; }
       .ansi-blue-intense-bg { background-color: #0065CA; }
       .ansi-magenta-fg { color: #D160C4; }
       .ansi-magenta-bg { background-color: #D160C4; }
       .ansi-magenta-intense-fg { color: #A03196; }
       .ansi-magenta-intense-bg { background-color: #A03196; }
       .ansi-cyan-fg { color: #60C6C8; }
       .ansi-cyan-bg { background-color: #60C6C8; }
       .ansi-cyan-intense-fg { color: #258F8F; }
       .ansi-cyan-intense-bg { background-color: #258F8F; }
       .ansi-white-fg { color: #C5C1B4; }
       .ansi-white-bg { background-color: #C5C1B4; }
       .ansi-white-intense-fg { color: #A1A6B2; }
       .ansi-white-intense-bg { background-color: #A1A6B2; }
       .ansi-bold { font-weight: bold; }
           </style>
       <style type="text/css">
       /* Overrides of notebook CSS for static HTML export */
       body {
         overflow: visible;
         padding: 8px;
+      }
       div#notebook {
         overflow: visible;
         border-top: none;
       }@media print {
         div.cell {
           display: block;
           page-break-inside: avoid;
+        }
         div.output_wrapper {
           display: block;
           page-break-inside: avoid;
+        }
         div.output {
           display: block;
           page-break-inside: avoid;
+        }
+      }
       </style>
       <!-- Custom stylesheet, it must be in the same directory as the html file -->
       <link rel="stylesheet" href="custom.css">
       <!-- Loading mathjax macro -->
       <!-- Load mathjax -->
           <script src="https://cdnjs.cloudflare.com/ajax/libs/mathjax/2.7.1/MathJax.js?config=TeX-AMS_HTML"></script>
           <!-- MathJax configuration -->
           <script type="text/x-mathjax-config">
           MathJax.Hub.Config({
               tex2jax: {
                   inlineMath: [ ['$','$'], ["\\(","\\)"] ],
                   displayMath: [ ['$$','$$'], ["\\[","\\]"] ],
                   processEscapes: true,
                   processEnvironments: true
               },
               // Center justify equations in code and markdown cells. Elsewhere
               // we use CSS to left justify single line equations in code cells.
               displayAlign: 'center',
               "HTML-CSS": {
                   styles: {'.MathJax_Display': {"margin": 0}},
                   linebreaks: { automatic: true }
+              }
           });
           </script>
           <!-- End of mathjax configuration --></head>
       <body>
         <div tabindex="-1" id="notebook" class="border-box-sizing">
           <div class="container" id="notebook-container">
       <div class="cell border-box-sizing code_cell rendered">
       <div class="input">
       <div class="prompt input_prompt">In&nbsp;[1]:</div>
       <div class="inner_cell">
           <div class="input_area">
       <div class=" highlight hl-ipython3"><pre><span></span><span class="kn">from</span> <span class="nn">rdkit</span> <span class="k">import</span> <span class="n">Chem</span>
       <span class="kn">from</span> <span class="nn">rdkit.Chem</span> <span class="k">import</span> <span class="n">AllChem</span>
       <span class="kn">from</span> <span class="nn">rdkit</span> <span class="k">import</span> <span class="n">RDConfig</span>
       <span class="kn">from</span> <span class="nn">rdkit.Chem.Draw</span> <span class="k">import</span> <span class="n">IPythonConsole</span>
       <span class="kn">from</span> <span class="nn">rdkit.Chem</span> <span class="k">import</span> <span class="n">Draw</span>
       <span class="kn">import</span> <span class="nn">numpy</span> <span class="k">as</span> <span class="nn">np</span>
       <span class="kn">from</span> <span class="nn">IPython.display</span> <span class="k">import</span> <span class="n">display</span><span class="p">,</span><span class="n">Image</span>
       </pre></div>
       </div>
       </div>
       </div>
       </div>
       <div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt">
       </div>
       <div class="inner_cell">
       <div class="text_cell_render border-box-sizing rendered_html">
       <h2 id="&#1048;&#1073;&#1091;&#1087;&#1088;&#1086;&#1092;&#1077;&#1085;">&#1048;&#1073;&#1091;&#1087;&#1088;&#1086;&#1092;&#1077;&#1085;<a class="anchor-link" href="#&#1048;&#1073;&#1091;&#1087;&#1088;&#1086;&#1092;&#1077;&#1085;">&#182;</a></h2><p>Нотация SMILES ибупрофена: CC(C)CC1=CC=C(C=C1)C(C)C(=O)O. Используя ее, нарисуем ибупрофен.</p>
       </div>
       </div>
       </div>
       <div class="cell border-box-sizing code_cell rendered">
       <div class="input">
       <div class="prompt input_prompt">In&nbsp;[2]:</div>
       <div class="inner_cell">
           <div class="input_area">
       <div class=" highlight hl-ipython3"><pre><span></span><span class="n">ibuprophenSmiles</span> <span class="o">=</span> <span class="s1">&#39;CC(C)CC1=CC=C(C=C1)C(C)C(=O)O&#39;</span>
       <span class="n">ibuprophen</span><span class="o">=</span><span class="n">Chem</span><span class="o">.</span><span class="n">MolFromSmiles</span><span class="p">(</span><span class="n">ibuprophenSmiles</span><span class="p">)</span>
       <span class="n">AllChem</span><span class="o">.</span><span class="n">Compute2DCoords</span><span class="p">(</span><span class="n">ibuprophen</span><span class="p">)</span>
       <span class="n">display</span><span class="p">(</span><span class="n">ibuprophen</span><span class="p">)</span>
       </pre></div>
       </div>
       </div>
       </div>
       <div class="output_wrapper">
       <div class="output">
       <div class="output_area">
       <div class="prompt"></div>
       <div class="output_png output_subarea ">
       <img src="data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAcIAAACWCAIAAADCEh9HAAAFj0lEQVR4nO3d0XLbNhCGUbPT939l
 UIdJ6ElxtaKxL/AOZOLxs14KMT4uBKpaLvdbh8AvOqf0QcA0JuMApTIKECJjAKUyChAiYwClMgo
       QImMApTIKECJjAKUyChAiYwClMgoQImMApTIKECJjAKUyChAiYwClMgoQMm/ow8AVrVtv/7bR6J1
       JqMwwrb9kc7db2nFk3q43Ndo3m5/DKe0IqMAJTIKUCKjACUyClAio3C5rxeUXKnvzA1PMMKupBra
       mYzCINI5C0/qIZibSTuQ0ZY2u2sRbsvvQEYBSmS0n23bbl5WW4eBNJ6MQoaDVippNhltxig6La1s
       S0ahA5ENJqOdGEUnp5U9ySgkOSipyKaS0TaMoqtQ0m5kFKBERnswiq7FQNqKjEKkw5J6N3AUGW3A
       KLoog2cTMgr93AykSWQ0nVF0ac8HUiXNIaOQTS7jyWg0oygHDKQhZBTSyWU4Gc1lFOXTs5IqbAIZ
       hd6uK+m2/fq1+/rXP7kSnwwayijKzj2Xw34qtu2PjzLd/XZtMgrtVQt78MbTzz+w++b3O7GU9OPj
       Q0YzGUV56CCXuy8+fiH1+fetH9vKZBQ62ZX02auiV5+GF3sxdEdG4xhF+ZGIn5bdMSxWVVfqoZnP
       S/POuCFkNIuNwXdc/UPy9a39ri/9xpN6aOnqM+6upBr6GxkNYhR9wfGd59bznZ4t5tevL7bsMsp4
       lTfhHIdy1jPTrI+rKRlNMffGMDMyMRnlIkNaOfgNlOeY7xF150p9hLk3xthH599A4mwyCp3MfcZt
       SkbHm3tjJDw6Aymn8troRWzjCxwke44XSSd4CFOS0Z95uYbuy7nAHK2kHRndc2vOBYbErntkWx/8
 GR0z3057xLYyinXmeFcYkqxzmWQs0M25UqqfzIZ5RSx237KyDKWjAZZYYdfk9fjlWy3zrHnJO5k
       NEu7Hf5QwrafYyVpQUa5TkJe7xpFNmfReEZG4zTa4Q/lbPvJntoTS0YTTbnDB97/9Nr/TZBzTuKA
       jPJOtj0LktFQ+YPSjwzMa9+B1DmpCxnNlbzDH4rd9n1LSgsyyukS8tqulQmLxjfJaLRGm7/1tm+0
       zgSS0XTdd3hOXhs9tc9ZNL5DRhuI2uEPddn2+StJRzLKibrk9S4ksr0WjQ8Z7SJkhz/Ua9s3empP
       FzLaRrsdHpvX5JWMXTQOyCgl82375MiSabY9ML20bD07nrTj/Or4CM87fh/2NR+fxdRM1KcJ5RzJ
       C4or6TNi+SSjvN8ELfjrU/vuD5A3ktF+QgbShGMo+utKpn2yKZlcYmop+TJIrwo8O9TYf5KKQDLK
       K3q1Ek4lo11lzixz5HX4o8j8y+UZr402durraC6wjOVF0kZkdHIX35czwbYXL35KRntzX87EDKRd
       +EviRVPu8MAHFXhI7LjExItcBoE7GYX/Zc59Tlf5ZJTX2eHXsM7hZJSSaXZ45ihKCzIKDUxzupqS
       jFI1wQ5vMYpOsM6zklHewA5nZTLK6lqMondOV5lklPeww1mWjPI2HUvaaBS967jI05NRaEZJ08go
 Rrh7cbRckko9BPr9PV9GSUN+uyw7uPol3WeQUyyvvZ4SxFRllR91H0zukqhIxyCjv8GtY5gYxy
       ltgdPscoSg6fxUR7z2K9SCt9ZNNwVp9zvbbDfzTG/uj7z1qcWR9XC6ZRznU8Ky0+SDIHGWWki3M5
 cjmqf1ALjFxuthrTZPR0FFklCsklNSwxklkFKBERrnI2IHUKMp5XGLiOmdfBhn+ugFrklGyVFJo
 mQIz3S42nEo/UDSjowClLjEBFAiowAlMgpQIqMAJTIKUCKjACUyClAiowAlMgpQIqMAJTIKUCKj
       ACUyClAiowAlMgpQIqMAJTIKUCKjACUyClAiowAlMgpQ8h+c/UQin4jfUAAAAABJRU5ErkJggg==
+      "
+      >
       </div>
       </div>
       </div>
       </div>
       </div>
       <div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt">
       </div>
       <div class="inner_cell">
       <div class="text_cell_render border-box-sizing rendered_html">
       <h2 id="&#1052;&#1086;&#1076;&#1080;&#1092;&#1080;&#1082;&#1072;&#1094;&#1080;&#1103;-&#1080;&#1073;&#1091;&#1087;&#1088;&#1086;&#1092;&#1077;&#1085;&#1072;">&#1052;&#1086;&#1076;&#1080;&#1092;&#1080;&#1082;&#1072;&#1094;&#1080;&#1103; &#1080;&#1073;&#1091;&#1087;&#1088;&#1086;&#1092;&#1077;&#1085;&#1072;<a class="anchor-link" href="#&#1052;&#1086;&#1076;&#1080;&#1092;&#1080;&#1082;&#1072;&#1094;&#1080;&#1103;-&#1080;&#1073;&#1091;&#1087;&#1088;&#1086;&#1092;&#1077;&#1085;&#1072;">&#182;</a></h2><p>Модифицируем ибупрофена, с помощью замены изопропила на этин: CC(C) на C#.</p>
       </div>
       </div>
       </div>
       <div class="cell border-box-sizing code_cell rendered">
       <div class="input">
       <div class="prompt input_prompt">In&nbsp;[3]:</div>
       <div class="inner_cell">
           <div class="input_area">
       <div class=" highlight hl-ipython3"><pre><span></span><span class="n">mod_ibuprophenSmiles</span> <span class="o">=</span> <span class="n">ibuprophenSmiles</span><span class="o">.</span><span class="n">replace</span><span class="p">(</span><span class="s1">&#39;CC(C)&#39;</span><span class="p">,</span><span class="s1">&#39;C#&#39;</span><span class="p">)</span>
       <span class="n">mod_ibuprophen</span><span class="o">=</span><span class="n">Chem</span><span class="o">.</span><span class="n">MolFromSmiles</span><span class="p">(</span><span class="n">mod_ibuprophenSmiles</span><span class="p">)</span>
       <span class="n">AllChem</span><span class="o">.</span><span class="n">Compute2DCoords</span><span class="p">(</span><span class="n">mod_ibuprophen</span><span class="p">)</span>
       <span class="n">display</span><span class="p">(</span><span class="n">mod_ibuprophen</span><span class="p">)</span>
       </pre></div>
       </div>
       </div>
       </div>
       <div class="output_wrapper">
       <div class="output">
       <div class="output_area">
       <div class="prompt"></div>
       <div class="output_png output_subarea ">
       <img src="data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAcIAAACWCAIAAADCEh9HAAAFhklEQVR4nO3d0ZKiSBBAUdjY//9l
 mG2OxwVRBKqMotznmYnOqbRhWsiWM7LskwAHPVP7w0AqE1GAUJkFCBERgFCZBQgREYBQmQUIERG
       AUJkFCBERgFCZBQgREYBQmQUIERGAUJkFCBERgFCZBQgREYBQmQUIERGAUJkFCBERgFCZBQgREZL
       mue59yYA/5NRgBAZLWlZFgMpJCGjACEyWpWBFJKQUYAQGQUIkdHCnNdDBjIKECKjtRlIobt/e28A
       vPf48rAsS8ctgW0ySkbzPD+mc23illcymO2IA3iKTnX7H87bvI70VFCCaZTC3hbT6EpjQ00xdzbM
       QHrdA5FXLmIaJZFLXwzW/mXXsgiSUbLoNVD//lK3jnGM+0YHUf0G0gxvSlR/DunFNEpqzrjJr/8I
       wIkyzHQH7NzsNteIij6HdGQapbP92dpzjWjPz8O5ZJSeThn95JW+nL+MptA5aa9N/fh+a6HnkAxM
       o9yORHIuNzyNpspdO5knvirPIUnIKB1kbih8S0ZpTUMZjIwOKPM5aZWGZn4OyUZGAUJkdEw5h6kq
       oyh8RUZppFxDc74UkZCM0kK5hsJ+MjqsPMNU3YbmeQ7JTEYBQmR0ZBmGqbqjKOwko+Obf3T51dUb
       muGliOQsTTKyp4o1XjhugIbCHjJ6Iy3X5RypoX8G0mEeDqeT0WFdtKq8msATGR3TdavK7xldzW7c
       it19QF0qNvxXeHptYI0r9Zxj+bHxMy55MyQZHU33oWnUO4RGfVzEyehQujd0mxIxJBkdR56GyiW3
       IqM0VbqwpTee68joIPKMonA3MjqChA01uHEfMlpewoZuK13Y0hvPRWSUqwxQnLTbPz/ovS34FFNx
       yUfRjc1LvuVTnY1vvHAXr3ymvrBUB/NbdddG+rjZv/Hq/uisLNOdjFZVNE8D6LuK636HV5bhWzJK
       H5kH1a9O51uu4hq3Z2tz/k/JTEZLShugV5lz+dZZW1vrXLv7BpQmo/XUqlIt289t31VcScsBWUzR
       hq5tdqqH06Ch38o5uvLENAqf9cq90bUEGa0k1ex2ijzvnCbZjD1qXdS6Axmdpnmenvazp7953Dv7
 ZGFjvNXeXL5VsLT+QNqXdQaiYx+8prUHvtflSO5ojEausE7A1eT0U2v0VyWXiWtbm0g7TuoDt/Q
       NW4gPZGMhl1/yj/wwUw29rQDZHSapr9T+K21d1HXfuZLIzU020B621GUc8noNE0vmTtc1bWj7uEf
       /P3TnkP0z5HseL5C0YY66U5IRpt42N1//+Q9/o6KNnT6e/ewCyWRd3dpZ/uGp+ZX6t+OG5kP7G9l
       +ERTlbVEj3GHU2Om0U/+XJp//M8Wv9Mef6EBQrnNHU6NDb4/VZRhWLtax8dY93T+It5sjTONpuOa
 nU09NUNH/LpfKVdGQN8Q9xHlx7SGspFZDSj4Ys5/APkVmS0EvU5zCjKdWSUPlq+JGgol5LRpNYq
       YyA9QEO5lIzSjZcExiCj9QxWn/lHl19tFCXObpTa6nE+4pqnjT9mo6Gcxe33ZNHyK4Y0lBPJaGqr
       n2i60yL8vmKI5GQ0O1VYc3gBDqMo55LRsu40kO7nK4ZoT0bTk8szSCfXccMTQIiMVvC0dPTHvwca
       klGAEBktwuAJWclocfIKvckoQIiM1uFCE6QkowAhMlrKxkAKdCKjACEyWo3BE5KRUYAQGQUIkVGA
       EBkFCJFRgBDLNtf3eCep6/jQnIwW97QwvnXyoTkn9ZW9RtPn66E5GQUIkVGAEBkFCJFRgBAZrez1
       gpIr9dCcG56KeyqphkJzMlqfdEJXTuoBQmQUIERGAUJkFCBERgFCZBQgREYBQmQUIERGAUJkFCBE
       RgFCZBQgREYBQmQUIERGAUJkFCBERgFC/gPZ4mT8xpxqgwAAAABJRU5ErkJggg==
+      "
+      >
       </div>
       </div>
       </div>
       </div>
       </div>
       <div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt">
       </div>
       <div class="inner_cell">
       <div class="text_cell_render border-box-sizing rendered_html">
       <h2 id="&#1069;&#1084;&#1091;&#1083;&#1103;&#1094;&#1080;&#1103;-&#1088;&#1077;&#1072;&#1075;&#1077;&#1085;&#1090;&#1072;-Click-Chemistry">&#1069;&#1084;&#1091;&#1083;&#1103;&#1094;&#1080;&#1103; &#1088;&#1077;&#1072;&#1075;&#1077;&#1085;&#1090;&#1072; Click Chemistry<a class="anchor-link" href="#&#1069;&#1084;&#1091;&#1083;&#1103;&#1094;&#1080;&#1103;-&#1088;&#1077;&#1072;&#1075;&#1077;&#1085;&#1090;&#1072;-Click-Chemistry">&#182;</a></h2><p>Проведем Copper(I)-catalyzed azide-alkyne cycloaddition (CuAAC). Для начала построим template с радикалом R1, которым будем модифицированный ибупрофен.</p>
       </div>
       </div>
       </div>
       <div class="cell border-box-sizing code_cell rendered">
       <div class="input">
       <div class="prompt input_prompt">In&nbsp;[4]:</div>
       <div class="inner_cell">
           <div class="input_area">
       <div class=" highlight hl-ipython3"><pre><span></span><span class="n">template</span> <span class="o">=</span> <span class="s1">&#39;N1C=C(N=N1)C1=CC=C(C=C1)C(C)C(=O)O&#39;</span>
       <span class="n">ibu_cycle</span><span class="o">=</span><span class="n">Chem</span><span class="o">.</span><span class="n">MolFromSmiles</span><span class="p">(</span><span class="n">template</span><span class="p">)</span>
       <span class="n">AllChem</span><span class="o">.</span><span class="n">Compute2DCoords</span><span class="p">(</span><span class="n">ibu_cycle</span><span class="p">)</span>
       <span class="n">display</span><span class="p">(</span><span class="n">ibu_cycle</span><span class="p">)</span>
       </pre></div>
       </div>
       </div>
       </div>
       <div class="output_wrapper">
       <div class="output">
       <div class="output_area">
       <div class="prompt"></div>
       <div class="output_png output_subarea ">
       <img src="data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAcIAAACWCAIAAADCEh9HAAAGpUlEQVR4nO3d3XabVhCAUejq+78y
       vZAry4AQYviZOey9ctE6cSJjzscgkNwPw9ABsNU/Vz8AgNpkFCBERgFCZBQgREYBQmQUIERGAUJk
       FCBERgFCZBQgREYBQmQUIERGAUJkFCBERgFCZBQgREYBQmQUIERGAUJkFCBERgFC/r36AQB/9f3v
       f/vBvRXIKGTS93/SOfpfUnJSD2lMozkMf4ZTUpJRgBAZBQiRUYAQGQUIkVFIY3pByZX6CtzwBJmM
       SqqhFcgoJCOd1TipBwiRUSjF3fj5yChAiIxCKV4emo+MQlZyWYSMQjUG0mRkFLKSyyJkFApS2Exk
 DLTVWBdMCaXFcjolSwQtlPYNGT0ShYCn9lL0pNRKEthc5DRk/T9z68RC4HP7CW5eYenA618w7PH
       GvG2Pmxh70lARvc0mhjs2+zmfS77rrOjXUtGQ/bqppM2NhuGoe/7wUH7OjL6tYPem/w+Je3nvk4V
       +Mz5e1YOYj+m++foI8+1b4NFvJubZts6dfPddWHqNJBeyDT6a/lIbxc91MoErKltwzVx/p6TjP5y
       znS0eALWfLonDTiZjJ7h2ycEmqz5aWPU9F9Z+YxBCe8GUoPqhWT0jx0H0siVqPbm4mtXuMRwKBkd
 wwN41yDgNpNjIactDNT11bA2mGtS0xHEdGZ3y8hdPNT+st36Mz+ojMrWQgTUVG5y2X9Jy9tIGB
       dHlJf3stKH6VX2I4goz+mC4uy+18y407NLLlLAyklzyeO5PR1EoPpLuPfl9FdvYPNzyQvjvGNPnF
       ZiOjY9myVbSk59fqhr14HhW+egK6G70j1P222+5klP1lnvgaG0g/fiGfv9J3T5UsfOK7O1Q+vjNF
       o2S0gKIDKeeIHhXefe7KVto1ZZTdtTTr5Xfg1p79a6fRdJD3s5iqqPJupCUa+jivv/pR7KDE1r4D
 +gfmQ+rw5B92SR/eJyhiePTt2SUO2rgQlPSxz+9xHQDTuoryXw2mnRVN8rWTkVG2UHFVZ35mJTX
 En6zE+EncVJfTEJz0azPZ7mXbzBRyX1rZdR7izhMemjFA/43QO46ztTOKmvJ9XZaIpVfRu2dk4y
       ynYNrOpUxySKktECZt/e+PLF30BDa7HB05LRXzkvOVo8R8twTPrIbpCZS0ypLSye6eI/c5lZ1fAk
       o3ktp2r6u6e9ObyGnswGT05GS9rw0yMWIvvVEm1ySWe+8yntA+NJRpNafj/zDetqebDd9olAJ6Ov
 uTi5AEk/jOOuvpDU86BNOFDYkpG0/n2KdGjvf5z+a9ot0RDq3DDUy7ZGjqycG9QiduGlqX6Ei7/
       XrOejCaSvKHALBnNokpDDaQnyPPtZg0ZTaFKQzmBb3c5MppdwkXVxkDawJdAEq7UXy9hKJv3cZu/
       ltSrbFl264xO34vk+ZGF39r7MZQ8nV+4yzLnDZjreZUt37p1Rrur39WpaEOr+3bDepUty+6e0cfP
       lblk763e0KID6e6b3atsuXtGr1K9oUWdvNl3eZUt+cno24H0uKu1d2ho5oF0llfZspkbnrpu7odv
       Pz74+msvLTW01r1BmbdtrS3JiIwmknmdb5AqDS0dvchGRn/MDqS7a2+5pmrlNkm+KQ1syduS0V9H
       LyUD0VV2fw9seHXrjE6Xz/MjC7/10PffTa8NNzT5a0MLbdsMm4sNXKnf6Plip27dGNtqQ5Nr+OhF
       HreeRuMeF/Efk+m2MaKNlZx8IJ3VxpYnA9PoDp6Lcf1w+v+ft5IPVPEp0XL329KZRvf1Mpz2H0ew
       xlZLtoG0sc1LZqbR/Q1D13VD9/9LUyzm85V+StRAWo5p9EDDMDyWxHQWa3KdZBtIZzW55bmWjB5u
       GlMr+VAVnxIdyXPUYQ0n9Sd5rN47n+afc65aJZS0xDR6qsdkevWjOFDmMUphOYiMcp6jI9vA6fxT
 gMSIzLKzq5a/y01lFpklFMdlLMmQ2kgrUJG2V+q9d9kYUlFRimv4dP5VAck3pFRDnHm+m+1oVQh
       owAhMspRrj0hbWYUdV6fn1cxcaxpAk6oWzMNpQR7G2dbM1tFdssmG9rkF9UM0yhnW5ODlaexykIG
       DnEUNlvbVndpA2laplEKkxUycKUeIERGoQZ3PqUlowAhMgplGEhzklGAEBmFSgykCckoQIiMQjHu
       ls1GRgFCZBQgREYBQmQUIERGAUJkFCBERgFCZBQgREYBQmQUIERGAUJkFCBERgFCZBQgREYBQmQU
       IERGAUJkFCBERgFCZBQgREYBQmQUIERGAUL+A3itceGSfZi8AAAAAElFTkSuQmCC
+      "
+      >
       </div>
       </div>
       </div>
       </div>
       </div>
       <div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt">
       </div>
       <div class="inner_cell">
       <div class="text_cell_render border-box-sizing rendered_html">
       <p>Теперь загрузим скачанные SMILES для радикалов с азидом и отфильтруем их.</p>
       </div>
       </div>
       </div>
       <div class="cell border-box-sizing code_cell rendered">
       <div class="input">
       <div class="prompt input_prompt">In&nbsp;[5]:</div>
       <div class="inner_cell">
           <div class="input_area">
       <div class=" highlight hl-ipython3"><pre><span></span><span class="n">strings</span><span class="o">=</span><span class="n">np</span><span class="o">.</span><span class="n">genfromtxt</span><span class="p">(</span><span class="s1">&#39;873774121219644625.txt&#39;</span><span class="p">,</span><span class="n">dtype</span><span class="o">=</span><span class="n">np</span><span class="o">.</span><span class="n">str</span><span class="p">)</span>
       <span class="n">r_smiles</span><span class="o">=</span><span class="p">[]</span>
       <span class="k">for</span> <span class="n">line</span> <span class="ow">in</span> <span class="n">strings</span><span class="p">:</span>
           <span class="k">if</span> <span class="nb">len</span><span class="p">(</span><span class="n">line</span><span class="p">[</span><span class="mi">1</span><span class="p">])</span> <span class="o">&lt;</span> <span class="mi">30</span> <span class="ow">and</span> <span class="ow">not</span> <span class="s1">&#39;.&#39;</span> <span class="ow">in</span> <span class="n">line</span><span class="p">[</span><span class="mi">1</span><span class="p">]:</span>
               <span class="n">r_smiles</span><span class="o">.</span><span class="n">append</span><span class="p">(</span><span class="n">line</span><span class="p">[</span><span class="mi">1</span><span class="p">])</span>
       <span class="nb">print</span><span class="p">(</span><span class="nb">len</span><span class="p">(</span><span class="n">r_smiles</span><span class="p">))</span>
       </pre></div>
       </div>
       </div>
       </div>
       <div class="output_wrapper">
       <div class="output">
       <div class="output_area">
       <div class="prompt"></div>
       <div class="output_subarea output_stream output_stdout output_text">
       <pre>10747
       </pre>
       </div>
       </div>
       </div>
       </div>
       </div>
       <div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt">
       </div>
       <div class="inner_cell">
       <div class="text_cell_render border-box-sizing rendered_html">
       <p>И заменим в них азид на построенный template.</p>
       </div>
       </div>
       </div>
       <div class="cell border-box-sizing code_cell rendered">
       <div class="input">
       <div class="prompt input_prompt">In&nbsp;[6]:</div>
       <div class="inner_cell">
           <div class="input_area">
       <div class=" highlight hl-ipython3"><pre><span></span><span class="n">res_smiles</span><span class="o">=</span><span class="p">[]</span>
       <span class="n">azid</span> <span class="o">=</span> <span class="s1">&#39;N=[N+]=[N-]&#39;</span>
       <span class="k">for</span> <span class="n">r_smi</span> <span class="ow">in</span> <span class="n">r_smiles</span><span class="p">[:</span><span class="mi">10747</span><span class="p">]:</span>
           <span class="k">if</span> <span class="n">azid</span> <span class="ow">in</span> <span class="n">r_smi</span><span class="p">:</span>
               <span class="n">res_smi</span><span class="o">=</span><span class="n">r_smi</span><span class="o">.</span><span class="n">replace</span><span class="p">(</span><span class="n">azid</span><span class="p">,</span> <span class="n">template</span><span class="p">)</span>
               <span class="n">res_smiles</span><span class="o">.</span><span class="n">append</span><span class="p">(</span><span class="n">res_smi</span><span class="p">)</span>
           <span class="k">else</span><span class="p">:</span>
               <span class="k">continue</span>
       </pre></div>
       </div>
       </div>
       </div>
       </div>
       <div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt">
       </div>
       <div class="inner_cell">
       <div class="text_cell_render border-box-sizing rendered_html">
       <h2 id="&#1055;&#1088;&#1072;&#1074;&#1080;&#1083;&#1086;-&#1087;&#1103;&#1090;&#1080;-&#1051;&#1077;&#1087;&#1080;&#1085;&#1089;&#1082;&#1080;:">&#1055;&#1088;&#1072;&#1074;&#1080;&#1083;&#1086; &#1087;&#1103;&#1090;&#1080; &#1051;&#1077;&#1087;&#1080;&#1085;&#1089;&#1082;&#1080;:<a class="anchor-link" href="#&#1055;&#1088;&#1072;&#1074;&#1080;&#1083;&#1086;-&#1087;&#1103;&#1090;&#1080;-&#1051;&#1077;&#1087;&#1080;&#1085;&#1089;&#1082;&#1080;:">&#182;</a></h2><ul>
       <li>No more than 5 hydrogen bond donors</li>
       <li>No more than 10 hydrogen bond acceptors</li>
       <li>A molecular mass less than 500 daltons</li>
       <li>An octanol-water partition coefficient log(P) not greater than 5</li>
       </ul>
       </div>
       </div>
       </div>
       <div class="cell border-box-sizing code_cell rendered">
       <div class="input">
       <div class="prompt input_prompt">In&nbsp;[7]:</div>
       <div class="inner_cell">
           <div class="input_area">
       <div class=" highlight hl-ipython3"><pre><span></span><span class="kn">import</span> <span class="nn">rdkit.Chem.Lipinski</span> <span class="k">as</span> <span class="nn">Lipinksy</span>
       </pre></div>
       </div>
       </div>
       </div>
       </div>
       <div class="cell border-box-sizing code_cell rendered">
       <div class="input">
       <div class="prompt input_prompt">In&nbsp;[8]:</div>
       <div class="inner_cell">
           <div class="input_area">
       <div class=" highlight hl-ipython3"><pre><span></span><span class="nb">print</span><span class="p">(</span><span class="n">Lipinksy</span><span class="o">.</span><span class="n">NumHDonors</span><span class="p">(</span><span class="n">ibuprophen</span><span class="p">))</span>
       <span class="nb">print</span><span class="p">(</span><span class="n">Lipinksy</span><span class="o">.</span><span class="n">NumHAcceptors</span><span class="p">(</span><span class="n">ibuprophen</span><span class="p">))</span>
       <span class="nb">print</span><span class="p">(</span><span class="n">Lipinksy</span><span class="o">.</span><span class="n">rdMolDescriptors</span><span class="o">.</span><span class="n">CalcExactMolWt</span><span class="p">(</span><span class="n">ibuprophen</span><span class="p">))</span>
       <span class="nb">print</span><span class="p">(</span><span class="n">Lipinksy</span><span class="o">.</span><span class="n">rdMolDescriptors</span><span class="o">.</span><span class="n">CalcCrippenDescriptors</span><span class="p">(</span><span class="n">ibuprophen</span><span class="p">)[</span><span class="mi">0</span><span class="p">])</span>
       </pre></div>
       </div>
       </div>
       </div>
       <div class="output_wrapper">
       <div class="output">
       <div class="output_area">
       <div class="prompt"></div>
       <div class="output_subarea output_stream output_stdout output_text">
       <pre>1
 .130679816
 .073200000000001
       </pre>
       </div>
       </div>
       </div>
       </div>
       </div>
       <div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt">
       </div>
       <div class="inner_cell">
       <div class="text_cell_render border-box-sizing rendered_html">
       <p>Отберем SMILES, удовлетворяющие правилу:</p>
       </div>
       </div>
       </div>
       <div class="cell border-box-sizing code_cell rendered">
       <div class="input">
       <div class="prompt input_prompt">In&nbsp;[11]:</div>
       <div class="inner_cell">
           <div class="input_area">
       <div class=" highlight hl-ipython3"><pre><span></span><span class="n">analog_smiles</span><span class="o">=</span><span class="p">[]</span>
       <span class="k">for</span> <span class="n">smi</span> <span class="ow">in</span> <span class="n">res_smiles</span><span class="p">:</span>
           <span class="k">try</span><span class="p">:</span>
               <span class="n">newmol</span><span class="o">=</span><span class="n">Chem</span><span class="o">.</span><span class="n">MolFromSmiles</span><span class="p">(</span><span class="n">smi</span><span class="p">)</span>
               <span class="k">if</span> <span class="p">((</span><span class="n">Lipinksy</span><span class="o">.</span><span class="n">NumHDonors</span><span class="p">(</span><span class="n">newmol</span><span class="p">)</span> <span class="o">&lt;=</span> <span class="mi">5</span><span class="p">)</span> <span class="ow">and</span> <span class="p">(</span><span class="n">Lipinksy</span><span class="o">.</span><span class="n">NumHAcceptors</span><span class="p">(</span><span class="n">newmol</span><span class="p">)</span> <span class="o">&lt;=</span> <span class="mi">10</span><span class="p">)</span> <span class="ow">and</span> <span class="p">(</span><span class="n">Lipinksy</span><span class="o">.</span><span class="n">rdMolDescriptors</span><span class="o">.</span><span class="n">CalcExactMolWt</span><span class="p">(</span><span class="n">newmol</span><span class="p">)</span> <span class="o">&lt;=</span> <span class="mi">500</span><span class="p">)</span> <span class="ow">and</span> <span class="p">(</span><span class="n">Lipinksy</span><span class="o">.</span><span class="n">rdMolDescriptors</span><span class="o">.</span><span class="n">CalcCrippenDescriptors</span><span class="p">(</span><span class="n">newmol</span><span class="p">)[</span><span class="mi">0</span><span class="p">]</span> <span class="o">&lt;=</span> <span class="mi">5</span><span class="p">)):</span>
                   <span class="n">analog_smiles</span><span class="o">.</span><span class="n">append</span><span class="p">(</span><span class="n">smi</span><span class="p">)</span>
                   <span class="n">AllChem</span><span class="o">.</span><span class="n">Compute2DCoords</span><span class="p">(</span><span class="n">newmol</span><span class="p">)</span>
           <span class="k">except</span><span class="p">:</span>
               <span class="k">pass</span>
       </pre></div>
       </div>
       </div>
       </div>
       </div>
       <div class="cell border-box-sizing code_cell rendered">
       <div class="input">
       <div class="prompt input_prompt">In&nbsp;[12]:</div>
       <div class="inner_cell">
           <div class="input_area">
       <div class=" highlight hl-ipython3"><pre><span></span><span class="nb">len</span><span class="p">(</span><span class="n">analog_smiles</span><span class="p">)</span>
       </pre></div>
       </div>
       </div>
       </div>
       <div class="output_wrapper">
       <div class="output">
       <div class="output_area">
       <div class="prompt output_prompt">Out[12]:</div>
       <div class="output_text output_subarea output_execute_result">
       <pre>7206</pre>
       </div>
       </div>
       </div>
       </div>
       </div>
       <div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt">
       </div>
       <div class="inner_cell">
       <div class="text_cell_render border-box-sizing rendered_html">
       <p>Построим стурктуры первых 10 полученных SMILES:</p>
       </div>
       </div>
       </div>
       <div class="cell border-box-sizing code_cell rendered">
       <div class="input">
       <div class="prompt input_prompt">In&nbsp;[16]:</div>
       <div class="inner_cell">
           <div class="input_area">
       <div class=" highlight hl-ipython3"><pre><span></span><span class="k">for</span> <span class="n">analog</span> <span class="ow">in</span> <span class="n">analog_smiles</span><span class="p">[:</span><span class="mi">10</span><span class="p">]:</span>
           <span class="nb">print</span><span class="p">(</span><span class="n">analog</span><span class="p">)</span>
           <span class="n">mol</span><span class="o">=</span><span class="n">Chem</span><span class="o">.</span><span class="n">MolFromSmiles</span><span class="p">(</span><span class="n">analog</span><span class="p">)</span>
           <span class="n">AllChem</span><span class="o">.</span><span class="n">Compute2DCoords</span><span class="p">(</span><span class="n">mol</span><span class="p">)</span>
           <span class="n">display</span><span class="p">(</span><span class="n">mol</span><span class="p">)</span>
       </pre></div>
       </div>
       </div>
       </div>
       <div class="output_wrapper">
       <div class="output">
       <div class="output_area">
       <div class="prompt"></div>
       <div class="output_subarea output_stream output_stdout output_text">
       <pre>C1C(COC1=O)CN1C=C(N=N1)C1=CC=C(C=C1)C(C)C(=O)O
       </pre>
       </div>
       </div>
       <div class="output_area">
       <div class="prompt"></div>
       <div class="output_png output_subarea ">
       <img src="data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAcIAAACWCAIAAADCEh9HAAAHJklEQVR4nO3d0ZKjOBIFUJjY//9l
 oEelrZBBlJIQpwT/VBRU8aMSS4pAWacpmkA4Kp/aq8AwLOJUYAQMQoQIkYBQsQoQIgYBQgRowAh
       YhQgRIwChIhRgBAxChAiRgFCxChAiBgFCBGjACFiFCBEjAKE/K/2CrRtHP/84BkBwA7d6L5xHKbp
       z78lT4fhr5+B1xOj532kKvBuBvWXLElqsE92ppKeRjd61fdgH+L2ppIGs0ntEqP75jqe/+0lpiSl
       mKUgaYxBfdJ6VDUX8fc4ywCfYuYa26xD6tGNnpHoSbWlFKPYGjNODmtnJXpPbQJx61NMiYoyBmqG
       GL1qp77HcRyGwadKNuljsyN3A8RowH4Fj6MPlnzSjackrc3caMD+FNU0TWOW2auPM7PLlQO8Snry
       PVexzdIlp/a2aJrCkj3pcGGAv67U9WvXb6QBeadbB0DfPe93ySm8LS54CpumvQqef3movveiE9b2
       r65bBkDXD9sHX+jU1hcxmsG0n6Tp//qn7gdFyWH7l46eOGzPrgWiWv0iRvNI9wLrX66nscyocNH+
       +Dp9UB/mnF0WQg7mRjPbrOBs0elLK1hJHLm/63ApwnMV+FFy5ka3iNH81hV8+2Wkyvr1ElNGyzB/
       MPS5kwue8vu42une8nVf4Oslrq4bx3EOUxl6K3Ojt/g5PwUZfUzNaz8L043epVwRa0gZhrnlvDgB
       SowYhX5ku32OM8RoFzSk/EcfWp4Y7YUkZRgGX4tTgxgFCBGjHdGQQg1itC/OMEBxYhQgRIz2xiUv
       UJgYBQgRox3SkL6Wq52qEKM3qljTkhSKEaMAIWK0WxpSKEOMdss0GZQhRvskQ6EYMdohGfpOtnst
       YhQgRIz2RksChYnRrsjQYuanxdVeC5rgkXb9kKFlfDw8zmeOGO2E/flum0+L+3gkJ+8kRnsgQ+/z
 mb2lLE6OPZgW9yqs2c29KKG0IZVCRG76W4H+fyo96rJym1iNEbLcO94ba5M/ttRse31N5fmip9
       JzthIZd7nPQybb64U5vmYEoW3jSyuy77YWm5Kl6GBl1Iz4N/vLykwAZy9VULfO51BJtTO0zEqSNZ
 LB332baqx9taRX2xsou1L0Mvezs7OfBP04vJ+80zvxDepkqpDAfdxOO77T2kIgjn172hi7LAs8u
       RJ2U5Ex9E5aKNyir5Y5zgOsFXss1V189gg+6RYmZL9srYvMDLHboOrX5cvWwCqYAn3LTnIfN6PsD
       LN/7/9yI2Zti45sC7JkPYE/IopHj0ObWvG9KYVl+C//vvTI3+gCe8dmTj7FFmWOkqdJb+drmZ5Ck
       nZk36BxtZdJNCd1HjEI1hdvDJbtLvukbiFEooZHwmpvfRlamG2IUXkeS5iVGH0PpR7R2gqX6+iin
       jMQovJQkzUWMwu2q9557nHTKQozCqznpFCdGn0S5cxOlFSFGgWFwt3GAGKV/zU5N0gcxCqWJ9c6I
 YcxhwWtEaMAIWIU7mUI3z0xSk4mHHghMfo8bU6PLt+e6a4Y3sa335PBetza2pOj2lkTeqUbJWRp
       Qj9+32xbWn2VxHp/xCjXpZ+B0ebN2g2uEk8nRh+pehbsNaHf6ralm+/bbKfMQ5kb5bS9AN37fZXZ
 vUTN7/futgqGcK/gRjlnHHc/Q6LpUfeC9MCDxPefOD73lt77DBZiFFOGMchnTnpLu++J7NvpueR
       FSsT7vTNofjBSnZSc0wdf7ef2ZRr5c+G4NkZiaDvxep/+2OLPlixNupnE7r/wtQaRtb/Z/uZfm3J
       JC38FpRnoz7e+ozzPf3UxQxdLSFVZmeTJcvBY28hdx+ZxGiXbNSuZI/UeIb+t5xoWxppPxPLLNyW
       itEu2ajdGsdxGKbhzITm1xLyZOh6lc62pXek55FVuiPvnMvqlRjt3/oy8+pb+3hbWnDmdzdJs6zA
 UcCqhOj79JIpN536uny+iRWpvxJMJ5FjL7X2WuYbliBamfMN9902Im8U+sjPV9IjFLTd3jVPQmj
 +QCdzExDH+fTcp+ZimhtS8nvXB7qBNHiFH+KJmeH5rKoINJqv1kIUb5Y5pqJumskbY0caO99OSb
       GIUNH7MN0pMEMcr/zQ0pC9//xBFilL9I0g8ClJ88RIRh+Pvq0VpJ2sjEKJwlRmmHDOWRxCgbDO3h
       ODEKECJGaUL1S1bhMjHKNuN6OEiMAoSIUYAQMcquYuN6E6M8mhgFCBGjACFilJQy43ojeh7NV5OQ
 byykp6JUb5IR1/EhPEKCESE8yNAoSIUYAQMQoQYm6UWyQukzKdSmfEKBelryf9mZXrG0DdDMqj
       iVF+24y8ePBJT/pgbpRD7riXyVea0gcxyiEiD/aIUWqSznRAjHLUTZFnepSnE6OckDHy1ouSpDza
       OClhgADdKECIGAUIEaMAIWIUIESMAoSIUYAQMQoQIkYBQsQoQIgYBQj5F/1nzceQG7uQAAAAAElF
       TkSuQmCC
+      "
+      >
       </div>
       </div>
       <div class="output_area">
       <div class="prompt"></div>
       <div class="output_subarea output_stream output_stdout output_text">
       <pre>CCCNCN1C=C(N=N1)C1=CC=C(C=C1)C(C)C(=O)O
       </pre>
       </div>
       </div>
       <div class="output_area">
       <div class="prompt"></div>
       <div class="output_png output_subarea ">
       <img src="data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAcIAAACWCAIAAADCEh9HAAAGwUlEQVR4nO3d23abSBBAUZiV//9l
 kG2QrgJKJquFnuveXCcidQWcNRchPthGDoAzvqv9gAA2iajACEyChAiowAhMgoQIqMAITIKECKj
       ACEyChAiowAhMgoQIqMAITIKECKjACEyChAiowAhMgoQIqMAITIKECKjACEyChAiowAhMgoQIqMA
       ITIKECKjACEyChAiowAhMgoQIqMAITIKECKjACEyChDyp/YAgBb0/d+vh6HeODKSUeCTvv8nnZM/
       Pp6deoAQGQUIkVEq6/t/DruNv4YmyChAiIxyt9f0c3Li1ySUdjlTT1nzPjrH257JG51F+C8ZZZfX
       RvTefNaueDkdzdd2avPMa215W2YyyiXe9bRN8UCOjbLXxhHMYfj5r9Djk8VkCVlmXdfJKECQjHJA
       cPLxPke/droiPqWlrPkaYELq2CiFLG5Z+xPp1AUNkVGO2Zh8PPaSmP73Jx+e8GO7qGJGRrnMhVtW
       Q5tq3/fvevazdxhhfQIZZZfJEUxexg3tlqL50LA+TG+hklb+Kc4kozv/yeQ7TW6D82WTf2kVYzbK
       AQ/eUhacaGhnxvqNZJS8Mh9zO9fQRRthzdvT2bLpuy7rWItz3SgcttjQ/lf88YdhyBvQFcMwXPKz
       t8hslNQSTkjX5qGXn69/hSltT588/ZyQUfbKlrMq9nTtIUc/55VP3v1yZJTsEk5Ijzod1seGqS0y
       ShNS7EE+/bQSK5xiogEZTl+UnhUOv8o9xQ0yLKn7ySh8VnHPOnOYMo/tTjJKGypusY5OHvLAtsoo
       u7R+kue0DA19YJjaIqM0Q00SGi+U9wcQqr/x3MyZelKru00+sAinPfmGgdYSdqmyU7/2mct7Vtps
       Dc02nrGPY/t7Odf7W1l/lhPMRtklSUPff9UVnuBkblaLFl7M+fGZZl/wB2X0hm2Pq6xV7J49Rw09
 OTLtRHW8V8t/mqayc5R7ROgj8joOKBimt+ehnbFPrqetqE5Pxh65ZAWw5opl2u+PKPzaL5jmmR1
       fG3483fZRtaf6+1s6KKH3BMkjzzbUV1fm9HtWef7Kg0rQSqRhi46GtbkXUg1Ia08kkyXvn1hRnf2
       Mc8+/hfcwegSlzd00XZYkxQqv/o1Xzt+WsNXZfREE7Pt44/VXTfWjjYUe7o7Grpo45xVzhWDbL4k
       o8FJ5c37+JNCdSsT0kxvt2VVbOhYql3mNRkGWX0A2TSf0avyd8+0dB7QzO452pCkoYsyNCubW1+Q
 yo4/mNKDWe0xPyx3LT0Y0AnK8xDZG5oWhXjXuF5F59uY8ethiZvTfK+/UGJJfp62AtvgdH3P3O6
 st6l8nPXTTuCRs6X/Tuh/LmvW1NY7PR245gXjIt3bMLPzlCuvj1xwe5xKEDDvGd/YQNZYPlsqGZ
       jN5/ZdLpo6V9//OLgy4fbKEjldsBXZyQvr95bjyZG9rE8dAmBvkcDWS07qWdh6alpYcajNei02l+
       f9rq6HgyN3SRZj38x/8odUYzXBvfjaalG4O58WjD6+kuKOnHSeji12vj2f7fRk/aWEOTmL8+t8Xd
       ovnIC3TMfJWq1frYPvX5fxt52IYaurigaw1y43V7fVFuYAkXTUKpZ6MJjffxax9t6Lrja/nruG2h
       IY9mpsujaqWhqVS8Z6BFs5OX6aQ8a9jOmt8c/f2jSvIyTtS98X58JPGwpl00CZmNnpRnDft4RUGV
       WfPOA8p5XsaJJKeVbru1FREy+iUWN/vq5+g2YpohUsldeyj5UFgtnUO8WF8lyXHbReMhNbGV1t2v
       r3I67oZzVl+pgbWZozJHKmHfN9Q6X1/3kobM609OTX6mnm2Zt4FCd0K4zQ0fsa9+WZjbCBwlo9AA
       M8TMZBRW3T8vS5JLE9JDZBSOKZeY6rvznCOjsOW2eZmGtktG4bDL25qwofbr95NRqCxhQzlERuGD
       xXlZ6cBlaKgJ6U4yCjVlyCVBMgrV2J3/DjIKn5XYvW2iofbr95BR2Ov1m72verT8DWUnywyOKXe6
       KW1D0w4sCfcbhWMK3RFZqtoloxDlVvMP5w0Q7rAd1vxT0fwjrMhsFO6wPWNVqKbJKNQhnV/DBU/A
       Zy4g3SCjACEyCuxiQrpGRgFCZBQgREaBvezXL5JRgBAZBQ4wIZ2TUYAQGQWO8fmrCRkFCJFRgBAZ
       BQiRUYAQGQUIkVGAEBkFCJFRgBAZBQiRUYAQGQUIkVGAEBkFCJFRgBAZBQiRUYAQGQUIkVGAEBkF
       CJFRgBAZBQiRUYAQGQUIkVGAEBkFCJFRgBAZBQiRUYAQGQUIkVGAEBkFCJFRgBAZBQiRUYCQ/wFg
 ryvRctyOwAAAABJRU5ErkJggg==
+      "
+      >
       </div>
       </div>
       <div class="output_area">
       <div class="prompt"></div>
       <div class="output_subarea output_stream output_stdout output_text">
       <pre>CC(CN)CN1C=C(N=N1)C1=CC=C(C=C1)C(C)C(=O)O
       </pre>
       </div>
       </div>
       <div class="output_area">
       <div class="prompt"></div>
       <div class="output_png output_subarea ">
       <img src="data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAcIAAACWCAIAAADCEh9HAAAHwElEQVR4nO3d25ajNhAFUJOV//9l
 GM43AzUFyqxN5rHiadsVtG6FBCgLv3+/0CYK+/7m4AQG1iFCBEjAKEiFGAEDEKECJGAULEKECI
       GAUIEaMAIWIUIESMAoSIUYAQMQoQIkYBQsQoQIgYBQgRowAhYhQgRIwChIhRgBAxChAiRgFCxChA
       iBgFCBGjACF/390AIIeu++/v7/d97ahHjAKvV9f9LzoH/8kik3p4vHFovt//K05ZJEYBQsQoQIgY
       BQgRowAhV8To+FT190+67t8/K/89cLDxgpKV+i1uvuDpu7Pm/g6cbpCkht8WN8foXGf1faor4TrG
 Zzo0KTcjLabVFF1Wjy70wmaEKUqCEi2J0kIaDBSVTe0jNUFx086R+R9eYXsC5jLGNspwbnTO+
       EqP/iY6GS7nLft79T3j6eZXFZJJ+XmieAQczhd+oexffWMIUjjcXo+J1SvZJ/U/vt9nGKdxL9mgG
 RblY7TnhOkZbE+GxOuURmL09VWW6uWjGDKPpvtXaydGe+b4uzkCsYoBNnL/Sv0Z3u9X13Wv16v6
       AtrZVl4mYSs+lO5fp80Yff0JUGE6tvU5PoYSA93rZXf41myM9oRpzyPQ2GnqKPp+v7uu/LWSB2o8
       RnufMG2g48eF4cIVfh/Bz93w2bBu9MEa2Em42CNitNcfQl/1x8nyFPsTC8d+yiaTdPLIOg7Wseq7
 CaTU3gF6bcHxeirlTn+8snKoz7W5KMLn2DNjvGoqJWYPz0rRnstzfHZLbID7IvaxvY38frxxBht
       wOGr55tOBTSwcH/B+B+8/5oCNi2JuUyMVhVM0smHZl3zq5+pySRq8kPtIEYfYVwJPXnPN/I5lhgt
 Ofq+Umr9q/KBelchg4m3WfkbOnaba7xpT/UUcRobctJ+ux9e8LCgN90KvPhqcHAcw8jDqFx5QrS
       ozp9IWR/vn/pHW+hlq/7oeJUozzFgUN94X0uODmQxOCTVr8cO+K5x5CHHz+PUqUgTdXdqRqzVd/4
       laeYe4Mb8rf+vunXrr8t+nyq0aqq5BeP8vvwMHk+ZO5Vg708604vRgkpsWSfrforvbodbfz65+iM
       d6yse5sYpXF1AyunU7Zn8Q4So0RlLRFSK12QZpHm/loxWlK22Oq/tSVhKORsVV25tud4iekmrX2l
       HXzkGvMjnwfgVpF8e95IjHKMcqHAJjdk6PgWvWyzsD9M6mmT0qkFgyTN2qGqUQ6TpyCtkqF5ttiy
       O7fn+/3fn8HPx//yJmKUI1XJBdarcky6kRilNbWGvQNPA8QoUeOHcdyYC7UyND/bcw0xWk+q5cpU
       wyxVY9ZLW5AW3Z7Xs1LPfnPDbJwLRiMNE6PstFCqjP9X5DnH8fbkl/De0GztyUyMssemDH1tec7x
       yletbw872J6biFE225qhy85O2CoSFqSsJEbrec5Ai3xXh0jazabbSoyyzbGl6G7fvyjnMvcOGQrS
 xtQkQue2CBJhg5MXjCU9ioi2iNGWStnhjbGzQsViVFWSZ6hCtK4DP1YlBjlt+QZWtf01xHfkf76
       MUKM1jAeVpcNtCoZWq4gXd563ZcrW8UOVurLuOVW+lRB+RDX3wOml4PEaBnXfwHnz3Ip29ibvGAo
       w1VEY5uatOMOBTeAXUmMMq1chhZy4HmShffZ+hJ2e2KM9nvY56xZob0qyTfCl8vQnAXp2IGNjNwA
       xlbPitFBbvZ/qRWm1yRplWWlsfyJOde8y5rd5A1g93rQSn2/m04+fKgfe6V3qa47bO2+boYuSLJk
       n20DJtks1T0iRvuIXN59P2F6Wat+mmvL+Ou7X3++PzEeptnG+Q7Z+vGjyeMTr+Yn9Vsn7ElOmPYh
       sNCEyST9vOTny+d/r2WlG9y7YfOfBsmv5c0X2TluDNOjTn1+cnbluzWWoZMNvvFT3H5KdEGGNpTW
       ZjUaD8HP6tOVu9fuKnLS531Wvm1LGZpN8g2oIA1qLUaPrSIvm+MfG6ADXzP9PZ+lpQGWLS9SNYbd
       murF83bKU8P0+nuTXqs/S+lxnmRen3k6/y1bewpppBo9u2Y86QrTU4vQOes/S5Pj6uKCtMltyED5
       GL1yLejYE6b33o9U8daDrbJN4b8lbFjmzZVc7Ri9pdfjJ0zzhNdCmDY8oi7LiyrTeYKqdmeGJNrR
       hgzNnvPdtpbG+V1nSItmaPLm5VSvGs2TRJsSJ0+z5zxhmv9xdkEqjB6lWIwm3DvXzPETNntOlXau
       l+qUX56WzEm1uaooE6OZq6TlM4zjH5LBeXlRdDrPbgVitEoSDcK0SrM5VgNZqSDdKnuMluvO9pZo
       GjCXC9fe6WuXaFb2B+UV3fOKNpsg0/lnyh6jcIj3JQ8hbSZDr9lczRCjACFilKe4pcKqWIr2FKTr
       ZV9igmNd+b2YdTOUTXQzj7am4No3RtrI0DY+xdlUozza+ht54+9Dqxxq4ADjqG1mZClIf1KNwgEE
       zZNZqQeWWLL/SYwChIhR4AcF6TIxChAiRoHfFKQLxChAiBgFVnFR1xwxChAiRgFCxChAiBgFCBGj
       ACFiFCBEjAKEiFGAEDEKECJGAULEKECIGAUIEaMAIWIUIESMAoSIUYAQMQoQIkYBQsQoQIgYBQgR
       owAhYhQgRIwChIhRgBAxChAiRgFCxChAyD8hzXC+3rPKMQAAAABJRU5ErkJggg==
+      "
+      >
       </div>
       </div>
       <div class="output_area">
       <div class="prompt"></div>
       <div class="output_subarea output_stream output_stdout output_text">
       <pre>C(CN=N)CN1C=C(N=N1)C1=CC=C(C=C1)C(C)C(=O)O
       </pre>
       </div>
       </div>
       <div class="output_area">
       <div class="prompt"></div>
       <div class="output_png output_subarea ">
       <img src="data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAcIAAACWCAIAAADCEh9HAAAG0ElEQVR4nO3d23abSBBAUZg1///L
       zIMnisxNDQXd1WLvNQ+ZxHGQcB8XF8njNE0DAGf903oDAPomowAhMgoQIqMAITIKECKjACEyChAi
       owAhMgoQIqMAITIKECKjACEyChAiowAhMgoQIqMAITIKECKjACEyChAiowAhMgoQIqMAITIKECKj
       ACEyChAiowAhMgoQIqMAITIKECKjACEyChAiowAhMgoQ8m/rDQB6MI5/fz1N7bYjIxkFPhnHX+mc
       /e/jOagHCJFRgBAZpbFx/HXa7f3X0AUZBQiRUWr7GT9nF34NofTLlXruteyja7z9mX2jswt/k1GK
       /Cyi1/LZuuPldDR/1qnlmdfW/rbPZJRLvOppTfFAzo1SaucM5jT9/99Nn58sZnvIPhuGQUYBgmSU
       A4LDx+sa/dblivhIy72WXwEGUudGucnqyipPpEsXdERGOWZn+HjsLTHjn0c+PeFhu6liQUa5zIUr
       q6OlOo7jq57j4juMsD6BjFJkdgaTH+8NHdai+dCwPsxop5JW/hFnltHCvzL7nS7X4HLf5N9btzGN
       csCDV8qKEw0dTKzfSEbJK/M5t3MNXbUT1rw9XeybcRiybuvt3DcKh602dPwj/vmnacob0A3TNF3y
 HtkGiW1hAPp1hx6+fX6nzCl7emTx88ZGaVUtpw1UdK1h5z9XFY+effvI6Nkl3AgPep0WB8bpr7I
       KF1IcQT59MtKbHCJiQ5kuHxx91Q4/XHfP1FBhj1Vn4zCZw2PrDOHKfO21SSj9KHhinV28pAHtlVG
       KdL7RZ7TMjT0gWHqi4zSDTVJ6H2nvF6A0PwbT2Wu1JNa2zX5wCKc9uQ3DPRVQpEmB/Vbr7ms80Wb
       raHZtufdx237ezvX67eyPpYTHjGNFv6MdXYkaejrj4abB5zMzerRypO5PD/T7RP+tRnVyq5tVazO
       kaOGHnLy6doJ6/sfrf5omtnybr3avzCjs9nzxxe8oPA5Sho63PbS9bQNzfnC0Cs3aTWsmXK55asy
       uhpQ+lLY0FUPeU+QPBJmvYkvyWhJQDMPpBVO9nUh0tBVR8OavAupBtLGW5Lp1rfuMxqcQJuH9T2g
       D4/p5Q1dtR/Wxz75R7Wv+db50xY6zuiJgE6Ln7H++p0mV6KH3+v2FdMMi7ny7Q11Grpq55pVkn1B
       cl1mtDx8JYv/5wNqxnR/6ny9LOQ5C7hhQ9+lOmTekmEjm29ANp1l9FBAXx/5/vFbf/cV07tnrqGg
       j0nG0jpnk5M0dFWGZmVT9QmZHT9m3RE9ZbRwSUfmyvuO8U8MmE8YSzM3NK2GcW/w767+c8v7GZvq
       KaMfn6tLCnj5MX4khfXH0tn3qlsH0oQN9fOFdngetvSU0R2Xj5CXHONfNUvWGUsPPYfxtiZsKDvs
       lx3dZ/TWS0PTdDKFl1fv1rF0/zlc3t4whM9+ZG5oF+NnFxv5HC0zuvVCr8JbbepcWz/ar1vHxjsW
       z+m58vTZj8wNXaVZD3/4H3U5jda/07PksLrO5aALD/A/DqGrv179sCN3UHTW0CSWz0+1uNs1HyXN
 P6VjSb7dGcsrXw9PX6Af9+p5P1P20tDs11oaviegdl2TU6NM9r6RVyHzYbBhjcknRtLx3G8b3vf
       Yrq+9rpoaDYN3zPQrinUOKOzc6OzP2r+gvdVzQO63JKSzai2wdM0DENp4jtaqKnOkFZ4z8A8Dza/
       pAf1+eX5Cvs4ljYpfsk3m8wLNUk0q721FRGpM7p6qw1LW2Np85F5J6YZIpXctaeSD4XV3jkkdUY5
 H0sbR7Qd8uYdrpKa46oFS7H7YS1x73TUJdfzezLHKlUff9odcBveI+RO5xy+qf1BnC9zGtgmqbM
       m/fRa9K/T/Pbwio8xi8jo9ABE2JmMgqb6s9lSXJpID1ERuGY+xLT/HCec2QU9lSbyzS0XzIKh13e
 oQNdVxfTkahsYQN5RAZhQ9W57K7A5ehoQbSQjIKLWXIJUEyCs04nP8OMgqf3XF420VDHdeXkFEo
       NY7jhU3J31AK2WdwzH2Xm9I2NO2GJeGN8uCYm94RWar6JaMQ5a3mH843QKhhP6z5R9H8W9iQaRRq
 J9YFaprMgptSOfXcMMT8JkbSHfIKECIjAJFDKRbZBQgREYBQmQUKOW4fpWMAoTIKHCAgXRJRgFC
       ZBQ4xuuvZmQUIERGAUJkFCBERgFCZBQgREYBQmQUIERGAUJkFCBERgFCZBQgREYBQmQUIERGAUJk
       FCBERgFCZBQgREYBQmQUIERGAUJkFCBERgFCZBQgREYBQmQUIERGAUJkFCBERgFCZBQgREYBQmQU
       IERGAUJkFCBERgFC/gPlQf2ETRg5ZwAAAABJRU5ErkJggg==
+      "
+      >
       </div>
       </div>
       <div class="output_area">
       <div class="prompt"></div>
       <div class="output_subarea output_stream output_stdout output_text">
       <pre>CC1CN([C@@H]1N1C=C(N=N1)C1=CC=C(C=C1)C(C)C(=O)O)N=N
       </pre>
       </div>
       </div>
       <div class="output_area">
       <div class="prompt"></div>
       <div class="output_png output_subarea ">
       <img src="data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAcIAAACWCAIAAADCEh9HAAAHHUlEQVR4nO3d25abOBRAQTMr///L
       ngeyaALIjZGEjlDVU+LM2DS2dourp/f7/QLgqv9aLwBA32QUIIuMAmSRUYAsMgqQRUYBssgoQBYZ
       BcgiowBZZBQgi4wCZJFRgCwyCpBFRgGyyChAFhkFyCKjAFlk9A7TtP3z+hGgazLajJLCM/xpvQCj
 Efz/X5N08tXYUHvZPQmSy5NQuFhbNS3ZCoKDyCj4ZiuQl8m31MfkH2m0BGzUYAsMtpe6iA+0AUZ
       bU80oWsyGpS2Qi9kNITDaCopdEFGoxBN6JSMBrIvqbZCfDIanRNIITgZjcX0E7ojo+EoKfRFRiOy
       IQ8dkVGALDIKkEVGAbLIKEAWGQXIIqMd2H8/MxCHjPZBPSEsGe2Dc/IhLF+wDGEsvypdgNEVGe2G
       CenDrb/I0JcadsVGfU+MLAhIRkObp5/reiopRCOjEJ69ObFNb9ObqOwfG86HQ0w+DYE5xARhfAjl
       fIRRSUOyUR+UITM6XxXbDxmFkHzpdj9kNCJTUZKUNB4ZhahSxVTSYGQ0HFNRfihpD2QUYkuXdFLS
       GGQ0FlNRznsraQwyGouGciC9Ca+kEcgo9MDO0MBkFDqRmHiakDbnmnroyTQdj9nU46ln2T6yvtXp
       +hF7609wTT30ZJ577ot5+Pg8Sz2oYKqMbh19iYxCZz6XdPNIgdfb3/WWf8ko9GdT0qWeVfbRCehv
       HGJqYJp+dkD5Dnqu2cw93++34xytmI3eJ3VPXvuguGYpabGArk+r8qE8TUbv8Hnnkhvycln5s502
       H0SfyxNktCK/16ntu/OcqENGy5umaT7J5PzH2yUq0C8ZLWOzs//CMygpdEpGs+SfaGKDjMts0Qch
       oxcVPkIKdEtGryveUIfso6l7WjtPIaMXpS7Io2upiykDvtcBF2lYMsrQTl6E7rcmH8hoLLbrq9qf
       qX6+jKFKGmdJeMlojlDjikNV7ngE/5JRHqjSoSG/ODkko+HYri8iP3aHLY5Q0uYLwIaMZqk2qKbD
       e5ZzxrV35Pxu0wglJRQZZVA5u00bllTBA5LRiMx3LvvwjW+bRzJXr/eIhYzmMpwiq3oZkreemYzy
       ZA9rnGrH5LuYgip/V/MB3F8ZbxMvGS3CWBqZdx8Z5SEabvDeU1Jb9GHJaBk1BpJpTke8WSOT0bgC
       DsuAixRH1ZKaikbmSH04qXN02g6k5W7/McdzkKUqvn783uqCjBaTP4RifjHJZqnClvQBPl8jYLWH
       JaPtXThF/J4Rlcp6tJKGWpiTK+dwmvn5/4q22lnIaDPf1jP1n9UYWr/Oiw3pD/Yrp9SlqFZ7TDJa
 plPef7liR9eosgY+3BZerRbxoW1OdxkLT2bYVDYr7fGKLvC1y93OAP66uXmZfzwf+x/uuYlbb4A
       qcWot2BBfmQWZqPVNTlwNI+088d5fw3obD8DNSc9VHWdWOfReDPK2ySs3houMhU9GdDU66YeuUeQ
       mjRZIUF+dl5Ov69k/ojP6r1K5h7Safr7bSXfLuN+nusanrV7AmedxyGjVTTZhF//+cSRrisBXaRK
       OuDAfvy1/PxKRgtrMqguvGL+Mh6W9M6Bbav2paQxyOijnJyKlnI4hgcf2OI+IBktqfkQSpxrdfzn
       Uq/YpKSHR3WqvuLJxbjf4L+3IpDRB9oP7PtHWb2xndoDG6Emraoa4WcfmfNGi4kwMUl5v/8eU6rz
 Me7EUrtXtjvgV0e3zz5zSdUhnrHnUzakIxSQMGSnr/8/PDJR67JyD97W1Z6GZE/vss89MKZ9l++
 KmL8ff/uv7rt6vx8MlvuwPW5pKHCJ+BIIsxFLPRgcyb9jWf/9ScNLObQagVCx+FAnoZUfV2j/77
       KrfenCX1irXflJhT0VmohRmBI/UUdnjUuOrVsfefdBW8Uw7c30xGcwUfUU3cP4xdCLAx8s9+Pxml
       ivs3eBuWNOav0oCL9FQymiXm+EmpfYipuXtK2tebzg1klLpujo79pNxPRq8zfjpSqqTedPZklIpa
 TbQ0RXuJKMXmZWcE+h+xkXyur+tlI8BMkot95ztn+IUKG4jo1f0Owd5/MH6tdol7fdjQFkyShVt
       p6KLVEkzn3bMb50ixa1JvmYO0pcit497xu1UqERGKS/IVPSyGhNYHkxGv/OAqWjni3/FrxNSk01y
       dB8Fogk7FX3ePU8JwmyUH+u2PC8s68NNuklBZqMc2x+IPvNJCTsVhXpklLOePVeFy2zUc5Z0wiGn
 wNkMRsdy3rf5eaLlxdmnfAVGR3O/ijQ5q+pqxzlFQ7J6HDmu5N8aGLqn0xa4ZCMcpZuwiGHmEZU
 HZ56+dxzyPGJKODKji1VE8GJ6NjWdezVEmHuhU07MkoQBYZpQATUkYmo5ThOD7DcmsSgCxmowBZ
       ZBQgi4wCZJFRgCwyCpBFRgGyyChAFhkFyCKjAFlkFCDL/0fswtSFns5vAAAAAElFTkSuQmCC
+      "
+      >
       </div>
       </div>
       <div class="output_area">
       <div class="prompt"></div>
       <div class="output_subarea output_stream output_stdout output_text">
       <pre>C1COC[C@@H](C1N1C=C(N=N1)C1=CC=C(C=C1)C(C)C(=O)O)O
       </pre>
       </div>
       </div>
       <div class="output_area">
       <div class="prompt"></div>
       <div class="output_png output_subarea ">
       <img src="data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAcIAAACWCAIAAADCEh9HAAAIbElEQVR4nO3d0XabOBQFUDNr/v+X
       mQc6CQWMMULoXrH36kOaurEQcHxlKfIwjuMLgLP+ad0AgNzEKEARMQpQRIwCFBGjAEXEKEARMQpQ
       RIwCFBGjAEXEKEARMQpQRIwCFPm3dQOAGw3D79e2JbqIGIXHGIa/onPxV84yqIdnWIfmOP5VnHKW
       GAUoIkYBiohRgCJiNJVh+P2z+P76kcAtzNTnYZqVEtOEkkuoAjGaxLtpVrcBxy2m5l08FxGj4QzD
 ONaqeXgpeUV+htiNJxxHM8kqTdDuZCxzjfEaCBFdejiP0pVuMtDZ+qHYRjiBc1Uh86/gGb8jtNh
       j4vRKUDHcZyiKmxaLZN0fU0bc1GbJD3mWYP6xah5+vqnAIzQqvkbo8s3SU2zUomX5DIPmhTef+ex
       bZjO2/bua6hoJ0mF7CePGNT/DOR3HhNnmD8fznuTlJvsjN8N7T/pv9g5UdDdU5kuGrbzVzUpN1GT
       ntJ5NXougO6pTBeV5k7hKUO5icLzlG6nmMoryrYTUCcX4UMlFuS/1+eNenkAXRimx8fy0Mb7uHR9
       buquU6YhSZ2DuipMve9JdJL0G331yC2DjnNhagaJZIIk6bu10uvmtXvPoZcbuGYR+uYJvw5T43eS
       aZ6kOxukRorR/FNMtwfopHwCSoYSXdt5zjx77CZf8DT1abtu/bg06uCSJojp3UV7/cW8+ek4SaSt
       RhsVoZuOV6YqULpRuiZvkZgnfk6YzM0ZoyEL+80wtfyT7Hau4a8v72v31gmzx27OGA2cSuswlaFk
       dy5Jf7eGmD26Ugvbyhmj4XkblM58TNLN7xc+ZZaPMo0aozbWhNgW06dVniPJHrshYzTJSxA8yrog
       veMNq3dPsf5+u5SIt+Dp3WIxoLWf8buJ07l4MQoEJj3XxChAETEKfMeIfkGMAhSJF6PrCaWcM/WW
       jsJDhFzwlGSxGDyQEf1ayBh9iU4gjXiDeiAqpegmMQpQJOqg/kfO+SWY/O5y5DLuV/gYhTzWazN6
       +uDCDg6hEjEKJ+2E5poNvDsmRuGQr0KTRxGjsKFGaKYuSPO2/AZiFO6rNFMnKe+IUZ6ryTS6JO1P
       +HWj9mympnEc70+0dPstyP194WMU6qgdDcP/Nv81XZKyw6AeLmAe/8nEKE9UWIpeEppZ3iRN0ci2
       xCh8UK/SzJKk7BOj8Jebh+eStANitCJ3SEybJ6XhHiKRr5OwDQslQYwOr5fTSG3CgtMseIL2Yq5/
       UooeJEZ5lrDREDNJOUKMQhSSNCkxyoOELUV/xEnS+H0VhxiFWOIkKQcliFFXFRBZghiloZ5ewBKN
       UpuXDon6KoIE60ZpYrqNI68M71uTnu/pVfNOYrSWeQy9Uq3uXjS4jyTNeAi1e37/114z9lgrYrSK
       +SU4fZEiTN81so8kzejCnv92rwAn/TgxerGdJNr51wj27xk3VSvnet7+p3fKcWNETp+5g5d7tMM5
 p6kSZq02T8+tr9eaGbvuntk6qNo6TN3om0RDudcs2Oegh0Z27wwP4SbK80Oeq+2fB0UIX0WSq6z
       Yfizg9XNBzQMr9NnP919la7Bmxpu5ddHB9aTtXeChOmFzZjukRsO6OAT7d85ie6rRE2dvGtw2wNJ
 yjrFFGHG5toLa/pJVcP0qx++P7NhxulmzXvbGd+RNUYnrcK03jNWCtNzP7CDJI3fwoV0DeaV
       PUYnN4fpDRf6hWFa+EM6SFKu4nS/00OMTm4I05vL3sIwvaqklaTNxelhp3tTnz1SI+9av8H/eh3O
       xBpvsH6ccXoFmPFbSHfDx5xcWovWnub6qUbnrq1MI2TEV09eo6Ufa9KXu+sx1KQLPW+UN47jdL5L
 q2ZLpdoV8z6gG7Ymmf8tHvbxwewI0spOnGu53qO0cnpMJ3+S8AreNLkGk6UpJHPHZ3pP0Yn34Zp
       zCJ0bhwl6dfCNuydyC8GkU/0zZ4So5MjYRq8CI0gfpK+O4PNG/ZO0ksubH/e7FkxOtkJ0/hF6Fyr
       gvQVOEk/Djjc+dfSn69eZ+qPWMzmR5iOP2FK0iat/jhde8N87s5eR0nru7ksh2Di/rkxOrFSp8TN
       SfrVBnE7Tx3ttg/VGE54eoxOUl/EDYf2r5pJWnVXzWhJmt3D+/O5R57aeiDfamj//7N/3p794wMW
 nkyoy/3V+u5aL7Mrb5EqrRlNbXatur99uatGql+VXDuNBje/uJx0wlx0vOm6+6nYY1v+17qkYn
       eVt+2uMOuEttR/RzYQMrZsP6y9BJ9vZ/64nrRqkn7CrCnYaFbTNZiFEutplKwcsTSXqtp/WnGO1B
 zVPazETM9q93euIfhKtt6sSo1QXJxcM7e8U5KTfQIzyLEGSNM5LC+XEKHUFzIsgSbopYHfxkRjl
       iSInKemIUSpSW23qe3LpgcRoJ6JN1senIOUqYpRa4tdWrZI0eLfwLTFKPQnCIk5NGv9Vh3fEKE9n
       CE8hMUoVcXZLKSFhOUKMQvuhvRF9ak5eV4LUgEGa8a37s2we0O7EvOx+D3/U3rz9tj3/uZkY5WJJ
       S9HJhUkqNJ9DjHbFfVruXJIKzScTo1wpdSl6nNBkTozCUqvPMSUpM/WPs8iEC89/Z6Voq88xJR3V
 OMsMuHdmkjRIT05SDXKtnpFK3RGNdqJ9YC6cIgtN+EgvwzaD7/8DU2I0X7YuRmaMKh/hHm8Gq3D
       tcRoV6aCdB2U8++YmodridHevEvS+QM2bcbr+sGXz2VBdmKUPzajcPPdALkJc2K0QxfONW3G5ceC
       Fx7FTH2fZBzcRox2Yn9aqcbTWVwFEzHKSZIUJmIUoIgY5TwFKbzEKIXMZYGN8gCKqEYBiohRgCJi
       FKCIGAUoIkYBiohRgCJiFKCIGAUoIkYBivwHw1e8iUgJKGcAAAAASUVORK5CYII=
+      "
+      >
       </div>
       </div>
       <div class="output_area">
       <div class="prompt"></div>
       <div class="output_subarea output_stream output_stdout output_text">
       <pre>C1[C@@H](C(CO1)N1C=C(N=N1)C1=CC=C(C=C1)C(C)C(=O)O)O
       </pre>
       </div>
       </div>
       <div class="output_area">
       <div class="prompt"></div>
       <div class="output_png output_subarea ">
       <img src="data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAcIAAACWCAIAAADCEh9HAAAIjklEQVR4nO3d646jOhSEURid93/l
       nB+o6TQOjsHGrtr+lkaavsfxpbIdIFlfr9cCALjr3+gGAIA3YhQAqhCjAFCFGAWAKsQoAFQhRgGg
       CjEKAFWIUQCoQowCQBViFACqEKMAUIUYBYAqxCgAVCFGAaAKMQoAVf4b3QAAQ63r78e8+vAtxCgw
       sXX9E52HT1HGOUZ5FAVqpKH5epGkN9jGKI+iADR4HmI6exQFgO48YxQAZNhu6r/ai1M2+wCeFDdG
 /Q8bPZJVWCTHlDiGMMtcWN0d5gWHN8HdoeDCqyIW9aXacc1eRT9mUDbf65dATyNKjXLNkaX9nXl
       +nf7b9wzQHMk6TnnTX3rQT3kJqkKoIRzNdrXnqr0GCZFQXqC80ZLvV4vAhRT4yKXE24xyigCT8us
       MpL0E6sYZU8BdEBWXmQVowD6yCQpIZvwiVGNUvT1eq3MIUyOJP3LJEY1MhSYSD4rSdI3JjEKoD+y
       soxDjFKKAqPwJGkBhxgFMFA2STlUsBjEKKUoAG3aMUqGAgrOC1LOXVnUYxSACJL0nG6MrpSigJTp
 /KMaIyuKy89BdiYvCAVjVFlk88YzCwz+Xuvi3X9/Xf4evqTD1OMUUpRQJZEkm7P+O3/Rpc1zq9+
       DyC2j28UlB41Sd/itC+5GKUUBcRtVefHdZr5Vk7mQikHWjFKhgLu8u9p9vtjf3+nZQu67/G1YhSA
       hbTqzDxh2qtRvzf559PnU1UoRilFASNpkk67fhWP1APw0rUGSg/Nj75UR6UapRQF7Nw8oNTihj8f
       xB9EJbzsYtSuwcBDWAsSm3qGAYAviRjl8krAFDXQIhKjC0kKwJbKIaZl4NPVwAMOZQETOzChGF1I
       UljJ75/Si3niTeyQd+oGrRhdSFKIyWQlsxQbuRhdSFL0damovC3erA52d2ooxugScc5Bx6hnLZnV
       UYnGKPCoUVkWJklj3ItWVE54SomfAiXePJxh/aM53RhdiCpExKyOR31TH2YTBAUd5lLJE6/us9q6
 U9Qj9HFf84hmCZH9pnVkRjE6CI559iX2SmfQn1OgTKlthIVeMToopSk2xrbWvL+MUylodlnQHWm
       NCqZjeLYaXcWmoSpBc3M0mzVGa/WduPXKf0Hcq9W8rfLDFOmPDrKbTswampPNpv6Xc+t0KUycz+R
       xW6emTYbEOH62PJ0ktYki9Ej9uF5XpdmX6V/1/RbuJg0cgi/anTzUE1auH/PsyhL0xZyxGMgOt+a
 g1nHlPBJ9gmH59nIi3mI3ukXJTlds2nGs1umnyGP5c2P1sloe//+uySGY6EIN3jNZosn8vsb+l
 qgEu3GgjLQdQrbzNVulI0LvXB3jUXVZ5zBd12VZbt7TMMvG8Y4ItlmwSVIiVKPlj+FjN7bbzXYI
 ebuHkzsmXRDOh8OxFidPk287rt30s8GqZX/2ym0wIsZvf2i6AbvwoSo8vJspc9rtI2TPeLwq/+
       qXxWBkhSU/S8l2hDtU8+2QBN1YRpkyDOr1jT9Wza7HcKd0GhDfriVKMbi1PfD/bK9FKTGz4tQO2j
       iXFxES1GN44z78oTmtd+vhKLeVqMe6Fo3WRXiuqItLX3am1e5/sy6t2nrcWsRq2lu/s+10FxuElT
 /9Nr+DHqJUDEa5o09Rl0/GiNJLRp5yY2ez6yFYJ2jIFSMhrFdP0qSIqPPG0Yx4iXixGiYUnQ4
 yRVbluN/RSU96/0vOmQvdrKv9ENwGf7C5oMuvXjoi3/Lmp8rTF33Zq0MOLfBInRkGOsnKTojHpQ
       WZAYRWeaIeueNcrt1xxxEcSoNOWClHXVjUi8MuJnIsRo7KEdu3yMklQka25zb//MIsRoMOlSIklv
       U25bIal4FR/uUexjlEHtQD9Jz7JGoW0lpLIyz6VLe7KP0fBEZqxgkq5vOt90N5rxSpIeeJ9+/3Es
       BaddDP1Pw25y9bf+2ePizcNX3jGKzjKRdC+tuKIxQ7nNpl36EOMYZVuhJvM+LplfefTWC7+LG+jS
       nXGMYoiStDp8pUu7fm/da2HbNRgpDjGpG3sG/keZIwxbKIy69DvfNq8DIxbx6tWlz3GNUQZvLNP1
       o9Zsi6zMU+vSIVxjFMOl618kFAIsbJGeRCHLGHVfJHiaxdY+TFbqdOkoljEKQUahIL7sjXpyJ96l
       T/OL0ZlHC+UEL7t655iVecO7dCC/GIUgzVBwXNiaPYk8sxi1WxUYy+JJ0jCm7VKzGIUg3wJq1LI/
 zHfntzNmaRmVzF9PMlmSEt6Gvh+ywFwkSieZhajqUtXcKO5dTV4SS2prAxcim6keruPaJv6qQZv
       uBg18pz70EfN1qXRYhT4SOT8p3nKtKmSlBjFTXalqPLCnideQyJGPagtMbsM/apDyM6WlcqPW20R
       o5iIyNb+IHC8Rr1fB8QoLrMuRQcm6SSZMiHJGE3n8eEr6/r7D7hIarMZuBSdh+F5o4dayLo0ampP
       hkf7I3x/T3jaIyq5xWi6iLnE58feB++VVtuOCdPTXy9t6tMM8joGtxhFgUOxfvatyVF1ohXVGJV5
 srdISVqCtUwpagIQjwM1RjNrP6ZpMlVmWUfC9XCPxhvyfcvSHUObaEh1RjFj+dqwHixeEPzJM0H
       JeVnSG4xmh5Qir7V5BDa024kaf7M0xaNghO3GF1+cuX904n1OclpQhSVKMeT3NL2OjT9IP3JHUN6
       wyE3WRcoZ1iNTunr1p6TnCqRm7iNGA0of5oDcQG0RYzaODwnfOkX37H9B9oiRp3cTtLDH9mlR6ia
       n6kKhEeMSkvzq22inR2tIjeBcpIvlIehmtS8wDyIUQCoQoziAwpSoBwxis9IUqAQMQoAVYhRnKIg
       BUoQo8jhzCfgK16aBACqUI0CQBViFACqEKMAUIUYBYAqxCgAVCFGAaAKMQoAVYhRAKhCjAJAFWIU
       AKr8D0CzLprZc7KKAAAAAElFTkSuQmCC
+      "
+      >
       </div>
       </div>
       <div class="output_area">
       <div class="prompt"></div>
       <div class="output_subarea output_stream output_stdout output_text">
       <pre>CCOC(=O)C(CN1C=C(N=N1)C1=CC=C(C=C1)C(C)C(=O)O)NI
       </pre>
       </div>
       </div>
       <div class="output_area">
       <div class="prompt"></div>
       <div class="output_png output_subarea ">
       <img src="data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAcIAAACWCAIAAADCEh9HAAAHfElEQVR4nO3d7ZmbRhQGUJEnBbgD
       l5a05tKcCtwB+UEWE0BI4sLMHTjnl3e9uxoN6NWdD1DX9/0DgL3+qN0AgLaJUYAQMQoQIkYBQsQo
       QIgYBQgRowAhYhQgRIwChIhRgBAxChAiRgFCxChAiBgFCBGjACFiFCBEjAKEiFGAEDEKECJGAULE
       KECIGAUIEaMAIWIUIESMAoSIUYAQMQoQIkYBQsQoQIgYBQgRowAhYhQgRIwChIjRmn58/1W7CUCU
       GE1BnkK7xGgKf/389uP7L2EKLRKjWfz189sQprUbAnxGjOYiSaE5YjQdA3xoS9f3fe02sO7H919/
       //PN8SGXrvvvH07NL2I0u+GkdZRIoet+n4vTf9/bn7UbwAvDiSpMIS0x2gZhCmlZYmpJ3z/6/vfc
       FJCBuVHgE8slpttPkhrUk5QF4aQcjwUxSgrLmYrZq9UScSKzAzDMNN34kIhRKngZms9+68YvVfIS
       ow1bFmiZg2YanfsamfwJ3sjySNz72IjRtjV06rbSTviUDU9tW+5/6rr6O6KmDTi2MfZ7ZbE8Ejc+
       NqrRq0lS9EXK5O3hfyuv1u6rlfYUXp4YbV7OWHlzrmy15au/1dZEXNf93pHdLZ7kRYLVDOkXMXoF
       OZP0mfha0yP3C3aaoY+10LxssN6VGG3YeKH9cJHoI82IfvAs3FM1soqXwdpMqi7ezbrHo5GmH0mM
       cqJTy+ScBemsFH3T7FfaLVf7vt/XA00ToxxvGnC3ekEdlSAb5Wq2hLpn+TljwxMNSzUpvJqh3Zfg
       H+/7PluADobyc/s7l6capW05h/ajY9fr7zlkzk+MwgFeptt1lpUWhPutn/wF5CzEyreqbj8cEiLv
       l6sJM2vZpISNPI9qlGuottRxw2UlZiwxcQW1ljVOrbn6Lyf9/QPdfKFJjEJjbpVQTRCjXET5cLnV
 N9LY/9P93gdstkrP3OjrbP9uY66GZp2cfzZ5tnpl9PbDZRo0/nEKAeruGheLFxyRlgGq93ytK/2
       fZhMPmKU5gm1Vi2P2iG3/yrO3ChtW96V7uzJuCSpnW2h6ZhuGW5WNt6yrBGqURr27KV73o7LJBma
       zbndMr5bTG8NmUnqGHXKtqjYEXu2mjH95mq9tvukynZCJlloOj1DZ59/m0/qGB2HLdVPFLJ5J0Mf
       T86cY7OVCoYjmOaQpY7Rx9fJneEtlzzezNBn9mWrk3BVnW5JdiCyx+hAWcoomKHPvMzWnOde3XG9
       t5ZBGzH6mJSlj4on9Gyqm+JOytBnNu4WKkEK9cD01txZO7yxDU/DnRrK7fOYPtD40XFpbrmear9L
       AYUzdCrb7qKpzG07xmwLVL4wbaYanSoxxn9zDrvS0uH06d9kuqNihq5Kskpey52f+1KTMfo4denp
       o0XAsTItdUotQ/MOq3AZMvTmuTmlH2YaG9TPDGf2YSOarvvfh76/3Ygyw/zhmT67AeXBXfG52fzH
       oX+5foauyjOaLtmSDD2fTavV6OiYge07FeX2VPeZZembz658WTp7xssZjvichxdtKg7HquZjdLA7
       Qbqu6x+fDOFf/u+hs6U73h7KbA5bfcvoFx/SGXxz2bjWs8qLOdW4fvVmAknadjcXidHBRwlyVtYc
       VJZGmndqWfrpkxvfXD76rUe+DF1VK7y2byZwUntS9Xwql4rRx3sJcnqxFkuxo5p3eFn66czH7Ptv
       /oWvx2ogQ2t5OVm8nCeNd5qe33C1GB08S5CSe4N2pNjhzTtqR9S+zQur//XOX8ucoTnHzssB/vIH
       pl/umftK9pRTuXjvjAlScXPlOw9dZDZzd3V8ym6u4aN6PnqPSXKuLltSdlnvgH0Ln5areTo/p1v0
       ToaT4FlQlsz36tXx7ofIcASnZu0p1rzz9n5tBGu2zk9IBxWV4eqjd14Vhdu2/XAJX8ZVCtLC+2fH
       YM3W+Qldc240p/GMr3v55sspjvKxtdEtCTM0j1M7Z3pQ2Nb2VUyNGq9EqnWODg1YPvp4oVTdVo0N
       S5uh5a9fqrtVtvzjtkU1el/TsrRugTyVoWDf4dQV/LSXwzIQo7d26kb9iGztWSq286l6hubc45WK
       QT0NZNZtVc9Q3iFG4RimEW9LjFajpmjd2bmZpxT1DrFNjMJhDoybPBnKS2IU0pGhbRGjsN+y/Cy5
 kk4/oNYhRyqZ6YfEqMltNvfkmjji3TMg/nFaTP2H4PBzjqRh5pM5QNYhSiZjfN2/6Bj8jQJohR
       ONKz+/a/+ZPJuTB0lRiF0+3LVoHVCjFaykmfxUGzXmZrzgxVkC6JUUhEPLXIhieAEDEKfMYG0hkx
       ChAiRgFCrLgBe1ivH6lGAULEKLCHhaaRGAUIEaPATuZGB2IUIESMAoSIUYAQtyYpa1zZNKkEVyFG
       C5reK8998+AqDOoBQsQoQIgYBQgxN1pQ31tigusRo2VJT7gcg3qAEDEKECJGAULEKECIGAUIEaMA
       IWIUIESMAoSIUYAQMQoQIkYBQsQoQIgYBQgRowAhYhQgRIwChIhRgBAxChAiRgFCxChAiBgFCBGj
       ACFiFCBEjAKEiFGAkH8BjgEwrBwsJC0AAAAASUVORK5CYII=
+      "
+      >
       </div>
       </div>
       <div class="output_area">
       <div class="prompt"></div>
       <div class="output_subarea output_stream output_stdout output_text">
       <pre>CCOC(=C)COCCOC(C)N1C=C(N=N1)C1=CC=C(C=C1)C(C)C(=O)O
       </pre>
       </div>
       </div>
       <div class="output_area">
       <div class="prompt"></div>
       <div class="output_png output_subarea ">
       <img src="data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAcIAAACWCAIAAADCEh9HAAAGbUlEQVR4nO3d23abOBiAUTFr3v+V
       mQs6hBIDMjogib1XLtrGdZzY/vJznuZ5DgDc9c/TDwCgbzIKkERGAZLIKEASGQVIIqMASWQUIImM
       AiSRUYAkMgqQREYBksgoQBIZBUgiowBJZBQgiYwCJJFRgCQyCpBERslsmqanHwJUJaNkNs9zayXd
       PpzGHhojkFFe4Xc9p0lSyePfpx8AA1oG0qYuOjvPYZrC9hEtf96WtKXHS09klFfbpnNNqp7yFRml
       iGYH0vMbLIyofEVGKaXHkq43Wy23b+mboDk2MTGy3xHcjpyRSdVQzrU1LDCeBwfS3Talo9uszm+8
       vbeYe+Y9LNRTVoOL9lsfNzGFg6SqJx/JKGO6kbzLVaK/95qCYN0oFdQ/rik9dlaJEk9GGU3RgTFy
       Wz+vIqPU0OCB9pCLjFJJnZKWG0U/7jUFQUYZjMBRn4xSj0V7hiSjVKWkjEdGAZLIKLUZSBmMjAIk
       cTAoD4gYSM+2uK8nrneuEFogozwm/Xwl6kkLLNTzgFznfHro0EwrdvmLjAIkkVFqy3v6UecK4XEy
       SvesHuVZMkpVGUfRoyssQWUyylBKLONP0+R4AU7Y4Yl66lyUKdelPtZ0NnshKRoho9RS8cJ2KSVV
       T74loxBCdD0t3fObjFJF9eONIgfS+NlzueVys+2fQUYZ1jwfro39tp67W64xVVJCCF4HlPfooe+7
 MUPkjG3NJYSTKO8zb3x8/zeao6lwt0g0yiFNXAWppjMJW6gr1A3K2ebJaO8wklJMyap0Fh69Ait
       nG2Ep4G3+LiSNOSe6fLOiZf3ZixtgXWjvE7R9ORaWxr5IO0z0AI/fV6k5ux272tdzsjnu3B5Oz9C
       RqGg+Dkxy55YYvoIGYWyCq3fPN9o5n1dkx83h3bHj1+upVv/2/5fOEhb4vBoLG2EjPJj380brw1X
       PT5WaMdPY+njbKnnD2+50grtOT/P89F9nnyKjJz9HmrLHrV5ntdixn+KXGSUEIyiQzjJ5fIpMS2k
 Yx61vuznOZz+dDlK9lf4Se5NJaW0/S60eVZNyWVlvmH7Pl6lOOa6mt6GgXusRRfU+sZtRhSmrFl
       VJbiq2k9o0FJS9LQyur/wBt6fteV5sNpet0oMIihj8voYBoNBtIyjKKQRR8ZDUoKyfziLKSbjJKX
       dxTk0tO6UbuRQq+W4zLWP4+ls2nUon0Wfhu14EXPwvKenec/H8O9hTvLKOle9O6FKvrLqIEUaEp/
       GSWFURSy6zKjBlKgHV1mNCjpLUZRnjfcIUyh34xCd/waG1VP+43u2I303O9p3c8KSug4o+GdJT1e
       lbH7xLt+LPCcvjM6vt8HfhzHUTU58bqBo6LuM3q5ren6hbM9f9fuX5419LnFeI9p8zacRvx9331G
       Q66lV82irtKzoSvUVzNCRoEtAa1MRqGSdQVUucAJ6CNktEnLWoWhzy32TuWuftxsQN+waUtG/9dm
       s9p5JOSTdyyNuSuH/BUloxu7F+JTG5ps4HqBLGNpfEDXL3d5e26Q0WPLfOo1RzG3x9JvA7p+ufCO
       pezKZLQxwv0y36btXkB3X7HyWDr8FOz30pXKXZPRt7psTXpAf9+45r6rA8dURq/U7JqGvt5Ra86T
       t25BKrFy4J5730inBvyW8qtWNxklhJB7GT/jl4u8t5A8VvdFRiPUqZuGslE5RrlyHH8nI8VURqPU
       WYvkuWDn46ui/pJ4zP+6+ZCGmB68dWMVzZyGcqT+VprKqxR+rmLfLTs8QdPqb+aO2SMq5+NZ7qTn
       sdQQ9IVCM6NRlDZVXqXQ71hqGv3CG69ZwovtxtLiE/E6lobOYioKX8u+d4ingMY9sFW9q2V8F1j+
       jjPl8E61f9n309Bgof4r6+SYMaZGUeidjN7hTDnAykJ9rF00NRQqmaY/H+tfG2MaBRrWwyV7TaNR
       jKLQkO1w2gDTKNCbxoYY0+g1oyhwwjQKNKzNS/b+TUYvGEXhYbt3XHtvQAv1AElk9IxRFLgko4dE
       E4I3QgQZjeXFBHwko59ZnAciyShAEhn9wCgKxJNRgCQyumcUBb4iowBJZPQvRlHgWzIKkERGfxhF
       gRtk9IdoAjfI6GdGUSCSWAAkMY0CJJFRgCQyCpBERgGSyChAEhkFSCKjAElkFCCJjAIkkVGAJDIK
       kERGAZLIKEASGQVIIqMASWQUIImMAiSRUYAk/wGN9ircDlRKUgAAAABJRU5ErkJggg==
+      "
+      >
       </div>
       </div>
       <div class="output_area">
       <div class="prompt"></div>
       <div class="output_subarea output_stream output_stdout output_text">
       <pre>CC1(CCC1)N1C=C(N=N1)C1=CC=C(C=C1)C(C)C(=O)O
       </pre>
       </div>
       </div>
       <div class="output_area">
       <div class="prompt"></div>
       <div class="output_png output_subarea ">
       <img src="data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAcIAAACWCAIAAADCEh9HAAAISklEQVR4nO3d23acvBJFYbHH//6v
       zL5QjDEHASqQVpXmN3yROI6bFtSiQDRM8zwnAECt//VeAADwjRgFABNiFABMiFEAMCFGAcCEGAUA
       E2IUAEyIUQAwIUYBwIQYBQATYhQATIhRADAhRgHAhBgFABNiFABMiFEAMCFGAcCEGAUAE2IUAEz+
 AADqZpt8/80w2A2IUGNI0/YnOzV/xBAf1wHj2oTnPf5pTPEGMAoAJMQoAJsQoAJgQowBgQowC
 lPKDFTb8AFT8CQNklKhhoQo8CoiM6XcFAP4BwXk95AjAI4x2X5NxCjAGBCjAIooiG9QowC+HEW
       lyRpETEK4AdxWYUYBXADCXsuWoxOrGnAgrh8LlSMTtM0z/M0TYQpUO8sSUnYE6FiNJvnOYdp7wUB
       wiFJj8SJ0dyKLn+lLQXqEZdPBInRTYZmtKXA+0jYnSAxWkBbCtQoxCXdyV8RYvSwFV2jLQVq0Hje
 z5GLzN0QVsKvIW+ZM19jD5CWwo8c96QUkoL3zF6vxVdoy0FHiAurziO0boMzWhLATuKKHMco3a0
       pcAdxGVZfUPXl6UVPfxtKSWnQwG0cVZ07xajRy670ddXG8f4QLV2tTNNv1+b7+9/siGeDPpr2RoG
 UCh3KBdKuOafrzKNPNX7vyF6Ofrsj8mzlIAR6xJmzhrvvLD2x+eb4SS6NO/cVoA7SlwKFCXG6+
       eXiYf1pOzgvNWYw26xNpS4FDmyQ9OyvaunC6Tmx4itH2oUZbChQI9RmbxWibqi5n6ltiEh/YoCI2
 MRo3/0eF+oDa61n7fcf7ZeZX0peDuoVjh04Wzqs6t0nm8qbNkmqNLY+YlTE8si8RIV4YzmSqF7X
       gXe6fd7a2Svuv9922RzEqMi2uNQhbak7rCx8Sv3cqEgB7DtQzpbiUtSpGJGq1KEeowrOjuKZxHdB
       YXKy16ujDekYVdjp3XnQE20pxqFQlWp0Y1RhbS1zSjwyzymFrYhtIzwHU0xdLAfyTx+Zl5xM4jta
       VFn3PwfZ+d5I74nxLl4nGqN911b1q/9M4ktd07a1DtDYVfH03T3tGQMPHR5RjFGdDK19ZN6/y4Sl
       qmxzwdby59hJeqjL3TQCDLX35f+OYox2ZM/QLP8/kbZ0zOP3wurrNRQBkhSH5GK043b2wbNJeral
       h+3nHrWNO9hIChSHpkv3tNlK3n5kXtMkrRjAYEWi/HaUl63A6WK3oTs0LVfbpxn68ztT+rgtnaaU
       Uv0eKFKdiL8X8cXbc7fAjckd1C+aXT/UZhP57mzpMl8yz6nwmIZLYY7uY7wLHYznJd0YTa0uytk/
       Q+a7l3vxbOnf9Lz/vyiJ/sLssZD5WJfNzpY227gtbakxiMvv0Xt5e1l+ljMS3Q+DrsX7tGXFljlN
       /77m2dTMlkcy2DjLYpwj8RGj2dc3AZHd8a7Ts8EC+q1w2TV4SH+cfY1nR55iNEVsS9PRQww333k9
       PS/HMN4gA99xFqPZF21p70+gtn7FeEHpsXVSXgsex7MXlzGaVm3pK1th9y1m3j33sMmLcpK0P8Y5
       AK8xmoU8xm8pTJJ23xEGw3g+4jtGM2NbKrLFdGlILzlKUr8YZO8ixGgytKUiGZoJHtrf+YHupFZi
       HalBDjCejQWJ0ezrK6KikqphwJ1QMZoetqWCe91eh/Z+T5IKrsQ6IoMcZjxbihaj2Z22VHZz6bVQ
       fpM0DAbZqZgxmlxN4u9zUzLeFYtcdl/oFONZJ2yMZmdtKZvLoQDTTd4xwh6NkiZvPWRpBF5uAaWz
       JK/77q1d7ia/eNHwpO83+qJmN4E2UngKXvlumNwrU0F1x1pecazZOqPEaBrjyextKCRp9wV4y+Eb
       uXN25cuFwjMDxWjG9nfHZVAqJGkAl4PccmESq7VW8CkmVFOebgpf6h3fIHNcFYbrRnFf397E+0d7
       L/laWhQQoyixTze1nAyJcUza/S3EGMaWiFGYMBlSRzynSNJHiFFcKFdUr2I7Wyrv9e964YfFFBOu
       +Zp20F9aF1mpP4w6iFHcclj2feMgXp2rxWu8Ef4IMapF8x74hxRq/qzOletfYdzwLmIUNfSzQDlJ
       D2kOqbth7IIYhW++6lwzK8t8jXAXxCge85IFjurfy5DiEDGKZwQLvhCXUkkqOHQ3SQ2jIGIUD8gG
       ges6lx3VNdcj/DViFMGJ1L+LrEQdYhR3TZP0Jzu9HNpvOIpX5WHsixjFLQq35bfoGwGOshIViFE5
       lFs1d+2Su3h1N8JtEKO45qgVFTy0d5eVZSTpHjGKC44y9JJUBASL15ERo4iGrPya1AgrIEZR4rQV
       FTy03/AeryLDKIIYdWma/n2hQrMI8J6VuIm737u01OY6DV4vWKetaKZ8G3zZBXtEeYQbI0ZV7DPr
       Toqtf2DTYBk3b9cZeqlBBIwQMSRpRowKMSbXPoXP/mkQ9seafoHciYdzo0LevfX9PP9+PT2XGqYV
 VrRrzHXlIjRQSx5ev/nR/BdBKg9SPVTJCkxqqXQkDI1X6dc5PFCDe1xblROTtJ9defvcMbTr5Ct
       aDb4XBMx6szZ1PyoG/Atgxd5GyMPLzGq6OZc02GkDrwxl3RPUnI8MGJU1NNZ+zYX5APYYw8ZGZG6
 WlLWJ6tptACoxuNbH/Uv25aKz40FZ7lwh2CcljE6Cj2NT5gbl5e4UgUogIxOq6zK6tiIyjxOi6/
       BwATYnRo736KHxgTMTo6khQwIkYBwIQYBQ0pYEKMIiUuzgcM+BQTAJjQjQKACTEKACbEKACYEKMA
       YEKMAoAJMQoAJsQoAJgQowBgQowCgAkxCgAmxCgAmBCjAGBCjAKACTEKACbEKACY/B/swODMpUgO
 wAAAABJRU5ErkJggg==
+      "
+      >
       </div>
       </div>
       </div>
       </div>
       </div>
       <div class="cell border-box-sizing text_cell rendered"><div class="prompt input_prompt">
       </div>
       <div class="inner_cell">
       <div class="text_cell_render border-box-sizing rendered_html">
       <p>Построим 3D структуру одной из молекул.</p>
       </div>
       </div>
       </div>
       <div class="cell border-box-sizing code_cell rendered">
       <div class="input">
       <div class="prompt input_prompt">In&nbsp;[17]:</div>
       <div class="inner_cell">
           <div class="input_area">
       <div class=" highlight hl-ipython3"><pre><span></span><span class="n">smile_3d</span><span class="o">=</span><span class="n">analog_smiles</span><span class="p">[</span><span class="mi">20</span><span class="p">]</span>
       <span class="n">mol_3d</span><span class="o">=</span><span class="n">Chem</span><span class="o">.</span><span class="n">MolFromSmiles</span><span class="p">(</span><span class="n">smile_3d</span><span class="p">)</span>
       <span class="n">m3d</span><span class="o">=</span><span class="n">Chem</span><span class="o">.</span><span class="n">AddHs</span><span class="p">(</span><span class="n">mol_3d</span><span class="p">)</span>
       <span class="n">Chem</span><span class="o">.</span><span class="n">AllChem</span><span class="o">.</span><span class="n">EmbedMolecule</span><span class="p">(</span><span class="n">m3d</span><span class="p">)</span>
       <span class="n">AllChem</span><span class="o">.</span><span class="n">MMFFOptimizeMolecule</span><span class="p">(</span><span class="n">m3d</span><span class="p">,</span><span class="n">maxIters</span><span class="o">=</span><span class="mi">500</span><span class="p">,</span><span class="n">nonBondedThresh</span><span class="o">=</span><span class="mi">200</span><span class="p">)</span>
       </pre></div>
       </div>
       </div>
       </div>
       <div class="output_wrapper">
       <div class="output">
       <div class="output_area">
       <div class="prompt output_prompt">Out[17]:</div>
       <div class="output_text output_subarea output_execute_result">
       <pre>0</pre>
       </div>
       </div>
       </div>
       </div>
       </div>
       <div class="cell border-box-sizing code_cell rendered">
       <div class="input">
       <div class="prompt input_prompt">In&nbsp;[22]:</div>
       <div class="inner_cell">
           <div class="input_area">
       <div class=" highlight hl-ipython3"><pre><span></span><span class="kn">import</span> <span class="nn">nglview</span> <span class="k">as</span> <span class="nn">nv</span>
       <span class="n">nv</span><span class="o">.</span><span class="n">show_rdkit</span><span class="p">(</span><span class="n">m3d</span><span class="p">)</span>
       <span class="n">m3d</span>
       </pre></div>
       </div>
       </div>
       </div>
       <div class="output_wrapper">
       <div class="output">
       <div class="output_area">
       <div class="prompt output_prompt">Out[22]:</div>
       <div class="output_png output_subarea output_execute_result">
       <img src="data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAcIAAACWCAIAAADCEh9HAAAIi0lEQVR4nO3d21aryBoG0LBHvzF5
       jPDM7AuWiIEQoIo6wJyjL+yohKj51l/npu/7BwBH/S/3DQDUTYwCBBGjAEHEKEAQMQoQRIwCBBGj
       AEHEKEAQMQoQRIwCBBGjAEHEKEAQMQoQRIwCBBGjAEHEKEAQMQoQRIxCNbquW/yYvMQoQJD/ct8A
       sIMitEBiFGrStu3wgTwth0Y9QBAxChCkcU49VKfrurF1T3aqUYAgYhQgiBiF+rRta6S+HGIUIIgY
       BQgiRiG1KEvjn89npNshlBgFCGIxKGQQPkDU933TfJz3Pb2+GaZnE6OQQdyl8U3TDB+8Xq+364+m
       M/bN3o9LjEIFxrR96xIdAtRaxLzEKJRrTM+xeJxWkSuN+vWrEVkPpPJ6vbZ8auXLpna9fw9cn42M
 HN3yU7m0CN5VRr1UAqN7kqJUUiRX1tK0VN3tp8+u6I4LjEKp5/MoTl/bWIUzrV3PL1oPxNUH5d5
       RTEYYoIilNjoHkNz/N++//ff26fu7UL/TkIMcRvgp5ai59a5Q2h+emT+2RtTjcIfUXZEbn5UWaY0
       jZTcRd8ohGpmLdwxPetLUgG6X22/Y0hivWn/lpsrb6KzYzTy9T9l6Pi4IaYlYhQWTONppdjce6no
       Yl78a4bygUY9LOj7fkzPckLzJGvbRMnQDcQoLDichv1sN+X5I0VZuzcZuo0YhZv6slepDN3MhCd4
       F1g8TjsEPj2S3fAaZWgUYhT+OKkBXlqSrs8ukKG7iNFrSraH5h0ciL/SQvNNMzF/vNhu3GLpG4Vf
 xCJGCtZxpoW03xxLpcAPUyMXsrb6Y95b6Y6cXMkfWiuJ+bX75Whh4nRixhCc3GXIHm6xWKORA+X
       WNn6VkWOFz98NRkaQoxegV2BzxAeLmeE5njl8VPh15ehgcRo9Zrm0fcyNEjKcuxrtu5aexqY1OIz
       CsV83TZOTXnrMy22dM2yoeXZzfn1YavABfuL19/1zeY2hVON1u0Cb4EhRoraDvjs4vTwgv1Fr9fr
 HeW8LO+BDFamcO1ZGkDTZ92XBvOp0j27k7QnJ+3uw3pXIwYrUlIe7yQgfui9qtMMzr/OHkMZ9iu
       v9iOmjuwiqka0z60ghfILBuOpZgeibYi44FpCerEgkrRQm6jfmK0Gq9X93zuqzhKaMhvT8+pBG/w
       UxcsbX9SLsAvtQ5d1z2f7dhvuKX3sKKG3tso09unzvgLTdacT3l9clGNlmJlM5Gm2Xdwedd1tWTo
       tFZN+KQZMpQLM8RUtJ88/Q3Er/2GGQN0+6zP7QNNaQbuNecJIUYLMu/KbNu2aR6v178V88ODK0ma
       vQj9Gnkr7fezRZyqeeCpZeiFidGCvM1JGjKx7x+PR9t13RCmQ7B+6EbM/15dKR4PB+ixgnT7OvQS
       fm5UTYxWYwjZrusej+d8MXT5WXDg7sYX1fdfXmDIksqbNueLmsFbOTFatMVmftu2Xw4jyyrWrM+V
 Alch55yJ9ByM7So5beVM1JfisWtQtsfsy/vhywYAqW092r4vcxf0fh6x7PYpkKfr3LOjMlLNVqx
       IT5Ky9BByB0lmJCUpiAt7lej8DyHGKUsl5nUmfie14vQruva51OGnqS+v04GY2FRTj9peK2TOEPD
       r/xpElX6DF3ZT3Z5GpwhpnhUo3Ub3q4ldIdVl6EHhG+xnN7HqcTF33lFDDHV6/ctPWyVlvFWwmXJ
 PXT5JuZjUNbRUV/FWuCa6caJb+MdejbWNM0VY89e5YMXZzmQTKq0YvIXpAGnAZUUFveJCoOEKO1
       mjdIayxDSsjQ9ab9RtOGf5S7OsDs0Vw06utWddFUQoYec/bB8dRFjJJHURn6dTb+W26ufOXxczpj
       UIRmIUbJoKgMnQuZ2JT3gLlCDi68GzFaqyF0ypl7v12ZGdpHPTueWzHEVJ/pUMYwpjzuUVKFAjN0
       vIcoY/TZZ02QWP4/X3ZZ3z4u8W9zcbu1vdszl5Ohee+BemnU12T93Z6ljT9fAzoN0+kjH75dflE9
       MVqNr4nTdd24dd7jtDB9KzY/nfAxfWTYE/Xn8eJO7xh/bnCMGK3A3lgcNiuJHlIhhymNp56Er7aM
       K/shgFyAGC3drjScjmxEbOOvB+iuU0MWV6/nIkOJQowWbW9F+TZtMHx7/I0VaKzzl6BGYrRcsVrl
       x8rSLQE6/WwBDfR9lKLEYt5ooaIfPbR9eunPvNRzkzHvosnH+Tu52CjkPlSjxTncofl108mvbfwa
 RBdmK0LAnmAH1q4xcy/ehKFKE3IUYLkizIptNLX6/X8/l8KEJPYKOQmxCjpUhfDIaP44cwvMNl
       iNE8ps1qPZJQNd1haf2siyxns/TsNwC1M+Eplab5t/h8shWbCEvG9CPOo1GfiriEixKj2RRSimaf
       Bp+MIpSTiNFseoNLaZl+xEn0jeYw9JP+rNFM//wZc0QfJdejGj3NuHp9toPxx72OgQqJ0XMsnlL0
       KGigqZCCNJmvGw7AYWI0k9x5mrGjUB8lF6NvFCCIGAUIUsTUxWtaHGICLkff6GmkJ9yDRj1AEDEK
       EESjPi0dpnA5qtGEfjbKK+dYd0szIZwYBQiiUX93ilAIJEbPV/YuJJZmQiAxerK3fUkMMcHliNEz
       zetQ6QmXYzHoacpuywOxGKk/RdMoPOEuxGh8ylC4FTEamQyFuxGjMclQuCEx+itwZaQMhXsSo190
       XbcxUmUo3JN5o3/ME3NY5NN13fPZCkpgToz+8WllZNu2bavZDizQqN+njP3tgIKI0a26rht3Ct3e
       YQpcnhj9Nbbo3z5+M7Tr27YVpsBD3+gu8w7Th3lOcHtidIfpAJT0BAYa9QcVc5wSkJkYBQhiv9Ej
       xhb9UJD6EcKdqUaDCFBANQoQRDUKEESMAgQRowBBxChAEDEKEESMAgQRowBBxChAEDEKEESMAgT5
       P5+8yvQzen4CAAAAAElFTkSuQmCC
+      "
+      >
       </div>
       </div>
       </div>
       </div>
       </div>
           </div>
         </div>
       </body>
       </html>

Virtual Structural Biology Group » Учебные курсы » Структурная биоинформатика в ВШЭ

hw3_Lovepreet_Singh.html